Laninamivir
 |
| Systematic (IUPAC) name |
| (4S,5R,6R)-5-acetamido-4-carbamimidamido-6-[(1R,2R)-3-hydroxy-2-methoxypropyl]-5,6-dihydro-4H-pyran-2-carboxylic acid |
| Clinical data |
| Pregnancy cat. |
? |
| Legal status |
? |
| Routes |
Inhalation |
| Identifiers |
| CAS number |
203120-17-6 N |
| ATC code |
None |
| PubChem |
CID 502272 |
| ChemSpider |
439182 Y |
| UNII |
B408IW3GL5 Y |
| ChEMBL |
CHEMBL466246 Y |
| Chemical data |
| Formula |
C13H22N4O7 |
| Mol. mass |
346.33638 g/mol |
| SMILES |
eMolecules & PubChem |
-
InChI=1S/C13H22N4O7/c1-5(19)16-9-6(17-13(14)15)3-8(12(21)22)24-11(9)10(23-2)7(20)4-18/h3,6-7,9-11,18,20H,4H2,1-2H3,(H,16,19)(H,21,22)(H4,14,15,17)/t6-,7+,9+,10+,11+/m0/s1 Y
Key:QNRRHYPPQFELSF-CNYIRLTGSA-N Y
|
N (what is this?) (verify)
|
Laninamivir (CS-8958) is a neuraminidase inhibitor which is being researched for the treatment and prophylaxis of Influenzavirus A and Influenzavirus B.[1] It is currently in Phase III clinical trials. [2]
Laninamivir was approved for influenza treatment in Japan in 2010 and is currently marketed under the name "Inavir" by Daiichi Sankyo. Biota Holdings Ltd and Daiichi Sankyo co-own Laninamivir. On 1st April 2011, BARDA awarded up to an estimated U$231m to Biota Holdings Ltd's wholly owned subsidiary, Biota Scientific Management Pty Ltd, for the advanced development of Laninamivir in the US. [3]
[edit] References
|
|
|
| General topics |
|
|
| Influenza viruses |
|
|
Influenza A virus
subtypes |
|
|
| H1N1 |
|
|
| H5N1 |
|
|
| Treatments |
|
|
Influenza epidemics
and pandemics |
|
|
| Non-human |
|
|
| Related |
|
|
|
|
|