From Wikipedia, the free encyclopedia
5-Hydroxyferulic acid
|
Names
|
IUPAC name
(E)-3-(3,4-dihydroxy-5-methoxyphenyl)prop-2-enoic acid
|
Identifiers
|
|
|
|
|
ChEBI
|
|
ChemSpider
|
|
ECHA InfoCard
|
100.230.072
|
|
|
|
|
InChI=1S/C10H10O5/c1-15-8-5-6(2-3-9(12)13)4-7(11)10(8)14/h2-5,11,14H,1H3,(H,12,13)/b3-2+ Key: YFXWTVLDSKSYLW-NSCUHMNNSA-N InChI=1/C10H10O5/c1-15-8-5-6(2-3-9(12)13)4-7(11)10(8)14/h2-5,11,14H,1H3,(H,12,13)/b3-2+ Key: YFXWTVLDSKSYLW-NSCUHMNNBP
|
O=C(O)\C=C\c1cc(O)c(O)c(OC)c1
|
Properties
|
|
C10H10O5
|
Molar mass
|
210.18 g/mol
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Chemical compound
5-Hydroxyferulic acid is a hydroxycinnamic acid.
It is a precursor in the biosynthesis of sinapic acid. Phenylalanine is first converted to cinnamic acid by the action of the enzyme phenylalanine ammonia-lyase (PAL). A series of enzymatic hydroxylations and methylations leads to coumaric acid, caffeic acid, ferulic acid, 5-hydroxyferulic acid and sinapic acid.
Thus 5-hydroxyferulic acid is formed from ferulic acid by the action of the specific enzyme ferulate 5-hydroxylase (F5H).
References
|
---|
Aglycones | Precursor | |
---|
Monohydroxycinnamic acids (Coumaric acids) | |
---|
Dihydroxycinnamic acids | |
---|
Trihydroxycinnamic acids | |
---|
O-methylated forms | |
---|
others | |
---|
|
---|
Esters | glycoside-likes | Esters of caffeic acid with cyclitols | |
---|
Glycosides | |
---|
|
---|
Tartaric acid esters | |
---|
Other esters with caffeic acid | |
---|
Caffeoyl phenylethanoid glycoside (CPG) |
- Echinacoside
- Calceolarioside A, B, C, F
- Chiritoside A, B, C
- Cistanoside A, B, C, D, E, F, G, H
- Conandroside
- Myconoside
- Pauoifloside
- Plantainoside A
- Plantamajoside
- Tubuloside B
- Verbascoside (Isoverbascoside, 2′-Acetylverbascoside)
|
---|
|
---|
Oligomeric forms | Dimers |
- Diferulic acids (DiFA) : 5,5′-Diferulic acid, 8-O-4′-Diferulic acid, 8,5′-Diferulic acid, 8,5′-DiFA (DC), 8,5′-DiFA (BF), 8,8′-Diferulic acid
|
---|
Trimers | |
---|
Tetramers | |
---|
|
---|
Conjugates with coenzyme A (CoA) | |
---|