Jump to content

Sofalcone

From Wikipedia, the free encyclopedia

This is an old revision of this page, as edited by Kbdank71 (talk | contribs) at 16:44, 8 April 2009 (CFD 2009 Apr 2, replaced: Category:Gastrointestinal system drugs → Category:Drugs acting on the gastroin using AWB). The present address (URL) is a permanent link to this revision, which may differ significantly from the current revision.

{{Drugbox | IUPAC_name = [5-[(3-methylbut-2-en-1-yl)oxy]-2-((2E)-3-{4-[(3-methylbut-2-en-1-yl)oxy]phenyl}prop-2-enoyl)phenoxy]acetic acid | image = Sofalcone.svg | CAS_number = 64506-49-6 | CAS_supplemental = | ATC_prefix = | ATC_suffix = | ATC_supplemental = | PubChem = 5282219 | DrugBank = | C=27 | H=30 | O=6 | molecular_weight = 450.52 g/mol | smiles = CC(=CCOC1=CC=C(C=C1)C=CC(=O)C2=C(C=C(C=C2)OCC=C(C)C)OCC(=O)O)C | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | pregnancy_AU = | pregnancy_US = | pregnancy_category= | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = Rx-only | routes_of_administration = Oral }}

Sofalcone (INN) is an oral gastrointestinal medication. It is a synthetic derivative of sophoradin,[1] a flavonoid found in Sophora tonkinensis (or Sophora subprostrata), a herb used in traditional Chinese medicine.

References

  1. ^ Konturek SJ, Mrzozowski T, Drozdowicz D, Pawlik W, Sendur R (1987). "Gastroprotective and ulcer healing effects of solon, a synthetic flavonoid derivative of sophoradin". Hepatogastroenterology. 34 (4): 164–70. PMID 3478294. {{cite journal}}: Unknown parameter |month= ignored (help)CS1 maint: multiple names: authors list (link)