Wikipedia:WikiProject Pharmacology/Log/2011-11-06

Standard header for logs from CheMoBot

01:14:17 (2, 4, 5) (EDIT) User:Livv17 (contribs, talk) edited Phenylpiracetam (diff, hist)
Changed: 'pregnancy_category' ('?' -> '? cheese', SET '?')
01:24:56 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Chloroquine (diff, hist)
Added: 'CAS_number_Ref' ('' -> '{{cascite|correct|??}}', SET '')
01:26:27 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Phenylpiracetam (diff, hist)
Changed: 'verifiedrevid' ('447380381' -> '447920554', SET '447380381')
01:26:28 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Phenylpiracetam (diff, hist)
Added: 'CAS_number_Ref' ('' -> '{{cascite|correct|??}}', SET '')
01:34:33 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Tiagabine (diff, hist)
Added: 'CAS_number_Ref' ('' -> '{{cascite|correct|??}}', SET '')
01:34:33 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Tiagabine (diff, hist)
Added: 'DrugBank_Ref' ('' -> '{{drugbankcite|correct|drugbank}}', SET '')
05:11:39 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Carfentanil (diff, hist)
Added: 'CAS_number_Ref' ('' -> '{{cascite|correct|??}}', SET '')
06:23:38 (3, 2, 4) (EDIT) User:Netha Hussain (contribs, talk) edited Captopril (diff, hist)
Added links: http://www.ncbi.nlm.nih.gov/pubmed/3292102
07:26:01 (3, 2, 4) (EDIT) User:Uniearth (contribs, talk) edited Pancrelipase (diff, hist)
Added links: http://www.mims.com/Creon%2010000.html
08:08:04 (3, 2, 4) (EDIT) User:46.138.95.18 (contribs, talk) edited Zanolimumab (diff, hist)
Added links: http://clinicaltrials.gov/search/intervention=Zanolimumab
09:52:18 (2, 4, 5) (EDIT) User:Whywhenwhohow (contribs, talk) edited Ketoconazole (diff, hist)
Added: 'pregnancy_AU' ('' -> 'B3', SET '')
09:52:19 (2, 4, 5) (EDIT) User:Whywhenwhohow (contribs, talk) edited Ketoconazole (diff, hist)
Added: 'pregnancy_US' ('' -> 'C', SET '')
09:52:19 (2, 4, 5) (EDIT) User:Whywhenwhohow (contribs, talk) edited Ketoconazole (diff, hist)
Added: 'legal_UK' ('' -> 'POM', SET '')
09:52:19 (2, 4, 5) (EDIT) User:Whywhenwhohow (contribs, talk) edited Ketoconazole (diff, hist)
Added: 'licence_US' ('' -> 'Ketoconazole', SET '')
09:52:19 (2, 5, 5) (EDIT) User:Whywhenwhohow (contribs, talk) edited Ketoconazole (diff, hist)
Deleted: 'pregnancy_category' ('B3 ([[Australia|Au]]), C (United States)' -> '', SET 'B3 ([[Australia|Au]]), C (United States)')
09:52:20 (2, 5, 5) (EDIT) User:Whywhenwhohow (contribs, talk) edited Ketoconazole (diff, hist)
Deleted: 'legal_status' ('[[Prescription drug|POM]] (UK, oral formulation)' -> '', SET '[[Prescription drug|POM]] (UK, oral formulation)')
13:26:18 (3, 2, 4) (EDIT) User:Anypodetos (contribs, talk) edited Midazolam (diff, hist)
Added links: http://www.ema.europa.eu/docs/en_GB/document_library/Committee_meeting_report/2011/07/WC500108232.pdf, http://www.wallstreet-online.de/nachricht/3364595-viropharma-s-buccolam-midazolam-oromucosal-solution-granted-european-marketing-authorization-for-treat
13:49:39 (3, 2, 4) (EDIT) User:Shaylesh (contribs, talk) edited Febuxostat (diff, hist)
Added links: http://www.facebook.com/Febutaz
15:10:22 (3, 2, 4) (EDIT) User:182.11.190.195 (contribs, talk) edited Pregabalin (diff, hist)
Added links: http://drimspc.com
15:24:07 (3, 2, 4) (EDIT) User:AnomieBOT (contribs, talk) edited Methamphetamine (diff, hist)
Added links: http://www.mappsd.org/Meth%20Mouth.htm
16:10:34 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Picamilon (diff, hist)
Changed: 'verifiedrevid' ('400851867' -> '447570774', SET '400851867')
16:10:34 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Picamilon (diff, hist)
Added: 'CAS_number_Ref' ('' -> '{{cascite|correct|??}}', SET '')
16:41:38 (3, 2, 4) (EDIT) User:97.255.110.222 (contribs, talk) edited MMR_vaccine (diff, hist)
Added links: http://www.cdc.gov/vaccines/vac-gen/side-effects.htm, http://www.pediatricsdigest.mobi/content/126/1/e1.full, http://www.fda.gov/downloads/biologicsbloodvaccines/vaccines/approvedproducts/ucm123800.pdf
17:33:49 (4, 4, 5) (EDIT) User:89.169.187.137 (contribs, talk) edited UR-144 (diff, hist)
Changed: 'IUPAC_name' ('(1-pentylindol- 3-yl )-(2, 2,3, 3-tetramethylcyclopropyl)methanone' -> '(1-metylindol- 3-yl )-(2, 2,3, 3-tetramethylcyclopropyl)methanone', SET '(1-pentylindol- 3-yl )-(2, 2,3, 3-tetramethylcyclopropyl)methanone')
17:44:52 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited UR-144 (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')
17:56:03 (3, 2, 4) (EDIT) User:71.231.56.84 (contribs, talk) edited Carvedilol (diff, hist)
Added links: http://sideeffectz.com/carvedilolsideeffects
19:09:17 (3, 2, 4) (EDIT) User:AnomieBOT (contribs, talk) edited Mefloquine (diff, hist)
Added links: http://www.accessdata.fda.gov/drugsatfda_docs/label/2008/019591s023lbl.pdf
19:40:51 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Sigmodal (diff, hist)
Changed: 'verifiedrevid' ('448003382' -> '449588889', SET '448003382')
19:40:52 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Sigmodal (diff, hist)
Added: 'CAS_number_Ref' ('' -> '{{cascite|correct|??}}', SET '')
21:23:35 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Pentostatin (diff, hist)
Added: 'CAS_number_Ref' ('' -> '{{cascite|correct|??}}', SET '')
21:32:57 (2, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'realboxname' ('drugbox' -> '', SET 'drugbox')
21:32:57 (2, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'boxname' ('drugbox' -> '', SET 'drugbox')
21:32:58 (2, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Changed: 'Verifiedfields' ('changed' -> '', SET '')
21:32:58 (2, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'verifiedrevid' ('457117082' -> '', SET '455335901')
21:32:59 (2, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'drug_name' ('MDMA' -> '', SET 'MDMA')
21:33:00 (2, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'imagename' ('1 : 1 mixture (racemate)' -> '', SET '1 : 1 mixture (racemate)')
21:33:00 (2, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'CASNo_Ref' ('{{cascite}}' -> '', SET '{{cascite}}')
21:33:01 (2, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'image' ('MDMA (simple).svg' -> '', SET 'MDMA (simple).svg')
21:33:01 (2, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'width' ('200' -> '', SET '200')
21:33:02 (2, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'image2' ('MDMAsanimation.gif' -> '', SET 'MDMAsanimation.gif')
21:33:03 (2, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'CAS_number_Ref' ('{{cascite|changed|??}}' -> '', SET '{{cascite|correct|??}}')
21:33:04 (2, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'ChemSpiderID_Ref' ('{{chemspidercite|correct|chemspider}}' -> '', SET '{{chemspidercite|correct|chemspider}}')
21:33:05 (2, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'UNII_Ref' ('{{fdacite|correct|FDA}}' -> '', SET '{{fdacite|correct|FDA}}')
21:33:06 (2, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'DrugBank_Ref' ('{{drugbankcite|correct|drugbank}}' -> '', SET '{{drugbankcite|correct|drugbank}}')
21:33:08 (2, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'ChEBI_Ref' ('{{ebicite|correct|EBI}}' -> '', SET '{{ebicite|correct|EBI}}')
21:33:09 (2, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'StdInChI_Ref' ('{{stdinchicite|correct|chemspider}}' -> '', SET '{{stdinchicite|correct|chemspider}}')
21:33:11 (2, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'StdInChIKey_Ref' ('{{stdinchicite|correct|chemspider}}' -> '', SET '{{stdinchicite|correct|chemspider}}')
21:33:13 (2, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Changed: 'ChEMBL_Ref' ('{{ebicite|correct|EBI}}' -> '', SET '')
21:33:14 (2, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'synonyms' ('(Â±)-1,3-benzodioxolyl-''N''-methyl-2-propanamine; (Â±)-3,4-methylenedioxy-''N''-methyl-Î±-methyl-2-phenethylamine; DL-3,4-methylenedioxy-''N''-methylamphetamine; methylenedioxymethamphetamine' -> '', SET '(Â±)-1,3-
21:33:16 (2, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'elimination_half-life' ('6â10 hours (though duration of effects is typically actually 3â5 hours)' -> '', SET '6â10 hours (though duration of effects is typically actually 3â5 hours)')
21:33:18 (2, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'metabolism' ('[[Liver|Hepatic]], [[Cytochrome P450 oxidase|CYP450]] extensively involved, especially [[CYP2D6]]' -> '', SET '[[Liver|Hepatic]], [[Cytochrome P450 oxidase|CYP450]] extensively involved, especially [[CYP2D6]]')
21:33:19 (2, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'excretion' ('[[Kidney|Renal]]' -> '', SET '[[Kidney|Renal]]')
21:33:20 (2, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'legal_AU' ('S9' -> '', SET 'S9')
21:33:22 (2, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'legal_US' ('Schedule I' -> '', SET 'Schedule I')
21:33:24 (2, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'legal_UK' ('CD Lic' -> '', SET 'CD Lic')
21:33:25 (2, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'legal_CA' ('Schedule III' -> '', SET 'Schedule III')
21:33:26 (2, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'routes_of_administration' ('[[Mouth|Oral]], [[sublingual]], [[insufflation (medicine)|insufflation]], [[inhalation]] ([[vaporization]]), [[injection (medicine)|injection]],<ref>{{cite web|title= Methylenedioxymethamphetamine (MDMA, ecstasy) |url = http:/
21:33:27 (2, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'pregnancy_category' ('C<ref>[http://findarticles.com/p/articles/mism0CYD/iss11s38/ais102839980 Stimulants, Narcotics, Hallucinogens â Drugs, Pregnancy, and Lactation.], Gerald G. Briggs, ''OB/GYN News'', 1 June 2003.</ref>' -> '', SET 'C<ref>[http://fi
21:33:28 (4, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'IUPAC_name' ('(''RS'')-1-(benzo[''d''][1,3]dioxol-5-yl)-''N''-methylpropan-2-amine' -> '', SET '(''RS'')-1-(benzo[''d''][1,3]dioxol-5-yl)-''N''-methylpropan-2-amine')
21:33:28 (4, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'molecular_weight' ('193.25 g/mol' -> '', SET '193.25 g/mol')
21:33:29 (4, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'ATC_prefix' ('N/A' -> '', SET 'N/A')
21:33:29 (4, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'smiles' ('CC(NC)CC1=CC=C(OCO2)C2=C1' -> '', SET 'CC(NC)CC1=CC=C(OCO2)C2=C1')
21:33:30 (4, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'C' ('1' -> '', SET '1')
21:33:30 (4, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'H' ('1' -> '', SET '1')
21:33:31 (4, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'O' ('2' -> '', SET '2')
21:33:31 (4, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'PubChem' ('1615' -> '', SET '1615')
21:33:32 (5, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'ChemSpiderID' ('1556' -> '', SET '1556')
21:33:32 (5, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'DrugBank' ('DB01454' -> '', SET 'DB01454')
21:33:33 (5, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'UNII' ('KE1SEN21RM' -> '', SET 'KE1SEN21RM')
21:33:33 (5, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'ChEMBL' ('43048' -> '', SET '43048')
21:33:33 (5, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'ChEBI' ('1391' -> '', SET '1391')
21:33:34 (5, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'StdInChI' ('1S/C11H15NO2/c1-8(12-2)5-9-3-4-10-11(6-9)14-7-13-10/h3-4,6,8,12H,5,7H2,1-2H3' -> '', SET '1S/C11H15NO2/c1-8(12-2)5-9-3-4-10-11(6-9)14-7-13-10/h3-4,6,8,12H,5,7H2,1-2H3')
21:33:34 (5, 5, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Deleted: 'StdInChIKey' ('SHXWCVYOXRDMCX-UHFFFAOYSA-N' -> '', SET 'SHXWCVYOXRDMCX-UHFFFAOYSA-N')
21:33:35 (5, 6, 5) (EDIT) User:96.232.69.55 (contribs, talk) edited MDMA (diff, hist)
Changed: 'CAS_number' ('42542-10-9' -> '', SET '')
23:39:22 (3, 2, 4) (EDIT) User:Arnons 1 (contribs, talk) edited Talampanel (diff, hist)
Added links: http://www.alsa.org/research/clinical-trials/talampanel-trial.html