Jump to content

Cadralazine

From Wikipedia, the free encyclopedia

This is an old revision of this page, as edited by DePiep (talk | contribs) at 15:31, 2 April 2016 (Remove redundant parameters InChI, InChIKey (StdInChI, StdInChIKey are used). See Talk (via AWB script)). The present address (URL) is a permanent link to this revision, which may differ significantly from the current revision.

{{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 443953677 | IUPAC_name = ethoxy-N'-{6-[ethyl(2-hydroxypropyl)amino]pyridazin-3-yl}carbohydrazide | image = Cadralazine.png | image2 = Cadralazine-3D-spacefill.png | alt2 = Cadralazine molecule

| tradename = | Drugs.com = International Drug Names | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref =  checkY | CAS_number = 64241-34-5 | ATC_prefix = C02 | ATC_suffix = DB04 | PubChem = 2515 | ChEMBL_Ref =  ☒N | ChEMBL = 2106561 | DrugBank_Ref =  checkY | DrugBank = | UNII_Ref =  checkY | UNII = 8T96I3U713 | ChemSpiderID_Ref =  ☒N | ChemSpiderID = 2420 | smiles = O=C(OCC)NNc1nnc(N(CC(O)C)CC)cc1 | StdInChI_Ref =  ☒N | StdInChI = 1S/C12H21N5O3/c1-4-17(8-9(3)18)11-7-6-10(13-15-11)14-16-12(19)20-5-2/h6-7,9,18H,4-5,8H2,1-3H3,(H,13,14)(H,16,19) | StdInChIKey_Ref =  ☒N | StdInChIKey = QLTVVOATEHFXLT-UHFFFAOYSA-N

| C=12 | H=21 | N=5 | O=3 | molecular_weight = 283.33 g/mol }}

Cadralazine is an antihypertensive of the hydrazinophthalazine chemical class.

References