Pluviatilol: Difference between revisions
Appearance
Content deleted Content added
clean up using AWB |
chembox data, etc. |
||
Line 1: | Line 1: | ||
{{orphan|date=October 2013}} |
|||
{{Chembox |
{{Chembox |
||
| ImageFile = Pluviatilol.png |
| ImageFile = Pluviatilol.png |
||
| ImageSize = |
| ImageSize = 200px |
||
| ImageAlt = |
| ImageAlt = |
||
| IUPACName = 4-[(3''R'',3a''S'',6''S'',6a''S'')-3-(1,3-Benzodioxol-5-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-''c'']furan-6-yl]-2-methoxyphenol |
|||
| IUPACName = |
|||
| OtherNames = |
| OtherNames = |
||
| Section1 = {{Chembox Identifiers |
| Section1 = {{Chembox Identifiers |
||
| CASNo = |
| CASNo = |
||
| PubChem = 70695727 |
| PubChem = 70695727 |
||
| InChI=1S/C20H20O6/c1-22-17-6-11(2-4-15(17)21)19-13-8-24-20(14(13)9-23-19)12-3-5-16-18(7-12)26-10-25-16/h2-7,13-14,19-21H,8-10H2,1H3/t13-,14-,19-,20+/m1/s1 |
|||
| SMILES = }} |
|||
| InChIKey = VBIRCRCPHNUJAS-FQZPYLGXSA-N |
|||
| SMILES = COC1=C(C=CC(=C1)[C@@H]2[C@@H]3CO[C@H]([C@@H]3CO2)C4=CC5=C(C=C4)OCO5)O}} |
|||
| Section2 = {{Chembox Properties |
| Section2 = {{Chembox Properties |
||
| C=20|H=20|O=6 |
|||
| Formula = |
|||
| MolarMass = |
|||
| Appearance = |
| Appearance = |
||
| Density = |
| Density = |
||
Line 25: | Line 25: | ||
}} |
}} |
||
'''Pluviatilol''' is a ''[[Lindera obtusiloba]]'' isolate with anti-allergic activity. |
'''Pluviatilol''' is a ''[[Lindera obtusiloba]]'' isolate with anti-allergic activity.<ref>{{cite journal|pmid=24014307}}</ref> |
||
==References== |
|||
{{reflist}} |
|||
==External links== |
|||
* [http://www.ncbi.nlm.nih.gov/pubmed/24014307 A new neolignan and lignans from the stems of Lindera obtusiloba Blume and their anti-allergic inflammatory effects] |
|||
⚫ | |||
[[Category:Benzodioxoles]] |
|||
⚫ |
Revision as of 14:31, 28 October 2013
![]() | |
Names | |
---|---|
IUPAC name
4-[(3R,3aS,6S,6aS)-3-(1,3-Benzodioxol-5-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-2-methoxyphenol
| |
Identifiers | |
3D model (JSmol)
|
|
PubChem CID
|
|
| |
| |
Properties | |
C20H20O6 | |
Molar mass | 356.374 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Pluviatilol is a Lindera obtusiloba isolate with anti-allergic activity.[1]
References