User:Cryptic/Improper disambiguation redirects/9
This table is generated by querying the database replica and is periodically updated by SDZeroBot.
Edits made to this page will be removed on the next update!
<< Previous page || Next page >>
| title | creation |
|---|---|
| ⤷El Dorado Cinema(Oslo) | 2010-01-02T19:29:59.000Z |
| ⤷Juno Award for Classical Album of the Year - Large Ensemble or Soloist(s) with Large Ensemble Accompaniment | 2009-12-31T21:38:36.000Z |
| ⤷Chartered Institute of Logistics and Transport in the UK - CILT(UK) | 2009-12-31T19:56:31.000Z |
| Niobium(V) fluoride | 2009-12-30T06:32:40.000Z |
| ⤷Benzo(e)fluoranthene | 2009-12-29T13:03:15.000Z |
| ⤷Lp(a) | 2009-12-29T12:36:17.000Z |
| ⤷Mayanur(tamilnadu) | 2009-12-28T18:37:03.000Z |
| ⤷Get Out!(album) | 2009-12-27T05:40:40.000Z |
| ⤷Garz(Rügen) | 2009-12-25T15:29:32.000Z |
| ⤷USS Fairview (PCE(R)-850) | 2009-12-25T12:51:36.000Z |
| ⤷Alto Paraná(city) | 2009-12-25T06:33:57.000Z |
| ⤷Sin(x)/x | 2009-12-24T03:32:55.000Z |
| ⤷Mendocino Homeland(The Lookouts ep) | 2009-12-21T15:30:11.000Z |
| ⤷K-OTIC(Thai Group) | 2009-12-20T22:02:26.000Z |
| ⤷42 USC 652(k) | 2009-12-20T11:02:22.000Z |
| 42 U.S.C. § 652(k) | 2009-12-20T10:10:02.000Z |
| ⤷AUCP(b) | 2009-12-19T18:04:20.000Z |
| ⤷W(2) | 2009-12-18T19:57:28.000Z |
| ⤷W(1) | 2009-12-17T11:52:51.000Z |
| Fox(film) | 2009-12-17T02:42:47.000Z |
| Bond(z) | 2009-12-15T20:19:22.000Z |
| ⤷Rory Gallagher(Gaelic Footballer) | 2009-12-15T14:53:24.000Z |
| ⤷Fauj Mein Mauj (2009)(Film) | 2009-12-15T09:25:58.000Z |
| ⤷2-(1-hexyloxyethyl)-2-devinyl pyropheophorbide-a | 2009-12-14T20:10:28.000Z |
| ⤷Down the Rabbit Hole(song) | 2009-12-14T12:32:21.000Z |
| ⤷SUCI(C) | 2009-12-12T11:40:26.000Z |
| 2-(1-Hexyloxyethyl)-2-devinyl pyropheophorbide-a | 2009-12-12T03:52:03.000Z |
| ⤷Tom Drake(wrestler, politician, coach) | 2009-12-11T16:45:56.000Z |
| ⤷James Johnston(Australian Idol) | 2009-12-11T06:20:34.000Z |
| ⤷Receptacle(botany) | 2009-12-10T18:10:28.000Z |
| ⤷Poly(methyl-methacrylate) | 2009-12-08T19:12:55.000Z |
| ⤷Before the storm(Niley) | 2009-12-05T19:44:43.000Z |
| ⤷Rai(Indian Title) | 2009-12-04T15:37:08.000Z |
| ⤷Gf(x) (band) | 2009-12-04T15:23:49.000Z |
| ⤷Iron(II)sulfide | 2009-12-03T21:57:52.000Z |
| ⤷Savior(song) | 2009-12-03T19:04:04.000Z |
| ⤷2,2-bis(4-glycidyloxyphenyl)propane | 2009-12-03T19:03:25.000Z |
| ⤷Ƒ(x) | 2009-12-02T21:55:24.000Z |
| ⤷Chromium(III) sulphate | 2009-12-02T11:03:56.000Z |
| ⤷PC(AP) | 2009-12-02T10:27:19.000Z |
| ⤷F(x) (Female Group) | 2009-12-01T15:11:27.000Z |
| ⤷1-(4-Methoxyphenyl)piperazine | 2009-12-01T09:25:07.000Z |
| ⤷On the Daltons' Trail(Lucky Luke) | 2009-12-01T08:58:59.000Z |
| ⤷Daisy Town(Lucky Luke) | 2009-12-01T08:57:14.000Z |
| ⤷The Ballad of the Daltons and other stories(Lucky Luke) | 2009-12-01T08:56:49.000Z |
| ⤷Claude Kelly(Songwriter) | 2009-12-01T00:33:57.000Z |
| ⤷2,5-dimethoxy-4-(2-fluoroethyl)amphetamine | 2009-11-30T06:11:06.000Z |
| ⤷Kokri Vehniwal(Moga) | 2009-11-29T16:43:58.000Z |
| ⤷CVR(T) Scimitar | 2009-11-29T14:58:52.000Z |
| ⤷CVR(T) Scorpion | 2009-11-29T14:57:54.000Z |
| ⤷National Highway 54B (India)(old numbering) | 2009-11-29T14:43:59.000Z |
| ⤷National Highway 47C (India)(old numbering) | 2009-11-29T14:01:08.000Z |
| ⤷National Highway 11C (India)(old numbering) | 2009-11-29T13:52:21.000Z |
| ⤷National Highway 4C (India)(old numbering) | 2009-11-29T13:44:12.000Z |
| ⤷National Highway 2C (India)(old numbering) | 2009-11-29T13:37:02.000Z |
| ⤷National Highway 2B (India)(old numbering) | 2009-11-29T13:30:52.000Z |
| ⤷Sooner or Later(Breaking Benjamin song) | 2009-11-29T07:03:10.000Z |
| ⤷Utz Rothe,(Austrian Artist) | 2009-11-28T23:13:02.000Z |
| ⤷Spieker Aquatics Center(UCLA) | 2009-11-28T19:19:29.000Z |
| ⤷Od(1) | 2009-11-26T20:45:38.000Z |
| Iron(II) | 2009-11-26T01:39:53.000Z |
| ⤷ΚΚΕ(μ-λ) | 2009-11-25T20:00:26.000Z |
| ⤷KKE(m-l) | 2009-11-25T19:58:23.000Z |
| Gold(I) bromide | 2009-11-24T19:55:49.000Z |
| ⤷Vigilance(album) | 2009-11-24T17:58:12.000Z |
| ⤷Rizen(gospel group) | 2009-11-24T03:07:28.000Z |
| Praseodymium(III) sulfate | 2009-11-24T02:24:46.000Z |
| ⤷Mike Compton(catcher) | 2009-11-23T21:51:38.000Z |
| ⤷Trioctylmethylammonium bis(trifluoromethyl-sulfonyl)imide | 2009-11-23T21:16:27.000Z |
| ⤷Shivalli(village) | 2009-11-23T16:56:28.000Z |
| ⤷KPU(o) | 2009-11-22T19:11:54.000Z |
| ⤷Poly(ethylene oxide) | 2009-11-22T05:58:25.000Z |
| ⤷Poly(ethylene terephthalate) | 2009-11-22T05:56:36.000Z |
| ⤷СДПУ(о) | 2009-11-21T17:55:18.000Z |
| ⤷USS PCE(R)-853 | 2009-11-19T22:08:41.000Z |
| ⤷USS PCE(R)-852 | 2009-11-19T22:08:33.000Z |
| ⤷PF6(-) | 2009-11-19T16:35:06.000Z |
| ⤷1-(1-Phenylcyclohexyl)-4-hydroxypiperidine | 2009-11-19T16:15:49.000Z |
| ⤷The National Stadium(Jamaica) | 2009-11-18T20:41:37.000Z |
| ⤷1,1'-azobis(N,N-dimethylformamide) | 2009-11-17T14:05:44.000Z |
| ⤷Azodicarboxylic acid bis(dimethylamide) | 2009-11-17T14:05:34.000Z |
| ⤷Gallium(III) arsenide | 2009-11-16T05:53:01.000Z |
| ⤷Ramling(Old Shirur) | 2009-11-15T19:43:43.000Z |
| ⤷Tonight(TobyMac album) | 2009-11-15T08:02:06.000Z |
| ⤷Divertimento No. 11(Mozart) | 2009-11-14T18:46:08.000Z |
| ⤷AlLibis(binaphthoxide) | 2009-11-11T20:14:40.000Z |
| ⤷Mike Austin(swimmer) | 2009-11-11T10:04:17.000Z |
| Bundesliga(wrestling) | 2009-11-10T12:46:49.000Z |
| ⤷Eddie Freeman(musician) | 2009-11-09T18:05:08.000Z |
| ⤷RSP(B) | 2009-11-09T17:24:28.000Z |
| ⤷Salmson-(Canton-Unne) Z9 | 2009-11-09T07:39:11.000Z |
| ⤷Good morning(Chamillionaire single) | 2009-11-08T20:51:10.000Z |
| ⤷A1(M) motorway (Great Britain) | 2009-11-08T08:39:28.000Z |
| 4-(γ-Glutamylamino)butanoic acid | 2009-11-07T21:21:36.000Z |
| ⤷Americas Best Dance Crew(season 5) | 2009-11-07T20:56:40.000Z |
| ⤷Zeta(3) | 2009-11-07T03:24:50.000Z |
| ⤷Guo Yuan(Zen monk) | 2009-11-05T03:50:46.000Z |
| ⤷National Highway 28C (India)(old numbering) | 2009-11-04T22:09:32.000Z |
| ⤷National Highway 26A (India)(old numbering) | 2009-11-04T21:47:56.000Z |
| ⤷BNC(bank) | 2009-11-04T17:32:59.000Z |
| ⤷Police Quarters(the film) | 2009-11-04T14:21:30.000Z |
| ⤷AKASH(missile) | 2009-11-04T11:03:23.000Z |
| ⤷UCPN(M) | 2009-11-04T07:00:40.000Z |
| ⤷Bagpipes(How I Met Your Mother) | 2009-11-03T00:13:52.000Z |
| ⤷Epicatechin-(2β→7,4β→8)-epicatechin | 2009-11-02T16:26:20.000Z |
| ⤷Oligo(U) tail | 2009-11-02T14:36:45.000Z |
| ⤷Poly(U) tail | 2009-11-02T14:36:09.000Z |
| ⤷Finnegan's Wake(Homicide: Life on the Street) | 2009-11-02T13:20:24.000Z |
| ⤷Fallen Heroes(Homicide: Life on the Street) | 2009-11-02T13:20:21.000Z |
| ⤷CECT(mobile phone brand) | 2009-11-02T10:14:19.000Z |
| ⤷N-ethyl-5-(trifluoromethyl)-2,3-dihydro-1H-inden-2-amine | 2009-10-31T21:16:36.000Z |
| ⤷Grantown-on-Spey(West) railway station | 2009-10-30T22:54:21.000Z |
| ⤷Addictive(Band) | 2009-10-30T07:33:33.000Z |
| ⤷The Traitor(novel) | 2009-10-29T21:39:07.000Z |
| ⤷What the Dog Saw : And Other Adventures(book) | 2009-10-29T19:49:31.000Z |
| ⤷SE(n) | 2009-10-29T17:42:47.000Z |
| ⤷SE(2) | 2009-10-29T17:41:17.000Z |
| ⤷Grue-(monster) | 2009-10-28T13:49:00.000Z |
| ⤷Siege of Tunis(Mercenary War) | 2009-10-28T13:22:59.000Z |
| ⤷Atsede Kidanu(Mrs) | 2009-10-26T06:24:13.000Z |
| ⤷Epicatechin-(4β→8,2β→O→7)-entcatechin-(4β-8)-catechin | 2009-10-25T10:01:17.000Z |
| ⤷Veze(Baise) | 2009-10-25T03:14:27.000Z |
| ⤷Zeta(2) | 2009-10-25T01:44:55.000Z |
| ⤷Libx(graphics library) | 2009-10-25T00:52:28.000Z |
| ⤷Epiafzelechin-(4beta-8,2beta-0-7)-epiafzelechin-(4beta-8)-afzelechin | 2009-10-24T13:01:29.000Z |
| ⤷Art. 123(2) | 2009-10-24T09:19:24.000Z |
| ⤷Vibes(Soundtrack) | 2009-10-24T03:27:11.000Z |
| ⤷N'-(4-chloro-o-tolyl)-N,N-dimethylformamidine | 2009-10-23T16:55:32.000Z |
| ⤷1-(2-nitro-1-imidazolyl)-3-methoxy-2-propanol | 2009-10-23T14:49:56.000Z |
| ⤷12(S)-hydroxyeicosatetraenoic acid | 2009-10-23T14:00:42.000Z |
| ⤷12(S)-HETE | 2009-10-23T14:00:36.000Z |
| ⤷(5Z,8Z,10E,14Z)-(12S)-12-hydroperoxyicosa-5,8,10,14-tetraenoate | 2009-10-23T13:56:14.000Z |
| Are(A)zione | 2009-10-22T19:58:30.000Z |
| ⤷(E)-3-(4-dimethylaminophenyl)prop-2-enal | 2009-10-22T18:33:56.000Z |
| ⤷USS Nightingale (MSC(O)-50) | 2009-10-22T15:30:42.000Z |
| ⤷Rohini Village(West Bengal) | 2009-10-22T01:59:29.000Z |
| ⤷Paschim Champaran(Lok Sabha constituency) | 2009-10-21T05:49:53.000Z |
| Protactinium(IV) oxide | 2009-10-20T13:56:56.000Z |
| ⤷Kaba(The shiva Temple) | 2009-10-20T12:00:35.000Z |
| ⤷Algiers expedition(1541) | 2009-10-19T20:07:29.000Z |
| ⤷Cercal do Alentejo(Santiago do Cacém) | 2009-10-19T19:55:10.000Z |
| ⤷U(2) | 2009-10-19T02:29:43.000Z |
| ⤷The Last Night(song) | 2009-10-19T01:17:18.000Z |
| ⤷Ludwig(Germany) | 2009-10-19T01:08:43.000Z |
| ⤷FLEC(Lopes) | 2009-10-18T15:34:52.000Z |
| ⤷Gpp(NH)p | 2009-10-16T20:53:44.000Z |
| ⤷VR(PC) | 2009-10-16T19:28:27.000Z |
| Omerta(mmorpg) | 2009-10-16T09:22:32.000Z |
| ⤷1-(2-pyrimidinyl)-piperazine | 2009-10-15T04:44:40.000Z |
| ⤷1-(2-Pyrimidinyl)-piperazine | 2009-10-15T04:44:23.000Z |
| ⤷1-(2-pyrimidinyl)piperazine | 2009-10-15T04:37:45.000Z |
| T(1) theorem | 2009-10-15T03:42:27.000Z |
| ⤷Paul Foster(footballer) | 2009-10-15T01:17:34.000Z |
| ⤷Regret(LeToya song) | 2009-10-14T20:23:06.000Z |
| ⤷Wembley Stadium(1923) | 2009-10-14T00:32:08.000Z |
| ⤷Where Do I Begin (remix)(Shirley Bassey single) | 2009-10-13T19:43:59.000Z |
| ⤷SE(3) | 2009-10-13T12:33:50.000Z |
| ⤷2,3-(S)-hexahydroxydiphenoyl-4,6-(S,S)-gallagyl-D-glucose | 2009-10-12T13:19:09.000Z |
| ⤷Moon of the Spider(novel) | 2009-10-12T08:20:31.000Z |
| ⤷Bass(Mega Man) | 2009-10-12T00:17:57.000Z |
| ⤷Edith's 50th Birthday(All in the Family) | 2009-10-11T10:06:18.000Z |
| ⤷Fort Lyon(California) | 2009-10-08T21:42:12.000Z |
| ⤷European Cup for clubs(korfball) | 2009-10-06T23:22:45.000Z |
| ⤷Catechin-(4α→6)-epicatechin | 2009-10-06T14:11:27.000Z |
| ⤷Catechin-(4α→6)-catechin | 2009-10-06T14:06:24.000Z |
| ⤷Epicatechin-(4β → 6)-epicatechin | 2009-10-06T13:58:16.000Z |
| ⤷Catechin-(4α→8)-epicatechin | 2009-10-06T13:47:56.000Z |
| ⤷Guo Yuan(Three Kingdoms) | 2009-10-06T09:48:59.000Z |
| ⤷(2S)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-4,5,7-triol | 2009-10-05T17:15:29.000Z |
| ⤷Om(Kannada film) | 2009-10-05T15:29:00.000Z |
| ⤷(2S)-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromene-4,5,7-triol | 2009-10-05T07:11:14.000Z |
| ⤷Patrick Wolf(footballer) | 2009-10-04T12:05:37.000Z |
| ⤷Iṣṭa-deva(tā) | 2009-10-03T20:10:30.000Z |
| ⤷Nagpur West(Assembly constituency) | 2009-10-03T19:22:57.000Z |
| ⤷Akola West(Assembly constituency) | 2009-10-01T11:43:02.000Z |
| ⤷Jalgaon(Jamod) | 2009-10-01T11:14:58.000Z |
| ⤷Jalgaon(Jamod) (Assembly constituency) | 2009-09-30T12:37:26.000Z |
| Jennifer's Body(film) | 2009-09-30T05:08:04.000Z |
| ⤷D-Con(Gaming Convention) | 2009-09-28T23:15:34.000Z |
| ⤷Cheshunt F.C.(1880-1931) | 2009-09-28T19:20:09.000Z |
| ⤷Dangoh Khurd, Pirthipur, Una(HP) | 2009-09-28T15:29:48.000Z |
| ⤷OS(OSD) | 2009-09-28T13:42:19.000Z |
| ⤷Salem Witches(NEL) | 2009-09-27T19:32:28.000Z |
| ⤷Jeff Schroeder(Musician) | 2009-09-26T23:38:47.000Z |
| ⤷My Kinda Girl(Raghav) | 2009-09-26T05:48:20.000Z |
| ⤷Epicatechin-(4β→8)-catechin | 2009-09-26T05:46:51.000Z |
| USS LSM(R)-188 | 2009-09-26T01:26:52.000Z |
| ⤷Season 1(The Cleveland Show) | 2009-09-25T18:49:32.000Z |
| ⤷Yaaruku Yaaro(Tamil Film) | 2009-09-25T18:24:36.000Z |
| ⤷MIR(c) | 2009-09-24T10:11:39.000Z |
| ⤷Ahmednagar City(Assembly constituency) | 2009-09-22T18:37:35.000Z |
| ⤷Malavika(singer) | 2009-09-22T10:42:56.000Z |
| ⤷O-(beta-hydroxyethyl)-rutosides | 2009-09-21T11:51:09.000Z |
| ⤷Fire It Up(Thousand Foot Krutch) | 2009-09-21T10:15:52.000Z |
| ⤷0-(beta-hydroxyethyl)-rutosides | 2009-09-21T09:44:09.000Z |
| Assassin(s) | 2009-09-20T18:33:54.000Z |
| ⤷2-(((3R,4S)-1-methyl-4-(4-chlorophenyl)piperidin-3-yl)methylthio)-N-isopropylacetamide | 2009-09-19T23:00:51.000Z |
| ⤷C4H9(C6H4(OH)COO) | 2009-09-19T06:36:15.000Z |
| ⤷Aadat(Indian Edition) | 2009-09-18T21:37:57.000Z |
| ⤷Robert Herring(aviator) | 2009-09-18T20:47:47.000Z |
| ⤷Combined Arms(Computer Game) | 2009-09-18T20:31:55.000Z |
| ⤷Sqrt(5) | 2009-09-17T18:47:09.000Z |
| ⤷Sqrt(3) | 2009-09-17T18:43:52.000Z |
| ⤷2β-((3,4-Methylenedioxyphenoxy)methyl)-3α-(4-fluorophenyl)nortropane | 2009-09-17T17:34:11.000Z |
| ⤷Ga(NO3)3 | 2009-09-17T13:16:33.000Z |
| ⤷4',5-Dihydro-6-methoxy-7-(o-glucoside)isoflavone | 2009-09-16T19:15:54.000Z |
| ⤷High School Confidential(Sit Down, Shut Up) | 2009-09-16T17:30:21.000Z |
| ⤷688(i) Hunter/Killer | 2009-09-16T14:31:29.000Z |
| ⤷Foxbridge(horse) | 2009-09-16T11:50:15.000Z |
| ⤷5,7-dihydroxy-3-(3-hydroxy-4,5-dimethoxyphenyl)-6-methoxychromen-4-one | 2009-09-15T19:29:20.000Z |
| ⤷5,7-dihydroxy-3-(4-hydroxyphenyl)-6-methoxychromen-4-one | 2009-09-15T19:19:29.000Z |
| ⤷O-(beta-Hydroxyethyl)diosmin | 2009-09-15T14:03:20.000Z |
| ⤷Helen Money(cello) | 2009-09-14T21:48:20.000Z |
| ⤷Ganesh(Just Ganesh) | 2009-09-14T12:40:09.000Z |
| ⤷Copa America(Indoor) | 2009-09-14T09:07:50.000Z |
| ⤷Robert F. Wagner Jr.(Deputy Mayor) | 2009-09-14T02:38:58.000Z |
| ⤷Ryukyu News(paper) | 2009-09-13T08:10:19.000Z |
| ⤷The Hangover 2(film) | 2009-09-13T02:31:34.000Z |
| ⤷Sinc(x) | 2009-09-13T01:06:33.000Z |
| ⤷XRS-2200(rocket engine) | 2009-09-11T21:04:10.000Z |
| ⤷The third generation(2009) | 2009-09-11T14:38:40.000Z |
| ⤷Walt Disney International(India) Pvt. Ltd. | 2009-09-11T09:33:05.000Z |
| ⤷Β-D-xylosyl-(1→2)-β-D-glucose | 2009-09-10T14:49:33.000Z |
| ⤷Hornet's Nest(Doctor Who) | 2009-09-10T02:49:57.000Z |
| ⤷We Are Klang(TV Series) | 2009-09-09T03:15:43.000Z |
| ⤷Measure of a Man(Jack Ingram song) | 2009-09-08T21:38:41.000Z |
| ⤷Kofi Adu(Agya Koo) | 2009-09-08T19:17:33.000Z |
| ⤷Aladdin(film) | 2009-09-07T22:31:55.000Z |
| ⤷3-(Galactosyloxy)-5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-1-benzopyrylium chloride | 2009-09-07T17:34:27.000Z |
| ⤷Long March 3B(A) | 2009-09-07T13:11:33.000Z |
| ⤷Tony Dixon(American football) | 2009-09-06T16:27:41.000Z |
| ⤷Mandy(Jonas Brothers Song) | 2009-09-06T08:45:04.000Z |
| ⤷1-(2-Naphthyl)-2-aminopropane | 2009-09-06T00:58:47.000Z |
| ⤷Magnus(II), son of Gille Brigte | 2009-09-05T18:03:00.000Z |
| Bis(pinacolato)diboron | 2009-09-05T01:18:30.000Z |
| ⤷Keep It Real(Jonas Brothers song) | 2009-09-04T22:59:01.000Z |
| ⤷2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,4,5,7-tetrol | 2009-09-04T06:33:00.000Z |
| Zirconium(IV) sulfate | 2009-09-03T23:26:40.000Z |
| ⤷Consumer(food chain) | 2009-09-03T20:45:56.000Z |
| ⤷2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromene-3,4,5,7-tetrol | 2009-09-03T07:44:37.000Z |
| USS LSM(R)-199 | 2009-09-02T22:21:20.000Z |
| ⤷National Highway 24B (India)(old numbering) | 2009-09-02T21:15:19.000Z |
| C6H4(OH)2 | 2009-09-02T20:36:08.000Z |
| ⤷National Highway 79A (India)(old numbering) | 2009-09-02T14:33:19.000Z |
| ⤷National Highway 11B (India)(old numbering) | 2009-09-02T13:34:25.000Z |
| ⤷ORPC(M-L) | 2009-09-02T02:41:04.000Z |
| ⤷C6H2(OH)3COOH | 2009-09-01T17:30:23.000Z |
| ⤷Eclipse phase(Game) | 2009-09-01T16:49:12.000Z |
| ⤷(-)-2β-Carbocyclobutoxy-3β-(4-methylphenyl)tropane | 2009-09-01T16:19:38.000Z |
| ⤷2-(4-hydroxy-3,5-dimethoxyphenyl)-7-methoxychromenylium-3,5-diol | 2009-09-01T07:29:29.000Z |
| ⤷USS LSM(R) 195 | 2009-09-01T02:50:24.000Z |
| USS LSM(R)-195 | 2009-09-01T01:41:31.000Z |
| USS LSM(R)-198 | 2009-09-01T01:23:59.000Z |
| USS LSM(R)-197 | 2009-09-01T01:08:35.000Z |
| ⤷F(x) (South Korean group) | 2009-08-31T19:32:01.000Z |
| Dollaseite-(Ce) | 2009-08-31T18:15:40.000Z |
| ⤷USS ARD(BS)-20 | 2009-08-30T18:44:29.000Z |
| ⤷Exegesis(Millennium) | 2009-08-30T10:36:00.000Z |
| ⤷(2R-trans)-3-((6-Deoxy-alpha-L-mannopyranosyl)oxy)-2-(3,4- dihydroxyphenyl)-2,3-dihydro-5,7-dihydroxy-4H-1-benzopyran-4-one | 2009-08-30T06:35:32.000Z |
| F(x) (musical group) | 2009-08-30T03:22:50.000Z |
| ⤷Kelhauri(chachai) | 2009-08-29T22:33:26.000Z |
| USS LSM(R)-196 | 2009-08-29T21:58:27.000Z |
| ⤷Vacuity(Band) | 2009-08-29T19:19:23.000Z |
| USS LSM(R)-194 | 2009-08-29T16:23:13.000Z |
| ⤷C6H5CH(CH3)NH2 | 2009-08-29T13:29:55.000Z |
| ⤷USS LSM(R) 193 | 2009-08-28T07:26:50.000Z |
| ⤷Thomas William Murphy (1935-1992)(Associate Justice American Samoa 1980-1987) | 2009-08-28T06:48:57.000Z |
| USS LSM(R)-192 | 2009-08-28T04:16:57.000Z |
| ⤷Sqrt(2) | 2009-08-28T02:45:49.000Z |
| ⤷Bigger Than The Mayor(album) | 2009-08-28T02:34:19.000Z |
| ⤷Arrondissement of Château-Chinon(Ville) | 2009-08-27T20:33:31.000Z |
| ⤷(2S,3R)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol | 2009-08-27T17:19:02.000Z |
| USS LSM(R)-193 | 2009-08-27T02:03:48.000Z |
| ⤷Tropical Storm Danny(2009) | 2009-08-27T00:58:51.000Z |
| ⤷Chal Chalein(2009 film) | 2009-08-26T10:59:35.000Z |
| ⤷2-(3,4-dihydroxyphenyl)chromenylium-3,7-diol chloride | 2009-08-26T06:39:26.000Z |
| ⤷2-(3-hydroxy-4-methoxyphenyl)chromenylium-5,7-diol chloride | 2009-08-25T18:34:35.000Z |
| ⤷2-(4-hydroxy-3,5-dimethoxyphenyl)-5-methoxychromenylium-3,7-diol | 2009-08-25T17:49:45.000Z |
| ⤷2-(3,4-dihydroxyphenyl)chromenylium-5,7-diol | 2009-08-25T15:43:08.000Z |
| ⤷2-(3,4-Dihydroxy-phenyl)-5,7-dihydroxy-chromenylium | 2009-08-25T15:39:30.000Z |
| ⤷2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromenylium | 2009-08-25T15:39:12.000Z |
| ⤷5,7-dihydroxy-2-(4-hydroxyphenyl)benzopyrilium chloride | 2009-08-25T15:16:39.000Z |
| ⤷7-hydroxy-3-(4-methoxyphenyl)chromen-4-one | 2009-08-25T12:23:16.000Z |
| ⤷Biochanin A 7-O-(6-O-malonyl-beta-D-glucoside) | 2009-08-25T09:21:45.000Z |
| ⤷2-O-(6-deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranose | 2009-08-25T07:39:51.000Z |
| ⤷USS LSM(R) 191 | 2009-08-25T04:43:28.000Z |
| ⤷2-(3,4-dimethoxyphenyl)-5,6,7,8-tetramethoxychromen-4-one | 2009-08-24T18:12:36.000Z |
| ⤷5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)chromen-4-one | 2009-08-24T17:37:15.000Z |
| ⤷Video Phone(Beyonce Knowles song) | 2009-08-24T15:43:44.000Z |
| ⤷2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-7-methoxychromen-4-one | 2009-08-24T12:46:02.000Z |
| ⤷5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,7-dimethoxychromen-4-one | 2009-08-24T12:06:34.000Z |
| ⤷2-(3,4-dimethoxyphenyl)-3-hydroxy-5,6,7,8-tetramethoxychromen-4-one | 2009-08-24T11:32:50.000Z |
| ⤷3,5-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-methoxychromen-4-one | 2009-08-24T09:10:51.000Z |
| ⤷3,5,7-Trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-1-benzopyran-4-one | 2009-08-24T08:34:08.000Z |
| ⤷3,5,7-trihydroxy-2-(4-hydroxy-3-methoxyphenyl)chromen-4-one | 2009-08-24T08:27:10.000Z |
| ⤷Pudukkudi West(srivaikuntam) | 2009-08-24T08:10:56.000Z |
| ⤷3,5,7-trihydroxy-2-(4-methoxyphenyl)chromen-4-one | 2009-08-24T08:03:44.000Z |
| USS LSM(R)-191 | 2009-08-23T23:02:51.000Z |
| ⤷(E)-1-(2,4-dihydroxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one | 2009-08-23T19:22:38.000Z |
| ⤷2-(3,4-dihydroxyphenyl)-3,7-dihydroxychromen-4-one | 2009-08-23T13:51:07.000Z |
| ⤷Tytus(Masters of the Universe) | 2009-08-23T13:09:33.000Z |
| ⤷X( | 2009-08-22T17:18:28.000Z |
| ⤷Copenhagen Convention(bridge) | 2009-08-22T16:23:37.000Z |
| ⤷7-(β-D-glucopyranuronosyloxy)-5,6-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one | 2009-08-21T08:13:58.000Z |
| ⤷7.62 cm PaK 36(r) | 2009-08-20T20:25:51.000Z |
| ⤷Almost Home(Evergreen Terrace album) | 2009-08-20T17:33:19.000Z |
| USS LSM(R)-190 | 2009-08-20T16:01:13.000Z |
| ⤷Sulphur(IV) oxide | 2009-08-20T10:28:42.000Z |
| ⤷That Was Yesterday(Foreigner song) | 2009-08-20T07:22:25.000Z |
| ⤷Proddatur(Assembly constituency) | 2009-08-20T05:46:37.000Z |
| ⤷Blue Morning, Blue Day(Foreigner song) | 2009-08-20T05:36:48.000Z |
| ⤷2β-((3,4-Methylenedioxy)phenoxy)methyl)-3α-(4-fluorophenyl)tropane | 2009-08-19T12:36:28.000Z |
| ⤷Made Of Stone(play) | 2009-08-19T04:52:04.000Z |
| S. Rajendran (CPI(M) politician) | 2009-08-19T00:39:31.000Z |
| ⤷Operater(A Girl Like Me) | 2009-08-18T20:29:37.000Z |
| ⤷Mario Mendez(futbolista panameño) | 2009-08-18T16:16:59.000Z |
| ⤷Chiloda(Naroda) | 2009-08-16T13:11:49.000Z |
| ⤷St.Martin's Engineering college,Dhulapally(smec) | 2009-08-15T09:20:10.000Z |
| ⤷A Thousand Nights(album) | 2009-08-15T08:12:55.000Z |
| ⤷(-)-2β-Carbomethoxy-3β-(4-fluorophenyl)tropane | 2009-08-14T20:28:58.000Z |
| ⤷Raw(Juvenile album) | 2009-08-14T10:19:57.000Z |
| ⤷Quake(Aftershock) | 2009-08-13T21:19:33.000Z |
| ⤷Lake Michigan Conference(Michigan) | 2009-08-13T15:36:18.000Z |
| ⤷CPI(ML) Unity Initiative | 2009-08-13T09:58:51.000Z |
| ⤷Bring Me To Life(Thousand Foot Krutch) | 2009-08-12T04:42:52.000Z |
| ⤷Sodium tetrachloropalladate(II) | 2009-08-12T01:40:47.000Z |
| ⤷Noble College(Autonomous), Machilipatnam | 2009-08-11T13:00:04.000Z |
| ⤷Redundant(play) | 2009-08-11T05:08:02.000Z |
| ⤷Send it on(song) | 2009-08-10T19:57:35.000Z |
| ⤷Vmsplice() exploit | 2009-08-10T13:38:13.000Z |
| ⤷25(OH)D | 2009-08-10T03:05:44.000Z |
| ⤷(-)-Methyl-1-methyl-4β-(2-naphthyl)piperidine-3β-carboxylate | 2009-08-10T02:04:34.000Z |
| ⤷2-Butyl-3-(p-tolyl)quinuclidine | 2009-08-10T01:20:36.000Z |
| ⤷Winter Wonderland(album) | 2009-08-08T23:45:17.000Z |
| ⤷Tribute(album) | 2009-08-08T23:35:18.000Z |
| ⤷Happy Feet(album) | 2009-08-08T23:28:19.000Z |
| ⤷Like a Lover(album) | 2009-08-08T23:24:37.000Z |
| ⤷(-)-2β-Carbomethoxy-3β-(4-methylphenyl)tropane | 2009-08-08T13:55:50.000Z |
| ⤷(-)-2β-Carbomethoxy-3β-(4-bromophenyl)tropane | 2009-08-08T13:53:40.000Z |
| ⤷(-)-2β-Carbomethoxy-3β-(4-chlorophenyl)tropane | 2009-08-08T13:51:52.000Z |
| ⤷Tetrakis(dimethylamino)titanium | 2009-08-08T03:05:59.000Z |
| ⤷Tetrakis(dimethylamino)titanium(IV) | 2009-08-08T02:44:14.000Z |
| ⤷Zhao Peng(football player) | 2009-08-07T22:42:32.000Z |
| ⤷The Business of Dying(Novel) | 2009-08-07T17:04:44.000Z |
| ⤷Hats Off(EP) | 2009-08-07T06:07:37.000Z |
| ⤷Reborn(Avalon album) | 2009-08-07T05:59:00.000Z |
| ⤷5-(2-Propylamino)indane | 2009-08-06T15:06:03.000Z |
| ⤷5-(2-propylamino)indane | 2009-08-06T15:05:49.000Z |
| ⤷1-(5-Indanyl)-2-aminopropane | 2009-08-06T15:02:19.000Z |
| ⤷NordicTrack(MN based company) | 2009-08-06T14:10:52.000Z |
| ⤷Shri Shankaracharya College of Engineering and Technology(SSCET) | 2009-08-06T07:25:45.000Z |
| ⤷Bhilai Institute Of Technology(BIT-Durg) | 2009-08-06T07:24:05.000Z |
| ⤷5-(3,4-Methylenedioxyphenyl)-2,4-pentadienoyl-2-piperidine | 2009-08-06T04:46:21.000Z |
| ⤷4,5-(Methylenedioxyphenyl)-3-methoxy-2-propene | 2009-08-06T04:45:51.000Z |
| ⤷D-Lysergic acid N-(α-hydroxyethyl)amide | 2009-08-06T02:33:38.000Z |
| ⤷3-amino-2-methyl-1,1-di(phenyl)propan-1-ol | 2009-08-06T02:07:01.000Z |
| ⤷1-(1-(1-Benzothiophen-2-yl)cyclohexyl)piperidine | 2009-08-06T01:03:28.000Z |
| ⤷Carmel High School(Nagercoil) | 2009-08-05T23:11:56.000Z |
| Benzo(c)thiophene | 2009-08-05T21:25:41.000Z |
| Benzo(k)fluoranthene | 2009-08-05T21:19:16.000Z |
| Benzo(j)fluoranthene | 2009-08-05T21:13:49.000Z |
| Benzo(ghi)perylene | 2009-08-05T21:07:09.000Z |
| Benzo(e)pyrene | 2009-08-05T21:01:30.000Z |
| ⤷Benzo(b)fluoranthene | 2009-08-05T20:52:59.000Z |
| Benzo(c)phenanthrene | 2009-08-05T20:46:44.000Z |
| ⤷Duele(Chenoa´s single) | 2009-08-05T20:43:24.000Z |
| ⤷Benzo(b)phenanthrene | 2009-08-05T20:35:40.000Z |
| Benz(a)anthracene | 2009-08-05T20:34:47.000Z |
| ⤷Avatar: The Last Airbender(Kings Island) | 2009-08-05T18:27:05.000Z |
| ⤷Dear Agony(album) | 2009-08-05T00:01:20.000Z |
| ⤷Bis(triphenylphosphine)palladium(II) chloride | 2009-08-04T18:17:18.000Z |
| ⤷(-)-1-(Benzofuran-2-yl)-2-propylaminopentane | 2009-08-03T15:35:33.000Z |
| ⤷3,4-(Methylenedioxyphenyl)-1-propanone | 2009-08-03T10:26:57.000Z |
| ⤷Aladin(2009 film) | 2009-08-03T00:05:29.000Z |
| ⤷Dichlorobis(triphenylphosphine)palladium(II) | 2009-08-02T19:19:04.000Z |
| ⤷John Williams(bishop) | 2009-08-01T17:55:06.000Z |
| ⤷3,4-(Methylenedioxyphenyl)-2-propene | 2009-07-31T09:23:02.000Z |
| ⤷3,4-(Methylenedioxyphenyl)-1-propene | 2009-07-31T09:20:16.000Z |
| ⤷3-(3,4-(Methylenedioxy)phenyl)-1-propene | 2009-07-31T09:18:02.000Z |
| ⤷3,4-(methylenedioxyphenyl)-2-propanone | 2009-07-31T09:00:39.000Z |
| ⤷Nicholas Rush(Stargate) | 2009-07-31T08:26:40.000Z |
| ⤷2-(5-methoxy-2-methyl-H-indol-3-yl)-N,N-dimethylethanamine | 2009-07-31T03:15:06.000Z |
| ⤷Blue jersey(Vuelta a España) | 2009-07-29T21:43:14.000Z |
| ⤷2001: A Space Odyssey(film) | 2009-07-28T12:15:42.000Z |
| ⤷Cherry Hill(Amusement Park) | 2009-07-27T22:38:19.000Z |
| ⤷(-)-2β-Carbomethoxy-3β-(4-iodophenyl)tropane | 2009-07-25T20:12:01.000Z |
| ⤷Methylenedioxy-N-(2-hydroxyethyl)amphetamine | 2009-07-25T03:19:55.000Z |
| ⤷3,4-Methylenedioxy-N-(2-hydroxyethyl)amphetamine | 2009-07-25T03:18:54.000Z |
| ⤷(-)-1-(benzofuran-2-yl)-2-propylaminopentane | 2009-07-23T03:36:18.000Z |
| ⤷Poly(chloroethanediyl) | 2009-07-22T19:42:26.000Z |
| ⤷Hitler(Malayalam) | 2009-07-22T01:25:50.000Z |
| ⤷Benzo(a)pyrazine | 2009-07-21T14:47:47.000Z |
| ⤷For Eric Delko (2)(CSI: Miami) | 2009-07-20T19:52:14.000Z |
| ⤷Soil(Band) | 2009-07-20T15:50:09.000Z |
| ⤷Bismuth(III) fluoride | 2009-07-20T14:22:19.000Z |
| Mercury(I) nitrate | 2009-07-19T19:42:19.000Z |
| ⤷David Willison(pianist) | 2009-07-19T19:18:49.000Z |
| ⤷Son of a Son of a Sailor(song) | 2009-07-19T02:09:02.000Z |
| ⤷Strawweight(MMA) | 2009-07-18T15:28:47.000Z |
| ⤷4-(4-methylphenyl)-4-oxobutanoic acid | 2009-07-16T20:51:48.000Z |
| ⤷David Brand(footballer) | 2009-07-15T19:48:36.000Z |
| ⤷CPI(ML) Liberation | 2009-07-14T20:11:30.000Z |
| ⤷Kharapu(khorramkoh) | 2009-07-14T18:04:07.000Z |
| ⤷Today(OneRepublic album) | 2009-07-13T16:25:47.000Z |
| ⤷Phosphorus(III) oxide | 2009-07-13T14:40:09.000Z |
| ⤷Marko Popović(footballer) | 2009-07-13T13:03:48.000Z |
| ⤷Almost Honest(Megadeth song) | 2009-07-13T11:58:13.000Z |
| ⤷Benzo(c)pyridine | 2009-07-12T18:08:49.000Z |
| ⤷Jack Taylor(TV Financial News Anchor) | 2009-07-10T18:05:41.000Z |
| ⤷Cat Cay(s) | 2009-07-10T14:48:04.000Z |
| ⤷Strontium(II) bromide | 2009-07-10T10:11:23.000Z |
| ⤷Strontium(II) iodide | 2009-07-10T10:11:02.000Z |
| ⤷Ferguson Lake(Nova Scotia) | 2009-07-09T13:02:35.000Z |
| ⤷Belle Lake(Nova Scotia) | 2009-07-09T12:42:33.000Z |
| ⤷Skeletons in the Closet(Children of Bodom album) | 2009-07-09T11:29:15.000Z |
| Copper(II) phosphate | 2009-07-09T03:59:09.000Z |
| ⤷Vaana(Tamil film) | 2009-07-08T23:25:42.000Z |
| ⤷(+)-(R)-limonene | 2009-07-08T23:18:41.000Z |
| ⤷(+)-(4R)-limonene | 2009-07-08T23:16:03.000Z |
| ⤷(-)-(4S)-limonene | 2009-07-08T23:14:05.000Z |
| ⤷Claro River(Tinguirica) | 2009-07-08T02:03:42.000Z |
| ⤷1,3-bis(2-chloroethyl)-1-nitrosourea | 2009-07-07T22:32:11.000Z |
| ⤷1,25-(OH)2D3 | 2009-07-07T22:26:32.000Z |
| ⤷EMD GP40-2L(W) | 2009-07-07T19:32:52.000Z |
| ⤷Piney River(Thornton River) | 2009-07-07T02:52:07.000Z |
| ⤷Sakura(cigarette) | 2009-07-06T23:15:50.000Z |
| ⤷Karounga Keita(footballer) | 2009-07-06T05:10:43.000Z |
| ⤷Kira-Kira(Game) | 2009-07-06T03:44:12.000Z |
| Bis(triphenylphosphine)palladium chloride | 2009-07-05T14:46:29.000Z |
| ⤷Jesse(given name) | 2009-07-05T09:22:02.000Z |
| ⤷George Law-(financier) | 2009-07-04T18:43:35.000Z |
| ⤷Catch 22(album) | 2009-07-04T17:28:26.000Z |
| ⤷Tucapel(commune) | 2009-07-04T09:14:24.000Z |
| ⤷SRC(B) | 2009-07-04T07:17:02.000Z |
| ⤷West Farms Square–(IRT White Plains Road Line) | 2009-07-03T14:31:19.000Z |
| ⤷Casuaniformes(Casuariiformes) | 2009-07-03T08:08:20.000Z |
| ⤷Parappurath(K.E.Mathai) | 2009-07-03T06:15:04.000Z |
| ⤷Fire(single) | 2009-07-02T22:08:51.000Z |
| ⤷Cerite-(Ce) | 2009-07-02T17:41:38.000Z |
| ⤷Cerite-(La) | 2009-07-02T17:41:27.000Z |
| ⤷The Liverbirds(band) | 2009-07-02T02:21:37.000Z |
| ⤷Trichloro(nitro)methane | 2009-07-01T15:35:05.000Z |
| ⤷CH3(CH2)15OH | 2009-07-01T10:17:17.000Z |
| ⤷Count To Free(single) | 2009-06-30T20:59:17.000Z |
| ⤷OASA(ALT) | 2009-06-30T20:13:58.000Z |
| ⤷ASA(ALT) | 2009-06-30T20:13:18.000Z |
| ⤷Collagen alpha-1(IV) chain | 2009-06-30T19:58:34.000Z |
| ⤷Alcazar(band) | 2009-06-30T13:01:38.000Z |
| ⤷NH2(CH2)5NH2 | 2009-06-30T12:47:59.000Z |
| ⤷CH(CH3)3 | 2009-06-30T10:42:47.000Z |
| ⤷Chloro-(chloromethoxy)methane | 2009-06-29T20:30:08.000Z |
| ⤷3a-Hydroxymethyl-1-isopropenyl-5a,5b,8,8,11a-pentamethyl-icosahydro-cyclopenta(a)chrysen-9-ol | 2009-06-29T20:10:14.000Z |
| ⤷C6H2(OH)(CH3)(C(CH3)3)2 | 2009-06-29T20:05:41.000Z |
| ⤷C6H5CHCHC(O)CH3 | 2009-06-29T19:56:13.000Z |
| ⤷C6H5CH2N(CH3)2 | 2009-06-29T19:48:24.000Z |
| ⤷Rob Shaw(film) | 2009-06-29T19:17:35.000Z |
| ⤷HO2CCH(NH2)CH2CO2H | 2009-06-29T16:20:15.000Z |
| ⤷S2(CH2)2CHCO2H | 2009-06-29T16:16:45.000Z |
| ⤷C6H4(NH2)COOH | 2009-06-29T15:56:47.000Z |
| ⤷CH3(CH2)4ONO2 | 2009-06-29T15:41:35.000Z |
| ⤷CH3CH(NH2)COOH | 2009-06-29T14:56:28.000Z |
| ⤷(CH2)4(CN)2 | 2009-06-29T14:48:08.000Z |
| ⤷(CH2)4(CO2H)2 | 2009-06-29T14:47:36.000Z |
| ⤷Bhavanisagar (SC)(State Assembly Constituency) | 2009-06-29T12:48:57.000Z |
| ⤷Jayamkondam(State Assembly Constituency) | 2009-06-29T12:43:12.000Z |
| ⤷All Roads Lead to You(single) | 2009-06-29T11:48:01.000Z |
| ⤷C6H5NH(COCH3) | 2009-06-29T09:44:37.000Z |
| Poly(dichlorophosphazene) | 2009-06-28T22:01:49.000Z |
| ⤷Total World Domination(album) | 2009-06-28T21:59:24.000Z |
| ⤷NH4(Cr(ScN)4(NH3)2) | 2009-06-28T16:46:19.000Z |
| ⤷Zr(OH)4 | 2009-06-28T16:38:05.000Z |
| ⤷Zn(CN)2 | 2009-06-28T16:34:02.000Z |
| ⤷Xe(PtF6) | 2009-06-28T16:16:47.000Z |
| ⤷UO2(NO3)2 | 2009-06-28T16:07:53.000Z |
| ⤷(Cu(NH3)4)SO4 | 2009-06-28T15:55:59.000Z |
| ⤷Na4Fe(CN)6 | 2009-06-28T15:23:50.000Z |
| ⤷(SiOx(OH)4-2x)n | 2009-06-28T15:20:55.000Z |
| ⤷Sc(NO3)3 | 2009-06-28T15:16:56.000Z |
| ⤷Sc(OSO2CF3)3 | 2009-06-28T15:15:19.000Z |
| ⤷Fe4(Fe(CN)6)3 | 2009-06-28T15:11:04.000Z |
| ⤷K3(Fe(C2O4)3) | 2009-06-28T15:07:13.000Z |
| ⤷K2SO4.Al2(SO4)3·24H2O | 2009-06-28T15:05:05.000Z |
| ⤷Phosphoric(III) acid | 2009-06-28T14:56:51.000Z |
| ⤷Pd(NO3)2 | 2009-06-28T14:48:56.000Z |
| ⤷K2(HgI4) | 2009-06-28T14:43:53.000Z |
| ⤷Hg(ONC)2 | 2009-06-28T14:34:03.000Z |
| ⤷Pb(SO4) | 2009-06-28T14:25:16.000Z |
| ⤷Pb(CO3) | 2009-06-28T14:23:14.000Z |
| ⤷La2(CO3)3 | 2009-06-28T14:22:29.000Z |
| ⤷Fe(NO3)3(H2O)9 | 2009-06-28T14:20:49.000Z |
| ⤷FSO2(OH) | 2009-06-28T14:02:42.000Z |
| ⤷C3cl3K2SO4Cr2(SO4)3.24H2O | 2009-06-28T13:54:47.000Z |
| ⤷Cis-platinum(II) chloride diammine | 2009-06-28T13:49:53.000Z |
| ⤷PtCl2(NH3)2 | 2009-06-28T13:48:51.000Z |
| ⤷Cd(NO3)2 | 2009-06-28T13:35:21.000Z |
| ⤷(NH4)2Ce(NO3)6 | 2009-06-28T12:49:02.000Z |
| ⤷Al(NO3)3 | 2009-06-28T12:46:56.000Z |
| ⤷Dharapuram (SC)(State Assembly Constituency) | 2009-06-28T00:08:57.000Z |
| ⤷Sanjay Gupta(Raj Comics) | 2009-06-26T14:09:04.000Z |
| ⤷HMS Princess(1905) | 2009-06-24T21:58:01.000Z |
| ⤷Zr(WO4)2 | 2009-06-24T17:00:35.000Z |
| ⤷Papanasam(Tirunelveli) | 2009-06-24T14:59:45.000Z |
| ⤷Mya And Friends Presents...Best Of Both Worlds(Mýa album) | 2009-06-23T12:29:31.000Z |
| ⤷Rajendranagar(Assembly constituency) | 2009-06-22T22:42:19.000Z |
| ⤷Treaty of Amiens(1423) | 2009-06-21T14:46:01.000Z |
| ⤷Graniteville(Waterford) | 2009-06-21T13:56:24.000Z |
| ⤷Sr(NO3)2 | 2009-06-21T11:39:01.000Z |
| ⤷Wang Qiang(Fighter) | 2009-06-21T04:36:41.000Z |
| ⤷Yongkang City(China) | 2009-06-19T14:03:41.000Z |
| ⤷S(q) | 2009-06-18T07:59:28.000Z |
| ⤷(RhCl(cod))2 | 2009-06-18T05:55:38.000Z |
| ⤷Fe2(CO)9 | 2009-06-18T02:16:32.000Z |
| ⤷Hg(SCN)2 | 2009-06-17T23:20:45.000Z |
| ⤷Operation Creature Feature(video game) | 2009-06-17T23:12:32.000Z |
| ⤷Digger(PlayStation 3) | 2009-06-17T23:04:16.000Z |
| ⤷USS LSM(R)-524 | 2009-06-17T14:08:44.000Z |
| ⤷1-(3-Chlorophenyl)piperazine | 2009-06-15T22:59:46.000Z |
| ⤷Shi'a view of ali ameer ul momeneen(as) | 2009-06-15T12:55:14.000Z |
| ⤷Shi'a view of al mahdi(as) | 2009-06-15T12:50:50.000Z |
| ⤷Karanji kannada Movie(2009) | 2009-06-15T09:44:35.000Z |
| ⤷Askania-Nova(settlement) | 2009-06-13T17:56:51.000Z |
| ⤷Osmium(IV) oxide | 2009-06-13T09:46:07.000Z |
| ⤷Carlos Reyes(Uruguay) | 2009-06-12T14:11:37.000Z |
| ⤷Pd(dba)2 | 2009-06-12T05:26:38.000Z |
| ⤷Smash Cars(PlayStation 3) | 2009-06-11T17:48:17.000Z |
| ⤷Prod() | 2009-06-11T13:50:30.000Z |
| ⤷Sum() | 2009-06-11T13:36:33.000Z |
| ⤷Passenger(2009 film) | 2009-06-09T22:47:38.000Z |
| ⤷2nd Asian Para Games(2014 Asian Para Games) | 2009-06-07T13:29:16.000Z |
| ⤷1st Asian Para Games(2010 Asian Para Games) | 2009-06-07T09:35:24.000Z |
| ⤷Frank Phillips(golfer) | 2009-06-07T09:09:05.000Z |
| ⤷FFG(X) | 2009-06-07T05:45:30.000Z |
| ⤷Piggy D.(guitarist) | 2009-06-06T16:36:55.000Z |
| ⤷The Pope Must Die(t) | 2009-06-06T01:45:32.000Z |
| ⤷RAF Volunteer Reserve(Training) | 2009-06-05T18:00:07.000Z |
| ⤷Fortis holding(finance) | 2009-06-05T16:04:24.000Z |
| ⤷Dancing Under Streetlights(The Brains album) | 2009-06-05T03:21:57.000Z |
| Europium(III) oxide | 2009-06-04T03:18:10.000Z |
| ⤷Nocturnes(Chopin) | 2009-06-04T02:13:44.000Z |
| ⤷Jamal Malik(Slumdog Millionaire Character) | 2009-06-04T02:00:23.000Z |
| ⤷Bismuth(V) fluoride | 2009-06-04T01:15:58.000Z |
| ⤷Savadi(ron) | 2009-06-03T23:33:50.000Z |
| ⤷Ahmed Yusuf(Gobroon) | 2009-06-03T14:57:34.000Z |
| ⤷青(single) | 2009-06-03T00:15:06.000Z |
| ⤷Litti(cuisine) | 2009-06-02T23:39:09.000Z |
| ⤷Six Suspects(novel) | 2009-06-02T18:49:29.000Z |
| ⤷Suiren(song) | 2009-05-31T21:58:49.000Z |
| ⤷Brown's Requiem(novel) | 2009-05-31T11:45:05.000Z |
| ⤷Dr. Emilio B. Espinosa Sr. Memorial State College of Agriculture and Technology(DEBESMSCAT) | 2009-05-31T07:46:16.000Z |
| Aluminium(I) oxide | 2009-05-31T07:23:44.000Z |
| Aluminium(II) oxide | 2009-05-31T06:37:23.000Z |
| ⤷Shinji Takahashi(baseball) | 2009-05-31T01:29:18.000Z |
| ⤷If It Ain't One Thing, It's Another(Richard "Dimples" Fields song) | 2009-05-30T22:48:31.000Z |
| ⤷Shoeshine Boy(song) | 2009-05-30T22:25:24.000Z |
| ⤷Ujjain Public School(UPS) | 2009-05-30T08:27:50.000Z |
| ⤷Flagman(Game & Watch) | 2009-05-30T02:51:45.000Z |
| ⤷Institut Pendidikan Guru Malaysia, Kampus Kota Bharu(IPGM Kampus KB) | 2009-05-29T11:57:07.000Z |
| ⤷Pb(OH)2 | 2009-05-29T01:35:16.000Z |
| ⤷Luz y Sombra(album) | 2009-05-29T01:05:04.000Z |
| ⤷N(G)-monomethyl-L-arginine | 2009-05-28T20:09:42.000Z |
| ⤷Puthalapattu (SC)(Assembly constituency) | 2009-05-28T15:31:32.000Z |
| ⤷Quthbullapur(Assembly constituency) | 2009-05-28T15:31:21.000Z |
| ⤷Palamaner(Assembly constituency) | 2009-05-28T15:31:09.000Z |
| ⤷Kuppam(Assembly constituency) | 2009-05-28T15:23:41.000Z |
| ⤷Indian Institute of Space Science and Technology, Ponmudi(Trivandrum) | 2009-05-27T16:22:36.000Z |
| ⤷Ep(mono band) | 2009-05-27T10:44:38.000Z |
| ⤷Mono band(album) | 2009-05-27T10:09:14.000Z |
| ⤷Poly(2,6-dimethylphenylene oxide) | 2009-05-27T07:09:52.000Z |
| ⤷1,2-bis(dimethylphosphino)ethane | 2009-05-26T23:37:10.000Z |
| ⤷Corporate 2(film) | 2009-05-26T22:15:37.000Z |
| Nitrosonium octafluoroxenate(VI) | 2009-05-26T17:39:21.000Z |
| ⤷HCO(3)(-) | 2009-05-25T19:16:23.000Z |
| ⤷Behind the Garden - Behind the Wall - Under the Tree(album) | 2009-05-25T14:35:27.000Z |
| ⤷Vila(Emina Jahovic album) | 2009-05-25T07:37:29.000Z |
| ⤷Cis-diamminedichloroplatinum(II) | 2009-05-24T22:32:01.000Z |
| ⤷1,25(OH)2D3 | 2009-05-24T22:03:19.000Z |
| ⤷Bhatti(Rajpoot) | 2009-05-24T10:12:59.000Z |
| ⤷Chittoor(Assembly constituency) | 2009-05-24T04:48:06.000Z |
| ⤷Waverly Hills 9-0-2-1-(Annoyed Grunt) | 2009-05-24T02:15:02.000Z |
| ⤷K(+) | 2009-05-23T23:11:56.000Z |
| ⤷Na(+) | 2009-05-23T23:11:20.000Z |
| ⤷Ca(2+) | 2009-05-23T23:09:41.000Z |
| ⤷Prostaglandin E(2) | 2009-05-23T22:56:48.000Z |
| ⤷JSDLP(PZ) | 2009-05-22T22:25:45.000Z |
| ⤷JCP(PZ) | 2009-05-22T19:37:32.000Z |
| ⤷Apartment(film) | 2009-05-22T11:25:10.000Z |
| ⤷Coin(department store) | 2009-05-21T20:25:28.000Z |
| ⤷N(G)-nitro-L-arginine | 2009-05-21T17:35:39.000Z |
| ⤷Jeong Myeong(-)hun | 2009-05-21T14:14:47.000Z |
| ⤷Poly(ADP-ribose) polymerase-1 | 2009-05-21T06:14:27.000Z |
| ⤷Fantastic Voyage(Lakeside song) | 2009-05-21T03:42:15.000Z |
| ⤷Give Me The Night(George Benson song) | 2009-05-21T00:38:26.000Z |
| ⤷I.Q(series) | 2009-05-20T21:50:29.000Z |
| ⤷Special Lady(Ray, Goodman & Brown song) | 2009-05-20T21:12:55.000Z |
| ⤷William B. Turner(Medal of Honor) | 2009-05-20T17:25:10.000Z |
| ⤷Fast InvSqrt() | 2009-05-19T13:14:16.000Z |
| L(a | 2009-05-18T22:36:54.000Z |
| ⤷Critter Crunch(PlayStation 3) | 2009-05-18T17:40:27.000Z |
| ⤷The Power(of Bhangra) | 2009-05-18T17:01:23.000Z |
| ⤷2009 influenza A(H1N1) outbreak | 2009-05-18T03:30:30.000Z |
| ⤷287(g) program | 2009-05-17T23:26:23.000Z |
| ⤷Shatter(video games) | 2009-05-17T02:57:29.000Z |
| ⤷Dear(Shion Miyawaki) | 2009-05-16T18:49:27.000Z |
| ⤷2009 A(H1N1) | 2009-05-16T15:02:31.000Z |
| ⤷Mind the gap(album) | 2009-05-16T11:13:49.000Z |
| ⤷Gábor Nagy(born in 1985) | 2009-05-16T09:33:29.000Z |
| ⤷The Art(e) Of Romance | 2009-05-16T02:02:12.000Z |
| ⤷Sport-Auto(french) | 2009-05-14T21:39:26.000Z |
| ⤷Panzerkampfwagen 35(t) | 2009-05-14T19:47:01.000Z |
| ⤷BOY(Shion Miyawaki) | 2009-05-14T08:47:50.000Z |
| 1,2-Bis(dimethylphosphino)ethane | 2009-05-12T20:42:07.000Z |
| ⤷Naheere(Syriac Orhtodox) | 2009-05-12T08:54:55.000Z |
| ⤷Sandakoli(2005 film) | 2009-05-11T09:59:30.000Z |
| ⤷Diethylenetriamine penta(methylene phosphonic acid) | 2009-05-11T07:18:43.000Z |
| ⤷Ethylenediamine tetra(methylene phosphonic acid) | 2009-05-11T07:02:37.000Z |
| ⤷Songs of Life(1992 album) | 2009-05-11T02:57:08.000Z |
| ⤷Rasta Got Soul(album) | 2009-05-09T16:15:41.000Z |
| ⤷(benzene)-chromium(0) tricarbonyl | 2009-05-07T22:24:12.000Z |
| ⤷2009 Influenza A(H1N1) Outbreak | 2009-05-07T20:55:59.000Z |
| ⤷Dichlorobis(ethylenediamine)cobalt (III) chloride | 2009-05-07T01:39:19.000Z |
| ⤷2009 Influenza A(H1N1) outbreak | 2009-05-06T20:44:51.000Z |
| Tetrakis(acetonitrile)copper(I) hexafluorophosphate | 2009-05-06T17:17:29.000Z |
| ⤷Scandium(III) triflate | 2009-05-06T12:16:54.000Z |
| ⤷National Institute of Bank Management(NIBM) | 2009-05-06T09:49:46.000Z |
| ⤷Special Service(The Twilight Zone) | 2009-05-06T00:25:19.000Z |
| ⤷Rahue River(Bío-Bío) | 2009-05-05T21:32:55.000Z |
| Cis-Dichlorobis(ethylenediamine)cobalt(III) chloride | 2009-05-05T20:24:11.000Z |
| ⤷Tangerine Dream(album) | 2009-05-05T02:09:37.000Z |
| ⤷John Egan(Hurler) | 2009-05-03T03:17:59.000Z |
| ⤷CpCo(CO)2 | 2009-05-03T03:15:51.000Z |
| ⤷Chinese language(s) | 2009-05-02T11:12:28.000Z |
| ⤷CpRu(PPh3)2Cl | 2009-05-01T17:22:33.000Z |
| ⤷Niobium(IV) Chloride | 2009-05-01T15:55:15.000Z |
| ⤷Swine-Origin Influenza A(H1N1) | 2009-05-01T13:00:31.000Z |
| ⤷Swine-origin influenza A(H1N1) | 2009-05-01T12:59:21.000Z |
| ⤷Turn Right(Jonas Brothers song) | 2009-05-01T09:30:58.000Z |
| ⤷Hey Baby(Jonas Brothers song) | 2009-05-01T09:27:38.000Z |
| Niobium(IV) chloride | 2009-05-01T03:45:27.000Z |
| Manganese(II) acetate | 2009-05-01T01:31:53.000Z |
| ⤷Rhodium(II) oxide | 2009-05-01T00:33:17.000Z |
| ⤷Paul child(actor) | 2009-05-01T00:10:02.000Z |
| ⤷Ayna(Group) | 2009-04-30T23:56:12.000Z |
| Cobalt(II) cyanide | 2009-04-30T23:16:18.000Z |
| ⤷Influenza A(H1N1) | 2009-04-30T19:05:25.000Z |
| ⤷List of Speakers of the Shura Council(Egypt) | 2009-04-30T15:40:12.000Z |
| ⤷Keith Anderson(Australian politician) | 2009-04-30T14:43:03.000Z |
| Rhodium(IV) oxide | 2009-04-30T07:45:54.000Z |
| Chloro(cyclopentadienyl)bis(triphenylphosphine)ruthenium | 2009-04-30T02:29:51.000Z |
| ⤷A(H1N1) | 2009-04-30T00:01:11.000Z |
| ⤷Speed racer(movie) | 2009-04-29T10:40:15.000Z |
| ⤷Machakhlistskal(i) | 2009-04-27T14:43:07.000Z |
| ⤷CAUSA(Compania Aeronáutica Uruguaya S.A.) | 2009-04-27T10:37:25.000Z |
| ⤷NAD(P)H dehydrogenase | 2009-04-27T10:10:29.000Z |
| ⤷Army Aviation Corps(India) | 2009-04-26T16:32:12.000Z |
| ⤷Falling In Love(McFly Song) | 2009-04-26T00:02:51.000Z |
| ⤷Ca3(P04)2 | 2009-04-25T20:04:28.000Z |
| ⤷Uttara Foods and Feeds(company) | 2009-04-25T18:20:05.000Z |
| ⤷Tom Cronin(hurler) | 2009-04-24T20:42:16.000Z |
| ⤷Prof(Dr)P. K. Pokker | 2009-04-23T12:32:05.000Z |
| ⤷Dr.H.Srinivasan M.B.B.S., F.R.C.S (Lond)., F.R.C.S.(Eng). | 2009-04-22T23:52:55.000Z |
| ⤷Mocoví(tribe) | 2009-04-22T17:43:44.000Z |
| ⤷Cranberry Lake,(Nova Scotia) | 2009-04-22T12:50:25.000Z |
| 1-Ethyl-3-(3-dimethylaminopropyl)carbodiimide | 2009-04-22T01:41:18.000Z |
| ⤷SS John B. Cowle(1902) | 2009-04-21T19:21:22.000Z |
| ⤷National Highway 21A (India)(old numbering) | 2009-04-21T13:45:00.000Z |
| ⤷National Highway 54A (India)(old numbering) | 2009-04-20T18:06:59.000Z |
| ⤷Friends(Season 1) | 2009-04-20T13:22:07.000Z |
| ⤷Mydukur(Assembly constituency) | 2009-04-20T09:51:23.000Z |
| ⤷Riot!(album) | 2009-04-20T02:24:11.000Z |
| ⤷All We Know Is Falling(album) | 2009-04-20T02:18:16.000Z |
| ⤷2-(3,4-dihydroxy-5-methoxyphenyl)-3,5,7-trihydroxychromenylium | 2009-04-19T10:45:48.000Z |
| ⤷National Highway 214A (India)(old numbering) | 2009-04-18T19:25:31.000Z |
| ⤷4-(p-methylphenyl)-4-oxobutanoic acid | 2009-04-18T02:33:19.000Z |
| ⤷4-(4-Methylphenyl)-4-oxobutyric acid | 2009-04-18T01:22:24.000Z |
| ⤷3-(p-Toluoyl)propionic acid | 2009-04-18T01:21:08.000Z |
| ⤷3-(4-Methylbenzoyl)propionic Acid | 2009-04-18T01:19:47.000Z |
| ⤷National Highway 71B (India)(old numbering) | 2009-04-17T20:03:41.000Z |
| ⤷National Highway 71A (India)(old numbering) | 2009-04-17T20:01:54.000Z |
| ⤷Dr.No(FILM) | 2009-04-17T18:57:06.000Z |
| ⤷Andhra Pradesh(state assembly elections) | 2009-04-17T17:50:21.000Z |
| ⤷National Highway 25A (India)(Old Numbering) | 2009-04-17T16:26:27.000Z |
| 4-(4-Methylphenyl)-4-oxobutanoic acid | 2009-04-17T15:24:08.000Z |
| ⤷National Highway 17B (India)(old numbering) | 2009-04-17T13:46:27.000Z |
| ⤷National Highway 17A (India)(old Numbering) | 2009-04-17T13:46:19.000Z |
| ⤷National Highway 8E (India)(old numbering) | 2009-04-17T13:34:29.000Z |
| ⤷National Highway 8D (India)(old numbering) | 2009-04-17T13:34:21.000Z |
| ⤷Ahmednagar City(Maharashtra Assembly constituency) | 2009-04-17T09:54:29.000Z |
| ⤷Dear...(Tenjochiki's Album) | 2009-04-15T16:01:30.000Z |
| ⤷National Highway 8C (India)(Old Numbering) | 2009-04-15T13:09:54.000Z |
| ⤷National Highway 8A (India)(old numbering) | 2009-04-15T12:38:56.000Z |
| ⤷The Family(Omega Man) | 2009-04-15T00:24:32.000Z |
| ⤷Allison McKenzie(Actress) | 2009-04-14T03:33:31.000Z |
| ⤷Art. 100(b) EPC | 2009-04-13T07:46:54.000Z |
| ⤷Article 100(b) EPC | 2009-04-13T07:46:01.000Z |
| ⤷Lioness EP(Lioness album) | 2009-04-13T01:23:41.000Z |
| ⤷Mazda RX-7 Type RS/FD Type 5/6(FD3S) | 2009-04-12T11:36:23.000Z |
| ⤷3-chloro-6-(2-diethylamino-ethoxy)-10-(2-diethylamino-ethyl)-acridone | 2009-04-12T04:12:03.000Z |
| ⤷Swami(marathi novel) | 2009-04-11T16:10:30.000Z |
| ⤷Dr.H.Srinivasan M.B.Bs., F.R.C.S (Lond)., F.R.C.S.(Eng). | 2009-04-10T05:33:39.000Z |
| ⤷EPCP(M-L) | 2009-04-09T16:40:59.000Z |
| ⤷David Kirke(DSC) | 2009-04-09T14:08:16.000Z |
| ⤷3-Chloro-6-(2-diethylamino-ethoxy)-10-(2-diethylamino-ethyl)-acridone | 2009-04-09T06:22:59.000Z |
| ⤷Saw(Game) | 2009-04-08T22:05:26.000Z |
| ⤷Mascara(CSI: Episode) | 2009-04-08T21:31:30.000Z |
| ⤷T(11;14) | 2009-04-08T16:25:40.000Z |
| T(11:14) | 2009-04-08T16:25:26.000Z |
| ⤷T(9;22) | 2009-04-08T16:23:54.000Z |
| ⤷Musudan(Missile) | 2009-04-07T04:44:43.000Z |
| ⤷Alan Johnson(baseball) | 2009-04-07T02:05:28.000Z |
| ⤷Frontière(s) | 2009-04-06T21:44:19.000Z |
| ⤷Frontiere(s) | 2009-04-06T21:43:40.000Z |
| ⤷Ayya-2005(kannada) | 2009-04-05T16:00:07.000Z |
| ⤷C6H4(OH)COOH | 2009-04-05T11:39:33.000Z |
| ⤷Silver(I) selenite | 2009-04-05T01:23:25.000Z |
| ⤷Melrose(TV Series) | 2009-04-04T19:48:27.000Z |
| ⤷Reg District(Helmand) | 2009-04-04T15:57:25.000Z |
| Niobium(V) bromide | 2009-04-04T02:38:18.000Z |
| ⤷Grzywna(money) | 2009-04-02T20:54:42.000Z |
| ⤷(-)-2β-(3-(4-methylphenyl)isoxazol-5-yl)-3β-(4-chlorophenyl)tropane | 2009-04-02T12:48:58.000Z |
| ⤷(-)-2β-(1,2,4-oxadiazol-5-methyl)-3β-phenyltropane | 2009-04-02T12:48:20.000Z |
| ⤷Mathadhaana(film) | 2009-04-02T08:36:34.000Z |
| ⤷Lieutenant General Hamid Nawaz Khan, HI(M) | 2009-04-02T06:59:41.000Z |
| ⤷Kevin Burns(Mayor) | 2009-04-02T01:23:15.000Z |
| ⤷Team Vodafone(V8 Supercars) | 2009-04-01T22:50:39.000Z |
| ⤷Mary Crawford(Mansfield Park) | 2009-04-01T22:13:41.000Z |
| ⤷Get the Picture(1965 album) | 2009-04-01T03:44:10.000Z |
| ⤷Perumthachan(Film) | 2009-03-31T23:08:39.000Z |
| ⤷Tungi(Biharsharif) | 2009-03-31T14:40:15.000Z |
| ⤷Jeghatoo(Waeez Shahid) District | 2009-03-31T12:17:21.000Z |
| ⤷Murtaugh(How I Met Your Mother) | 2009-03-31T02:06:06.000Z |
| ⤷Rajapura(Kamboja) | 2009-03-29T20:12:43.000Z |
| ⤷Canyon(Novel) | 2009-03-28T20:59:55.000Z |
| ⤷Co(OH)2 | 2009-03-28T04:04:56.000Z |
| Cobalt(II) hydroxide | 2009-03-28T03:13:38.000Z |
| ⤷Liverpool Cult Classics Unearthed - Volume Two(CD) | 2009-03-27T18:23:07.000Z |
| ⤷Touchstone(band) | 2009-03-27T17:00:17.000Z |
| ⤷National Highway 37A (India)(old numbering) | 2009-03-26T17:39:58.000Z |
| ⤷Phenomenon(song) | 2009-03-26T03:03:00.000Z |
| ⤷Iron(III) sulphate | 2009-03-25T22:13:44.000Z |
| ⤷Greatest Hits, Vol. 2(Kenny Chesney album) | 2009-03-25T20:57:17.000Z |
| ⤷National Highway 5A (India)(Old Numbering) | 2009-03-24T18:27:19.000Z |
| ⤷MahaRaja's Boys' High School(M.R.B.H. School) | 2009-03-23T21:45:26.000Z |
| ⤷National Highway 4A (India)(Old Numbering) | 2009-03-23T19:02:31.000Z |
| ⤷National Highway 4B (India)(Old Numbering) | 2009-03-23T18:44:43.000Z |
| ⤷Thermal energy(conductivity) analyzer/detector | 2009-03-23T16:27:50.000Z |
| ⤷Many, Many Monkeys(The Twilight Zone) | 2009-03-22T22:27:08.000Z |
| ⤷5(FIVE) | 2009-03-22T07:48:52.000Z |
| ⤷KP(b)LiB | 2009-03-21T16:42:00.000Z |
| ⤷Y(4140) particle | 2009-03-21T14:33:16.000Z |
| Y(4140) | 2009-03-21T01:35:41.000Z |
| ⤷Hurricane One(1851) | 2009-03-21T01:20:31.000Z |
| ⤷Na(OH) | 2009-03-20T20:40:22.000Z |
| ⤷National Highway 228 (India)(old numbering) | 2009-03-20T12:53:44.000Z |
| ⤷National Highway 218 (India)(old numbering) | 2009-03-20T12:52:52.000Z |
| ⤷National Highway 216 (India)(old numbering) | 2009-03-20T12:52:37.000Z |
| ⤷National Highway 214 (India)(old numbering) | 2009-03-20T12:52:23.000Z |
| ⤷National Highway 207 (India)(Old Numbering) | 2009-03-20T12:52:11.000Z |
| ⤷National Highway 152 (India)(Old Numbering) | 2009-03-20T12:51:32.000Z |
| ⤷National Highway 125 (India)(Old Numbering) | 2009-03-20T12:46:06.000Z |
| ⤷National Highway 123 (India)(old numbering) | 2009-03-20T12:45:41.000Z |
| ⤷National Highway 121 (India)(old numbering) | 2009-03-20T12:45:18.000Z |
| ⤷National Highway 119 (India)(Old Numbering) | 2009-03-20T12:44:48.000Z |
| ⤷National Highway 113 (India)(old numbering) | 2009-03-20T12:43:46.000Z |
| ⤷National Highway 109 (India)(old numbering) | 2009-03-20T12:43:00.000Z |
| ⤷National Highway 104 (India)(Old Numbering) | 2009-03-20T12:41:59.000Z |
| ⤷National Highway 101 (India)(Old Numbering) | 2009-03-20T12:41:24.000Z |
| ⤷National Highway 92 (India)(old numbering) | 2009-03-20T12:40:35.000Z |
| ⤷National Highway 88 (India)(old numbering) | 2009-03-20T12:39:50.000Z |
| ⤷National Highway 85 (India)(old numbering) | 2009-03-20T12:39:37.000Z |
| ⤷National Highway 84 (India)(Old Numbering) | 2009-03-20T12:39:25.000Z |
| ⤷National Highway 79 (India)(old numbering) | 2009-03-20T12:39:09.000Z |
| ⤷National Highway 78 (India)(old numbering) | 2009-03-20T12:38:57.000Z |
| ⤷National Highway 73 (India)(old numbering) | 2009-03-20T12:38:39.000Z |
| ⤷National Highway 65 (India)(old numbering) | 2009-03-20T12:37:54.000Z |
| ⤷National Highway 64 (India)(old numbering) | 2009-03-20T12:37:39.000Z |
| ⤷National Highway 54 (India)(old numbering) | 2009-03-20T12:37:01.000Z |
| ⤷National Highway 52 (India)(old numbering) | 2009-03-20T12:36:46.000Z |
| ⤷National Highway 51 (India)(old numbering) | 2009-03-20T12:36:19.000Z |
| ⤷CFEL-FM(1) | 2009-03-20T03:01:56.000Z |
| ⤷Black(Black album) | 2009-03-20T02:39:15.000Z |
| ⤷VMF(N)-543 | 2009-03-20T01:28:31.000Z |
| ⤷VF2004(1) | 2009-03-19T23:28:38.000Z |
| ⤷CPI(ML) New Initiative | 2009-03-19T15:35:29.000Z |
| ⤷CPI(ML) ND | 2009-03-19T15:33:56.000Z |
| Praseodymium(III) oxide | 2009-03-19T02:05:16.000Z |
| ⤷Imagination(album) | 2009-03-19T01:05:24.000Z |
| Neptunium(IV) oxide | 2009-03-19T01:02:51.000Z |
| ⤷Transition(R) | 2009-03-18T23:34:12.000Z |
| ⤷Transition(R) Roadable Aircraft Proof of Concept | 2009-03-18T23:16:25.000Z |
| ⤷National Highway 150 (India)(old numbering) | 2009-03-18T10:16:01.000Z |
| Neodymium(III) oxide | 2009-03-18T06:06:35.000Z |
| ⤷CKPT-FM(1) | 2009-03-18T04:55:38.000Z |
| ⤷Benzenamine, 3-(trifluoromethyl)- | 2009-03-17T13:35:09.000Z |
| ⤷ChinaCache(CDN) | 2009-03-17T00:25:29.000Z |
| ⤷PC(R) | 2009-03-16T21:10:05.000Z |
| ⤷FEC(m-l) | 2009-03-16T21:05:41.000Z |
| ⤷Tracy Strauss(Character) | 2009-03-16T20:45:17.000Z |
| ⤷CP(BSTI) | 2009-03-16T20:34:47.000Z |
| ⤷Harry Freedman(author) | 2009-03-16T19:28:52.000Z |
| ⤷Sehnsucht(Lacrimosa Album) | 2009-03-16T04:34:07.000Z |
| ⤷CPI(ML) 2nd CC | 2009-03-15T17:21:49.000Z |
| ⤷H(x) | 2009-03-15T12:31:13.000Z |
| ⤷G(x) | 2009-03-15T12:30:56.000Z |
| ⤷Φ(n) | 2009-03-15T12:30:16.000Z |
| ⤷Wish You Were Here(Grey's Anatomy) | 2009-03-14T23:27:27.000Z |
| ⤷501(c)3 status | 2009-03-14T07:19:59.000Z |
| ⤷National Highway 75 (India)(old numbering) | 2009-03-12T12:51:17.000Z |
| ⤷National Highway 155 (India)(Old Numbering) | 2009-03-12T11:53:24.000Z |
| ⤷JSD(Rab) | 2009-03-12T09:54:28.000Z |
| ⤷National Highway 98 (India)(old numbering) | 2009-03-12T02:15:24.000Z |
| ⤷CPN(UC-M) | 2009-03-11T17:50:35.000Z |
| ⤷CPB(M-L) | 2009-03-11T17:45:51.000Z |
| ⤷OCR(m-l) | 2009-03-11T16:15:24.000Z |
| ⤷National Highway 39 (India)(old numbering) | 2009-03-11T11:58:29.000Z |
| Potassium hexanitritocobaltate(III) | 2009-03-10T23:38:12.000Z |
| ⤷Cobalt(II) sulfide | 2009-03-10T22:43:42.000Z |
| PCP(M-L) | 2009-03-10T19:56:48.000Z |
| ⤷Chromium(III) potassium sulfate | 2009-03-10T15:37:08.000Z |
| ⤷N(6)-carboxymethyllysine | 2009-03-10T12:27:03.000Z |
| ⤷Reach(ESTK song) | 2009-03-10T03:51:33.000Z |
| ⤷Symmetric Key Management(Key Derivation and Key Wrap) | 2009-03-10T03:29:12.000Z |
| ⤷National Highway 44 (India)(old numbering) | 2009-03-09T19:19:30.000Z |
| Fasc(UK) | 2009-03-09T15:25:23.000Z |
| ⤷TI(M) | 2009-03-09T14:45:29.000Z |
| ⤷SI(M) | 2009-03-09T14:20:14.000Z |
| ⤷Ni(NO3)2 | 2009-03-09T09:55:38.000Z |
| ⤷Pete Williams(television correspondent) | 2009-03-09T06:35:21.000Z |
| ⤷Hotel for Dogs(film) | 2009-03-08T22:17:30.000Z |
| ⤷Mp41(r) | 2009-03-08T18:18:31.000Z |
| ⤷Tweaking(drug slang) | 2009-03-08T09:05:00.000Z |
| Potassium tetraperoxochromate(V) | 2009-03-07T22:56:07.000Z |
| ⤷Carlos Johnson(soccer) | 2009-03-06T07:49:01.000Z |
| ⤷Kallar(caste) | 2009-03-06T03:09:39.000Z |
| Beautiful Me(s): Finding Our Revolutionary Selves | 2009-03-06T00:30:59.000Z |
| ⤷No You Girls(song) | 2009-03-05T18:25:08.000Z |
| ⤷Otto Kerner Jr.(version 2) | 2009-03-05T02:24:11.000Z |
| ⤷Hangfire(firearms) | 2009-03-05T00:35:30.000Z |
| ⤷Dive Bomber(film) | 2009-03-04T06:17:24.000Z |
| ⤷Y=sin(1/x) | 2009-03-04T04:07:36.000Z |
| ⤷National Waterway III(India) | 2009-03-04T03:28:28.000Z |
| ⤷CJLX-FM(2) | 2009-03-03T02:05:29.000Z |
| ⤷C(M)PA | 2009-03-03T00:28:33.000Z |
| ⤷Last Hero(2001) | 2009-03-02T19:30:37.000Z |
| ⤷PSA(CP) | 2009-03-02T18:02:44.000Z |
| ⤷Atmospherics(Bass Communion album) | 2009-03-02T16:12:25.000Z |
| ⤷Y = sin(1/x) | 2009-03-01T19:23:57.000Z |
| ⤷501(c)3 organization | 2009-03-01T14:32:39.000Z |
| ⤷Bristol Mountain(NY) | 2009-02-27T07:58:33.000Z |
| Sexual Harassment Panda(character) | 2009-02-26T22:31:39.000Z |
| ⤷Sher Khan(Bengal) | 2009-02-26T21:00:36.000Z |
| ⤷2-(4-chlorphenoxy)-ethanol | 2009-02-26T19:27:41.000Z |
| ⤷Echoplex(Nine Inch Nails song) | 2009-02-26T19:06:46.000Z |
| ⤷Cobalt(III) hexammine chloride | 2009-02-26T16:24:26.000Z |
| ⤷Gandhar(city/kingdom) | 2009-02-26T14:15:35.000Z |
| ⤷PCE(r) | 2009-02-26T11:24:59.000Z |
| ⤷PCB(ML) | 2009-02-26T09:56:03.000Z |
| ⤷Gordon Smith(Psychic) | 2009-02-25T20:00:43.000Z |
| ⤷National Highway 36 (India)(old numbering) | 2009-02-25T18:20:41.000Z |
| ⤷Ruthenium(II) tris(bathophenanthroline disulfonate) | 2009-02-25T06:20:00.000Z |
| ⤷East End(Peak) | 2009-02-25T01:17:06.000Z |
| ⤷Kbhit() | 2009-02-24T21:31:40.000Z |
| ⤷Getche() | 2009-02-24T21:27:40.000Z |
| ⤷Getch() | 2009-02-24T21:25:25.000Z |
| ⤷National Highway 99 (India)(old numbering) | 2009-02-24T19:15:49.000Z |
| ⤷Tris(dibenzylideneacetone)dipalladium | 2009-02-24T15:47:59.000Z |
| ⤷Tetrakis(triphenylphosphine)platinum | 2009-02-24T15:46:23.000Z |
| ⤷Saor Ollscoil na hÉireann(Free University of Ireland) | 2009-02-24T07:41:54.000Z |
| ⤷Albright(-McCune)(-Sternberg) syndrome | 2009-02-24T03:33:12.000Z |
| ⤷EIK(ml) | 2009-02-23T22:14:23.000Z |
| ⤷National Highway 215 (India)(old numbering) | 2009-02-23T20:09:58.000Z |
| ⤷National Highway 224 (India)(old numbering) | 2009-02-23T19:53:58.000Z |
| ⤷National Highway 217 (India)(old numbering) | 2009-02-23T19:43:53.000Z |
| ⤷Manoel(football player) | 2009-02-23T05:02:45.000Z |
| ⤷Ancylite-(La) | 2009-02-23T03:51:04.000Z |
| ⤷Ancylite-(Ce) | 2009-02-23T03:50:50.000Z |
| ⤷A423(M) | 2009-02-22T23:25:42.000Z |
| ⤷A404(M) | 2009-02-22T22:45:17.000Z |
| ⤷SJP(R) | 2009-02-22T18:30:39.000Z |
| ⤷NTRTDP(LP) | 2009-02-22T17:41:56.000Z |
| ⤷LM(HP) | 2009-02-22T17:22:26.000Z |
| ⤷OBG(W) | 2009-02-22T07:16:59.000Z |
| ⤷National Highway 55 (India)(old numbering) | 2009-02-21T19:31:33.000Z |
| ⤷National Highway 41 (India)(Old Numbering) | 2009-02-21T18:18:04.000Z |
| ⤷National Highway 33 (India)(old numbering) | 2009-02-21T16:44:33.000Z |
| ⤷I Love You(Oriya film) | 2009-02-20T05:25:20.000Z |
| ⤷River Lake(Nova Scotia) | 2009-02-19T16:54:49.000Z |
| ⤷Javier Suárez(economist) | 2009-02-19T09:26:55.000Z |
| ⤷Cin.get() | 2009-02-18T21:31:50.000Z |
| ⤷Boli(steroid) | 2009-02-18T20:31:21.000Z |
| ⤷National Highway 32 (India)(old numbering) | 2009-02-18T11:40:20.000Z |
| ⤷Han Han(韓寒) | 2009-02-17T16:06:52.000Z |
| ⤷Spectacle Lake(Nova Scotia) | 2009-02-17T10:51:26.000Z |
| ⤷Chittaranjan high school(E/M) | 2009-02-17T08:00:42.000Z |
| ⤷Eden Log(film) | 2009-02-16T20:34:44.000Z |
| ⤷USD(I) | 2009-02-16T18:59:33.000Z |
| ⤷Dream Girl(2009 film) | 2009-02-16T15:46:29.000Z |
| ⤷National Highway 100 (India)(Old Numbering) | 2009-02-16T15:45:58.000Z |
| ISAD(G) | 2009-02-16T13:58:23.000Z |
| ⤷Phenylmercury(II) acetate | 2009-02-15T23:45:50.000Z |
| ⤷Powerlight(album) | 2009-02-15T15:12:36.000Z |
| ⤷National Highway 203 (India)(old numbering) | 2009-02-14T13:17:40.000Z |
| ⤷Java.lang.Object.clone() | 2009-02-14T02:14:20.000Z |
| ⤷Sascha ...(ein aufrechter Deutscher) | 2009-02-13T20:36:56.000Z |
| ⤷Praga(czech automobile maker) | 2009-02-13T11:46:19.000Z |
| ⤷National Highway 35 (India)(old numbering) | 2009-02-11T23:28:52.000Z |
| ⤷National Highway 34 (India)(old numbering) | 2009-02-11T14:59:31.000Z |
| ⤷National Highway 200 (India)(Old Numbering) | 2009-02-11T08:39:43.000Z |
| ⤷National Highway 201 (India)(Old Numbering) | 2009-02-11T08:11:11.000Z |
| ⤷Tin(II) selenide | 2009-02-10T15:55:17.000Z |
| ⤷Bright Eyes(Bright Eyes) | 2009-02-10T14:33:03.000Z |
| ⤷Lead(II) telluride | 2009-02-10T13:29:46.000Z |
| ⤷Lead(II) selenide | 2009-02-10T13:14:35.000Z |
| ⤷Tungsten(VI) oxide | 2009-02-10T12:24:22.000Z |
| ⤷Microtubule(s) | 2009-02-10T01:30:56.000Z |
| ⤷Lysosome(s) | 2009-02-10T01:14:12.000Z |
| ⤷Radio:Active(DVD) | 2009-02-09T17:13:48.000Z |
| ⤷Nasiruddin Mahmud Shah(Bengal) | 2009-02-09T12:29:56.000Z |
| ⤷Titanium(IV) silicide | 2009-02-09T11:48:46.000Z |
| ⤷Tantalum(III) nitride | 2009-02-09T11:23:49.000Z |
| ⤷Vanadium(II) nitride | 2009-02-09T11:19:46.000Z |
| ⤷Molybdenum(VI) oxide | 2009-02-08T22:40:31.000Z |
| ⤷Manganese(VII) oxide | 2009-02-08T22:18:05.000Z |
| ⤷Indium(III) antimonide | 2009-02-08T15:35:58.000Z |
| ⤷Indium(III) phosphide | 2009-02-08T15:22:10.000Z |
| ⤷Indium(III) nitride | 2009-02-08T15:03:53.000Z |
| ⤷4-(2,4-dichlorophenoxy)butyric acid | 2009-02-07T22:51:43.000Z |
| ⤷Mercury(II) telluride | 2009-02-07T19:15:07.000Z |
| ⤷Mercury(II) selenide | 2009-02-07T19:04:49.000Z |
| ⤷Jeghatoo(Waeez shahid) District | 2009-02-07T17:00:58.000Z |
| ⤷CHMY-FM-1(1) | 2009-02-07T15:17:29.000Z |
| ⤷Titanium(II) hydride | 2009-02-06T19:13:38.000Z |
| ⤷1-(2-hydroxyethyl)-2-hydroxymethyl-5-nitroimidazole | 2009-02-05T20:48:17.000Z |
| ⤷Dichloro(1,5-cyclooctadiene)platinum(II) | 2009-02-04T05:35:11.000Z |
| Dichloro(cycloocta-1,5-diene)platinum(II) | 2009-02-04T05:16:35.000Z |
| ⤷Myelodysplastic syndrome associated with isolated del(5q) chromosome abnormality | 2009-02-04T05:16:23.000Z |
| ⤷John Healy(Hurler) | 2009-02-03T21:16:18.000Z |
| ⤷Nakai(Japanese vocation) | 2009-02-03T20:01:37.000Z |
| ⤷3-phospho-(R)-glycerate | 2009-02-02T20:39:52.000Z |
| ⤷Tigran Martirosyan(tennis) | 2009-02-01T21:56:37.000Z |
| ⤷PIBI(D)S syndrome | 2009-01-31T16:55:41.000Z |
| ⤷PC(SFIC)RM | 2009-01-31T16:18:53.000Z |
| ⤷South african chamber for agricultural development(SACADA) | 2009-01-31T00:33:45.000Z |
| ⤷Crocodile Tears(novel) | 2009-01-29T21:11:45.000Z |
| ⤷C str() | 2009-01-29T10:22:54.000Z |
| ⤷Lalita(oriya film) | 2009-01-29T05:21:06.000Z |
| ⤷James Brady(columnist) | 2009-01-28T16:12:31.000Z |
| ⤷Ultimate Spinach(album) | 2009-01-28T15:51:31.000Z |
| ⤷Paris(Paris Hilton album) | 2009-01-27T23:50:51.000Z |
| ⤷List of number one hits of 2009(FIMI-italian Download chart) | 2009-01-27T20:59:16.000Z |
| ⤷It's Me...(Remix) | 2009-01-27T18:03:06.000Z |
| ⤷Gran Premio Jockey Club(Uruguay) | 2009-01-27T09:50:44.000Z |
| ⤷Check clearing(finance) | 2009-01-26T21:34:46.000Z |
| ⤷Robert E. Yates(politician) | 2009-01-26T21:25:41.000Z |
| ⤷Chowwannur(Village) | 2009-01-26T12:25:51.000Z |
| ⤷Sajid Khan(director) | 2009-01-26T09:54:54.000Z |
| ⤷PCP(R) | 2009-01-26T01:47:03.000Z |
| ⤷PCdelP(m-l) | 2009-01-26T00:36:18.000Z |
| ⤷PCP(BR) | 2009-01-25T23:33:10.000Z |
| ⤷Hard tail(guitar) | 2009-01-25T20:35:40.000Z |
| ⤷PC(ml)P | 2009-01-25T19:02:09.000Z |
| ⤷ORPC(ML) | 2009-01-25T17:24:56.000Z |
| ⤷Veneer(dentistry) | 2009-01-25T10:05:43.000Z |
| ⤷Dichlorobis(ethylenediamine)nickel II | 2009-01-25T06:34:59.000Z |
| ⤷Disconnected (Out of Touch)(Trapt song) | 2009-01-23T17:58:49.000Z |
| ⤷Violet(Seal song) | 2009-01-23T07:06:41.000Z |
| ⤷Adam Williams(Basketball Player) | 2009-01-23T05:13:06.000Z |
| ⤷Chr(0) | 2009-01-23T04:10:14.000Z |
| ⤷Hello Dollie(TV series) | 2009-01-22T13:08:23.000Z |
| ⤷Germanium(IV) sulfide | 2009-01-21T14:33:26.000Z |
| ⤷Gallium(III) phosphide | 2009-01-21T14:09:36.000Z |
| ⤷Gallium(III) nitride | 2009-01-21T14:03:59.000Z |
| ⤷Harlem Heights(TV series) | 2009-01-21T04:50:50.000Z |
| ⤷AAPL(NASDAQ) | 2009-01-20T20:29:46.000Z |
| ⤷Pb(SCN)2 | 2009-01-20T17:28:43.000Z |
| Lead(II) thiocyanate | 2009-01-20T14:21:03.000Z |
| ⤷XT(2) | 2009-01-20T09:00:58.000Z |
| ⤷All Power to the People(film) | 2009-01-20T07:39:13.000Z |
| ⤷Gábor Horváth (footballer)(born 1985) | 2009-01-20T03:34:03.000Z |
| ⤷For(N)ever | 2009-01-19T17:39:00.000Z |
| We Are One(concert) | 2009-01-19T07:32:28.000Z |
| ⤷Pt(CN)42- | 2009-01-18T20:15:17.000Z |
| ⤷The Story So Far...(Mostly Autumn album) | 2009-01-18T08:47:05.000Z |
| ⤷Energoatom(Russia) | 2009-01-17T14:01:47.000Z |
| ⤷Energoatom(Ukraine) | 2009-01-17T13:59:59.000Z |
| ⤷Ruthenium tris(bipyridine) dichloride | 2009-01-17T12:08:00.000Z |
| ⤷Patrick Moran(Irish Republican) | 2009-01-17T09:39:36.000Z |
| ⤷Hannah Smith(1897-1960) | 2009-01-17T00:33:45.000Z |
| ⤷Dear...(Fukada Kyoko) | 2009-01-16T19:18:18.000Z |
| ⤷Orphans(song) | 2009-01-16T16:50:49.000Z |
| Al Said(yacht) | 2009-01-16T15:43:58.000Z |
| ⤷Two Weeks(All That Remains song) | 2009-01-16T04:50:46.000Z |
| ⤷Sirivennala Seetha Rama Sastry(Poet and Lyricist) | 2009-01-15T12:18:30.000Z |
| ⤷3,3'-Dithiobis(6-nitrobenzoic acid) | 2009-01-15T04:41:06.000Z |
| ⤷Purin-6(1H)-one | 2009-01-15T04:09:22.000Z |
| ⤷Rodrigo Prieto(soccer) | 2009-01-14T23:55:36.000Z |
| ⤷Enur(Group) | 2009-01-14T21:24:44.000Z |
| ⤷Tungsten(VI) fluoride | 2009-01-11T21:28:33.000Z |
| ⤷H.1(Isle of Man Railway) | 2009-01-11T21:21:16.000Z |
| ⤷New Moon(film) | 2009-01-11T20:22:26.000Z |
| ⤷CKUE-FM-1(2) | 2009-01-10T22:52:35.000Z |
∑ 1000 items on this page | Query runtime: 5.35 s | Last updated: 4 February 2024 22:26 (UTC) << Previous page || Next page >>