Phyllodulcin: Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
 {{chembox
+| Watchedfields = changed
-| verifiedrevid = 440974561
+| verifiedrevid = 442172331
 | Name = Phyllodulcin
-| ImageFile = Phyllodulcin.png
+| ImageFile = Phyllodulcin.svg
 | ImageSize = 200px
 | ImageName = Chemical structure of phyllodulcin
 | ImageAlt = Chemical structure of hyllodulcin
-| IUPACName = (3R)-8-hydroxy-3-(3-hydroxy-4-methoxyphenyl)-3,4-dihydroisochromen-1-one
+| PIN = (3''R'')-8-Hydroxy-3-(3-hydroxy-4-methoxyphenyl)-3,4-dihydro-1''H''-2-benzopyran-1-one
 | OtherNames = Praeruptorin<!-- <br> -->
-|Section1= {{Chembox Identifiers
+|Section1={{Chembox Identifiers
+| CASNo_Ref = {{cascite|correct|??}}
 | CASNo = 21499-23-0
-| CASNo_Ref =
+| CASNoOther =
+| UNII_Ref = {{fdacite|correct|FDA}}
-| CASOther =
+| UNII = 9DDW04R41V
 | PubChem = 146694
+|  ChemSpiderID = 129391
-| SMILES = COC1=C(C=C(C=C1)C2CC3=C(C(=CC=C3)O)C(=O)O2)O
+|  SMILES = COc1ccc(cc1O)[C@H]2Cc3cccc(c3C(=O)O2)O
-| InChI =
+|  StdInChI = 1S/C16H14O5/c1-20-13-6-5-9(7-12(13)18)14-8-10-3-2-4-11(17)15(10)16(19)21-14/h2-7,14,17-18H,8H2,1H3/t14-/m1/s1
+|  StdInChIKey = PBILBHLAPJTJOT-CQSZACIVSA-N
 | MeSHName =
 }}
-|Section2= {{Chembox Properties
+|Section2={{Chembox Properties
 | Formula = C<sub>16</sub>H<sub>14</sub>O<sub>5</sub>
 | MolarMass = 286.27 g/mol
-| ExactMass = 286.084124 u
 | Appearance =
 | Density =
-| MeltingPt = <!-- °C -->
+| MeltingPt =
-| BoilingPt = <!-- °C -->
+| BoilingPt =
 | Solubility =
 }}
-| Section3 = {{Chembox Hazards
+|Section3={{Chembox Hazards
 | MainHazards =
 | FlashPt =
-| Autoignition =
+| AutoignitionPt =
-| RPhrases = <!-- {{R10}}, {{R23}}, {{R34}}, {{R50}} etc. -->
-| SPhrases = <!-- {{S1/2}}, {{S9}}, {{S16}}, {{S26}}, {{S36/37/39}}, {{S45}}, {{S61}} etc. -->
 }}
 }}
-'''Phyllodulcin''' is an [[dihydroisocoumarin]] found in ''[[Hydrangea macrophylla]]''<ref>Effects of phyllodulcin, [[hydrangenol]], and their 8-O-glucosides, and [[Thunberginol A|Thunberginols A]] and [[Thunberginol F|F]] from Hydrangea macrophylla SERINGE var. thunbergii MAKINO on passive cutaneous anaphylaxis reaction in rats. Matsuda H., Shimoda H., Yamahara J. and Yoshikawa M., Biological & pharmaceutical bulletin, 1999, vol. 22, no8, pp. 870-872, {{INIST|1959604}}</ref> and ''[[Hydrangea serrata]]''.<ref>Accumulation of phyllodulcin in sweet-leaf plants of Hydrangea serrata and its neutrality in the defence against a specialist leafmining herbivore. Mami Ujihara, Masateru Shinozaki and Makoto Kato, Researches on population ecology, Volume 37, Number 2, pp. 249-257, {{doi|10.1007/BF02515827}}</ref>
+'''Phyllodulcin''' is a [[dihydroisocoumarin]] found in ''[[Hydrangea macrophylla]]''<ref>Effects of phyllodulcin, [[hydrangenol]], and their 8-O-glucosides, and [[Thunberginol A|Thunberginols A]] and [[Thunberginol F|F]] from Hydrangea macrophylla SERINGE var. thunbergii MAKINO on passive cutaneous anaphylaxis reaction in rats. Matsuda H., Shimoda H., Yamahara J. and Yoshikawa M., Biological & pharmaceutical bulletin, 1999, vol.&nbsp;22, no.&nbsp;8, pp.&nbsp;870–872, {{INIST|1959604}}.</ref> and ''[[Hydrangea serrata]]''.<ref>Accumulation of phyllodulcin in sweet-leaf plants of Hydrangea serrata and its neutrality in the defence against a specialist leafmining herbivore. Mami Ujihara, Masateru Shinozaki and Makoto Kato, Researches on population ecology, Volume&nbsp;37, Number&nbsp;2, pp.&nbsp;249–257, {{doi|10.1007/BF02515827}}.</ref> It is a [[sweetener]] 400–800 times sweeter than sugar.<ref name=Tomasik-2003>Chemical and Functional Properties of Food Saccharides. P. Tomasik, CRC Press, Boca Raton, 2003, {{ISBN|978-0-8493-1486-5}}.</ref>
+== See also ==
+* [[Amacha]]
 ==References==
 {{reflist}}
+==External links==
+*{{Commons category-inline}}
 {{Isocoumarin}}
+{{Food Substitutes}}
+[[Category:Dihydroisocoumarins]]
+[[Category:Sugar substitutes]]
+[[Category:Vanilloids]]
-[[Category:Isocoumarins]]
-{{Natural-phenol-stub}}
+{{aromatic-stub}}