Proxyphylline: Difference between revisions

{{one source|date=November 2014}}

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 298647946

| ImageFile = Proxyphylline.svg

| ImageSize = 160

| IUPACName = 7-(2-Hydroxypropyl)-1,3-dimethylpurine-2,6-dione

| OtherNames=

| Section1 = {{Chembox Identifiers

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = 13G1DMN4P0

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 603-00-9

| PubChem = 4977

| DrugBank = DB13449

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 37390

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 4806

| EINECS = 210-028-7

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG = D01771

| SMILES=CC(CN1C=NC2=C1C(=O)N(C(=O)N2C)C)O

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C10H14N4O3/c1-6(15)4-14-5-11-8-7(14)9(16)13(3)10(17)12(8)2/h5-6,15H,4H2,1-3H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = KYHQZNGJUGFTGR-UHFFFAOYSA-N

| Section2 = {{Chembox Properties

| Formula = C₁₀H₁₄N₄O₃

| MolarMass = 238.24316

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

| Section6 = {{Chembox Pharmacology

| ATCCode_prefix = R03

| ATCCode_suffix = DA03

}}

| Section7 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

'''Proxyphylline''' is a [[xanthine]] derivative that acts as a [[cardiac stimulant]], [[vasodilator]] and [[bronchodilator]].<ref>Drugs.com: [https://www.drugs.com/international/proxyphylline.html Proxyphylline]</ref>

==References==

{{Reflist|2}}

{{Asthma and copd rx}}

{{Adenosinergics}}

{{Phosphodiesterase inhibitors}}

[[Category:Adenosine receptor antagonists]]

[[Category:Phosphodiesterase inhibitors]]

{{respiratory-system-drug-stub}}

{{alkaloid-stub}}