Wikipedia:WikiProject Chemicals/Log/2011-10-26

Standard header for logs from CheMoBot

00:01:54 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Maslinic_acid (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite|correct|??}}', SET '')
00:17:53 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Guar_gum (diff, hist)
Changed: 'verifiedrevid' ('451918510' -> '455044422', SET '451918510')
00:35:43 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Acetylenediol (diff, hist)
Changed: 'verifiedrevid' ('450651399' -> '453634206', SET '450651399')
00:35:43 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Acetylenediol (diff, hist)
Changed: 'CASNo_Ref' ('{{cascite|??|??}}' -> '{{cascite|correct|??}}', SET '{{cascite|??|??}}')
01:48:45 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Lead(II)_acetate (diff, hist)
Changed: 'CASNo_Ref' ('{{cascite}}' -> '{{cascite|correct|CAS}}', SET '{{cascite}}')
02:37:37 (4, 4, 5) (EDIT) User:JaysonSunshine (contribs, talk) edited Acetanilide (diff, hist)
Changed: 'IUPACName' ('''N''-phenylacetamide' -> '''N''-phenylacetamide ''N''-phenylethanamide', SET '''N''-phenylacetamide')
02:49:48 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Acetanilide (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')
03:30:45 (3, 2, 4) (EDIT) User:Lymtudor1 (contribs, talk) edited Cyanuric_chloride (diff, hist)
Added links: http://pubs.acs.org/doi/abs/10.1021/jo015935s
03:49:09 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Cyanuric_chloride (diff, hist)
Changed: 'verifiedrevid' ('443544718' -> '443546213', SET '443544718')
04:35:16 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Potassium_iodate (diff, hist)
Changed: 'verifiedrevid' ('400858566' -> '434366230', SET '400858566')
04:44:48 (2, 3, 5) (EDIT) User:RicHard-59 (contribs, talk) edited Morphinan (diff, hist)
Changed: 'ImageFile' ('Morphinan.png' -> 'Morphinan.svg')
04:55:24 (3, 2, 4) (EDIT) User:AnomieBOT (contribs, talk) edited 1,4-Benzoquinone (diff, hist)
Added links: http://monographs.iarc.fr/ENG/Monographs/vol71/mono71-63.pdf
05:56:20 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Musk_xylene (diff, hist)
Changed: 'Reference' ('<ref name="PhysProps">Section 1.3, ''European Union Risk Assessment Report'' (2005), pp. 6â7.</ref>' -> '<ref name = "PhysProps">Section 1.3, ''European Union Risk Assessment Report'' (2005), pp. 6â7.</ref>', SET '<ref name="Ph
05:56:20 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Musk_xylene (diff, hist)
Added: 'ImageFile_Ref' ('' -> '{{chemboximage|correct|??}}', SET '')
05:56:21 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Musk_xylene (diff, hist)
Added: 'ImageName' ('' -> 'KekulÃ©, skeletal formula of musk xylene', SET '')
05:56:22 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Musk_xylene (diff, hist)
Added: 'PubChem_Ref' ('' -> '{{Pubchemcite|correct|Pubchem}}', SET '')
05:56:22 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Musk_xylene (diff, hist)
Added: 'SMILES1' ('' -> 'Cc1c(c(C)c(c(c1-n(:o):o)C(C)(C)C)-n(:o):o)-n(:o):o', SET '')
05:56:23 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Musk_xylene (diff, hist)
Added: 'SMILES2' ('' -> 'C[C]1[C]([C](C)[C]([C]([C]1[N++]([O-])[O-])C(C)(C)C)[N++]([O-])[O-])[N++]([O-])[O-]', SET '')
05:56:23 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Musk_xylene (diff, hist)
Changed: 'StdInChIKey_Ref' ('{{stdinchicite|correct|chemspider}}' -> '{{stdinchicite|correct|chemspider}}}', SET '{{stdinchicite|correct|chemspider}}')
05:56:24 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Musk_xylene (diff, hist)
Changed: 'Appearance' ('yellow crystals' -> 'Yellow crystals', SET 'yellow crystals')
05:56:24 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Musk_xylene (diff, hist)
Changed: 'Solubility' ('0.15 mg/l' -> '150 ng dm-1', SET '0.15 mg/l')
05:56:25 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Musk_xylene (diff, hist)
Changed: 'LogP' ('4.9' -> '4.369', SET '4.9')
05:56:25 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Musk_xylene (diff, hist)
Changed: 'VaporPressure' ('9.7 mPa (40 Â°C)' -> '9.7 mPa (at 40 Â°C)', SET '9.7 mPa (40 Â°C)')
05:56:26 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Musk_xylene (diff, hist)
Changed: 'Section3' ('{{Chembox Structure' -> '{{Chembox Hazards', SET '{{Chembox Structure')
05:56:26 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Musk_xylene (diff, hist)
Changed: 'EUClass' ('[[Carcinogen|Car. Cat. 3]] Explosive ('''E''') Harmful ('''Xn''') Dangerous for the environment ('''N''')' -> '{{Hazchem E}}{{Hazchem Xn}}{{Hazchem N}}', SET '[[Carcinogen|Car. Cat. 3]] Explosive ('''E''') Harmful ('''Xn'''
05:56:26 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Musk_xylene (diff, hist)
Changed: 'FlashPt' ('168 Â°C' -> '2 Â°C', SET '168 Â°C')
05:56:27 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Musk_xylene (diff, hist)
Changed: 'Section4' ('{{Chembox Thermochemistry' -> '{{Chembox Related', SET '{{Chembox Thermochemistry')
05:56:27 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Musk_xylene (diff, hist)
Changed: 'OtherCpds' ('[[Trinitrotoluene]] }' -> '[[Trinitrotoluene]]}', SET '[[Trinitrotoluene]] }')
05:56:28 (2, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Musk_xylene (diff, hist)
Deleted: 'Section6' ('{{Chembox Explosive' -> '', SET '{{Chembox Explosive')
05:56:28 (2, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Musk_xylene (diff, hist)
Deleted: 'Section7' ('{{Chembox Hazards' -> '', SET '{{Chembox Hazards')
05:56:29 (2, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Musk_xylene (diff, hist)
Deleted: 'Section8' ('{{Chembox Related' -> '', SET '{{Chembox Related')
05:56:29 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Musk_xylene (diff, hist)
Deleted: 'IUPACName' ('5-''tert''-Butyl-2,4,6-trinitro-''meta''-xylene' -> '', SET '5-''tert''-Butyl-2,4,6-trinitro-''meta''-xylene')
05:56:29 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Musk_xylene (diff, hist)
Changed: 'SMILES' ('[O-][N+](=O)c1c(c(c(c([N+]([O-])=O)c1C(C)(C)C)C)[N+]([O-])=O)C' -> 'CC1=C(C(=C(C(C)=C1N(=O)=O)N(=O)=O)C(C)(C)C)N(=O)=O', SET '[O-][N+](=O)c1c(c(c(c([N+]([O-])=O)c1C(C)(C)C)C)[N+]([O-])=O)C')
05:56:30 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Musk_xylene (diff, hist)
Deleted: 'InChI' ('1/C12H15N3O6/c1-6-9(13(16)17)7(2)11(15(20)21)8(12(3,4)5)10(6)14(18)19/h1-5H3' -> '', SET '1/C12H15N3O6/c1-6-9(13(16)17)7(2)11(15(20)21)8(12(3,4)5)10(6)14(18)19/h1-5H3')
05:56:31 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Musk_xylene (diff, hist)
Added: 'MeSHName' ('' -> 'musk+xylene', SET '')
05:56:31 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Musk_xylene (diff, hist)
Changed: 'Formula' ('C12H15N3O6' -> '{{Chem|C|12|N|3|H|15|O|6}}', SET 'C12H15N3O6')
05:56:31 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Musk_xylene (diff, hist)
Changed: 'MolarMass' ('297.30 g/mol' -> '297.2640 g mol-1', SET '297.30 g/mol')
05:56:32 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Musk_xylene (diff, hist)
Deleted: 'MeltingPt' ('112â114 Â°C' -> '', SET '112â114 Â°C')
05:56:32 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Musk_xylene (diff, hist)
Added: 'MeltingPtC' ('' -> '235', SET '')
05:56:32 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Musk_xylene (diff, hist)
Deleted: 'BoilingPt' ('''decomp.''' -> '', SET '''decomp.''')
05:56:32 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Musk_xylene (diff, hist)
Added: 'ExactMass' ('' -> '297.096085227 g mol-1', SET '')
05:56:33 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Musk_xylene (diff, hist)
Added: 'PIN' ('' -> '5-''tert''-Butyl-2,4,6-trinitro-''meta''-xylene{{Citation needed|date = October 2011}}', SET '')
06:07:11 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Musk_xylene (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')
06:35:49 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Trimethylolethane_trinitrate (diff, hist)
Changed: 'verifiedrevid' ('395266835' -> '428734596', SET '395266835')
06:35:49 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Trimethylolethane_trinitrate (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite|correct|??}}', SET '')
06:45:22 (3, 2, 4) (EDIT) User:169.231.34.41 (contribs, talk) edited Tantalum_pentoxide (diff, hist)
Added links: http://materion.com/ResourceCenter/Literature/AdvancedChemicalsDataSheets/TantalumOxideTa2O5.aspx
06:56:08 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Tantalum_pentoxide (diff, hist)
Changed: 'verifiedrevid' ('415857701' -> '437221973', SET '415857701')
06:56:08 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Tantalum_pentoxide (diff, hist)
Changed: 'CASNo_Ref' ('{{cascite}}' -> '{{cascite|correct|CAS}}', SET '{{cascite}}')
06:59:55 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Quinpirole (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite|correct|??}}', SET '')
07:06:25 (2, 4, 5) (EDIT) User:192.43.227.18 (contribs, talk) edited Propane (diff, hist)
Changed: 'Solubility' ('0.04 g/L (0 Â°C)<ref name="lpg">[http://www.aegpl.eu/Content/Default.asp?PageID=9 Propane], European LPG association{{dead link|date=November 2010}}</ref>' -> '0.12 g/L (0 Â°C)<ref name="lpg">[http://www.aegpl.eu/Content/Default.asp?PageID=
07:06:26 (2, 4, 5) (EDIT) User:192.43.227.18 (contribs, talk) edited Propane (diff, hist)
Changed: 'FlashPt' ('-104 Â°C, 169 K' -> '-110 Â°C, 163 K', SET '-104 Â°C (169.1 K)')
07:06:26 (4, 4, 5) (EDIT) User:192.43.227.18 (contribs, talk) edited Propane (diff, hist)
Changed: 'Density' ('2.0098 kg/m3, gas (0 Â°C, 1013 mbar) 581.2 kg/m3, liquid at boiling point<ref name="GESTIS">{{GESTIS|ZVG=10020|Name=Propane}}</ref>' -> '2.25 kg/m3, gas (0 Â°C, 1013 mbar) 581.2 kg/m3, liqu
07:06:27 (4, 4, 5) (EDIT) User:192.43.227.18 (contribs, talk) edited Propane (diff, hist)
Added: 'MeltingPt' ('-187.7' -> '-192.7', SET '')
07:06:27 (4, 4, 5) (EDIT) User:192.43.227.18 (contribs, talk) edited Propane (diff, hist)
Added: 'BoilingPt' ('-42.1' -> '-49.1', SET '')
07:07:16 (2, 5, 5) (EDIT) User:The chemistds (contribs, talk) edited Carboxymethyl_cellulose (diff, hist)
Changed: 'ChemSpiderID_Ref' ('{{chemspidercite|changed|chemspider}}' -> '', SET '')
07:07:16 (4, 5, 5) (EDIT) User:The chemistds (contribs, talk) edited Carboxymethyl_cellulose (diff, hist)
Deleted: 'SMILES' ('}' -> '', SET '}')
07:07:17 (5, 5, 5) (EDIT) User:The chemistds (contribs, talk) edited Carboxymethyl_cellulose (diff, hist)
Changed: 'CASNo' ('9004-32-4' -> '9000-11-7', SET '9004-32-4')
07:10:56 (2, 4, 4) (EDIT) User:Bongwarrior (contribs, talk) edited Propane (diff, hist)
Changed: 'Solubility' ('0.12 g/L (0 Â°C)<ref name="lpg">[http://www.aegpl.eu/Content/Default.asp?PageID=9 Propane], European LPG association{{dead link|date=November 2010}}</ref>' -> '0.04 g/L (0 Â°C)<ref name="lpg">[http://www.aegpl.eu/Content/Default.asp?PageID=
07:10:56 (2, 4, 4) (EDIT) User:Bongwarrior (contribs, talk) edited Propane (diff, hist)
Changed: 'FlashPt' ('-110 Â°C, 163 K' -> '-104 Â°C, 169 K', SET '-104 Â°C (169.1 K)')
07:10:56 (4, 4, 4) (EDIT) User:Bongwarrior (contribs, talk) edited Propane (diff, hist)
Changed: 'Density' ('2.25 kg/m3, gas (0 Â°C, 1013 mbar) 581.2 kg/m3, liquid at boiling point<ref name="GESTIS">{{GESTIS|ZVG=10020|Name=Propane}}</ref>' -> '2.0098 kg/m3, gas (0 Â°C, 1013 mbar) 581.2 kg/m3, liqu
07:10:57 (4, 4, 4) (EDIT) User:Bongwarrior (contribs, talk) edited Propane (diff, hist)
Added: 'MeltingPt' ('-192.7' -> '-187.7', SET '')
07:10:57 (4, 4, 4) (EDIT) User:Bongwarrior (contribs, talk) edited Propane (diff, hist)
Added: 'BoilingPt' ('-49.1' -> '-42.1', SET '')
07:11:58 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Ammonium_nitrite (diff, hist)
Changed: 'verifiedrevid' ('399518798' -> '441677914', SET '399518798')
07:11:58 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Ammonium_nitrite (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite|correct|??}}', SET '')
07:17:55 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Carboxymethyl_cellulose (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')
07:17:55 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Carboxymethyl_cellulose (diff, hist)
Added: 'CASNo_Ref' ('{{cascite|correct|CAS}}' -> '{{cascite|changed|??}}', SET '')
07:17:56 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Carboxymethyl_cellulose (diff, hist)
Added: 'ChemSpiderID_Ref' ('' -> '{{chemspidercite|changed|chemspider}}', SET '')
07:55:07 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Added: 'ImageFile_Ref' ('' -> '{{chemboximage|correct|??}}', SET '')
07:55:07 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Changed: 'OtherNames' ('18-Norestrane' -> '18-Norestrane{{Citation needed|date = October 2011}}', SET '18-Norestrane')
07:55:07 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite|correct|??}}', SET '')
07:55:07 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Added: 'CASNo_Comment' ('' -> '(1''R'',2''S'',10''S'',11''R'',15''S'')- heptadecane', SET '')
07:55:08 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Added: 'PubChem_Ref' ('' -> '{{Pubchemcite|correct|Pubchem}}', SET '')
07:55:08 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Added: 'PubChem1' ('' -> '6857523', SET '')
07:55:08 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Added: 'PubChem1_Ref' ('' -> '{{Pubchemcite|correct|Pubchem}}', SET '')
07:55:08 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Added: 'PubChem1_Comment' ('' -> '(1''R'',2''S'',10''S'',11''R'',15''S'')- heptadecane', SET '')
07:55:08 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Added: 'PubChem2' ('' -> '6857525', SET '')
07:55:09 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Added: 'PubChem2_Ref' ('' -> '{{Pubchemcite|correct|Pubchem}}', SET '')
07:55:09 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Added: 'PubChem2_Comment' ('' -> '(1''R'',2''S'',7''R'',10''S'',11''R'',15''S'')- heptadecane', SET '')
07:55:09 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Added: 'PubChem3' ('' -> '6857524', SET '')
07:55:10 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Added: 'PubChem3_Ref' ('' -> '{{Pubchemcite|correct|Pubchem}}', SET '')
07:55:10 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Added: 'PubChem3_Comment' ('' -> '(1''R'',2''S'',7''S'',10''S'',11''R'',15''S'')- heptadecane', SET '')
07:55:10 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Added: 'ChemSpiderID_Ref' ('' -> '{{chemspidercite|correct|chemspider}}', SET '')
07:55:11 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Added: 'ChemSpiderID1' ('' -> '5256861', SET '')
07:55:11 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Added: 'ChemSpiderID1_Ref' ('' -> '{{chemspidercite|correct|chemspider}}', SET '')
07:55:11 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Added: 'ChemSpiderID1_Comment' ('' -> '(1''R'',2''S'',7''R'',10''S'',11''R'',15''S'')- heptadecane', SET '')
07:55:11 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Added: 'ChemSpiderID1' ('' -> '5256861', SET '')
07:55:12 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Added: 'ChemSpiderID1_Ref' ('' -> '{{chemspidercite|correct|chemspider}}', SET '')
07:55:12 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Added: 'ChemSpiderID1_Comment' ('' -> '(1''R'',2''S'',7''R'',10''S'',11''R'',15''S'')- heptadecane', SET '')
07:55:12 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Added: 'ChemSpiderID2' ('' -> '5256860', SET '')
07:55:13 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Added: 'ChemSpiderID2_Ref' ('' -> '{{chemspidercite|correct|chemspider}}', SET '')
07:55:13 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Added: 'ChemSpiderID2_Comment' ('' -> '(1''R'',2''S'',7''S'',10''S'',11''R'',15''S'')- heptadecane', SET '')
07:55:13 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Added: 'KEGG_Ref' ('' -> '{{keggcite|orrect|kegg}}', SET '')
07:55:14 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Added: 'ChEBI_Ref' ('' -> '{{ebicite|correct|EBI}}', SET '')
07:55:14 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Added: 'StdInChI_Ref' ('' -> '{{stdinchicite|correct|chemspider}}', SET '')
07:55:14 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Added: 'StdInChIKey_Ref' ('' -> '{{stdinchicite|correct|chemspider}}}', SET '')
07:55:14 (2, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Deleted: 'ImageSize' ('200px' -> '', SET '200px')
07:55:15 (2, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Deleted: 'Section3' ('{{Chembox Hazards' -> '', SET '{{Chembox Hazards')
07:55:15 (2, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Deleted: 'Autoignition' ('}' -> '', SET '}')
07:55:15 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Changed: 'C' ('1' -> '17', SET '1')
07:55:16 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Deleted: 'IUPACName' ('(8S,9R,10S,13S,14R) -2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydro-1''H''-cyclopenta[a]phenanthrene' -> '', SET '(8S,9R,10S,13S,14R) -2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydro-1''H''-cyclopenta[a]phenanthrene')
07:55:16 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Changed: 'PubChem' ('6857523' -> '1108', SET '6857523')
07:55:16 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Changed: 'SMILES' ('[H][C@@]12[C@](CCC2)([H])[C@]3([H])CCC4CCCC[C@]4([H])[C@@]3([H])CC1' -> 'C1CC2CCC3C(CCC4CCCCC34)C2C1', SET '[H][C@@]12[C@](CCC2)([H])[C@]3([H])CCC4CCCC[C@]4([H])[C@@]3([H])CC1')
07:55:17 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Added: 'ExactMass' ('' -> '232.219100896 g mol-1}', SET '')
07:55:17 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Added: 'PIN' ('' -> '2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17-Hexadecahydro-1''H''-cyclopenta[a]phenanthrene{{Citation needed|date = October 2011}}', SET '')
07:55:17 (5, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Added: 'ChemSpiderID' ('' -> '1077', SET '')
07:55:18 (5, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Added: 'ChEBI' ('' -> '35528', SET '')
07:55:18 (5, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Added: 'KEGG' ('' -> 'C19639', SET '')
07:55:18 (5, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Added: 'StdInChI' ('' -> '1S/C17H28/c1-2-6-14-12(4-1)8-10-17-15-7-3-5-13(15)9-11-16(14)17/h12-17H,1-11H2', SET '')
07:55:19 (5, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Added: 'StdInChIKey' ('' -> 'UACIBCPNAKBWHX-UHFFFAOYSA-N', SET '')
07:55:19 (5, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Gonane (diff, hist)
Added: 'CASNo' ('' -> '4732-76-7', SET '')
07:58:37 (5, 2, 4) (EDIT) User:Beetstra (contribs, talk) edited Carboxymethyl_cellulose (diff, hist)
Changed: 'CASNo' ('9000-11-7' -> '9004-32-4', SET '9004-32-4')
07:59:22 (5, 4, 4) (EDIT) User:Beetstra (contribs, talk) edited Carboxymethyl_cellulose (diff, hist)
Changed: 'CASNo' ('9004-32-4' -> '9000-11-7', SET '9004-32-4')
08:00:08 (2, 4, 4) (EDIT) User:Beetstra (contribs, talk) edited Carboxymethyl_cellulose (diff, hist)
Changed: 'ChemSpiderID_Ref' ('{{chemspidercite|changed|chemspider}}' -> '{{chemspidercite|changed|chemspider}}}', SET '{{chemspidercite|changed|chemspider}}')
08:00:08 (5, 4, 4) (EDIT) User:Beetstra (contribs, talk) edited Carboxymethyl_cellulose (diff, hist)
Changed: 'ChemSpiderID' ('NA}}{{Chembox Identifiers' -> 'NA', SET 'NA}}{{Chembox Identifiers')
08:06:00 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Gonane (diff, hist)
Added: 'Verifiedfields' ('' -> 'changed', SET '')
08:06:00 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Gonane (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')
08:06:00 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Gonane (diff, hist)
Changed: 'verifiedrevid' ('400298941' -> '424869490', SET '400298941')
08:06:00 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Gonane (diff, hist)
Added: 'CASNo_Ref' ('{{cascite|correct|??}}' -> '{{cascite|changed|??}}', SET '')
08:06:01 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Gonane (diff, hist)
Added: 'ChemSpiderID_Ref' ('{{chemspidercite|correct|chemspider}}' -> '{{chemspidercite|changed|chemspider}}', SET '')
08:06:01 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Gonane (diff, hist)
Added: 'KEGG_Ref' ('{{keggcite|orrect|kegg}}' -> '{{keggcite|changed|kegg}}', SET '')
08:06:01 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Gonane (diff, hist)
Added: 'ChEBI_Ref' ('{{ebicite|correct|EBI}}' -> '{{ebicite|changed|EBI}}', SET '')
08:06:02 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Gonane (diff, hist)
Added: 'StdInChI_Ref' ('{{stdinchicite|correct|chemspider}}' -> '{{stdinchicite|changed|chemspider}}', SET '')
08:06:02 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Gonane (diff, hist)
Added: 'StdInChIKey_Ref' ('{{stdinchicite|correct|chemspider}}}' -> '{{stdinchicite|changed|chemspider}}}', SET '')
08:10:27 (3, 2, 4) (EDIT) User:AnomieBOT (contribs, talk) edited Adrenosterone (diff, hist)
Added links: http://www.iib.unsam.edu.ar/php/papiros/pdf/Blasco2009.pdf
08:10:37 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Carboxymethyl_cellulose (diff, hist)
Changed: 'verifiedrevid' ('450891067' -> '457451151', SET '450891067')
08:10:38 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Carboxymethyl_cellulose (diff, hist)
Deleted: 'Watchedfields' ('changed' -> '', SET 'changed')
08:39:24 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Chrysanthenone (diff, hist)
Changed: 'verifiedrevid' ('429835974' -> '443975833', SET '429835974')
08:39:24 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Chrysanthenone (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite|correct|??}}', SET '')
09:10:01 (3, 2, 4) (EDIT) User:AnomieBOT (contribs, talk) edited Brilliant_Green_(dye) (diff, hist)
Added links: http://www.ncbi.nlm.nih.gov/pmc/articles/PMC1391517/pdf/annsurg00645-0048.pdf
09:48:43 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited 2C-B (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite|correct|??}}', SET '')
10:03:49 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Morphinan (diff, hist)
Changed: 'PubChem1' ('11947744' -> '614838')
10:03:50 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Morphinan (diff, hist)
Changed: 'PubChem_Comment' ('' -> '(1''R'',9''R'',10''R'')')
10:03:50 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Morphinan (diff, hist)
Changed: 'ChemSpiderID1' ('5256833' -> '534418')
10:03:52 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Morphinan (diff, hist)
Changed: 'ChemSpiderID_Comment' ('' -> '(1''R'',9''R'',10''R'')')
10:03:53 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Morphinan (diff, hist)
Changed: 'PubChem1_Comment' ('(1''R'',9''R'',10''R'')' -> '')
10:03:54 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Morphinan (diff, hist)
Changed: 'ChemSpiderID1_Comment' ('(1''R'',9''R'',10''R'')' -> '')
10:03:54 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Morphinan (diff, hist)
Changed: 'PubChem' ('614838' -> '11947744')
10:03:55 (5, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Morphinan (diff, hist)
Changed: 'ChemSpiderID' ('534418' -> '5256833')
10:04:24 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Morphinan (diff, hist)
Changed: 'OtherNames' ('1,2,3,9,1â0,10a-Hexâahydro-10â,4a(4''H'')-iâminoethanâophenanthârene' -> '1,2,3,9,10,10a-Hexahydro-10,4a(4''H'')-iminoethanophenanthrene')
10:18:46 (5, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Hexamethylenetetramine (diff, hist)
Changed: 'ChEBI' ('' -> '6824')
10:20:57 (5, 4, 4) (EDIT) User:Beetstra (contribs, talk) edited Retinol (diff, hist)
Added: 'ChEMBL' ('' -> '986', SET '')
10:29:29 (5, 5, 4) (EDIT) User:Beetstra (contribs, talk) edited Sulfur_chloride_pentafluoride (diff, hist)
Deleted: 'CASNo' ('13780-57-9' -> '', SET '13780-57-9')
10:30:18 (5, 4, 4) (EDIT) User:Beetstra (contribs, talk) edited Sulfur_chloride_pentafluoride (diff, hist)
Added: 'CASNo' ('' -> '13780-57-9', SET '')
10:31:15 (5, 5, 4) (EDIT) User:Beetstra (contribs, talk) edited Poly(methyl_methacrylate) (diff, hist)
Deleted: 'KEGG' ('C19504' -> '', SET 'C19504')
10:31:50 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Retinol (diff, hist)
Changed: 'verifiedrevid' ('451566610' -> '457463655', SET '451566610')
10:31:50 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Retinol (diff, hist)
Added: 'ChEMBL_Ref' ('' -> '{{ebicite|correct|EBI}}', SET '')
10:32:16 (5, 4, 4) (EDIT) User:Beetstra (contribs, talk) edited Poly(methyl_methacrylate) (diff, hist)
Added: 'KEGG' ('' -> 'C19504', SET '')
10:36:20 (5, 6, 4) (EDIT) User:Beetstra (contribs, talk) edited Moracizine (diff, hist)
Changed: 'ChEMBL' ('1075' -> '', SET '')
10:37:09 (5, 4, 4) (EDIT) User:Beetstra (contribs, talk) edited Moracizine (diff, hist)
Added: 'ChEMBL' ('' -> '1075', SET '')
10:41:04 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Sulfur_chloride_pentafluoride (diff, hist)
Changed: 'verifiedrevid' ('433981940' -> '457464411', SET '433981940')
10:41:04 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Sulfur_chloride_pentafluoride (diff, hist)
Changed: 'CASNo_Ref' ('{{cascite|correct|??}}' -> '{{cascite|changed|??}}', SET '{{cascite|correct|??}}')
10:41:04 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Sulfur_chloride_pentafluoride (diff, hist)
Changed: 'ChemSpiderID_Ref' ('{{chemspidercite|changed|chemspider}}' -> '{{chemspidercite|correct|chemspider}}', SET '{{chemspidercite|changed|chemspider}}')
10:41:05 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Sulfur_chloride_pentafluoride (diff, hist)
Changed: 'StdInChI_Ref' ('{{stdinchicite|changed|chemspider}}' -> '{{stdinchicite|correct|chemspider}}', SET '{{stdinchicite|changed|chemspider}}')
10:41:05 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Sulfur_chloride_pentafluoride (diff, hist)
Changed: 'StdInChIKey_Ref' ('{{stdinchicite|changed|chemspider}}}' -> '{{stdinchicite|correct|chemspider}}}', SET '{{stdinchicite|changed|chemspider}}}')
10:41:05 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Sulfur_chloride_pentafluoride (diff, hist)
Deleted: 'Watchedfields' ('changed' -> '', SET 'changed')
10:43:04 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Poly(methyl_methacrylate) (diff, hist)
Added: 'Verifiedfields' ('' -> 'changed', SET '')
10:43:04 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Poly(methyl_methacrylate) (diff, hist)
Changed: 'verifiedrevid' ('434001393' -> '457464578', SET '434001393')
10:43:05 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Poly(methyl_methacrylate) (diff, hist)
Changed: 'KEGG_Ref' ('{{keggcite|correct|kegg}}' -> '{{keggcite|changed|kegg}}', SET '{{keggcite|correct|kegg}}')
10:47:50 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Moracizine (diff, hist)
Changed: 'UNII_Ref' ('{{fdacite|changed|FDA}}' -> '{{fdacite|correct|FDA}}', SET '{{fdacite|changed|FDA}}')
10:47:51 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Moracizine (diff, hist)
Changed: 'verifiedrevid' ('384299071' -> '457465120', SET '384299071')
10:59:19 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Ammonium_benzoate (diff, hist)
Changed: 'verifiedrevid' ('421860499' -> '448215149', SET '421860499')
11:20:14 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Hydrogen_bromide (diff, hist)
Changed: 'verifiedrevid' ('443860969' -> '443862322', SET '443860969')
11:33:04 (3, 2, 4) (EDIT) User:Bobber0001 (contribs, talk) edited Tetrodotoxin (diff, hist)
Added links: http://www.emedicine.com/emerg/topic342.htm
11:47:04 (3, 2, 4) (EDIT) User:Nikola Bruxelles (contribs, talk) edited Regorafenib (diff, hist)
Added links: http://www.press.bayer.com/baynews/baynews.nsf/id/Phase-III-Trial-Regorafenib-Metastatic-Colorectal-Cancer-Meets-Primary-Endpoint-Improving-Overall?Open&ccm=001
11:52:57 (5, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Hexamethylenetetramine (diff, hist)
Changed: 'ChEMBL' ('1201270' -> '')
11:53:48 (5, 4, 4) (EDIT) User:Beetstra (contribs, talk) edited Hexamethylenetetramine (diff, hist)
Added: 'ChEMBL' ('' -> '1201270', SET '')
11:55:58 (5, 4, 5) (EDIT) User:Louisajb (contribs, talk) edited LY294002 (diff, hist)
Added: 'ChEMBL' ('' -> '98350', SET '')
11:57:46 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Morphinan (diff, hist)
Changed: 'PubChem1_Ref' ('{{Pubchemcite|correct|PubChem}}' -> '{{Pubchemcite|correct|StdInChI = 1S/C16H21N/c1-2-6-13-12(5-1)11-15-14-7-3-4-8-16(13,14)9-10-17-15/h1-2,5-6,14-15,17H,3-4,7-11H2/t14-,15-,16+/m0/s1| StdInChIKey = INAXVFBXDYWQFN-HRCADAONSA-N| PubChem}}'
11:57:46 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Morphinan (diff, hist)
Changed: 'PubChem_Ref' ('{{Pubchemcite|correct|PubChem}}' -> '{{Pubchemcite|correct|StdInChI = 1S/C16H21N/c1-2-6-13-12(5-1)11-15-14-7-3-4-8-16(13,14)9-10-17-15/h1-2,5-6,14-15,17H,3-4,7-11H2/t14-,15-,16+/m0/s1| StdInChIKey = INAXVFBXDYWQFN-HRCADAONSA-N| PubChem}}')
11:57:47 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Morphinan (diff, hist)
Changed: 'PubChem2_Ref' ('{{Pubchemcite|correct|PubChem}}' -> '{{Pubchemcite|correct|StdInChI = 1S/C16H21N/c1-2-6-13-12(5-1)11-15-14-7-3-4-8-16(13,14)9-10-17-15/h1-2,5-6,14-15,17H,3-4,7-11H2/t14-,15-,16+/m0/s1| StdInChIKey = INAXVFBXDYWQFN-HRCADAONSA-N| PubChem}}'
11:57:47 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Morphinan (diff, hist)
Changed: 'PubChem3_Ref' ('{{Pubchemcite|correct|PubChem}}' -> '{{Pubchemcite|correct|StdInChI = 1S/C16H21N/c1-2-6-13-12(5-1)11-15-14-7-3-4-8-16(13,14)9-10-17-15/h1-2,5-6,14-15,17H,3-4,7-11H2/t14-,15-,16+/m0/s1| StdInChIKey = INAXVFBXDYWQFN-HRCADAONSA-N| PubChem}}'
11:57:48 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Morphinan (diff, hist)
Changed: 'PubChem4_Ref' ('{{Pubchemcite|correct|PubChem}}' -> '{{Pubchemcite|correct|StdInChI = 1S/C16H21N/c1-2-6-13-12(5-1)11-15-14-7-3-4-8-16(13,14)9-10-17-15/h1-2,5-6,14-15,17H,3-4,7-11H2/t14-,15-,16+/m0/s1| StdInChIKey = INAXVFBXDYWQFN-HRCADAONSA-N| PubChem}}'
11:57:48 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Morphinan (diff, hist)
Changed: 'PubChem5_Ref' ('{{Pubchemcite|correct|PubChem}}' -> '{{Pubchemcite|correct|StdInChI = 1S/C16H21N/c1-2-6-13-12(5-1)11-15-14-7-3-4-8-16(13,14)9-10-17-15/h1-2,5-6,14-15,17H,3-4,7-11H2/t14-,15-,16+/m0/s1| StdInChIKey = INAXVFBXDYWQFN-HRCADAONSA-N| PubChem}}'
11:57:49 (5, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Morphinan (diff, hist)
Changed: 'ChEBI' ('35649' -> '')
11:57:50 (5, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Morphinan (diff, hist)
Changed: 'StdInChI' ('' -> '1S/C16H21N/c1-2-6-13-12(5-1)11-15-14-7-3-4-8-16(13,14)9-10-17-15/h1-2,5-6,14-15,17H,3-4,7-11H2/t14-,15-,16+/m0/s1')
11:57:51 (5, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Morphinan (diff, hist)
Changed: 'StdInChIKey' ('' -> 'INAXVFBXDYWQFN-HRCADAONSA-N')
11:57:52 (5, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Morphinan (diff, hist)
Changed: 'CASNo' ('468-10-0' -> '')
11:58:49 (5, 4, 4) (EDIT) User:Beetstra (contribs, talk) edited Morphinan (diff, hist)
Added: 'ChEBI' ('' -> '35649', SET '')
11:58:50 (5, 4, 4) (EDIT) User:Beetstra (contribs, talk) edited Morphinan (diff, hist)
Added: 'CASNo' ('' -> '468-10-0', SET '')
12:01:59 (5, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Furan-2-ylmethanethiol (diff, hist)
Changed: 'CASNo' ('98-02-2' -> '')
12:02:57 (5, 4, 4) (EDIT) User:Beetstra (contribs, talk) edited Furan-2-ylmethanethiol (diff, hist)
Added: 'CASNo' ('' -> '98-02-2', SET '')
12:03:34 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Hexamethylenetetramine (diff, hist)
Changed: 'verifiedrevid' ('398937865' -> '457472844', SET '398937865')
12:03:34 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Hexamethylenetetramine (diff, hist)
Changed: 'KEGG_Ref' ('{{keggcite|changed|kegg}}' -> '{{keggcite|correct|kegg}}', SET '{{keggcite|changed|kegg}}')
12:03:35 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Hexamethylenetetramine (diff, hist)
Added: 'ChEBI_Ref' ('' -> '{{ebicite|correct|EBI}}', SET '')
12:06:33 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited LY294002 (diff, hist)
Added: 'Verifiedfields' ('' -> 'changed', SET '')
12:06:33 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited LY294002 (diff, hist)
Changed: 'verifiedrevid' ('391455997' -> '443344935', SET '391455997')
12:06:34 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited LY294002 (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite|correct|??}}', SET '')
12:06:34 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited LY294002 (diff, hist)
Added: 'ChEMBL_Ref' ('' -> '{{ebicite|changed|EBI}}', SET '')
12:09:28 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Morphinan (diff, hist)
Added: 'Verifiedfields' ('' -> 'changed', SET '')
12:09:28 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Morphinan (diff, hist)
Added: 'verifiedrevid' ('' -> '457473358', SET '')
12:09:29 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Morphinan (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite|changed|??}}', SET '')
12:09:29 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Morphinan (diff, hist)
Changed: 'PubChem1_Ref' ('{{Pubchemcite|correct|StdInChI = 1S/C16H21N/c1-2-6-13-12(5-1)11-15-14-7-3-4-8-16(13,14)9-10-17-15/h1-2,5-6,14-15,17H,3-4,7-11H2/t14-,15-,16+/m0/s1| StdInChIKey = INAXVFBXDYWQFN-HRCADAONSA-N| PubChem}}' -> '{{Pubchemcite|correct| StdInChIs
12:09:29 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Morphinan (diff, hist)
Added: 'StdInChI_Ref' ('' -> '{{stdinchicite|correct|chemspider}}', SET '')
12:09:30 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Morphinan (diff, hist)
Added: 'StdInChIKey_Ref' ('' -> '{{stdinchicite|correct|chemspider}}', SET '')
12:09:30 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Morphinan (diff, hist)
Changed: 'PubChem_Ref' ('{{Pubchemcite|correct|StdInChI = 1S/C16H21N/c1-2-6-13-12(5-1)11-15-14-7-3-4-8-16(13,14)9-10-17-15/h1-2,5-6,14-15,17H,3-4,7-11H2/t14-,15-,16+/m0/s1| StdInChIKey = INAXVFBXDYWQFN-HRCADAONSA-N| PubChem}}' -> '{{Pubchemcite|correct| StdInChIsR
12:09:31 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Morphinan (diff, hist)
Changed: 'PubChem2_Ref' ('{{Pubchemcite|correct|StdInChI = 1S/C16H21N/c1-2-6-13-12(5-1)11-15-14-7-3-4-8-16(13,14)9-10-17-15/h1-2,5-6,14-15,17H,3-4,7-11H2/t14-,15-,16+/m0/s1| StdInChIKey = INAXVFBXDYWQFN-HRCADAONSA-N| PubChem}}' -> '{{Pubchemcite|correct| StdInChIs
12:09:31 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Morphinan (diff, hist)
Changed: 'PubChem3_Ref' ('{{Pubchemcite|correct|StdInChI = 1S/C16H21N/c1-2-6-13-12(5-1)11-15-14-7-3-4-8-16(13,14)9-10-17-15/h1-2,5-6,14-15,17H,3-4,7-11H2/t14-,15-,16+/m0/s1| StdInChIKey = INAXVFBXDYWQFN-HRCADAONSA-N| PubChem}}' -> '{{Pubchemcite|correct| StdInChIs
12:09:32 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Morphinan (diff, hist)
Changed: 'PubChem4_Ref' ('{{Pubchemcite|correct|StdInChI = 1S/C16H21N/c1-2-6-13-12(5-1)11-15-14-7-3-4-8-16(13,14)9-10-17-15/h1-2,5-6,14-15,17H,3-4,7-11H2/t14-,15-,16+/m0/s1| StdInChIKey = INAXVFBXDYWQFN-HRCADAONSA-N| PubChem}}' -> '{{Pubchemcite|correct| StdInChIs
12:09:32 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Morphinan (diff, hist)
Changed: 'PubChem5_Ref' ('{{Pubchemcite|correct|StdInChI = 1S/C16H21N/c1-2-6-13-12(5-1)11-15-14-7-3-4-8-16(13,14)9-10-17-15/h1-2,5-6,14-15,17H,3-4,7-11H2/t14-,15-,16+/m0/s1| StdInChIKey = INAXVFBXDYWQFN-HRCADAONSA-N| PubChem}}' -> '{{Pubchemcite|correct| StdInChIs
12:09:33 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Morphinan (diff, hist)
Changed: 'ChemSpiderID_Ref' ('{{Chemspidercite|correct|ChemSpider}}' -> '{{chemspidercite|correct|chemspider}}', SET '{{Chemspidercite|correct|ChemSpider}}')
12:09:33 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Morphinan (diff, hist)
Added: 'ChEBI_Ref' ('' -> '{{ebicite|changed|EBI}}', SET '')
12:13:30 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Furan-2-ylmethanethiol (diff, hist)
Added: 'Verifiedfields' ('' -> 'changed', SET '')
12:13:31 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Furan-2-ylmethanethiol (diff, hist)
Added: 'verifiedrevid' ('' -> '457473820', SET '')
12:13:31 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Furan-2-ylmethanethiol (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite|changed|??}}', SET '')
12:16:26 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Thiamethoxam (diff, hist)
Changed: 'CASNo_Ref' ('{{cascite|correct}}' -> '{{cascite|correct|CAS}}', SET '{{cascite|correct}}')
12:28:18 (2, 4, 4) (EDIT) User:Beetstra (contribs, talk) edited Gonane (diff, hist)
Added: 'ChemSpiderID3' ('' -> '1077', SET '')
12:28:18 (2, 4, 4) (EDIT) User:Beetstra (contribs, talk) edited Gonane (diff, hist)
Added: 'ChemSpiderID3_Ref' ('' -> '{{chemspidercite|changed|chemspider}}', SET '')
12:28:18 (2, 5, 4) (EDIT) User:Beetstra (contribs, talk) edited Gonane (diff, hist)
Changed: 'ChemSpiderID_Ref' ('{{chemspidercite|changed|chemspider}}' -> '', SET '')
12:28:19 (4, 5, 4) (EDIT) User:Beetstra (contribs, talk) edited Gonane (diff, hist)
Changed: 'SMILES' ('C1CC2CCC3C(CCC4CCCCC34)C2C1' -> 'C2C1[C@H](CCCC1)[C@H]3CC[C@H]4[C@H]([C@@H]3C2)CCC4', SET '[H][C@@]12[C@](CCC2)([H])[C@]3([H])CCC4CCCC[C@]4([H])[C@@]3([H])CC1')
12:28:19 (5, 5, 4) (EDIT) User:Beetstra (contribs, talk) edited Gonane (diff, hist)
Added: 'ChemSpiderID' ('1077' -> '5256859', SET '')
12:28:19 (5, 5, 4) (EDIT) User:Beetstra (contribs, talk) edited Gonane (diff, hist)
Added: 'StdInChI' ('1S/C17H28/c1-2-6-14-12(4-1)8-10-17-15-7-3-5-13(15)9-11-16(14)17/h12-17H,1-11H2' -> '1S/C17H28/c1-2-6-14-12(4-1)8-10-17-15-7-3-5-13(15)9-11-16(14)17/h12-17H,1-11H2/t12?,13-,14-,15+,16+,17-/m0/s1', SET '')
12:28:19 (5, 5, 4) (EDIT) User:Beetstra (contribs, talk) edited Gonane (diff, hist)
Added: 'StdInChIKey' ('UACIBCPNAKBWHX-UHFFFAOYSA-N' -> 'UACIBCPNAKBWHX-CTBOZYAPSA-N', SET '')
12:29:03 (5, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Edelfosine (diff, hist)
Changed: 'ChEMBL' ('107514' -> '28509')
12:29:03 (5, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Edelfosine (diff, hist)
Changed: 'StdInChI' ('' -> '1S/C27H58NO6P/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23-32-25-27(31-5)26-34-35(29,30)33-24-22-28(2,3)4/h27H,6-26H2,1-5H3')
12:29:04 (5, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Edelfosine (diff, hist)
Changed: 'StdInChIKey' ('' -> 'MHFRGQHAERHWKZ-UHFFFAOYSA-N')
12:29:04 (5, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Edelfosine (diff, hist)
Changed: 'CASNo' ('70641-51-9' -> '')
12:29:55 (5, 4, 4) (EDIT) User:Beetstra (contribs, talk) edited Edelfosine (diff, hist)
Changed: 'ChEMBL' ('28509' -> '107514', SET '28509')
12:29:55 (5, 4, 4) (EDIT) User:Beetstra (contribs, talk) edited Edelfosine (diff, hist)
Added: 'CASNo' ('' -> '70641-51-9', SET '')
12:37:22 (3, 2, 4) (EDIT) User:Chris Capoccia (contribs, talk) edited Abscisic_acid (diff, hist)
Added links: http://www.benthamdirect.org/pages/content.php?CMC/2010/00000017/00000005/0006C.SGM
12:37:42 (3, 2, 4) (EDIT) User:AnomieBOT (contribs, talk) edited Xylitol (diff, hist)
Added links: http://www.dm2nb.ca/pdf/patient_resources/diabetes/sugar_alcohols_cda.pdf
12:39:08 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Gonane (diff, hist)
Added: 'ChemSpiderID_Ref' ('' -> '{{chemspidercite|changed|chemspider}}', SET '')
12:39:30 (3, 2, 4) (EDIT) User:95.215.254.159 (contribs, talk) edited Homocysteine (diff, hist)
Added links: http://www.drmirkin.com/morehealth/9894.html
12:40:51 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Edelfosine (diff, hist)
Added: 'Verifiedfields' ('' -> 'changed', SET '')
12:40:52 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Edelfosine (diff, hist)
Added: 'verifiedrevid' ('' -> '457477026', SET '')
12:40:52 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Edelfosine (diff, hist)
Changed: 'CASNo_Ref' ('{{cascite|correct|CAS}}' -> '{{cascite|changed|??}}', SET '{{cascite|correct|CAS}}')
12:40:53 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Edelfosine (diff, hist)
Added: 'StdInChI_Ref' ('' -> '{{stdinchicite|correct|chemspider}}', SET '')
12:40:53 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Edelfosine (diff, hist)
Added: 'StdInChIKey_Ref' ('' -> '{{stdinchicite|correct|chemspider}}', SET '')
12:40:53 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Edelfosine (diff, hist)
Added: 'ChemSpiderID_Ref' ('' -> '{{chemspidercite|correct|chemspider}}', SET '')
12:40:53 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Edelfosine (diff, hist)
Added: 'ChEMBL_Ref' ('' -> '{{ebicite|changed|EBI}}', SET '')
12:56:43 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Homocysteine (diff, hist)
Changed: 'CASNo_Ref' ('{{cascite|changed|ESIS}}' -> '{{cascite|correct|??}}', SET '{{cascite|changed|ESIS}}')
12:59:45 (5, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Xylitol (diff, hist)
Changed: 'ChEMBL' ('96783' -> '')
13:00:50 (5, 4, 4) (EDIT) User:Beetstra (contribs, talk) edited Xylitol (diff, hist)
Added: 'ChEMBL' ('' -> '96783', SET '')
13:02:12 (5, 6, 4) (EDIT) User:Beetstra (contribs, talk) edited Gonane (diff, hist)
Changed: 'KEGG' ('C19639' -> '', SET '')
13:02:13 (5, 6, 4) (EDIT) User:Beetstra (contribs, talk) edited Gonane (diff, hist)
Changed: 'CASNo' ('4732-76-7' -> '', SET '')
13:03:04 (5, 4, 4) (EDIT) User:Beetstra (contribs, talk) edited Gonane (diff, hist)
Added: 'KEGG' ('' -> 'C19639', SET '')
13:03:05 (5, 4, 4) (EDIT) User:Beetstra (contribs, talk) edited Gonane (diff, hist)
Added: 'CASNo' ('' -> '4732-76-7', SET '')
13:04:05 (5, 4, 4) (EDIT) User:Beetstra (contribs, talk) edited Folic_acid (diff, hist)
Added: 'KEGG' ('C00504' -> 'D00070', SET '')
13:04:17 (4, 4, 5) (EDIT) User:Louisajb (contribs, talk) edited PA_824 (diff, hist)
Added: 'SMILES' ('' -> '[O-][N+](=O)c1cn2C[C@@H](COc2n1)OCc3ccc(OC(F)(F)F)cc3', SET '')
13:04:18 (5, 4, 5) (EDIT) User:Louisajb (contribs, talk) edited PA_824 (diff, hist)
Added: 'ChEMBL' ('' -> '227875', SET '')
13:05:27 (5, 4, 4) (EDIT) User:Beetstra (contribs, talk) edited Folic_acid (diff, hist)
Changed: 'KEGG' ('D00070' -> 'C00504', SET 'D00070')
13:06:33 (5, 4, 5) (EDIT) User:Louisajb (contribs, talk) edited PB-28 (diff, hist)
Added: 'ChEMBL' ('' -> '458995', SET '')
13:07:10 (5, 4, 5) (EDIT) User:Louisajb (contribs, talk) edited PB-28 (diff, hist)
Added: 'ChEMBL' ('458995' -> '53325', SET '')
13:11:43 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Xylitol (diff, hist)
Added: 'Verifiedfields' ('' -> 'changed', SET '')
13:11:43 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Xylitol (diff, hist)
Changed: 'verifiedrevid' ('402759597' -> '457481039', SET '402759597')
13:11:44 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Xylitol (diff, hist)
Changed: 'ChEMBL_Ref' ('{{ebicite|correct|EBI}}' -> '{{ebicite|changed|EBI}}', SET '{{ebicite|correct|EBI}}')
13:11:45 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Xylitol (diff, hist)
Added: 'UNII_Ref' ('' -> '{{fdacite|correct|FDA}}', SET '')
13:11:46 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Xylitol (diff, hist)
Deleted: 'Watchedfields' ('changed' -> '', SET 'changed')
13:13:50 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Gonane (diff, hist)
Changed: 'verifiedrevid' ('424869490' -> '457481383', SET '424869490')
13:13:50 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Gonane (diff, hist)
Changed: 'ChemSpiderID_Ref' ('{{chemspidercite|changed|chemspider}}' -> '{{chemspidercite|correct|chemspider}}', SET '{{chemspidercite|changed|chemspider}}')
13:13:51 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Gonane (diff, hist)
Changed: 'ChEBI_Ref' ('{{ebicite|changed|EBI}}' -> '{{ebicite|correct|EBI}}', SET '{{ebicite|changed|EBI}}')
13:13:51 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Gonane (diff, hist)
Changed: 'StdInChI_Ref' ('{{stdinchicite|changed|chemspider}}' -> '{{stdinchicite|correct|chemspider}}', SET '{{stdinchicite|changed|chemspider}}')
13:13:52 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Gonane (diff, hist)
Changed: 'StdInChIKey_Ref' ('{{stdinchicite|changed|chemspider}}}' -> '{{stdinchicite|correct|chemspider}}}', SET '{{stdinchicite|changed|chemspider}}}')
13:13:52 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Gonane (diff, hist)
Deleted: 'Watchedfields' ('changed' -> '', SET 'changed')
13:15:08 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited PA_824 (diff, hist)
Added: 'Verifiedfields' ('' -> 'changed', SET '')
13:15:09 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited PA_824 (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')
13:15:09 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited PA_824 (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite|correct|??}}', SET '')
13:15:10 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited PA_824 (diff, hist)
Added: 'ChEMBL_Ref' ('' -> '{{ebicite|changed|EBI}}', SET '')
13:16:40 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Folic_acid (diff, hist)
Changed: 'verifiedrevid' ('399160898' -> '457481622', SET '399160898')
13:16:41 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Folic_acid (diff, hist)
Changed: 'DrugBank_Ref' ('{{drugbankcite|changed|drugbank}}' -> '{{drugbankcite|correct|drugbank}}', SET '{{drugbankcite|changed|drugbank}}')
13:16:41 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Folic_acid (diff, hist)
Changed: 'ChEBI_Ref' ('{{ebicite|changed|EBI}}' -> '{{ebicite|correct|EBI}}', SET '{{ebicite|changed|EBI}}')
13:16:41 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Folic_acid (diff, hist)
Changed: 'ChEMBL_Ref' ('{{ebicite|changed|EBI}}' -> '{{ebicite|correct|EBI}}', SET '{{ebicite|changed|EBI}}')
13:16:42 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Folic_acid (diff, hist)
Deleted: 'Watchedfields' ('changed' -> '', SET 'changed')
13:17:21 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited PB-28 (diff, hist)
Added: 'Verifiedfields' ('' -> 'changed', SET '')
13:17:21 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited PB-28 (diff, hist)
Changed: 'verifiedrevid' ('372564983' -> '426027785', SET '372564983')
13:17:21 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited PB-28 (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite|correct|??}}', SET '')
13:17:22 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited PB-28 (diff, hist)
Added: 'ChEMBL_Ref' ('' -> '{{ebicite|changed|EBI}}', SET '')
13:29:11 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Changed: 'realboxname' ('chembox' -> '')
13:29:12 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Changed: 'boxname' ('chembox' -> '')
13:29:12 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Changed: 'ImageFile' ('5-chlorouracil.svg' -> '')
13:29:13 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Changed: 'ImageSize' ('120px' -> '')
13:29:13 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Changed: 'OtherNames' ('5-Chloro-2,4-dihydroxypyrimidine; 5-Chloro-2,4-pyrimidinedione' -> '')
13:29:14 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Changed: 'Section1' ('{{Chembox Identifiers' -> '')
13:29:14 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Changed: 'CASNo_Ref' ('{{cascite|correct|CAS}}' -> '')
13:29:14 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Changed: 'Section2' ('{{Chembox Properties' -> '')
13:29:14 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Changed: 'Section3' ('{{Chembox Hazards' -> '')
13:29:15 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Changed: 'Autoignition' ('}' -> '')
13:29:15 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Changed: 'O' ('2' -> '')
13:29:16 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Changed: 'IUPACName' ('5-Chloropyrimidine-2,4(1''H'',3''H'')-dione' -> '')
13:29:16 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Changed: 'PubChem' ('15758' -> '')
13:29:16 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Changed: 'SMILES' ('Cl/C1=C/NC(=O)NC1=O' -> '')
13:29:17 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Changed: 'InChI' ('InChI=1S/C4H3ClN2O2/c5-2-1-6-4(9)7-3(2)8/h1H,(H2,6,7,8,9)' -> '')
13:29:17 (5, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Changed: 'ChemSpiderID' ('14985' -> '')
13:29:17 (5, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Changed: 'CASNo' ('1820-81-1' -> '')
13:30:36 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Changed: 'realboxname' ('' -> 'chembox')
13:30:36 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Changed: 'boxname' ('' -> 'chembox')
13:30:37 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Changed: 'ImageFile' ('' -> '5-chlorouracil.svg')
13:30:37 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Changed: 'ImageSize' ('' -> '120px')
13:30:38 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Changed: 'OtherNames' ('' -> '5-Chloro-2,4-dihydroxypyrimidine; 5-Chloro-2,4-pyrimidinedione')
13:30:38 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Changed: 'Section1' ('' -> '{{Chembox Identifiers')
13:30:39 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Changed: 'CASNo_Ref' ('' -> '{{cascite|correct|CAS}}')
13:30:40 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Changed: 'Section2' ('' -> '{{Chembox Properties')
13:30:40 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Changed: 'Section3' ('' -> '{{Chembox Hazards')
13:30:41 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Changed: 'Autoignition' ('' -> '}')
13:30:42 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Changed: 'error' ('empty' -> '')
13:30:42 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Changed: 'O' ('' -> '2')
13:30:43 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Changed: 'IUPACName' ('' -> '5-Chloropyrimidine-2,4(1''H'',3''H'')-dione')
13:30:43 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Changed: 'PubChem' ('' -> '15758')
13:30:44 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Changed: 'SMILES' ('' -> 'Cl/C1=C/NC(=O)NC1=O')
13:30:44 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Changed: 'InChI' ('' -> 'InChI=1S/C4H3ClN2O2/c5-2-1-6-4(9)7-3(2)8/h1H,(H2,6,7,8,9)')
13:30:45 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Changed: 'ChemSpiderID' ('' -> '14985')
13:30:45 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Changed: 'CASNo' ('' -> '1820-81-1')
13:30:46 (3, 2, 4) (EDIT) User:Edgar181 (contribs, talk) edited User:Edgar181/sandbox (diff, hist)
Added links: http://svick.org/CatWatch.aspx/List?listName=chemistry%20stubs, http://svick.org/CatWatch.aspx/List?listName=Structure+needed, http://en.wikipedia.org/wiki/Special:AbuseLog?&wpSearchFilter=189, http://tools.wikimedia.de/, http://www.wiki-search.eu/, http:
13:37:42 (3, 2, 4) (EDIT) User:AnomieBOT (contribs, talk) edited Triiodothyronine (diff, hist)
Added links: http://www.fasebj.org/content/19/11/1552.full.pdf
14:59:10 (2, 4, 5) (EDIT) User:129.217.142.123 (contribs, talk) edited 2-Methyl-2-butene (diff, hist)
Changed: 'OtherNames' ('Î²-isoamylene trimethylethylene 2-methyl-2-butene' -> 'Î²-isoamylene trimethylethylene 2-methyl-2-butene Isoamylene', SET 'Î²-isoamylene trimethylethylene 2-methyl-2-butene')
15:13:21 (2, 4, 5) (EDIT) User:JÃ¼ (contribs, talk) edited Phoxim (diff, hist)
Changed: 'ImageFile' ('Phoxim.png' -> 'Phoxim Structural FormulaeV.1.svg', SET 'Phoxim.png')
15:13:22 (2, 4, 5) (EDIT) User:JÃ¼ (contribs, talk) edited Phoxim (diff, hist)
Changed: 'ImageSize' ('150px' -> '350px', SET '150px')
15:13:24 (4, 4, 5) (EDIT) User:JÃ¼ (contribs, talk) edited Phoxim (diff, hist)
Changed: 'IUPACName' ('''N''-[(Diethoxyphosphorothioyl)oxy]benzenecarboximidoyl cyanide' -> '(''E'',''Z'')-''N''-[(Diethoxyphosphorothioyl)oxy]benzenecarboximidoyl cyanide', SET '''N''-[(Diethoxyphosphorothioyl)oxy]benzenecarboximidoyl cyanide')
15:13:35 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited 3-Hexyne (diff, hist)
Changed: 'verifiedrevid' ('401772050' -> '440494426', SET '401772050')
15:13:35 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited 3-Hexyne (diff, hist)
Deleted: 'Watchedfields' ('changed' -> '', SET 'changed')
15:24:05 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Phoxim (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')
15:24:06 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Phoxim (diff, hist)
Changed: 'verifiedrevid' ('437151182' -> '437293527', SET '437151182')
16:04:54 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Lead(IV)_sulfide (diff, hist)
Changed: 'verifiedrevid' ('402671916' -> '419901227', SET '402671916')
16:04:55 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Lead(IV)_sulfide (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite|correct|??}}', SET '')
16:16:35 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Uranium_tetrafluoride (diff, hist)
Changed: 'verifiedrevid' ('426999709' -> '451188952', SET '426999709')
16:34:39 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Theaflavin (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite|correct|??}}', SET '')
17:21:52 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Lithium_nitride (diff, hist)
Changed: 'CASNo_Ref' ('{{cascite}}' -> '{{cascite|correct|CAS}}', SET '{{cascite}}')
18:02:40 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Silica_gel (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite|correct|CAS}}', SET '')
18:25:23 (4, 4, 5) (EDIT) User:148.177.1.216 (contribs, talk) edited Acetoguanamine (diff, hist)
Added: 'H' ('' -> '7', SET '')
18:25:24 (4, 5, 5) (EDIT) User:148.177.1.216 (contribs, talk) edited Acetoguanamine (diff, hist)
Deleted: 'Formula' ('{{Chem|C|4|N|5|H|7}}' -> '', SET '{{Chem|C|4|N|5|H|7}}')
18:25:25 (4, 5, 5) (EDIT) User:148.177.1.216 (contribs, talk) edited Acetoguanamine (diff, hist)
Deleted: 'MolarMass' ('125.1319 g mol-1' -> '', SET '125.1319 g mol-1')
18:40:33 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Acetoguanamine (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')
18:40:34 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Acetoguanamine (diff, hist)
Changed: 'verifiedrevid' ('415772002' -> '434888675', SET '415772002')
18:40:36 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Acetoguanamine (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite|correct|??}}', SET '')
19:33:35 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Ferrocene (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')
19:33:38 (4, 4, 5) (EDIT) User:Electron9 (contribs, talk) edited Endosulfan (diff, hist)
Changed: 'IUPACName' ('6,7,8,9,10,10-Hexachloro-1,5,5a,6,9,9a-hexahydro-6,9-methano-2,4,3-benzodioxathiepine-3-oxide' -> '6,7,8,9,10,10-Hexachloro-1,5,5a,6,9,9a-hexahydro- 6,9-methano-2,4,3-benzodioxathiepine-3-oxide', SET '6,7,8,9,10,10-Hexachloro-1,5,5a,6,9,9a-h
19:48:56 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Endosulfan (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')
20:41:06 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited NaK (diff, hist)
Changed: 'verifiedrevid' ('434089900' -> '450755504', SET '434089900')
20:41:07 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited NaK (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite|correct|??}}', SET '')
20:41:08 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited NaK (diff, hist)
Deleted: 'Watchedfields' ('changed' -> '', SET 'changed')
20:48:37 (3, 2, 4) (EDIT) User:DadaNeem (contribs, talk) edited Resveratrol (diff, hist)
Added links: http://pubs.acs.org/doi/abs/10.1021/jf048804b, http://www.zalet.com/resveratrol-sources-resveratrol-red-grapes-juice/
21:18:13 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Barium_hydroxide (diff, hist)
Changed: 'verifiedrevid' ('443412971' -> '443414291', SET '443412971')
22:01:45 (3, 2, 4) (EDIT) User:DadaNeem (contribs, talk) edited Resveratrol (diff, hist)
Added links: http://www.sproutpeople.com/seed/peanut.html, http://www.zalet.com
22:14:44 (2, 4, 4) (EDIT) User:Materialscientist (contribs, talk) edited Zirconium_dioxide (diff, hist)
Changed: 'Entropy' ('50.3 J Kâ1 molâ1' -> '50.3 J Kâ1 molâ1', SET '50.3 J Kâ1 molâ1')
23:09:13 (3, 2, 4) (EDIT) User:Rod57 (contribs, talk) edited Dimethyl_fumarate (diff, hist)
Added links: http://www.genengnews.com/gen-news-highlights/biogen-idec-reports-positive-data-from-second-phase-iii-trial-with-multiple-sclerosis-drug/81245871/
23:33:44 (4, 4, 4) (EDIT) User:Materialscientist (contribs, talk) edited Ferrocene (diff, hist)
Changed: 'MeltingPt' ('114 Â°C' -> '172.5 Â°C<ref>{{RubberBible86th|page=3.258}}</ref>', SET '174 Â°C')
23:33:46 (4, 4, 4) (EDIT) User:Materialscientist (contribs, talk) edited Ferrocene (diff, hist)
Changed: 'BoilingPt' ('189 Â°C' -> '249 Â°C', SET '249 Â°C')