Indobufen: Difference between revisions

(18 intermediate revisions by 13 users not shown)

Line 1:

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = ~~443919163~~

| verifiedrevid = 447914993

| IUPAC_name = 2-(4-(1-Oxoisoindolin-2-yl)phenyl)butanoic acid

| image = Indobufen structure.svg

| image2 = Indobufen ball-and-stick.png

Line 26:

Line 29:

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 63610-08-2

| ATC_prefix = B01

Line 36:

Line 40:

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07141

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1765292

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 96823

| C=18 | H=17 | N=1 | O=3

| smiles = O=C(O)C(c1ccc(cc1)N3C(=O)c2ccccc2C3)CC

| molecular_weight = 295.333 g/mol

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C18H17NO3/c1-2-15(18(21)22)12-7-9-14(10-8-12)19-11-13-5-3-4-6-16(13)17(19)20/h3-10,15H,2,11H2,1H3,(H,21,22)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = AYDXAULLCROVIT-UHFFFAOYSA-N

}}

'''Indobufen''' is a [[platelet aggregation inhibitor]].<ref>The Merck Index, 12th ~~Edition.~~ 4991</ref> It ~~acs~~ as a reversible [[Mechanism of action of aspirin|cyclooxygenase inhibitor]].<ref>{{cite journal|title=Indobufen inhibits tissue factor in human monocytes through a thromboxane-mediated mechanism|~~first1=Sonia|last1=Eligini|~~journal=Cardiovascular Research|volume=69|issue=1|~~year~~=~~2005~~|~~pages~~=~~218–226~~|~~url~~=~~http://cardiovascres.oxfordjournals.org/content/69/1/218.abstract~~|doi=10.1016/j.cardiores.2005.07.013|~~pmid=16154551|last2=Violi|first2=F|last3=Banfi|first3=C|last4=Barbieri|first4=SS|last5~~=~~Brambilla|first5=M|last6=Saliola|first6=M|last7=Tremoli|first7=E|last8=Colli|first8=S~~}}</ref>

'''Indobufen''' is a [[platelet aggregation inhibitor]].<ref>{{cite book | title = The Merck Index | edition = 12th | page = 4991 }}</ref> It acts as a reversible [[Mechanism of action of aspirin|cyclooxygenase inhibitor]].<ref>{{cite journal | vauthors = Eligini S, Violi F, Banfi C, Barbieri SS, Brambilla M, Saliola M, Tremoli E, Colli S | display-authors = 6 | title = Indobufen inhibits tissue factor in human monocytes through a thromboxane-mediated mechanism | journal = Cardiovascular Research | volume = 69 | issue = 1 | pages = 218–26 | date = January 2006 | pmid = 16154551 | doi = 10.1016/j.cardiores.2005.07.013 | doi-access = free }}</ref>

== References ==

Line 51:

Line 63:

[[Category:Lactams]]

[[Category:Isoindolines]]

[[Category:Carboxylic acids]]

[[pl:Indobufen]]

[[pt:Indobufeno]]