JWH-161: Difference between revisions

{{Drugbox| verifiedrevid = 410898358

|

|IUPAC_name = (4aR,13bR)-2,5,5-trimethyl-8-pentyl-3,4,4a,5,8,13b-hexahydroisochromeno[3,4-b]carbazol-13-ol

| image = JWH-161_structure.png

| width= 240

| CAS_number=

| ATC_prefix=

| ATC_suffix=

| PubChem= 10431286

| DrugBank=

| C=27 | H=33 | N=1 | O=2

| molecular_weight = 403.555 g/mol

| smiles = c5cccc1c5c2c(O)c(c(OC3(C)C)cc2n1CCCCC)C4C3CCC(C)=C4

| bioavailability=

| metabolism =

| elimination_half-life=

| excretion =

| pregnancy_category =

| legal_status =

| routes_of_administration=

'''JWH-161''' is a cannabinoid derivative that was designed by Dr [[John W. Huffman]]'s team as a hybrid between the [[dibenzopyran]] "classical" [[cannabinoid]] drugs and the novel [[indole]] derivatives, in an attempt to unravel the differences in their binding modes to the CB₁ receptor. While retaining structural elements from both families, JWH-161 has a [[Cannabinoid receptor type 1|CB₁]] [[Dissociation constant#Protein-ligand binding|K_i]] of 19.0nM, although it was found to be slightly weaker than [[tetrahydrocannabinol|THC]] in animal tests.<ref name="pmid15974991">{{cite journal |author=Huffman JW, Padgett LW |title=Recent developments in the medicinal chemistry of cannabimimetic indoles, pyrroles and indenes |journal=Current Medicinal Chemistry |volume=12 |issue=12 |pages=1395–411 |year=2005 |pmid=15974991 |doi= 10.2174/0929867054020864|url=}}</ref>

[[Category:Cannabinoids]]