Octotiamine
{{Drugbox | IUPAC_name = methyl 6-(acetylsulfanyl)-8-{[(2E)-2-{[(4-amino-2-methyl-5-pyrimidinyl)methyl](formyl)amino}-5-hydroxy-2-penten-3-yl]disulfanyl}octanoate | image = Octotiamine.svg | CAS_number = 137-86-0 | ATC_prefix = None | ATC_suffix = | PubChem = 3034020 | DrugBank = | ChemSpiderID = 2298574 | chemical_formula = | C=23 | H=36 | N=4 | O=5 | S=3 | molecular_weight = 544.751 g/mol | SMILES = Cc1ncc(c(n1)N)CN(C=O)/C(=C(\CCO)/SSCCC(CCCCC(=O)OC)SC(=O)C)/C | StdInChI = 1S/C23H36N4O5S3/c1-16(27(15-29)14-19-13-25-17(2)26-23(19)24)21(9-11-28)35-33-12-10-20(34-18(3)30)7-5-6-8-22(31)32-4/h13,15,20,28H,5-12,14H2,1-4H3,(H2,24,25,26)/b21-16+ | StdInChIKey = VJTXQHYNRDGLON-LTGZKZEYSA-N | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | pregnancy_AU = | pregnancy_US = | pregnancy_category= | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration = }}
Octotiamine (INN, JAN; Gerostop, Neuvita, Neuvitan), also known as thioctothiamine, is an analogue of vitamin B1 which is used in Japan and Finland.[1][2]
See also
References
- ^ C.R. Ganellin; David J. Triggle (21 November 1996). Dictionary of Pharmacological Agents. CRC Press. pp. 1469–. ISBN 978-0-412-46630-4.
- ^ Index Nominum 2000: International Drug Directory. Taylor & Francis. January 2000. pp. 756–. ISBN 978-3-88763-075-1.
 | This article about an organic compound is a stub. You can help Wikipedia by expanding it. |