Barceloneic acid B

Barceloneic acid B
Names
	IUPAC name 2-(2-Carboxy-6-hydroxy-4-methoxyphenoxy)-6-hydroxy-4-methylbenzoic acid
Identifiers
3D model (JSmol)	Interactive image;
ChemSpider	8580060;
PubChem CID	10404622;
CompTox Dashboard (EPA)	DTXSID40439416 ;
	InChI InChI=1S/C16H14O8/c1-7-3-10(17)13(16(21)22)12(4-7)24-14-9(15(19)20)5-8(23-2)6-11(14)18/h3-6,17-18H,1-2H3,(H,19,20)(H,21,22) Key: BMKJMWKTRHWAPN-UHFFFAOYSA-N; InChI=1/C16H14O8/c1-7-3-10(17)13(16(21)22)12(4-7)24-14-9(15(19)20)5-8(23-2)6-11(14)18/h3-6,17-18H,1-2H3,(H,19,20)(H,21,22) Key: BMKJMWKTRHWAPN-UHFFFAOYAQ;
	SMILES CC1=CC(=C(C(=C1)OC2=C(C=C(C=C2O)OC)C(=O)O)C(=O)O)O;
Properties
Chemical formula	C16H14O8
Molar mass	334.280 g·mol−1
	Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references

Barceloneic acid B is a cytotoxic isolate of Penicillium albocoremium.^[1]

References

^ Overy, DP; Larsen, TO; Dalsgaard, PW; Frydenvang, K; Phipps, R; Munro, MH; Christophersen, C (2005). "Andrastin A and barceloneic acid metabolites, protein farnesyl transferase inhibitors from Penicillium albocoremium: Chemotaxonomic significance and pathological implications". Mycological Research. 109 (Pt 11): 1243–9. doi:10.1017/S0953756205003734. PMID 16279417.

This article about an aromatic compound is a stub. You can help Wikipedia by expanding it.