Jump to content

Viniferal: Difference between revisions

Browse history interactively
Page 1
Page 2
← Previous edit
Content deleted Content added
VisualWikitext
CheMoBot (talk | contribs)
Bots
141,565 edits
Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[WP:CHEMVALID|Chem/Drugbox validation
m GHS update: remove empty EUClass/Rphrase/Sphrase parameters (depr), replaced: | AutoignitionPt = → | AutoignitionPt =
 
(15 intermediate revisions by 9 users not shown)
Line 1: Line 1:
{{chembox
{{chembox
| Watchedfields = changed
| verifiedrevid = 448837277
| verifiedrevid = 448840373
| Name = Viniferal
| Name = Viniferal
| ImageFile = Viniferal.svg
| ImageFile = Viniferal.svg
Line 6: Line 7:
| ImageName = Chemical structure of viniferal
| ImageName = Chemical structure of viniferal
| ImageAlt = Chemical structure of viniferal
| ImageAlt = Chemical structure of viniferal
| IUPACName = (2''R'',2′''S'',3''R'',3′''S'')-3′-(3,5-Dihydroxyphenyl)-6′-hydroxy-2,2′-bis(4-hydroxyphenyl)-2,2′,3,3′-tetrahydro-[3,4′-bibenzofuran]-5-carbaldehyde
| PIN = (2''R'',2′''S'',3''R'',3′''S'')-3′-(3,5-Dihydroxyphenyl)-6′-hydroxy-2,2′-bis(4-hydroxyphenyl)[3,4′-bi-1-benzofuran]-5-carbaldehyde
| OtherNames = (-)-Viniferal
| OtherNames = (−)-Viniferal
|Section1= {{Chembox Identifiers
|Section1={{Chembox Identifiers
| CASNo = 180413-42-7
| CASNo = 180413-42-7
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo_Ref = {{cascite|correct|??}}
| CASOther =
| ChEBI = 169301
| PubChem =
| ChEMBL = 469541
| ChEMBL_Comment = (underspecified stereo)
| PubChem = 57518718
| SMILES = O=CC1=CC=C(O[C@@H](C2=CC=C(O)C=C2)[C@@H]3C4=CC(O)=CC5=C4[C@H](C6=CC(O)=CC(O)=C6)[C@@H](C7=CC=C(O)C=C7)O5)C3=C1
| SMILES = O=CC1=CC=C(O[C@@H](C2=CC=C(O)C=C2)[C@@H]3C4=CC(O)=CC5=C4[C@H](C6=CC(O)=CC(O)=C6)[C@@H](C7=CC=C(O)C=C7)O5)C3=C1
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 26233612
| ChemSpiderID = 26233612
| InChI = 1/C35H26O8/c36-17-18-1-10-29-27(11-18)32(35(42-29)20-4-8-23(38)9-5-20)28-15-26(41)16-30-33(28)31(21-12-24(39)14-25(40)13-21)34(43-30)19-2-6-22(37)7-3-19/h1-17,31-32,34-35,37-41H/t31-,32-,34+,35-/m0/s1
| InChI = 1/C35H26O8/c36-17-18-1-10-29-27(11-18)32(35(42-29)20-4-8-23(38)9-5-20)28-15-26(41)16-30-33(28)31(21-12-24(39)14-25(40)13-21)34(43-30)19-2-6-22(37)7-3-19/h1-17,31-32,34-35,37-41H/t31-,32-,34+,35-/m0/s1
| InChIKey = DHTHKPNODOWMKF-VPIGGYNKBX
| InChIKey = DHTHKPNODOWMKF-VPIGGYNKBX
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C35H26O8/c36-17-18-1-10-29-27(11-18)32(35(42-29)20-4-8-23(38)9-5-20)28-15-26(41)16-30-33(28)31(21-12-24(39)14-25(40)13-21)34(43-30)19-2-6-22(37)7-3-19/h1-17,31-32,34-35,37-41H/t31-,32-,34+,35-/m0/s1
| StdInChI = 1S/C35H26O8/c36-17-18-1-10-29-27(11-18)32(35(42-29)20-4-8-23(38)9-5-20)28-15-26(41)16-30-33(28)31(21-12-24(39)14-25(40)13-21)34(43-30)19-2-6-22(37)7-3-19/h1-17,31-32,34-35,37-41H/t31-,32-,34+,35-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = DHTHKPNODOWMKF-VPIGGYNKSA-N
| StdInChIKey = DHTHKPNODOWMKF-VPIGGYNKSA-N
| MeSHName =
| MeSHName =
}}
}}
|Section2= {{Chembox Properties
|Section2={{Chembox Properties
| C=35|H=26|O=8
| C=35 | H=26 | O=8
| ExactMass = 574.1627668 u
| Appearance =
| Appearance =
| Density =
| Density =
| MeltingPt = <!-- °C -->
| MeltingPt =
| BoilingPt = <!-- °C -->
| BoilingPt =
| Solubility =
| Solubility =
}}
}}
| Section3 = {{Chembox Hazards
|Section3={{Chembox Hazards
| MainHazards =
| MainHazards =
| FlashPt =
| FlashPt =
| Autoignition =
| AutoignitionPt =
| RPhrases = <!-- {{R10}}, {{R23}}, {{R34}}, {{R50}} etc. -->
| SPhrases = <!-- {{S1/2}}, {{S9}}, {{S16}}, {{S26}}, {{S36/37/39}}, {{S45}}, {{S61}} etc. -->
}}
}}
}}
}}


'''Viniferal''' is a [[hydroxystilbenoid]] with an [[aldehyde]] group found in ''[[Vitis vinifera]]'' (grapevine).<ref>{{cite journal | doi = 10.1016/0040-4020(96)00543-1 | title = Absolute structures of new hydroxystilbenoids, vitisin C and viniferal, from Vitis vinifera 'Kyohou' | year = 1996 | last1 = Ito | first1 = J | journal = Tetrahedron | volume = 52 | issue = 30 | pages = 9991}}</ref>
'''Viniferal''' is a [[hydroxystilbenoid]] with an [[aldehyde]] group found in ''[[Vitis vinifera]]'' (grapevine).<ref>{{cite journal |last1=Ito |first1=Junko |last2=Niwa |first2=Masatake |date=1996 |title=Absolute structures of new hydroxystilbenoids, vitisin C and viniferal, from ''Vitis vinifera'' 'Kyohou' |journal=Tetrahedron |volume=52 |issue=30 |pages=9991–9998 |doi=10.1016/0040-4020(96)00543-1 |s2cid=97047118}}</ref>


==References==
== References ==
{{reflist}}
{{reflist}}


==External links==
== External links ==
* [http://www.biologie.uni-freiburg.de/data/bio2/schroeder/Vitis_vinifera_1995-2008_de.html Website of the Schröder group]
* [http://www.biologie.uni-freiburg.de/data/bio2/schroeder/Vitis_vinifera_1995-2008_de.html Website of the Schröder group]


{{Stilbenoids}}
{{Oligostilbenoid}}


[[Category:Stilbenoids]]
[[Category:Oligostilbenoids]]
⚫
[[Category:Natural polyphenols]]
[[Category:Aldehydes]]
[[Category:Aldehydes]]
⚫
[[Category:Grape]]



{{Natural-phenol-stub}}
{{aromatic-stub}}
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"