Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Pifithrin: Difference between pages

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
+{{more citations needed|date=April 2022}}
-{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid [{{fullurl:Pifithrin|oldid=417928399}} 417928399] of page [[Pifithrin]] with values updated to verified values.}}
 {{chembox
+| Verifiedfields = changed
-| verifiedrevid = 417927422
+| Watchedfields = changed
-|   Name = Pifithrin
+| verifiedrevid = 464206558
-|   ImageFile = Pifithrin.PNG
+| Name = Pifithrin-α
-<!-- | ImageSize = 200px -->
+| ImageFile = Pifithrin.PNG
-|   ImageName =
+| ImageName =
-|   IUPACName = 2-amino-3-[2-(4-methylphenyl)-2-oxoethyl]-2,3,4,5,6,7-hexahydro-1,3-benzothiazol-2-ylium bromide
+| IUPACName = 2-amino-3-[2-(4-methylphenyl)-2-oxoethyl]-2,3,4,5,6,7-hexahydro-1,3-benzothiazol-2-ylium bromide
-| Section1 = {{Chembox Identifiers
+|Section1={{Chembox Identifiers
-|   InChI = 1/C16H19N2OS.BrH/c1-11-6-8-12(9-7-11)14(19)10-18-13-4-2-3-5-15(13)20-16(18)17;/h6-9H,2-5,10,17H2,1H3;1H/q+1;/p-1
+| index_label = α
+| index1_label = β
+| InChI = 1/C16H19N2OS.BrH/c1-11-6-8-12(9-7-11)14(19)10-18-13-4-2-3-5-15(13)20-16(18)17;/h6-9H,2-5,10,17H2,1H3;1H/q+1;/p-1
 | InChIKey = KXMMOFYVZLFBEG-REWHXWOFAW
 | ChEMBL_Ref = {{ebicite|correct|EBI}}
 | ChEMBL = 556353
+| ChEMBL1 = 193504
+| ChEBI = 93168
+| ChEBI1 = 92551
+| KEGG1 = C11571
 | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
 | StdInChI = 1S/C16H18N2OS.BrH/c1-11-6-8-12(9-7-11)14(19)10-18-13-4-2-3-5-15(13)20-16(18)17;/h6-9,17H,2-5,10H2,1H3;1H
 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
 | StdInChIKey = HAGVCKULCLQGRF-UHFFFAOYSA-N
+| InChI1=1S/C16H16N2S/c1-11-6-8-12(9-7-11)13-10-18-14-4-2-3-5-15(14)19-16(18)17-13/h6-10H,2-5H2,1H3
-| CASNo =
-|   ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
+| CASNo_Ref = {{cascite|correct|CAS}}
+| CASNo = 63208-82-2
-| ChemSpiderID=21106463
+| CASNo1_Ref = {{cascite|correct|CAS}}
-|   SMILES = [Br-].Cc1ccc(cc1)C(=O)Cn2[c+](N)sc3CCCCc23
+| CASNo1 = 60477-34-1
-  }}
+| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
-| Section2 = {{Chembox Properties
+| ChemSpiderID =21106463
-|   Formula = C<sub>16</sub>H<sub>19</sub>BrN<sub>2</sub>OS
+| PubChem = 4817
-|   MolarMass = 367.30 g/mol
+| PubChem1 = 443278
-|   Density =
+| DTXSID = DTXSID10432994
-|   MeltingPt = 192.1 °C
+| UNII_Ref = {{fdacite|correct|FDA}}
-|   BoilingPt =
+| UNII = D213B92S1Y
+| UNII1_Ref = {{fdacite|correct|FDA}}
+| UNII1 = 45I8QO7K37
+| SMILES = CC1=CC=C(C=C1)C(=O)CN2C3=C(CCCC3)SC2=N
+| SMILES1 = CC1=CC=C(C=C1)C2=CN3C4=C(CCCC4)SC3=N2
+| SMILES5 = [Br-].Cc1ccc(cc1)C(=O)Cn2[c+](N)sc3CCCCc23
   }}
+|Section2={{Chembox Properties
+| Formula = C<sub>16</sub>H<sub>19</sub>BrN<sub>2</sub>OS
+| MolarMass = 367.30 g/mol
+| Density =
+| MeltingPtC = 192.1
+| BoilingPt =
+ }}
 }}
+'''Pifithrin-α''' (chemical name 2-(2-Imino-4,5,6,7-tetrahydrobenzothiazol-3-yl)-1-p-tolylethanone hydrobromide<ref>{{Cite web |title=sigmaaldrich.com |url=https://www.sigmaaldrich.com/GB/en/product/sigma/p4359 |website=[[Merck Group|Merck]]}}</ref>) is an off-white in color chemical inhibitor of [[p53]].  It has a molecular weight of 367.30 and is soluble in [[Dimethyl sulfoxide|DMSO]] up to 20&nbsp;mg/mL.  Its melting point is 192.1-192.5&nbsp;°C.
+{{reflist}}
+[[Category:Ketones]]
+[[Category:Benzothiazoles]]
+[[Category:Bromides]]
+{{ketone-stub}}