Wikipedia:WikiProject Chemicals/Log/2009-12-17
Standard header for logs from CheMoBot
01:01:11 (3, 2, 4) (EDIT) User:Shootbamboo (contribs, talk) edited Polytetrafluoroethylene (diff, hist)
Added links: http://www.hpcbd.com/dupont/Settlement%20Agreement.pdf01:24:38 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Zinc_chromate (diff, hist)
Added: 'verifiedrevid' ('' -> '300365492', SET '')01:24:38 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Zinc_chromate (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite}}', SET '')01:36:35 (3, 2, 4) (EDIT) User:Alansohn (contribs, talk) edited Phosphoric_acid (diff, hist)
Added links: http://www.ajcn.org/cgi/content/full/84/4/93601:38:19 (2, 4, 4) (EDIT) User:SmackBot (contribs, talk) edited Xanthene (diff, hist)
Changed: 'CASNo_Ref' ('{{cascite}}' -> '{{Cascite}}', SET '{{cascite}}')01:48:50 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Xanthene (diff, hist)
Changed: 'CASNo_Ref' ('{{Cascite}}' -> '{{cascite}}', SET '{{cascite}}')01:53:17 (2, 4, 4) (EDIT) User:SmackBot (contribs, talk) edited Diacetylene (diff, hist)
Added: 'CASNo_Ref' ('{{cascite}}' -> '{{Cascite}}', SET '')02:03:43 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Diacetylene (diff, hist)
Added: 'CASNo_Ref' ('{{Cascite}}' -> '{{cascite}}', SET '')02:09:45 (2, 4, 4) (EDIT) User:SmackBot (contribs, talk) edited Nicotinamide_adenine_dinucleotide_phosphate (diff, hist)
Changed: 'CASNo_Ref' ('{{cascite}}' -> '{{Cascite}}', SET '{{cascite}}')02:20:14 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Nicotinamide_adenine_dinucleotide_phosphate (diff, hist)
Changed: 'CASNo_Ref' ('{{Cascite}}' -> '{{cascite}}', SET '{{cascite}}')- 02:45:14 (2, 4, 5) (EDIT) User:97.103.39.24 (contribs, talk) edited Nicotinamide_adenine_dinucleotide (diff, hist)
Added: 'Watchedfields' ('changed' -> 'screw you', SET '') - 02:47:43 (2, 4, 5) (EDIT) User:97.103.39.24 (contribs, talk) edited Nicotinamide_adenine_dinucleotide (diff, hist)
Added: 'Watchedfields' ('screw you' -> 'changed', SET '') - 03:23:05 (2, 3, 5) (EDIT) User:RjwilmsiBot (contribs, talk) edited Alizarine_Yellow_R (diff, hist)
Changed: 'CASOther' (' (Na salt)<br />2243-76-7 (acid)<ref name="CRC">{{ cite book | title = CRC Handbook of Chemistry and Physics, 89th Edition | last = Lide | first = David R. | year = 2008 | publisher = [[CRC Press]] | isbn = 978-0849304880 | page = 3-10}}</ref>' -> ' (Na salt)<br />2243-76-7 (acid)<ref name="CRC">{{ cite book | title = CRC Handbook of Chemistry and Physics, 89th Edition | last = Lide | first = David R. | year = 2008 | publisher = [[CRC Press]] | isbn = 978-0849304880 | page = 3â10}}</ref>') - 03:51:36 (2, 4, 5) (EDIT) User:165.246.95.154 (contribs, talk) edited N-Vinylpyrrolidone (diff, hist)
Added: 'vapordensity' ('' -> '3.8 (vs air)', SET '') - 03:51:37 (2, 4, 5) (EDIT) User:165.246.95.154 (contribs, talk) edited N-Vinylpyrrolidone (diff, hist)
Added: 'vaporpressure' ('' -> '0.1 mmHg ( 24 °C)', SET '') - 03:51:38 (2, 4, 5) (EDIT) User:165.246.95.154 (contribs, talk) edited N-Vinylpyrrolidone (diff, hist)
Added: 'autoignitiontemp.' ('' -> '685 °F', SET '') - 03:51:40 (4, 4, 5) (EDIT) User:165.246.95.154 (contribs, talk) edited N-Vinylpyrrolidone (diff, hist)
Added: 'BoilingPt' ('' -> '90 - 92 °C (1,3 kPa)', SET '') - 03:54:31 (2, 3, 5) (EDIT) User:RjwilmsiBot (contribs, talk) edited Aluminium_selenide (diff, hist)
Changed: 'Reference' ('<ref name="hand">{{Citation | last = Lide | first = David R. | author-link = | year = 1998 | title = Handbook of Chemistry and Physics | edition = 87 | publication-place = Boca Raton, FL | publisher = CRC Press | isbn = 0849305942 | pages = 4-40}}</ref>' -> '<ref name="hand">{{Citation | last = Lide | first = David R. | author-link = | year = 1998 | title = Handbook of Chemistry and Physics | edition = 87 | publication-place = Boca Raton, FL | publisher = CRC Press | isbn = 0849305942 | pages = 4â40}}</ref>') 04:01:06 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited N-Vinylpyrrolidone (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')- 04:24:27 (2, 4, 5) (EDIT) User:71.225.166.254 (contribs, talk) edited Beta-Carotene (diff, hist)
Changed: 'Solubility' ('Insoluble in cold water or hot water. Soluble in diethyl ether, acetone, benzene, chloroform, carbon disulfide. Moderately soluble in petroleium ether, oils.Very slightly soluble in methanol.Soluble in fat solvents' -> 'Insoluble in cold water or hot water. Soluble in diethyl ether, acetone, benzene, chloroform, carbon disulfide and. Moderately soluble in petroleium ether, oils.Very slightly soluble in methanol.Soluble in fat solvents', SET 'Insoluble in cold water or hot water. Soluble in diethyl ether, acetone, benzene, chloroform, carbon disulfide. Moderately soluble in petroleium ether, oils.Very slightly soluble in methanol.Soluble in fat solvents') - 04:27:13 (2, 4, 5) (EDIT) User:RjwilmsiBot (contribs, talk) edited Ammonium_dihydrogen_phosphate (diff, hist)
Changed: 'Reference' ('<ref name="hand">{{cite book | last = Lide | first = David R. | year = 1998 | title = Handbook of Chemistry and Physics | edition = 87 | volume = | location = Boca Raton, FL | publisher = CRC Press | isbn = 0849305942 | pages = 4-40}}</ref>' -> '<ref name="hand">{{cite book | last = Lide | first = David R. | year = 1998 | title = Handbook of Chemistry and Physics | edition = 87 | volume = | location = Boca Raton, FL | publisher = CRC Press | isbn = 0849305942 | pages = 4â40}}</ref>', SET '<ref name="hand">{{cite book | last = Lide | first = David R. | year = 1998 | title = Handbook of Chemistry and Physics | edition = 87 | volume = | location = Boca Raton, FL | publisher = CRC Press | isbn = 0849305942 | pages = 4-40}}</ref>') - 04:27:34 (2, 4, 5) (EDIT) User:RjwilmsiBot (contribs, talk) edited Ammonium_phosphate (diff, hist)
Changed: 'Reference' ('<ref name="hand">{{cite book | last = Lide | first = David R. | year = 1998 | title = Handbook of Chemistry and Physics | edition = 87 | volume = | location = Boca Raton, FL | publisher = CRC Press | isbn = 0849305942 | pages = 4-42, 5-19}}</ref>' -> '<ref name="hand">{{cite book | last = Lide | first = David R. | year = 1998 | title = Handbook of Chemistry and Physics | edition = 87 | volume = | location = Boca Raton, FL | publisher = CRC Press | isbn = 0849305942 | pages = 4â42, 5-19}}</ref>', SET '<ref name="hand">{{cite book | last = Lide | first = David R. | year = 1998 | title = Handbook of Chemistry and Physics | edition = 87 | volume = | location = Boca Raton, FL | publisher = CRC Press | isbn = 0849305942 | pages = 4-42, 5-19}}</ref>') 04:47:46 (2, 4, 4) (EDIT) User:SmackBot (contribs, talk) edited Veratridine (diff, hist)
Added: 'CASNo_Ref' ('{{cascite}}' -> '{{Cascite}}', SET '')04:58:11 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Veratridine (diff, hist)
Added: 'CASNo_Ref' ('{{Cascite}}' -> '{{cascite}}', SET '')05:01:24 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Ethylhexyl_palmitate (diff, hist)
Added: 'verifiedrevid' ('' -> '310221779', SET '')05:01:24 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Ethylhexyl_palmitate (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite}}', SET '')05:27:07 (2, 4, 4) (EDIT) User:SmackBot (contribs, talk) edited Uridine_triphosphate (diff, hist)
Changed: 'CASNo_Ref' ('{{cascite}}' -> '{{Cascite}}', SET '{{cascite}}')05:27:15 (2, 4, 4) (EDIT) User:SmackBot (contribs, talk) edited Uridine_diphosphate (diff, hist)
Changed: 'CASNo_Ref' ('{{cascite}}' -> '{{Cascite}}', SET '{{cascite}}')05:38:09 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Uridine_triphosphate (diff, hist)
Changed: 'CASNo_Ref' ('{{Cascite}}' -> '{{cascite}}', SET '{{cascite}}')05:38:13 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Uridine_diphosphate (diff, hist)
Changed: 'CASNo_Ref' ('{{Cascite}}' -> '{{cascite}}', SET '{{cascite}}')05:50:32 (3, 4, 4) (EDIT) User:Materialscientist (contribs, talk) edited Methane (diff, hist)
Changed: 'Solubility' ('3.5 mg/100 mL (17 °C)' -> '35 mg/L (17 °C)', SET '3.5 mg/100 mL (17 °C)')05:50:33 (3, 2, 4) (EDIT) User:Materialscientist (contribs, talk) edited Methane (diff, hist)
Added links: http://books.google.co.jp/books?id=3AClY8pMg-EC&pg=PA16&lpg=PA1606:12:43 (2, 4, 4) (EDIT) User:SmackBot (contribs, talk) edited Fluorescein_isothiocyanate (diff, hist)
Added: 'CASNo_Ref' ('{{cascite}}' -> '{{Cascite}}', SET '')06:23:05 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Fluorescein_isothiocyanate (diff, hist)
Added: 'CASNo_Ref' ('{{Cascite}}' -> '{{cascite}}', SET '')06:24:49 (2, 4, 4) (EDIT) User:SmackBot (contribs, talk) edited Rubidium_nitrate (diff, hist)
Changed: 'CASNo_Ref' ('{{cascite}}' -> '{{Cascite}}', SET '{{cascite}}')06:24:50 (4, 4, 4) (EDIT) User:SmackBot (contribs, talk) edited Rubidium_nitrate (diff, hist)
Changed: 'MeltingPt' ('310 ºC decomp.' -> '310 °C decomp.', SET '310 ºC decomp.')06:35:16 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Rubidium_nitrate (diff, hist)
Changed: 'CASNo_Ref' ('{{Cascite}}' -> '{{cascite}}', SET '{{cascite}}')- 07:01:21 (3, 2, 4) (EDIT) User:Yilloslime (contribs, talk) edited DDT (diff, hist)
Added links: http://whqlibdoc.who.int/publications/2009/9789241563901_eng.pdf 07:09:17 (3, 2, 4) (EDIT) User:AnomieBOT (contribs, talk) edited DDT (diff, hist)
Added links: http://www.who.int/malaria/publications/atoz/9789241563697/en/index.html- 07:37:37 (3, 5, 5) (EDIT) User:160.39.194.91 (contribs, talk) edited Cholesterol (diff, hist)
Deleted: 'realboxname' ('chembox' -> '', SET 'chembox') - 07:37:38 (3, 5, 5) (EDIT) User:160.39.194.91 (contribs, talk) edited Cholesterol (diff, hist)
Deleted: 'boxname' ('chembox' -> '', SET 'chembox') - 07:37:40 (3, 5, 5) (EDIT) User:160.39.194.91 (contribs, talk) edited Cholesterol (diff, hist)
Deleted: 'verifiedrevid' ('329028259' -> '', SET '267188022') - 07:37:41 (3, 5, 5) (EDIT) User:160.39.194.91 (contribs, talk) edited Cholesterol (diff, hist)
Deleted: 'ImageFile' ('Cholesterol.svg' -> '', SET 'Cholesterol.svg') - 07:37:42 (3, 5, 5) (EDIT) User:160.39.194.91 (contribs, talk) edited Cholesterol (diff, hist)
Deleted: 'ImageFile2' ('Cholesterol-3d.png' -> '', SET 'Cholesterol-3d.png') - 07:37:43 (3, 5, 5) (EDIT) User:160.39.194.91 (contribs, talk) edited Cholesterol (diff, hist)
Deleted: 'OtherNames' ('(10''R'',13''R'')-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1''H''-cyclopenta[''a'']phenanthren-3-ol' -> '', SET '(10''R'',13''R'')-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1''H''-cyclopenta[''a'']phenanthren-3-ol') - 07:37:43 (3, 5, 5) (EDIT) User:160.39.194.91 (contribs, talk) edited Cholesterol (diff, hist)
Deleted: 'Section1' ('{{Chembox Identifiers' -> '', SET '{{Chembox Identifiers') - 07:37:43 (3, 5, 5) (EDIT) User:160.39.194.91 (contribs, talk) edited Cholesterol (diff, hist)
Deleted: 'InChIKey' ('HVYWMOMLDIMFJA-DPAQBDIFBB' -> '', SET 'HVYWMOMLDIMFJA-DPAQBDIFBB') - 07:37:44 (3, 5, 5) (EDIT) User:160.39.194.91 (contribs, talk) edited Cholesterol (diff, hist)
Deleted: 'CASNo_Ref' ('{{cascite}}' -> '', SET '{{cascite}}') - 07:37:45 (3, 5, 5) (EDIT) User:160.39.194.91 (contribs, talk) edited Cholesterol (diff, hist)
Deleted: 'Section2' ('{{Chembox Properties' -> '', SET '{{Chembox Properties') - 07:37:46 (3, 5, 5) (EDIT) User:160.39.194.91 (contribs, talk) edited Cholesterol (diff, hist)
Deleted: 'Appearance' ('white crystalline powder<ref name=MSDS>{{cite web |url=http://physchem.ox.ac.uk/MSDS/CH/cholesterol.html |title=Safety (MSDS) data for cholesterol |accessdate=2007-10-20 |work=}}</ref>' -> '', SET 'white crystalline powder<ref name=MSDS>{{cite web |url=http://physchem.ox.ac.uk/MSDS/CH/cholesterol.html |title=Safety (MSDS) data for cholesterol |accessdate=2007-10-20 |work=}}</ref>') - 07:37:47 (3, 5, 5) (EDIT) User:160.39.194.91 (contribs, talk) edited Cholesterol (diff, hist)
Deleted: 'Solubility' ('0.095 mg/L (30 °C)' -> '', SET '0.095 mg/L (30 °C)') - 07:37:49 (3, 5, 5) (EDIT) User:160.39.194.91 (contribs, talk) edited Cholesterol (diff, hist)
Deleted: 'SolubleOther' ('soluble in [[acetone]], [[benzene]], [[chloroform]], [[ethanol]], [[ether]], [[hexane]], [[isopropyl myristate]], [[methanol]]' -> '', SET 'soluble in [[acetone]], [[benzene]], [[chloroform]], [[ethanol]], [[ether]], [[hexane]], [[isopropyl myristate]], [[methanol]]') - 07:37:49 (3, 5, 5) (EDIT) User:160.39.194.91 (contribs, talk) edited Cholesterol (diff, hist)
Deleted: 'Section7' ('{{Chembox Hazards' -> '', SET '{{Chembox Hazards') - 07:37:49 (4, 5, 5) (EDIT) User:160.39.194.91 (contribs, talk) edited Cholesterol (diff, hist)
Deleted: 'IUPACName' ('(3β)-cholest-5-en-3-ol' -> '', SET '(3β)-cholest-5-en-3-ol') - 07:37:50 (4, 5, 5) (EDIT) User:160.39.194.91 (contribs, talk) edited Cholesterol (diff, hist)
Deleted: 'PubChem' ('5997' -> '', SET '5997') - 07:37:50 (4, 5, 5) (EDIT) User:160.39.194.91 (contribs, talk) edited Cholesterol (diff, hist)
Deleted: 'SMILES' ('O[C@@H]4C/C3=C/C[C@@H]1[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@H](C)CCCC(C)C)C)[C@@]3(C)CC4' -> '', SET 'O[C@@H]4C/C3=C/C[C@@H]1[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@H](C)CCCC(C)C)C)[C@@]3(C)CC4') 07:37:50 (6, 6, 6) (EDIT) User:ClueBot (contribs, talk) edited Cholesterol (diff, hist)
Changed: 'realboxname' ('' -> 'chembox', SET 'chembox')- 07:37:51 (4, 5, 5) (EDIT) User:160.39.194.91 (contribs, talk) edited Cholesterol (diff, hist)
Deleted: 'InChI' ('1/C27H46O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h9,18-19,21-25,28H,6-8,10-17H2,1-5H3/t19-,21+,22+,23-,24+,25+,26+,27-/m1/s1' -> '', SET '1/C27H46O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h9,18-19,21-25,28H,6-8,10-17H2,1-5H3/t19-,21+,22+,23-,24+,25+,26+,27-/m1/s1') 07:37:51 (6, 6, 6) (EDIT) User:ClueBot (contribs, talk) edited Cholesterol (diff, hist)
Changed: 'boxname' ('' -> 'chembox', SET 'chembox')- 07:37:52 (4, 5, 5) (EDIT) User:160.39.194.91 (contribs, talk) edited Cholesterol (diff, hist)
Deleted: 'ChemSpiderID' ('5775' -> '', SET '5775') - 07:37:52 (4, 5, 5) (EDIT) User:160.39.194.91 (contribs, talk) edited Cholesterol (diff, hist)
Deleted: 'Formula' ('C<sub>27</sub>H<sub>46</sub>O' -> '', SET 'C<sub>27</sub>H<sub>46</sub>O') - 07:37:52 (4, 5, 5) (EDIT) User:160.39.194.91 (contribs, talk) edited Cholesterol (diff, hist)
Deleted: 'MolarMass' ('386.65 g/mol' -> '', SET '386.65 g/mol') 07:37:52 (6, 6, 6) (EDIT) User:ClueBot (contribs, talk) edited Cholesterol (diff, hist)
Changed: 'verifiedrevid' ('' -> '329028259', SET '267188022')07:37:52 (6, 6, 6) (EDIT) User:ClueBot (contribs, talk) edited Cholesterol (diff, hist)
Changed: 'ImageFile' ('' -> 'Cholesterol.svg', SET 'Cholesterol.svg')07:37:52 (6, 6, 6) (EDIT) User:ClueBot (contribs, talk) edited Cholesterol (diff, hist)
Changed: 'ImageFile2' ('' -> 'Cholesterol-3d.png', SET 'Cholesterol-3d.png')- 07:37:53 (4, 5, 5) (EDIT) User:160.39.194.91 (contribs, talk) edited Cholesterol (diff, hist)
Deleted: 'Density' ('1.052 g/cm<sup>3</sup>' -> '', SET '1.052 g/cm<sup>3</sup>') - 07:37:53 (4, 5, 5) (EDIT) User:160.39.194.91 (contribs, talk) edited Cholesterol (diff, hist)
Deleted: 'MeltingPt' ('148â150 °C<ref name=MSDS/>' -> '', SET '148â150 °C<ref name=MSDS/>') - 07:37:53 (4, 5, 5) (EDIT) User:160.39.194.91 (contribs, talk) edited Cholesterol (diff, hist)
Deleted: 'BoilingPt' ('360 °C (decomposes)' -> '', SET '360 °C (decomposes)') - 07:37:53 (5, 5, 5) (EDIT) User:160.39.194.91 (contribs, talk) edited Cholesterol (diff, hist)
Deleted: 'CASNo' ('57-88-5' -> '', SET '57-88-5') 07:37:53 (6, 6, 6) (EDIT) User:ClueBot (contribs, talk) edited Cholesterol (diff, hist)
Changed: 'OtherNames' ('' -> '(10''R'',13''R'')-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1''H''-cyclopenta[''a'']phenanthren-3-ol', SET '(10''R'',13''R'')-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1''H''-cyclopenta[''a'']phenanthren-3-ol')07:37:53 (6, 6, 6) (EDIT) User:ClueBot (contribs, talk) edited Cholesterol (diff, hist)
Changed: 'Section1' ('' -> '{{Chembox Identifiers', SET '{{Chembox Identifiers')07:37:53 (6, 6, 6) (EDIT) User:ClueBot (contribs, talk) edited Cholesterol (diff, hist)
Changed: 'InChIKey' ('' -> 'HVYWMOMLDIMFJA-DPAQBDIFBB', SET 'HVYWMOMLDIMFJA-DPAQBDIFBB')07:37:53 (6, 6, 6) (EDIT) User:ClueBot (contribs, talk) edited Cholesterol (diff, hist)
Changed: 'CASNo_Ref' ('' -> '{{cascite}}', SET '{{cascite}}')- 07:37:54 (3, 2, 4) (EDIT) User:160.39.194.91 (contribs, talk) edited Cholesterol (diff, hist)
Added links: http://www.americanheart.org/cholesterol/about.jsp, http://www.americanheart.org/cholesterol/about.jsp, http://www.clinchem.org/cgi/content/abstract/36/1/15 07:37:54 (6, 6, 6) (EDIT) User:ClueBot (contribs, talk) edited Cholesterol (diff, hist)
Changed: 'Section2' ('' -> '{{Chembox Properties', SET '{{Chembox Properties')07:37:54 (6, 6, 6) (EDIT) User:ClueBot (contribs, talk) edited Cholesterol (diff, hist)
Changed: 'Appearance' ('' -> 'white crystalline powder<ref name=MSDS>{{cite web |url=http://physchem.ox.ac.uk/MSDS/CH/cholesterol.html |title=Safety (MSDS) data for cholesterol |accessdate=2007-10-20 |work=}}</ref>', SET 'white crystalline powder<ref name=MSDS>{{cite web |url=http://physchem.ox.ac.uk/MSDS/CH/cholesterol.html |title=Safety (MSDS) data for cholesterol |accessdate=2007-10-20 |work=}}</ref>')07:37:54 (6, 6, 6) (EDIT) User:ClueBot (contribs, talk) edited Cholesterol (diff, hist)
Changed: 'Solubility' ('' -> '0.095 mg/L (30 °C)', SET '0.095 mg/L (30 °C)')07:37:55 (6, 6, 6) (EDIT) User:ClueBot (contribs, talk) edited Cholesterol (diff, hist)
Changed: 'SolubleOther' ('' -> 'soluble in [[acetone]], [[benzene]], [[chloroform]], [[ethanol]], [[ether]], [[hexane]], [[isopropyl myristate]], [[methanol]]', SET 'soluble in [[acetone]], [[benzene]], [[chloroform]], [[ethanol]], [[ether]], [[hexane]], [[isopropyl myristate]], [[methanol]]')07:37:56 (6, 6, 6) (EDIT) User:ClueBot (contribs, talk) edited Cholesterol (diff, hist)
Changed: 'Section7' ('' -> '{{Chembox Hazards', SET '{{Chembox Hazards')07:37:56 (6, 6, 6) (EDIT) User:ClueBot (contribs, talk) edited Cholesterol (diff, hist)
Changed: 'error' ('empty' -> '', SET '')07:37:57 (6, 6, 6) (EDIT) User:ClueBot (contribs, talk) edited Cholesterol (diff, hist)
Changed: 'IUPACName' ('' -> '(3β)-cholest-5-en-3-ol', SET '(3β)-cholest-5-en-3-ol')07:37:57 (6, 6, 6) (EDIT) User:ClueBot (contribs, talk) edited Cholesterol (diff, hist)
Changed: 'PubChem' ('' -> '5997', SET '5997')07:37:57 (6, 6, 6) (EDIT) User:ClueBot (contribs, talk) edited Cholesterol (diff, hist)
Changed: 'SMILES' ('' -> 'O[C@@H]4C/C3=C/C[C@@H]1[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@H](C)CCCC(C)C)C)[C@@]3(C)CC4', SET 'O[C@@H]4C/C3=C/C[C@@H]1[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@H](C)CCCC(C)C)C)[C@@]3(C)CC4')07:37:58 (6, 6, 6) (EDIT) User:ClueBot (contribs, talk) edited Cholesterol (diff, hist)
Changed: 'InChI' ('' -> '1/C27H46O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h9,18-19,21-25,28H,6-8,10-17H2,1-5H3/t19-,21+,22+,23-,24+,25+,26+,27-/m1/s1', SET '1/C27H46O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h9,18-19,21-25,28H,6-8,10-17H2,1-5H3/t19-,21+,22+,23-,24+,25+,26+,27-/m1/s1')07:37:58 (6, 6, 6) (EDIT) User:ClueBot (contribs, talk) edited Cholesterol (diff, hist)
Changed: 'ChemSpiderID' ('' -> '5775', SET '5775')07:37:58 (6, 6, 6) (EDIT) User:ClueBot (contribs, talk) edited Cholesterol (diff, hist)
Changed: 'Formula' ('' -> 'C<sub>27</sub>H<sub>46</sub>O', SET 'C<sub>27</sub>H<sub>46</sub>O')07:37:59 (6, 6, 6) (EDIT) User:ClueBot (contribs, talk) edited Cholesterol (diff, hist)
Changed: 'MolarMass' ('' -> '386.65 g/mol', SET '386.65 g/mol')07:38:01 (6, 6, 6) (EDIT) User:ClueBot (contribs, talk) edited Cholesterol (diff, hist)
Changed: 'Density' ('' -> '1.052 g/cm<sup>3</sup>', SET '1.052 g/cm<sup>3</sup>')07:38:01 (6, 6, 6) (EDIT) User:ClueBot (contribs, talk) edited Cholesterol (diff, hist)
Changed: 'MeltingPt' ('' -> '148â150 °C<ref name=MSDS/>', SET '148â150 °C<ref name=MSDS/>')07:38:02 (3, 2, 4) (EDIT) User:ClueBot (contribs, talk) edited Cholesterol (diff, hist)
Added links: http://www.lipidmaps.org/update/2009/090501/full/lipidmaps.2009.3.html, http://jn.nutrition.org/cgi/pmidlookup?view=long&pmid=9478044, http://www.ajcn.org/cgi/reprint/31/6/990, http://www.nal.usda.gov/fnic/foodcomp/Data/SR21/nutrlist/sr21w601.pdf, http://www.nhlbi.nih.gov/health/public/heart/chol/wyntk.htm, http://www.fasebj.org/cgi/pmidlookup?view=long&pmid=8001744, http://www.nhlbi.nih.gov/guidelines/cholesterol/atp3full.pdf07:38:02 (6, 6, 6) (EDIT) User:ClueBot (contribs, talk) edited Cholesterol (diff, hist)
Changed: 'BoilingPt' ('' -> '360 °C (decomposes)', SET '360 °C (decomposes)')07:38:02 (6, 6, 6) (EDIT) User:ClueBot (contribs, talk) edited Cholesterol (diff, hist)
Changed: 'CASNo' ('' -> '57-88-5', SET '57-88-5')07:45:58 (2, 4, 4) (EDIT) User:SmackBot (contribs, talk) edited Glycerol_3-phosphate (diff, hist)
Added: 'CASNo_Ref' ('{{cascite}}' -> '{{Cascite}}', SET '')07:56:18 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Glycerol_3-phosphate (diff, hist)
Added: 'CASNo_Ref' ('{{Cascite}}' -> '{{cascite}}', SET '')- 07:58:29 (2, 4, 5) (EDIT) User:RjwilmsiBot (contribs, talk) edited Arsenic_triselenide (diff, hist)
Changed: 'Reference' ('<ref name="hand">{{Citation | last = Lide | first = David R. | author-link = | year = 1998 | title = Handbook of Chemistry and Physics | edition = 87 | publication-place = Boca Raton, FL | publisher = CRC Press | isbn = 0849305942 | pages = 4-43}}</ref>' -> '<ref name="hand">{{Citation | last = Lide | first = David R. | author-link = | year = 1998 | title = Handbook of Chemistry and Physics | edition = 87 | publication-place = Boca Raton, FL | publisher = CRC Press | isbn = 0849305942 | pages = 4â43}}</ref>', SET '<ref name="hand">{{Citation | last = Lide | first = David R. | author-link = | year = 1998 | title = Handbook of Chemistry and Physics | edition = 87 | publication-place = Boca Raton, FL | publisher = CRC Press | isbn = 0849305942 | pages = 4-43}}</ref>') 08:04:22 (2, 4, 4) (EDIT) User:SmackBot (contribs, talk) edited Pyrazole (diff, hist)
Added: 'CASNo_Ref' ('{{cascite}}' -> '{{Cascite}}', SET '')08:08:59 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Arsenic_triselenide (diff, hist)
Added: 'verifiedrevid' ('' -> '299840390', SET '')08:08:59 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Arsenic_triselenide (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite}}', SET '')08:11:36 (2, 4, 4) (EDIT) User:SmackBot (contribs, talk) edited 20-alpha-Dihydroprogesterone (diff, hist)
Changed: 'CASNo_Ref' ('{{cascite}}' -> '{{Cascite}}', SET '{{cascite}}')08:13:05 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited 2-Pentanone (diff, hist)
Added: 'verifiedrevid' ('' -> '306539555', SET '')08:13:05 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited 2-Pentanone (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite}}', SET '')08:14:39 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Pyrazole (diff, hist)
Added: 'CASNo_Ref' ('{{Cascite}}' -> '{{cascite}}', SET '')08:15:11 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Pyridazine (diff, hist)
Added: 'verifiedrevid' ('' -> '308160392', SET '')08:15:11 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Pyridazine (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite}}', SET '')08:16:34 (2, 4, 4) (EDIT) User:SmackBot (contribs, talk) edited Quercitrin (diff, hist)
Added: 'CASNo_Ref' ('{{cascite}}' -> '{{Cascite}}', SET '')08:21:54 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited 20-alpha-Dihydroprogesterone (diff, hist)
Changed: 'CASNo_Ref' ('{{Cascite}}' -> '{{cascite}}', SET '{{cascite}}')08:23:09 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Quinazoline (diff, hist)
Added: 'verifiedrevid' ('' -> '306856916', SET '')08:23:09 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Quinazoline (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite}}', SET '')08:27:02 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Quercitrin (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')08:27:03 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Quercitrin (diff, hist)
Added: 'CASNo_Ref' ('{{Cascite}}' -> '{{cascite}}', SET '')- 08:34:30 (2, 3, 4) (EDIT) User:Shadowjams (contribs, talk) edited Propoxycaine (diff, hist)
Changed: 'OtherNames' ('hardycaine' -> '') 08:36:37 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Iprodione (diff, hist)
Added: 'verifiedrevid' ('' -> '308000591', SET '')08:36:37 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Iprodione (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite}}', SET '')08:58:16 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Nonene (diff, hist)
Added: 'verifiedrevid' ('' -> '310427623', SET '')08:58:16 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Nonene (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite}}', SET '')09:12:43 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Sodium_diethyldithiocarbamate (diff, hist)
Added: 'verifiedrevid' ('' -> '308944728', SET '')09:12:43 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Sodium_diethyldithiocarbamate (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite}}', SET '')09:17:13 (2, 4, 4) (EDIT) User:SmackBot (contribs, talk) edited Deoxyuridine (diff, hist)
Added: 'CASNo_Ref' ('{{cascite}}' -> '{{Cascite}}', SET '')09:27:14 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Deoxycytidine (diff, hist)
Added: 'verifiedrevid' ('' -> '299150465', SET '')09:27:15 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Deoxycytidine (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite}}', SET '')09:27:34 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Deoxyguanosine (diff, hist)
Added: 'verifiedrevid' ('' -> '299150481', SET '')09:27:34 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Deoxyguanosine (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite}}', SET '')09:27:44 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Deoxyuridine (diff, hist)
Added: 'CASNo_Ref' ('{{Cascite}}' -> '{{cascite}}', SET '')- 10:00:25 (4, 4, 5) (EDIT) User:213.243.241.88 (contribs, talk) edited 2-Methyl-2-butanol (diff, hist)
Changed: 'MolarMass' ('88.15 g/mol' -> '88.12 g/mol', SET '88.15 g/mol') - 10:49:57 (2, 3, 5) (EDIT) User:RjwilmsiBot (contribs, talk) edited Barium_iodide (diff, hist)
Changed: 'Reference' ('<ref name="hand">{{Citation | last = Lide | first = David R. | year = 1998 | title = Handbook of Chemistry and Physics | edition = 87 | publication-place = Boca Raton, FL | publisher = CRC Press | isbn = 0849305942 | pages = 4-44}}</ref>' -> '<ref name="hand">{{Citation | last = Lide | first = David R. | year = 1998 | title = Handbook of Chemistry and Physics | edition = 87 | publication-place = Boca Raton, FL | publisher = CRC Press | isbn = 0849305942 | pages = 4â44}}</ref>') - 10:50:12 (2, 3, 5) (EDIT) User:RjwilmsiBot (contribs, talk) edited Barium_sulfite (diff, hist)
Changed: 'SolubleOther' ('insoluble in [[ethanol]]<ref name="hand">{{Citation | last = Lide | first = David R. | author-link = | last2 = | first2 = | author2-link = | publication-date = | date = | year = 1998 | title = Handbook of Chemistry and Physics | edition = 87 | volume = | series = | publication-place = Boca Raton, FL | place = | publisher = CRC Press | id = | isbn = 0849305942 | doi = | oclc = | pages = 4-45 | url = | accessdate =}}</ref>' -> 'insoluble in [[ethanol]]<ref name="hand">{{Citation | last = Lide | first = David R. | author-link = | last2 = | first2 = | author2-link = | publication-date = | date = | year = 1998 | title = Handbook of Chemistry and Physics | edition = 87 | volume = | series = | publication-place = Boca Raton, FL | place = | publisher = CRC Press | id = | isbn = 0849305942 | doi = | oclc = | pages = 4â45 | url = | accessdate =}}</ref>') 11:00:04 (2, 4, 4) (EDIT) User:SmackBot (contribs, talk) edited Dicalcium_phosphate (diff, hist)
Changed: 'CASNo_Ref' ('{{cascite}}' -> '{{Cascite}}', SET '{{cascite}}')11:04:30 (2, 4, 4) (EDIT) User:SmackBot (contribs, talk) edited Digitonin (diff, hist)
Changed: 'CASNo_Ref' ('{{cascite}}' -> '{{Cascite}}', SET '{{cascite}}')11:08:19 (2, 4, 4) (EDIT) User:SmackBot (contribs, talk) edited Dioctyl_sebacate (diff, hist)
Added: 'CASNo_Ref' ('{{cascite}}' -> '{{Cascite}}', SET '')11:10:27 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Dicalcium_phosphate (diff, hist)
Changed: 'CASNo_Ref' ('{{Cascite}}' -> '{{cascite}}', SET '{{cascite}}')11:14:50 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Digitonin (diff, hist)
Changed: 'CASNo_Ref' ('{{Cascite}}' -> '{{cascite}}', SET '{{cascite}}')11:18:41 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Dioctyl_sebacate (diff, hist)
Added: 'CASNo_Ref' ('{{Cascite}}' -> '{{cascite}}', SET '')11:45:42 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 2C-T-17 (diff, hist)
Changed: 'InChIKey' ('' -> 'KSZHVRPGICAZOA-UHFFFAOYAV')11:45:42 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 2C-T-17 (diff, hist)
Changed: 'SMILES' ('C1(=CC(=C(C=C1CCN)OC)SC(CC)C)OC' -> 'CC(CC)Sc1cc(OC)c(cc1OC)CCN')11:45:42 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 2C-T-17 (diff, hist)
Changed: 'InChI' ('' -> '1/C14H23NO2S/c1-5-10(2)18-14-9-12(16-3)11(6-7-15)8-13(14)17-4/h8-10H,5-7,15H2,1-4H3')11:45:43 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 2C-T-17 (diff, hist)
Changed: 'ChemSpiderID' ('' -> '21106230')11:46:44 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 3,4-(Methylenedioxyphenyl)-2-propanone (diff, hist)
Changed: 'PubChem' ('' -> '78407')11:47:25 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 3,4-Dihydroxyphenylacetaldehyde (diff, hist)
Changed: 'InChIKey' ('' -> 'IADQVXRMSNIUEL-UHFFFAOYAV')11:47:26 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 3,4-Dihydroxyphenylacetaldehyde (diff, hist)
Changed: 'SMILES' ('C1=CC(=C(C=C1CC=O)O)O' -> 'O=CCc1cc(O)c(O)cc1')11:47:26 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 3,4-Dihydroxyphenylacetaldehyde (diff, hist)
Changed: 'InChI' ('' -> '1/C8H8O3/c9-4-3-6-1-2-7(10)8(11)5-6/h1-2,4-5,10-11H,3H2')11:47:26 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 3,4-Dihydroxyphenylacetaldehyde (diff, hist)
Changed: 'ChemSpiderID' ('' -> '106504')11:51:13 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 3-Amino-5-nitrosalicylic_acid (diff, hist)
Changed: 'InChIKey' ('' -> 'JFTUSFFYSRNFBA-UHFFFAOYAS')11:51:14 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 3-Amino-5-nitrosalicylic_acid (diff, hist)
Changed: 'SMILES' ('Nc1cc(cc(C(O)=O)c1O)[N+]([O-])=O' -> '[O-][N+](=O)c1cc(C(=O)O)c(O)c(N)c1')11:51:14 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 3-Amino-5-nitrosalicylic_acid (diff, hist)
Changed: 'InChI' ('' -> '1/C7H6N2O5/c8-5-2-3(9(13)14)1-4(6(5)10)7(11)12/h1-2,10H,8H2,(H,11,12)')11:51:14 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 3-Amino-5-nitrosalicylic_acid (diff, hist)
Changed: 'ChemSpiderID' ('' -> '4271595')11:53:13 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 3-Hydroxykynurenine (diff, hist)
Changed: 'ChemSpiderID' ('' -> '87')11:53:43 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 3-Hydroxykynurenine (diff, hist)
Changed: 'InChIKey' ('' -> 'VCKPUUFAIGNJHC-UHFFFAOYAF')11:53:43 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 3-Hydroxykynurenine (diff, hist)
Changed: 'SMILES' ('C1=CC(=C(C(=C1)O)N)C(=O)CC(C(=O)O)N' -> 'O=C(O)C(N)CC(=O)c1cccc(O)c1N')11:53:43 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 3-Hydroxykynurenine (diff, hist)
Changed: 'InChI' ('' -> '1/C10H12N2O4/c11-6(10(15)16)4-8(14)5-2-1-3-7(13)9(5)12/h1-3,6,13H,4,11-12H2,(H,15,16)')12:24:20 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 3-Methylglutaconic_acid (diff, hist)
Changed: 'ChemSpiderID' ('' -> '1267861')12:24:35 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 3-Methylglutaconic_acid (diff, hist)
Changed: 'InChIKey' ('' -> 'WKRBKYFIJPGYQC-DUXPYHPUBK')12:24:35 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 3-Methylglutaconic_acid (diff, hist)
Changed: 'SMILES' ('CC(=CC(=O)O)CC(=O)O' -> 'O=C(O)CC(=C\C(=O)O)\C')12:24:36 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 3-Methylglutaconic_acid (diff, hist)
Changed: 'InChI' ('' -> '1/C6H8O4/c1-4(2-5(7)8)3-6(9)10/h2H,3H2,1H3,(H,7,8)(H,9,10)/b4-2+')12:27:52 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 3-Oxetanone (diff, hist)
Changed: 'InChIKey' ('' -> 'ROADCYAOHVSOLQ-UHFFFAOYAK')12:27:52 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 3-Oxetanone (diff, hist)
Changed: 'InChI' ('InChI=1S/C3H4O2/c4-3-1-5-2-3/h1-2H2' -> '1/C3H4O2/c4-3-1-5-2-3/h1-2H2')12:29:45 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 3C-BZ (diff, hist)
Changed: 'InChIKey' ('' -> 'IQKPLBJGFPDASR-UHFFFAOYAD')12:29:45 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 3C-BZ (diff, hist)
Changed: 'SMILES' ('C1=C(C(=C(C=C1CC(C)N)OC)OCC2=CC=CC=C2)OC' -> 'CC(N)Cc2cc(OC)c(OCc1ccccc1)c(c2)OC')12:29:46 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 3C-BZ (diff, hist)
Changed: 'InChI' ('' -> '1/C18H23NO3/c1-13(19)9-15-10-16(20-2)18(17(11-15)21-3)22-12-14-7-5-4-6-8-14/h4-8,10-11,13H,9,12,19H2,1-3H3')12:29:46 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 3C-BZ (diff, hist)
Changed: 'ChemSpiderID' ('' -> '21106236')12:30:24 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 3C-E (diff, hist)
Changed: 'InChIKey' ('' -> 'AHLXCGRWNKUNTQ-UHFFFAOYAM')12:30:24 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 3C-E (diff, hist)
Changed: 'SMILES' ('NC(C)CC1=CC(OC)=C(OCC)C(OC)=C1' -> 'CCOc1c(cc(cc1OC)CC(C)N)OC')12:30:24 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 3C-E (diff, hist)
Changed: 'InChI' ('' -> '1/C13H21NO3/c1-5-17-13-11(15-3)7-10(6-9(2)14)8-12(13)16-4/h7-9H,5-6,14H2,1-4H3')12:30:25 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 3C-E (diff, hist)
Changed: 'ChemSpiderID' ('' -> '21106237')12:32:12 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-(4-Methylphenyl)-4-oxobutanoic_acid (diff, hist)
Changed: 'InChIKey' ('' -> 'OEEUWZITKKSXAZ-UHFFFAOYAH')12:35:15 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Dimethylaminophenol (diff, hist)
Changed: 'InChIKey' ('' -> 'JVVRCYWZTJLJSG-UHFFFAOYAU')12:35:15 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Dimethylaminophenol (diff, hist)
Changed: 'PubChem' ('164849' -> '22174')12:35:16 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Dimethylaminophenol (diff, hist)
Changed: 'SMILES' ('CN(C)c1ccc(O)cc1' -> 'Oc1ccc(N(C)C)cc1')12:35:16 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Dimethylaminophenol (diff, hist)
Changed: 'InChI' ('' -> '1/C8H11NO/c1-9(2)7-3-5-8(10)6-4-7/h3-6,10H,1-2H3')12:35:16 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Dimethylaminophenol (diff, hist)
Changed: 'ChemSpiderID' ('' -> '20816')- 12:44:25 (3, 2, 4) (EDIT) User:Wickey-nl (contribs, talk) edited Phenylacetylcarbinol (diff, hist)
Added links: http://www.agro.cmu.ac.th/department/fe/JANoppol/NoppolThesis.pdf 13:06:30 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Ethylbenzaldehyde (diff, hist)
Changed: 'InChIKey' ('' -> 'QNGNSVIICDLXHT-UHFFFAOYAN')13:06:31 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Ethylbenzaldehyde (diff, hist)
Changed: 'InChI' ('InChI=1S/C9H10O/c1-2-8-3-5-9(7-10)6-4-8/h3-7H,2H2,1H3' -> '1/C9H10O/c1-2-8-3-5-9(7-10)6-4-8/h3-7H,2H2,1H3')13:10:05 (4, 4, 4) (EDIT) User:Edgar181 (contribs, talk) edited 2-Methyl-2-butanol (diff, hist)
Added: 'C' ('' -> '5', SET '')13:10:06 (4, 4, 4) (EDIT) User:Edgar181 (contribs, talk) edited 2-Methyl-2-butanol (diff, hist)
Added: 'H' ('' -> '12', SET '')13:10:06 (4, 4, 4) (EDIT) User:Edgar181 (contribs, talk) edited 2-Methyl-2-butanol (diff, hist)
Added: 'O' ('' -> '1', SET '')13:10:06 (4, 5, 4) (EDIT) User:Edgar181 (contribs, talk) edited 2-Methyl-2-butanol (diff, hist)
Deleted: 'Formula' ('C<sub>5</sub>H<sub>12</sub>O' -> '', SET 'C<sub>5</sub>H<sub>12</sub>O')13:10:06 (4, 5, 4) (EDIT) User:Edgar181 (contribs, talk) edited 2-Methyl-2-butanol (diff, hist)
Deleted: 'MolarMass' ('88.12 g/mol' -> '', SET '88.15 g/mol')13:11:21 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-HO-MET (diff, hist)
Changed: 'InChIKey' ('' -> 'ORWQBKPSGDRPPA-UHFFFAOYAM')13:11:22 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-HO-MET (diff, hist)
Changed: 'SMILES' ('' -> 'CCN(C)CCc2cnc1cccc(O)c12')13:11:22 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-HO-MET (diff, hist)
Changed: 'InChI' ('' -> '1/C13H18N2O/c1-3-15(2)8-7-10-9-14-11-5-4-6-12(16)13(10)11/h4-6,9,14,16H,3,7-8H2,1-2H3')13:11:22 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-HO-MET (diff, hist)
Changed: 'ChemSpiderID' ('' -> '10513072')13:11:49 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-HO-MPT (diff, hist)
Changed: 'InChIKey' ('' -> 'XFQDDPQGBLSNCN-UHFFFAOYAC')13:11:49 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-HO-MPT (diff, hist)
Changed: 'SMILES' ('' -> 'CCCN(C)CCc2cnc1cccc(O)c12')13:11:49 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-HO-MPT (diff, hist)
Changed: 'InChI' ('' -> '1/C14H20N2O/c1-3-8-16(2)9-7-11-10-15-12-5-4-6-13(17)14(11)12/h4-6,10,15,17H,3,7-9H2,1-2H3')13:11:49 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-HO-MPT (diff, hist)
Changed: 'ChemSpiderID' ('' -> '10513074')13:13:28 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-HO-pyr-T (diff, hist)
Changed: 'InChIKey' ('' -> 'XASLPZWIPBCAPF-UHFFFAOYAH')13:13:28 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-HO-pyr-T (diff, hist)
Changed: 'SMILES' ('C1CCN(C1)CCC2=CNC3=C2C(=CC=C3)O' -> 'Oc2cccc3ncc(CCN1CCCC1)c23')13:13:28 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-HO-pyr-T (diff, hist)
Changed: 'InChI' ('' -> '1/C14H18N2O/c17-13-5-3-4-12-14(13)11(10-15-12)6-9-16-7-1-2-8-16/h3-5,10,15,17H,1-2,6-9H2')13:13:29 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-HO-pyr-T (diff, hist)
Changed: 'ChemSpiderID' ('' -> '10579820')13:14:18 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Hydroxy-3-nitrobenzenearsonic_acid (diff, hist)
Changed: 'InChIKey' ('' -> 'XMVJITFPVVRMHC-UHFFFAOYAF')13:14:18 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Hydroxy-3-nitrobenzenearsonic_acid (diff, hist)
Changed: 'SMILES' ('' -> 'O=[N+]([O-])c1cc(ccc1O)[As](=O)(O)O')13:14:19 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Hydroxy-3-nitrobenzenearsonic_acid (diff, hist)
Changed: 'InChI' ('' -> '1/C6H6AsNO6/c9-6-2-1-4(7(10,11)12)3-5(6)8(13)14/h1-3,9H,(H2,10,11,12)')13:14:19 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Hydroxy-3-nitrobenzenearsonic_acid (diff, hist)
Changed: 'ChemSpiderID' ('' -> '4925')13:15:44 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Hydroxynonenal (diff, hist)
Changed: 'InChIKey' ('' -> 'JVJFIQYAHPMBBX-FNORWQNLBE')13:15:45 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Hydroxynonenal (diff, hist)
Changed: 'InChI' ('' -> '1/C9H16O2/c1-2-3-4-6-9(11)7-5-8-10/h5,7-9,11H,2-4,6H2,1H3/b7-5+')13:15:45 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Hydroxynonenal (diff, hist)
Changed: 'ChemSpiderID' ('' -> '4446465')13:16:14 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Dimethoxymethane (diff, hist)
Added: 'verifiedrevid' ('' -> '265808497', SET '')13:16:15 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Dimethoxymethane (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite}}', SET '')13:16:25 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited 2-Methyl-1-butanol (diff, hist)
Changed: 'FlashPt' ('50°C' -> '50 °C')13:16:25 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited 2-Methyl-1-butanol (diff, hist)
Changed: 'Autoignition' ('385°C' -> '385 °C')13:16:26 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited 2-Methyl-1-butanol (diff, hist)
Changed: 'MeltingPt' ('-117.2°C' -> '')13:16:26 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited 2-Methyl-1-butanol (diff, hist)
Changed: 'MeltingPtC' ('' -> '-117.2')13:16:26 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited 2-Methyl-1-butanol (diff, hist)
Changed: 'BoilingPt' ('127.5°C' -> '')13:16:27 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited 2-Methyl-1-butanol (diff, hist)
Changed: 'BoilingPtC' ('' -> '127.5')13:16:50 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Hydroxyphenylpyruvic_acid (diff, hist)
Changed: 'ChemSpiderID' ('' -> '954')13:17:03 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Hydroxyphenylpyruvic_acid (diff, hist)
Changed: 'InChIKey' ('' -> 'KKADPXVIOXHVKN-UHFFFAOYAH')13:17:03 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Hydroxyphenylpyruvic_acid (diff, hist)
Changed: 'SMILES' ('C1=CC(=CC=C1CC(=O)C(=O)O)O' -> 'O=C(O)C(=O)Cc1ccc(O)cc1')13:17:03 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Hydroxyphenylpyruvic_acid (diff, hist)
Changed: 'InChI' ('' -> '1/C9H8O4/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,10H,5H2,(H,12,13)')13:17:15 (2, 3, 4) (EDIT) User:Citation bot (contribs, talk) edited 2-Methyl-1-butanol (diff, hist)
Changed: 'Reference' ('<ref name="hand">{{Citation | last = Lide | first = David R. | author-link = | last2 = | first2 = | author2-link = | publication-date = | date = | year = 1998 | title = Handbook of Chemistry and Physics | edition = 87 | volume = | series = | publication-place = Boca Raton, FL | place = | publisher = CRC Press | id = | isbn = 0849305942 | doi = | oclc = | pages = 3-374, 5-42, 6-188, 8-102, 16-22 | url = | accessdate =}}</ref><ref name="encyc">{{Citation | last = McKetta | first = John J. | author-link = | last2 = Cunningham | first2 = William Aaron | author2-link = | publication-date = | date = | year = 1977 | title = Encyclopedia of Chemical Processing and Design | edition = | volume = 3 | series = | publication-place = Boca Raton, FL | place = | publisher = CRC Press | id = | isbn = 9780824724801 | doi = | oclc = | pages = 279-280 | url = http://books.google.com/books?id=iwSU5G5VzO0C&pg=PA279 | accessdate = 2009-12-14}}</ref>' -> '<ref name="hand">{{Citation | last = Lide | first = David R. | author-link = | last2 = | first2 = | author2-link = | publication-date = | date = | year = 1998 | title = Handbook of Chemistry and Physics | edition = 87 | volume = | series = | publication-place = Boca Raton, FL | place = | publisher = CRC Press | id = | isbn = 0849305942 | doi = | oclc = | pages = 3â374, 5â42, 6â188, 8â102, 16â22 | url = | accessdate =}}</ref><ref name="encyc">{{Citation | last = McKetta | first = John J. | author-link = | last2 = Cunningham | first2 = William Aaron | author2-link = | publication-date = | date = | year = 1977 | title = Encyclopedia of Chemical Processing and Design | edition = | volume = 3 | series = | publication-place = Boca Raton, FL | place = | publisher = CRC Press | id = | isbn = 9780824724801 | doi = | oclc = | pages = 279â280 | url = http://books.google.com/books?id=iwSU5G5VzO0C&pg=PA279 | accessdate = 2009-12-14}}</ref>')13:18:28 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Hydroxytestosterone (diff, hist)
Changed: 'InChIKey' ('' -> 'BQOIJSIMMIDHMO-FBPKJDBXBD')13:18:29 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Hydroxytestosterone (diff, hist)
Changed: 'PubChem' ('' -> '160615')13:18:29 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Hydroxytestosterone (diff, hist)
Changed: 'SMILES' ('[H][C@]34[C@]2([H])CCC1=C(O)C(CC[C@@](C)1[C@]([H])2CC[C@@](C)3[C@@H](O)CC4)=O' -> 'O=C4C(\O)=C2/[C@]([C@H]1CC[C@@]3([C@@H](O)CC[C@H]3[C@@H]1CC2)C)(C)CC4')13:18:29 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Hydroxytestosterone (diff, hist)
Changed: 'InChI' ('' -> '1/C19H28O3/c1-18-10-8-15(20)17(22)14(18)4-3-11-12-5-6-16(21)19(12,2)9-7-13(11)18/h11-13,16,21-22H,3-10H2,1-2H3/t11-,12-,13-,16-,18+,19-/m0/s1')13:18:30 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Hydroxytestosterone (diff, hist)
Changed: 'ChemSpiderID' ('' -> '141138')13:19:28 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Maleylacetoacetate (diff, hist)
Changed: 'ChemSpiderID' ('' -> '4444078')13:19:42 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Maleylacetoacetate (diff, hist)
Changed: 'InChIKey' ('' -> 'GACSIVHAIFQKTC-UPHRSURJBV')13:19:42 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Maleylacetoacetate (diff, hist)
Changed: 'SMILES' ('C(C(=O)CC(=O)O)C(=O)C=CC(=O)O' -> 'O=C(/C=C\C(=O)O)CC(=O)CC(=O)O')13:19:43 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Maleylacetoacetate (diff, hist)
Changed: 'InChI' ('' -> '1/C8H8O6/c9-5(1-2-7(11)12)3-6(10)4-8(13)14/h1-2H,3-4H2,(H,11,12)(H,13,14)/b2-1-')13:20:14 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-MeO-MiPT (diff, hist)
Changed: 'InChIKey' ('' -> 'BJIWLHLNPTWSGD-UHFFFAOYAK')13:20:14 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-MeO-MiPT (diff, hist)
Changed: 'SMILES' ('' -> 'CC(C)N(C)CCc2cnc1cccc(OC)c12')13:20:15 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-MeO-MiPT (diff, hist)
Changed: 'InChI' ('' -> '1/C15H22N2O/c1-11(2)17(3)9-8-12-10-16-13-6-5-7-14(18-4)15(12)13/h5-7,10-11,16H,8-9H2,1-4H3')13:20:15 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-MeO-MiPT (diff, hist)
Changed: 'ChemSpiderID' ('' -> '21106243')13:24:17 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Methylbenzylidene_camphor (diff, hist)
Changed: 'ChemSpiderID' ('' -> '4939160')13:24:39 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Methylbenzylidene_camphor (diff, hist)
Changed: 'InChIKey' ('' -> 'HEOCBCNFKCOKBX-SDNWHVSQBW')13:24:39 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Methylbenzylidene_camphor (diff, hist)
Changed: 'SMILES' ('CC1=CC=C(C=C1)C=C2C3CCC(C2=O)(C3(C)C)C' -> 'O=C2\C(=C\c1ccc(cc1)C)C3CCC2(C)C3(C)C')13:24:40 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Methylbenzylidene_camphor (diff, hist)
Changed: 'InChI' ('' -> '1/C18H22O/c1-12-5-7-13(8-6-12)11-14-15-9-10-18(4,16(14)19)17(15,2)3/h5-8,11,15H,9-10H2,1-4H3/b14-11+')13:25:20 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Methylpyridine (diff, hist)
Changed: 'ChemSpiderID' ('' -> '7675')13:25:48 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Nitrophenol (diff, hist)
Changed: 'InChIKey' ('' -> 'BTJIUGUIPKRLHP-UHFFFAOYAP')13:25:49 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Nitrophenol (diff, hist)
Changed: 'PubChem' ('' -> '980')13:25:49 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Nitrophenol (diff, hist)
Changed: 'SMILES' ('OC1=CC=C([N+]([O-])=O)C=C1' -> 'O=[N+]([O-])c1ccc(O)cc1')13:25:49 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Nitrophenol (diff, hist)
Changed: 'InChI' ('' -> '1/C6H5NO3/c8-6-3-1-5(2-4-6)7(9)10/h1-4,8H')13:26:32 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Phenyl-1,2,4-triazole-3,5-dione (diff, hist)
Changed: 'InChIKey' ('' -> 'ISULLEUFOQSBGY-UHFFFAOYAD')13:26:33 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Phenyl-1,2,4-triazole-3,5-dione (diff, hist)
Changed: 'SMILES' ('' -> 'O=C2/N=N\C(=O)N2c1ccccc1')13:26:33 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Phenyl-1,2,4-triazole-3,5-dione (diff, hist)
Changed: 'InChI' ('' -> '1/C8H5N3O2/c12-7-9-10-8(13)11(7)6-4-2-1-3-5-6/h1-5H')13:26:33 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Phenyl-1,2,4-triazole-3,5-dione (diff, hist)
Changed: 'ChemSpiderID' ('' -> '70304')13:27:12 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Piperidinone (diff, hist)
Changed: 'InChIKey' ('' -> 'VRJHQPZVIGNGMX-UHFFFAOYAC')13:27:12 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Piperidinone (diff, hist)
Changed: 'SMILES' ('C1CNCCC1=O' -> 'O=C1CCNCC1')13:27:12 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Piperidinone (diff, hist)
Changed: 'InChI' ('' -> '1/C5H9NO/c7-5-1-3-6-4-2-5/h6H,1-4H2')13:27:13 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 4-Piperidinone (diff, hist)
Changed: 'ChemSpiderID' ('' -> '31091')13:27:47 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 5,12-Bis(phenylethynyl)naphthacene (diff, hist)
Changed: 'InChIKey' ('' -> 'OUHYGBCAEPBUNA-UHFFFAOYAO')13:27:47 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 5,12-Bis(phenylethynyl)naphthacene (diff, hist)
Changed: 'SMILES' ('c12ccccc1cc3c(c(C#Cc6ccccc6)c(cccc5)c5c3C#Cc4ccccc4)c2' -> 'C(#Cc1ccccc1)c5c2ccccc2c(C#Cc3ccccc3)c6cc4ccccc4cc56')13:27:48 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 5,12-Bis(phenylethynyl)naphthacene (diff, hist)
Changed: 'ChemSpiderID' ('' -> '79226')13:28:21 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 5,7-Dihydroxytryptamine (diff, hist)
Changed: 'InChIKey' ('' -> 'LXWHQTNFZDTKBH-UHFFFAOYAC')13:28:22 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 5,7-Dihydroxytryptamine (diff, hist)
Changed: 'SMILES' ('C1=C(C=C2C(=CNC2=C1O)CCN)O' -> 'Oc1cc2c(c(O)c1)ncc2CCN')13:28:22 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 5,7-Dihydroxytryptamine (diff, hist)
Changed: 'InChI' ('' -> '1/C10H12N2O2/c11-2-1-6-5-12-10-8(6)3-7(13)4-9(10)14/h3-5,12-14H,1-2,11H2')13:28:22 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 5,7-Dihydroxytryptamine (diff, hist)
Changed: 'ChemSpiderID' ('' -> '32913')13:40:28 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Salvinorin_A (diff, hist)
Changed: 'BoilingPt' ('760.2 °C( Estimation by the Joback Method)' -> '760.2 °C (estimation by the [[Joback method]])')14:02:32 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Pregnenolone_sulfate (diff, hist)
Changed: 'ImageFile' ('' -> 'Pregnenolone sulfate.png')14:02:32 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Pregnenolone_sulfate (diff, hist)
Changed: 'ImageSize' ('' -> '200px')14:02:33 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Pregnenolone_sulfate (diff, hist)
Changed: 'OtherNames' ('' -> 'Pregn-sulf; Pregnenolone monosulfate; Pregnenolone hydrogen sulfate; Pregnenolone 3β-sulfate; 5-Pregnen-3β-ol-20-one sulfate; (3β)-3-(Sulfooxy)pregn-5-en-20-one; 5-Pregnen-3β-sulfate-20-one; 20-Oxo-5-pregnen-3β-yl sulfate')14:02:33 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Pregnenolone_sulfate (diff, hist)
Changed: 'S' ('' -> '1')14:02:33 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Pregnenolone_sulfate (diff, hist)
Changed: 'C' ('' -> '21')14:02:33 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Pregnenolone_sulfate (diff, hist)
Changed: 'H' ('' -> '32')14:02:34 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Pregnenolone_sulfate (diff, hist)
Changed: 'O' ('' -> '5')14:02:34 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Pregnenolone_sulfate (diff, hist)
Changed: 'IUPACName' ('' -> '[(3''S'',8''S'',9''S'',10''R'',13''S'',14''S'',17''S'')-17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1''H''-cyclopenta[''a'']phenanthren-3-yl] hydrogen sulfate')14:02:34 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Pregnenolone_sulfate (diff, hist)
Changed: 'SMILES' ('CC(=O)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)OS(=O)(=O)O)C)C' -> 'CC(=O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)OS(=O)(=O)O)C)C')14:02:35 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Pregnenolone_sulfate (diff, hist)
Changed: 'Formula' ('C<sub>21</sub>H<sub>32</sub>O<sub>5</sub>S' -> '')14:02:35 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Pregnenolone_sulfate (diff, hist)
Changed: 'MolarMass' ('396.54078' -> '')14:02:35 (5, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Pregnenolone_sulfate (diff, hist)
Changed: 'CASNo' ('' -> '1247-64-9')14:55:57 (2, 4, 4) (EDIT) User:SmackBot (contribs, talk) edited Ethion (diff, hist)
Added: 'CASNo_Ref' ('{{cascite}}' -> '{{Cascite}}', SET '')15:06:51 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Ethion (diff, hist)
Added: 'CASNo_Ref' ('{{Cascite}}' -> '{{cascite}}', SET '')15:07:25 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Ethylparaben (diff, hist)
Added: 'verifiedrevid' ('' -> '306608602', SET '')15:07:26 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Ethylparaben (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite}}', SET '')15:08:03 (2, 4, 4) (EDIT) User:SmackBot (contribs, talk) edited Sodium_periodate (diff, hist)
Added: 'CASNo_Ref' ('{{cascite}}' -> '{{Cascite}}', SET '')15:09:08 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 5-MeO-NMT (diff, hist)
Changed: 'InChIKey' ('' -> 'NFDDCRIHMZGWBP-UHFFFAOYAI')15:09:08 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 5-MeO-NMT (diff, hist)
Changed: 'PubChem' ('' -> '16184')15:09:08 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 5-MeO-NMT (diff, hist)
Changed: 'SMILES' ('' -> 'O(c1cc2c(cc1)ncc2CCNC)C')15:09:09 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 5-MeO-NMT (diff, hist)
Changed: 'InChI' ('' -> '1/C12H16N2O/c1-13-6-5-9-8-14-12-4-3-10(15-2)7-11(9)12/h3-4,7-8,13-14H,5-6H2,1-2H3')15:09:09 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 5-MeO-NMT (diff, hist)
Changed: 'ChemSpiderID' ('' -> '15360')15:10:01 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 5-MeO-pyr-T (diff, hist)
Changed: 'InChIKey' ('' -> 'KAASYKNZNPWPQG-UHFFFAOYAA')15:10:02 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 5-MeO-pyr-T (diff, hist)
Changed: 'SMILES' ('COC1=CC2=C(C=C1)NC=C2CCN3CCCC3' -> 'O(c3ccc1c(c(cn1)CCN2CCCC2)c3)C')15:10:02 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 5-MeO-pyr-T (diff, hist)
Changed: 'InChI' ('' -> '1/C15H20N2O/c1-18-13-4-5-15-14(10-13)12(11-16-15)6-9-17-7-2-3-8-17/h4-5,10-11,16H,2-3,6-9H2,1H3')15:10:02 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 5-MeO-pyr-T (diff, hist)
Changed: 'ChemSpiderID' ('' -> '16153')15:10:43 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 5-MeS-DMT (diff, hist)
Changed: 'InChIKey' ('' -> 'YOGJZQGRTVMCPY-UHFFFAOYAL')15:10:43 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 5-MeS-DMT (diff, hist)
Changed: 'PubChem' ('' -> '21180')15:10:44 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 5-MeS-DMT (diff, hist)
Changed: 'SMILES' ('' -> 'S(c1cc2c(cc1)ncc2CCN(C)C)C')15:10:44 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 5-MeS-DMT (diff, hist)
Changed: 'InChI' ('' -> '1/C13H18N2S/c1-15(2)7-6-10-9-14-13-5-4-11(16-3)8-12(10)13/h4-5,8-9,14H,6-7H2,1-3H3')15:10:44 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 5-MeS-DMT (diff, hist)
Changed: 'ChemSpiderID' ('' -> '19917')15:13:25 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 5-Methyltetrahydrofolate (diff, hist)
Changed: 'InChIKey' ('' -> 'ZNOVTXRBGFNYRX-ZGTCLIOFBZ')15:13:26 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 5-Methyltetrahydrofolate (diff, hist)
Changed: 'SMILES' ('CN1C(CNC2=C1C(=O)N=C(N2)N)CNC3=CC=C(C=C3)C(=O)N[C@@H](CCC(=O)O)C(=O)O' -> 'O=C(O)[C@H](NC(=O)c1ccc(cc1)NCC3N(/C2=C(/N/C(=N\C2=O)N)NC3)C)CCC(=O)O')15:13:26 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 5-Methyltetrahydrofolate (diff, hist)
Changed: 'InChI' ('' -> '1/C20H25N7O6/c1-27-12(9-23-16-15(27)18(31)26-20(21)25-16)8-22-11-4-2-10(3-5-11)17(30)24-13(19(32)33)6-7-14(28)29/h2-5,12-13,22H,6-9H2,1H3,(H,24,30)(H,28,29)(H,32,33)(H4,21,23,25,26,31)/t12?,13-/m1/s1')15:13:26 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 5-Methyltetrahydrofolate (diff, hist)
Changed: 'ChemSpiderID' ('' -> '388371')15:14:10 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 5-Methyluridine (diff, hist)
Changed: 'InChIKey' ('' -> 'DWRXFEITVBNRMK-AZRUVXNYBS')15:14:10 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 5-Methyluridine (diff, hist)
Changed: 'SMILES' ('CC1=CN(C(=O)NC1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O' -> 'O=C/1NC(=O)N(\C=C\1C)[C@H]2O[C@H]([C@H](O)[C@@H]2O)CO')15:14:11 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 5-Methyluridine (diff, hist)
Changed: 'InChI' ('' -> '1/C10H14N2O6/c1-4-2-12(10(17)11-8(4)16)9-7(15)6(14)5(3-13)18-9/h2,5-7,9,13-15H,3H2,1H3,(H,11,16,17)/t5-,6-,7-,9-/m0/s1')15:14:11 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 5-Methyluridine (diff, hist)
Changed: 'ChemSpiderID' ('' -> '1363755')15:14:38 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 5-Nitro-2-propoxyaniline (diff, hist)
Changed: 'InChIKey' ('' -> 'RXQCEGOUSFBKPI-UHFFFAOYAU')15:14:38 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 5-Nitro-2-propoxyaniline (diff, hist)
Changed: 'SMILES' ('NC1=CC([N+]([O-])=O)=CC=C1OCCC' -> '[O-][N+](=O)c1ccc(OCCC)c(c1)N')15:14:39 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 5-Nitro-2-propoxyaniline (diff, hist)
Changed: 'InChI' ('' -> '1/C9H12N2O3/c1-2-5-14-9-4-3-7(11(12)13)6-8(9)10/h3-4,6H,2,5,10H2,1H3')15:14:39 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited 5-Nitro-2-propoxyaniline (diff, hist)
Changed: 'ChemSpiderID' ('' -> '10647')15:17:06 (2, 5, 4) (EDIT) User:Smokefoot (contribs, talk) edited Sodium_diethyldithiocarbamate (diff, hist)
Changed: 'verifiedrevid' ('308944728' -> '', SET '')15:17:06 (2, 5, 4) (EDIT) User:Smokefoot (contribs, talk) edited Sodium_diethyldithiocarbamate (diff, hist)
Changed: 'CASNo_Ref' ('{{cascite}}' -> '', SET '')15:17:06 (4, 5, 4) (EDIT) User:Smokefoot (contribs, talk) edited Sodium_diethyldithiocarbamate (diff, hist)
Added: 'IUPACName' ('' -> 'sodium (diethylcarbamothioyl)sulfanide', SET '')15:18:46 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Sodium_periodate (diff, hist)
Added: 'CASNo_Ref' ('{{Cascite}}' -> '{{cascite}}', SET '')15:28:49 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Sodium_diethyldithiocarbamate (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')15:28:49 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Sodium_diethyldithiocarbamate (diff, hist)
Added: 'verifiedrevid' ('' -> '308944728', SET '')15:28:50 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Sodium_diethyldithiocarbamate (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite}}', SET '')16:18:54 (2, 4, 4) (EDIT) User:SmackBot (contribs, talk) edited Terpinen-4-ol (diff, hist)
Added: 'CASNo_Ref' ('{{cascite}}' -> '{{Cascite}}', SET '')16:29:27 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Terpinen-4-ol (diff, hist)
Added: 'CASNo_Ref' ('{{Cascite}}' -> '{{cascite}}', SET '')