AS-19 (drug): Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
+{{Short description|Chemical compound}}
-{{drugbox
+{{Drugbox
-| verifiedrevid = 401784495
+| drug_name = AS-19
-| IUPAC_name        = (2S)-N,N-dimethyl-5-(1,3,5-trimethylpyrazol-4-yl)-1,2,3,4-tetrahydronaphthalen-2-amine
+| Watchedfields = changed
-| image             = AS19.png
+| verifiedrevid = 407703632
-| width             = 220
+| IUPAC_name = (2S)-N,N-dimethyl-5-(1,3,5-trimethylpyrazol-4-yl)-1,2,3,4-tetrahydronaphthalen-2-amine
+| image = AS-19.svg
+<!--Clinical data-->
+| tradename =
+| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
+| pregnancy_US = <!-- A / B            / C / D / X -->
+| pregnancy_category =
+| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
+| legal_CA = <!--             / Schedule I, II, III, IV, V, VI, VII, VIII -->
+| legal_UK = <!-- GSL         / P       / POM / CD / Class A, B, C -->
+| legal_US = <!-- OTC                   / Rx-only  / Schedule I, II, III, IV, V -->
+| legal_status =
+| routes_of_administration =
+<!--Pharmacokinetic data-->
+| bioavailability =
+| protein_bound =
+| metabolism =
+| elimination_half-life =
+| excretion =
+<!--Identifiers-->
+| CAS_number_Ref = {{cascite|correct|CAS}}
+| CAS_number = 1000578-26-6
+| UNII_Ref = {{fdacite|correct|FDA}}
+| UNII = LA5AQ5R6QS
+| ATC_prefix =
+| ATC_suffix =
+| PubChem = 23642275
+| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
+| DrugBank =
 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
 | ChemSpiderID = 24605931
+| ChEMBL = 2164327
+<!--Chemical data-->
+| C=18 | H=25 | N=3
+| smiles = CC1=C(C(=NN1C)C)C2=C3CC[C@@H](CC3=CC=C2)N(C)C
 | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
 | StdInChI = 1S/C18H25N3/c1-12-18(13(2)21(5)19-12)17-8-6-7-14-11-15(20(3)4)9-10-16(14)17/h6-8,15H,9-11H2,1-5H3/t15-/m0/s1
 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
 | StdInChIKey = BTTOYOKCLDAHHO-HNNXBMFYSA-N
-| smiles1 = Cc1c(c(n(n1)C)C)c2cccc3c2CC[C@@H](C3)N(C)C
-| CAS_number        =
-| ATC_prefix        =
-| ATC_suffix        =
-| PubChem           = 23642275
-| DrugBank          =
-| C=18|H=25|N=3
-| molecular_weight  = 283.411 g/mol
-| smiles            = CC1=C(C(=NN1C)C)C2=C3CC[C@@H](CC3=CC=C2)N(C)C
-| bioavailability   =
-| protein_bound     =
-| metabolism        =
-| elimination_half-life =
-| excretion         =
-| pregnancy_AU      =  <!-- A / B1 / B2 / B3 / C / D / X -->
-| pregnancy_US      =  <!-- A / B            / C / D / X -->
-| pregnancy_category=
-| legal_AU          =  <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
-| legal_CA          =  <!--             / Schedule I, II, III, IV, V, VI, VII, VIII -->
-| legal_UK          =  <!-- GSL         / P       / POM / CD / Class A, B, C -->
-| legal_US          =  <!-- OTC                   / Rx-only  / Schedule I, II, III, IV, V -->
-| legal_status      =
-| routes_of_administration =
 }}
-'''AS-19''' is a substance which acts as a potent [[agonist]] at the [[5-HT7 receptor|5HT<sub>7</sub>]] [[Receptor (biochemistry)|receptor]], with an IC<sub>50</sub> of 0.83nM. It reverses the [[amnesia]] induced by drugs such as [[scopolamine]] and [[dizocilpine]] and improves long term memory acquisition, but inhibits short term memory formation.<ref>{{cite journal | last1 = Meneses | first1 = A | last2 = Perez-Garcia | first2 = G | last3 = Liy-Salmeron | first3 = G | last4 = Flores-Galvez | first4 = D | last5 = Castillo | first5 = C | last6 = Castillo | first6 = E | title = The effects of the 5-HT(6) receptor agonist EMD and the 5-HT(7) receptor agonist AS19 on memory formation | journal = Behavioural brain research | volume = 195 | issue = 1 | pages = 112–9 | year = 2008 | pmid = 18191236 | doi = 10.1016/j.bbr.2007.11.023 }}</ref><ref>{{cite journal | last1 = Perez-García | first1 = G | last2 = Meneses | first2 = A | title = Ex vivo study of 5-HT(1A) and 5-HT(7) receptor agonists and antagonists on cAMP accumulation during memory formation and amnesia | journal = Behavioural brain research | volume = 195 | issue = 1 | pages = 139–46 | year = 2008 | pmid = 18723050 | doi = 10.1016/j.bbr.2008.07.033 }}</ref>
+'''AS-19''' is a substance which acts as a potent [[agonist]] at the [[5-HT7 receptor|5-HT<sub>7</sub> receptor]], with an IC<sub>50</sub> of 0.83&nbsp;nM. It reverses the [[amnesia]] induced by drugs such as [[Hyoscine hydrobromide|scopolamine]] and [[dizocilpine]] and improves long-term memory acquisition, but inhibits short-term memory formation.<ref>{{cite journal | vauthors = Meneses A, Perez-Garcia G, Liy-Salmeron G, Flores-Galvez D, Castillo C, Castillo E | title = The effects of the 5-HT(6) receptor agonist EMD and the 5-HT(7) receptor agonist AS19 on memory formation | journal = Behavioural Brain Research | volume = 195 | issue = 1 | pages = 112–9 | date = December 2008 | pmid = 18191236 | doi = 10.1016/j.bbr.2007.11.023 | s2cid = 144901859 }}</ref><ref>{{cite journal | vauthors = Perez-García G, Meneses A | title = Ex vivo study of 5-HT(1A) and 5-HT(7) receptor agonists and antagonists on cAMP accumulation during memory formation and amnesia | journal = Behavioural Brain Research | volume = 195 | issue = 1 | pages = 139–46 | date = December 2008 | pmid = 18723050 | doi = 10.1016/j.bbr.2008.07.033 | s2cid = 140204255 }}</ref>
+== See also ==
+* [[E-55888]]
+* [[LP-12]]
+* [[LP-44]]
+* [[LP-211]]
-==References==
+== References ==
 {{reflist}}
 {{Serotonergics}}
-[[Category:Serotonin receptor agonists]]
+[[Category:2-Aminotetralins]]
+[[Category:5-HT7 agonists]]
 [[Category:Pyrazoles]]
-[[Category:Amines]]
+[[Category:Dimethylamino compounds]]
-[[Category:Tetralins]]
+{{nervous-system-drug-stub}}
 {{Amine-stub}}
-{{pharm-stub}}