Wikipedia:WikiProject Chemicals/Log/2009-12-20
Appearance
Standard header for logs from CheMoBot
- 01:12:35 (2, 3, 4) (EDIT) User:Ronhjones (contribs, talk) edited Ambuphylline (diff, hist)
Changed: 'ImageFile' ('<!-- Ambuphylline.png --><!-- image conflict, this is not 2-amino-2-methylpropan-1-ol. -->' -> 'Ambuphylline.svg') - 01:12:35 (4, 3, 4) (EDIT) User:Ronhjones (contribs, talk) edited Ambuphylline (diff, hist)
Changed: 'SMILES' ('O=C2N(c1ncnc1C(=O)N2C)C.OCC(N)(C)C' -> 'CC(C)(CO)N.Cn1c2c(c(=O)n(c1=O)C)[nH]cn2') - 05:59:33 (4, 3, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Methyldichloroarsine (diff, hist)
Changed: 'IUPACName' ('Dichloromethylarsane' -> 'dichloro(methyl)arsane') 06:28:01 (2, 4, 4) (EDIT) User:Materialscientist (contribs, talk) edited Potassium_chloride (diff, hist)
Changed: 'LD50' ('2600 mg/kg (oral/rat), 142 mg/kg (intravenous/rat)<ref>{{citation | title = Material Safety Data Sheet - Potassium Chloride | publisher = SigmaâAldrich | date = July 2001}}</ref>' -> '2600 mg/kg (oral/rat), 142 mg/kg (intravenous/rat)<ref>{{citation|title = Material Safety Data Sheet - Potassium Chloride|publisher = SigmaâAldrich|date = July 2001}}</ref>', SET '2600 mg/kg (oral/rat), 142 mg/kg (intravenous/rat)<ref>{{citation | title = Material Safety Data Sheet - Potassium Chloride | publisher = SigmaâAldrich | date = July 2001}}</ref>')- 06:45:23 (2, 3, 5) (EDIT) User:13mullja (contribs, talk) edited Pentacarbon_dioxide (diff, hist)
Changed: 'ChemSpider' ('' -> '454765') - 06:48:23 (2, 3, 5) (EDIT) User:13mullja (contribs, talk) edited Pentacarbon_dioxide (diff, hist)
Changed: '[[ChemSpider]]' ('' -> '454765') - 06:48:23 (2, 3, 5) (EDIT) User:13mullja (contribs, talk) edited Pentacarbon_dioxide (diff, hist)
Changed: 'ChemSpider' ('454765' -> '') 07:14:11 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Silicon_tetrachloride (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')07:14:11 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Silicon_tetrachloride (diff, hist)
Added: 'verifiedrevid' ('' -> '261991783', SET '')08:14:04 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Ambuphylline (diff, hist)
Changed: 'OtherNames' ('Theophylline aminoisobutnaol' -> 'Theophylline aminoisobutanol')09:05:04 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Ambuphylline (diff, hist)
Changed: 'SMILES' ('CC(C)(CO)N.Cn1c2c(c(=O)n(c1=O)C)[nH]cn2' -> 'O=C2N(c1ncnc1C(=O)N2C)C.OCC(N)(C)C')- 09:26:22 (3, 2, 4) (EDIT) User:Cffrost (contribs, talk) edited Behentrimonium_chloride (diff, hist)
Added links: http://hpd.nlm.nih.gov/cgi-bin/household/brands?tbl=chem&id=839&query=behentrimonium+chloride&searchas=TblChemicals1&prodcat=all 09:28:01 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Benzenemethanethiol (diff, hist)
Changed: 'InChIKey' ('' -> 'UENWRTRMUIOCKN-UHFFFAOYAC')09:28:01 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Benzenemethanethiol (diff, hist)
Changed: 'SMILES' ('C1=CC=C(C=C1)CS' -> 'SCc1ccccc1')09:28:01 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Benzenemethanethiol (diff, hist)
Changed: 'InChI' ('' -> '1/C7H8S/c8-6-7-4-2-1-3-5-7/h1-5,8H,6H2')09:33:09 (2, 4, 4) (EDIT) User:Beetstra (contribs, talk) edited Beta-D (diff, hist)
Added: 'InChIKey' ('' -> 'RHCSKNNOAZULRK-APZFVMQVEB', SET '')09:35:08 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Beta-Ureidoisobutyric_acid (diff, hist)
Changed: 'InChIKey' ('' -> 'PHENTZNALBMCQD-UHFFFAOYAG')09:35:09 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Beta-Ureidoisobutyric_acid (diff, hist)
Changed: 'SMILES' ('CC(CNC(=O)N)C(=O)O' -> 'O=C(O)C(C)CNC(=O)N')09:35:09 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Beta-Ureidoisobutyric_acid (diff, hist)
Changed: 'InChI' ('' -> '1/C5H10N2O3/c1-3(4(8)9)2-7-5(6)10/h3H,2H2,1H3,(H,8,9)(H3,6,7,10)')09:39:40 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Betamethasone_17-valerate (diff, hist)
Changed: 'InChIKey' ('' -> 'SNHRLVCMMWUAJD-SUYDQAKGBY')09:39:40 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Betamethasone_17-valerate (diff, hist)
Changed: 'SMILES' ('CCCCC(=O)O[C@@]1([C@H](C[C@@H]2[C@@]1(C[C@@H]([C@]3([C@H]2CCC4=CC(=O)C=C[C@@]43C)F)O)C)C)C(=O)CO' -> 'O=C(O[C@@]3(C(=O)CO)[C@]2(C[C@H](O)[C@]4(F)[C@@]/1(\C(=C/C(=O)\C=C\1)CC[C@H]4[C@@H]2C[C@@H]3C)C)C)CCCC')09:39:41 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Betamethasone_17-valerate (diff, hist)
Changed: 'InChI' ('' -> '1/C27H37FO6/c1-5-6-7-23(33)34-27(22(32)15-29)16(2)12-20-19-9-8-17-13-18(30)10-11-24(17,3)26(19,28)21(31)14-25(20,27)4/h10-11,13,16,19-21,29,31H,5-9,12,14-15H2,1-4H3/t16-,19-,20-,21-,24-,25-,26-,27-/m0/s1')09:39:41 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Betamethasone_17-valerate (diff, hist)
Changed: 'ChemSpiderID' ('' -> '15673')09:47:52 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bicinchoninic_acid (diff, hist)
Changed: 'InChIKey' ('' -> 'AFYNADDZULBEJA-UHFFFAOYAF')09:47:52 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bicinchoninic_acid (diff, hist)
Changed: 'SMILES' ('' -> 'O=C(O)c1cc(nc2c1cccc2)c3nc4ccccc4c(c3)C(=O)O')09:47:53 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bicinchoninic_acid (diff, hist)
Changed: 'InChI' ('' -> '1/C20H12N2O4/c23-19(24)13-9-17(21-15-7-3-1-5-11(13)15)18-10-14(20(25)26)12-6-2-4-8-16(12)22-18/h1-10H,(H,23,24)(H,25,26)')09:47:53 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bicinchoninic_acid (diff, hist)
Changed: 'ChemSpiderID' ('' -> '64223')09:53:03 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Biebrich_scarlet (diff, hist)
Changed: 'InChIKey' ('' -> 'VVAVKBBTPWYADW-NUQVWONBAJ')09:53:03 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Biebrich_scarlet (diff, hist)
Changed: 'SMILES' ('C1=CC=C2C(=C1)C=CC(=O)C2=NNC3=C(C=C(C=C3)N=NC4=CC=C(C=C4)S(=O)(=O)O)S(=O)(=O)O' -> '[Na+].[Na+].[O-]S(=O)(=O)c1ccc(cc1)/N=N/c4ccc(/N=N/c2c3ccccc3ccc2O)c(c4)S([O-])(=O)=O')09:53:03 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Biebrich_scarlet (diff, hist)
Changed: 'InChI' ('' -> '1/C22H16N4O7S2.2Na/c27-20-12-5-14-3-1-2-4-18(14)22(20)26-25-19-11-8-16(13-21(19)35(31,32)33)24-23-15-6-9-17(10-7-15)34(28,29)30;;/h1-13,27H,(H,28,29,30)(H,31,32,33);;/q;2*+1/p-2')09:53:03 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Biebrich_scarlet (diff, hist)
Changed: 'ChemSpiderID' ('' -> '17967084')09:54:08 (4, 4, 4) (EDIT) User:Beetstra (contribs, talk) edited Biguanide (diff, hist)
Changed: 'SMILES' ('[N@H]=C(\N=C(/N)N)N' -> 'C(=N)(N)NC(=N)N', SET '[N@H]=C(\N=C(/N)N)N')09:57:58 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Biopterin (diff, hist)
Changed: 'InChIKey' ('' -> 'LHQIJBMDNUYRAM-UHFFFAOYAC')09:57:59 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Biopterin (diff, hist)
Changed: 'SMILES' ('CC(C(C1=CN=C2C(=N1) C(=O)N=C(N2)N)O)O' -> 'O=C2\N=C(/Nc1ncc(nc12)C(O)C(O)C)N')09:57:59 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Biopterin (diff, hist)
Changed: 'InChI' ('' -> '1/C9H11N5O3/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7/h2-3,6,15-16H,1H3,(H3,10,11,13,14,17)')09:57:59 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Biopterin (diff, hist)
Changed: 'ChemSpiderID' ('' -> '2288')10:04:38 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Biguanide (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')10:18:03 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bis(2,4,5-trichlorophenyl-6-carbopentoxyphenyl)oxalate (diff, hist)
Changed: 'InChIKey' ('' -> 'TZZLVFUOAYMTHA-UHFFFAOYAP')10:18:04 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bis(2,4,5-trichlorophenyl-6-carbopentoxyphenyl)oxalate (diff, hist)
Changed: 'SMILES' ('ClC1=C(Cl)C=C(Cl)C(OC(C(OC2=C(C(OCCCCC)=O)C(Cl)=C(Cl)C=C2Cl)=O)=O)=C1C(OCCCCC)=O' -> 'Clc2c(C(=O)OCCCCC)c(OC(=O)C(=O)Oc1c(C(=O)OCCCCC)c(Cl)c(Cl)cc1Cl)c(Cl)cc2Cl')10:18:04 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bis(2,4,5-trichlorophenyl-6-carbopentoxyphenyl)oxalate (diff, hist)
Changed: 'InChI' ('' -> '1/C26H24Cl6O8/c1-3-5-7-9-37-23(33)17-19(31)13(27)11-15(29)21(17)39-25(35)26(36)40-22-16(30)12-14(28)20(32)18(22)24(34)38-10-8-6-4-2/h11-12H,3-10H2,1-2H3')10:18:04 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bis(2,4,5-trichlorophenyl-6-carbopentoxyphenyl)oxalate (diff, hist)
Changed: 'ChemSpiderID' ('' -> '84082')10:21:09 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bis(2-chloroethyl)ethylamine (diff, hist)
Changed: 'InChIKey' ('' -> 'UQZPGHOJMQTOHB-UHFFFAOYAK')10:21:09 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bis(2-chloroethyl)ethylamine (diff, hist)
Changed: 'InChI' ('' -> '1/C6H13Cl2N/c1-2-9(5-3-7)6-4-8/h2-6H2,1H3')10:21:09 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bis(2-chloroethyl)ethylamine (diff, hist)
Changed: 'ChemSpiderID' ('' -> '10391')10:33:04 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bis(chloromethyl)_ether (diff, hist)
Changed: 'InChIKey' ('' -> 'HRQGCQVOJVTVLU-UHFFFAOYAN')10:36:07 (2, 4, 4) (EDIT) User:Beetstra (contribs, talk) edited Bis-TOM (diff, hist)
Added: 'InChIKey' ('' -> 'XFCQINWERPNOHI-UHFFFAOYAA', SET '')- 10:42:46 (4, 3, 4) (EDIT) User:Closedmouth (contribs, talk) edited Boron_suboxide (diff, hist)
Changed: 'Density' ('2.56 g/cm<sup>3</sup> <ref name=b6o>{{cite journal | last = Kobayashi | first = M. | coauthors = Higashi, I.; Brodhag, C.; Thévenot, F.| title = Structure of B<sub>6</sub>O boron-suboxide by Rietveld refinement | doi = 10.1007/BF00367573 | journal = Journal of Material Science | volume = 28 | year = 1993 | pages = 2129–2134}}</ref>' -> '2.56 g/cm<sup>3</sup><ref name=b6o>{{cite journal | last = Kobayashi | first = M. | coauthors = Higashi, I.; Brodhag, C.; Thévenot, F.| title = Structure of B<sub>6</sub>O boron-suboxide by Rietveld refinement | doi = 10.1007/BF00367573 | journal = Journal of Material Science | volume = 28 | year = 1993 | pages = 2129–2134}}</ref>') 10:58:53 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bisabolol (diff, hist)
Changed: 'InChIKey' ('' -> 'RGZSQWQPBWRIAQ-CABCVRREBV')10:58:53 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bisabolol (diff, hist)
Changed: 'SMILES' ('C/C(C)=C/CC[C@](O)(C)[C@@]1([H])CC=C(C)CC1' -> 'O[C@@](C)(CC\C=C(/C)C)[C@@H]1C/C=C(/C)CC1')10:58:53 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bisabolol (diff, hist)
Changed: 'InChI' ('' -> '1/C15H26O/c1-12(2)6-5-11-15(4,16)14-9-7-13(3)8-10-14/h6-7,14,16H,5,8-11H2,1-4H3/t14-,15+/m1/s1')10:58:54 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bisabolol (diff, hist)
Changed: 'ChemSpiderID' ('' -> '390796')11:11:50 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bismuth_pentafluoride (diff, hist)
Changed: 'InChIKey' ('' -> 'MELFHUKMGVSOTN-COTDSHSIAY')11:11:51 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bismuth_pentafluoride (diff, hist)
Changed: 'SMILES' ('' -> '[F-].[F-].[F-].[F-].[F-].[BiH3+3]')11:11:51 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bismuth_pentafluoride (diff, hist)
Changed: 'InChI' ('' -> '1/Bi.5FH.3H/h;5*1H;;;/q+3;;;;;;;;/p-5/rBiH3.5FH/h1H3;5*1H/q+3;;;;;/p-5')11:11:51 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bismuth_pentafluoride (diff, hist)
Changed: 'ChemSpiderID' ('' -> '21172752')11:16:05 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bismuth_trifluoride (diff, hist)
Changed: 'InChIKey' ('' -> 'GRQDKISMHISLGB-IZWAAGQTAY')11:16:05 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bismuth_trifluoride (diff, hist)
Changed: 'SMILES' ('' -> '[F-].[F-].[F-].[BiH3+3]')11:16:05 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bismuth_trifluoride (diff, hist)
Changed: 'InChI' ('' -> '1/Bi.3FH.3H/h;3*1H;;;/q+3;;;;;;/p-3/rBiH3.3FH/h1H3;3*1H/q+3;;;/p-3')11:16:06 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bismuth_trifluoride (diff, hist)
Changed: 'ChemSpiderID' ('' -> '21172751')11:17:05 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bismuth(III)_iodide (diff, hist)
Changed: 'InChIKey' ('' -> 'HXTWPIJUKIDKIH-ZPTXHWADAA')11:17:05 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bismuth(III)_iodide (diff, hist)
Changed: 'SMILES' ('' -> '[I-].[I-].[I-].[BiH3+3]')11:17:06 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bismuth(III)_iodide (diff, hist)
Changed: 'InChI' ('' -> '1/Bi.3HI.3H/h;3*1H;;;/q+3;;;;;;/p-3/rBiH3.3HI/h1H3;3*1H/q+3;;;/p-3')11:17:06 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bismuth(III)_iodide (diff, hist)
Changed: 'ChemSpiderID' ('' -> '21172753')11:20:54 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bixin (diff, hist)
Changed: 'InChIKey' ('' -> 'RAFGELQLHMBRHD-SLEZCNMEBU')11:20:54 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bixin (diff, hist)
Changed: 'SMILES' ('C/C(=C\C=C\C=C(/C)\C=C\C=C(\C)/C=C/C(=O)OC)/C=C/C=C(\C)/C=C/C(=O)O' -> 'O=C(O)\C=C\C(=C\C=C\C(=C\C=C\C=C(\C=C\C=C(/C=C/C(=O)OC)C)C)C)C')11:20:55 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bixin (diff, hist)
Changed: 'InChI' ('' -> '1/C25H30O4/c1-20(12-8-14-22(3)16-18-24(26)27)10-6-7-11-21(2)13-9-15-23(4)17-19-25(28)29-5/h6-19H,1-5H3,(H,26,27)/b7-6+,12-8+,13-9+,18-16+,19-17+,20-10+,21-11+,22-14+,23-15-')11:20:55 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bixin (diff, hist)
Changed: 'ChemSpiderID' ('' -> '4444638')11:21:32 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Blattellaquinone (diff, hist)
Changed: 'InChIKey' ('' -> 'JVMUMZYOAWLJQW-UHFFFAOYAC')11:21:33 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Blattellaquinone (diff, hist)
Changed: 'SMILES' ('O=C(C=C1)C(COC(CC(C)C)=O)=CC1=O' -> 'O=C/1/C=C\C(=O)\C=C\1COC(=O)CC(C)C')11:21:33 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Blattellaquinone (diff, hist)
Changed: 'InChI' ('' -> '1/C12H14O4/c1-8(2)5-12(15)16-7-9-6-10(13)3-4-11(9)14/h3-4,6,8H,5,7H2,1-2H3')11:21:33 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Blattellaquinone (diff, hist)
Changed: 'ChemSpiderID' ('' -> '9553964')11:22:39 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bolasterone (diff, hist)
Changed: 'InChIKey' ('' -> 'IVFYLRMMHVYGJH-VLOLGRDOBD')11:22:39 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bolasterone (diff, hist)
Changed: 'SMILES' ('CC1CC2=CC(=O)CCC2(C3C1C4CCC(C4(CC3)C)(C)O)C' -> 'O=C4\C=C3/[C@]([C@H]2CC[C@]1([C@@H](CC[C@@]1(O)C)[C@@H]2[C@H](C)C3)C)(C)CC4')11:22:39 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bolasterone (diff, hist)
Changed: 'InChI' ('' -> '1/C21H32O2/c1-13-11-14-12-15(22)5-8-19(14,2)16-6-9-20(3)17(18(13)16)7-10-21(20,4)23/h12-13,16-18,23H,5-11H2,1-4H3/t13-,16+,17+,18-,19+,20+,21+/m1/s1')11:22:39 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bolasterone (diff, hist)
Changed: 'ChemSpiderID' ('' -> '92280')11:25:04 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Boldione (diff, hist)
Changed: 'InChIKey' ('' -> 'LUJVUUWNAPIQQI-QAGGRKNEBZ')11:25:04 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Boldione (diff, hist)
Changed: 'SMILES' ('C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CCC4=CC(=O)C=C[C@]34C' -> 'O=C\1\C=C/[C@]3(/C(=C/1)CC[C@H]4[C@@H]2CCC(=O)[C@]2(CC[C@H]34)C)C')11:25:05 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Boldione (diff, hist)
Changed: 'InChI' ('' -> '1/C19H24O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h7,9,11,14-16H,3-6,8,10H2,1-2H3/t14-,15-,16-,18-,19-/m0/s1')11:25:05 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Boldione (diff, hist)
Changed: 'ChemSpiderID' ('' -> '12893')11:30:34 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Decanoic_acid (diff, hist)
Added: 'verifiedrevid' ('' -> '308122706', SET '')11:30:35 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Decanoic_acid (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite}}', SET '')11:51:43 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Diisononyl_phthalate (diff, hist)
Added: 'verifiedrevid' ('' -> '307738964', SET '')11:51:44 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Diisononyl_phthalate (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite}}', SET '')11:52:25 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Boron_triiodide (diff, hist)
Changed: 'InChIKey' ('' -> 'YMEKEHSRPZAOGO-UHFFFAOYAR')11:52:25 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Boron_triiodide (diff, hist)
Changed: 'SMILES' ('B(I)(I)I' -> 'IB(I)I')11:52:26 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Boron_triiodide (diff, hist)
Changed: 'InChI' ('' -> '1/BI3/c2-1(3)4')11:52:26 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Boron_triiodide (diff, hist)
Changed: 'ChemSpiderID' ('' -> '75378')11:53:13 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bourgeonal (diff, hist)
Changed: 'InChIKey' ('' -> 'FZJUFJKVIYFBSY-UHFFFAOYAX')11:53:13 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bourgeonal (diff, hist)
Changed: 'SMILES' ('CC(C)(C)C1=CC=C(C=C1)CCC=O' -> 'O=CCCc1ccc(cc1)C(C)(C)C')11:53:13 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bourgeonal (diff, hist)
Changed: 'InChI' ('' -> '1/C13H18O/c1-13(2,3)12-8-6-11(7-9-12)5-4-10-14/h6-10H,4-5H2,1-3H3')11:53:14 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bourgeonal (diff, hist)
Changed: 'ChemSpiderID' ('' -> '58364')11:59:22 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Brivaracetam (diff, hist)
Changed: 'InChIKey' ('' -> 'MSYKRHVOOPPJKU-BDAKNGLRBT')11:59:22 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Brivaracetam (diff, hist)
Changed: 'PubChem' ('' -> '9837243')11:59:22 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Brivaracetam (diff, hist)
Changed: 'SMILES' ('' -> 'O=C(N)[C@@H](N1C(=O)C[C@@H](CCC)C1)CC')11:59:22 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Brivaracetam (diff, hist)
Changed: 'InChI' ('' -> '1/C11H20N2O2/c1-3-5-8-6-10(14)13(7-8)9(4-2)11(12)15/h8-9H,3-7H2,1-2H3,(H2,12,15)/t8-,9+/m1/s1')11:59:23 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Brivaracetam (diff, hist)
Changed: 'ChemSpiderID' ('' -> '8012964')12:02:29 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bromadiolone (diff, hist)
Changed: 'InChIKey' ('' -> 'OWNRRUFOJXFKCU-UHFFFAOYAS')12:02:29 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bromadiolone (diff, hist)
Changed: 'SMILES' ('C1=CC=C(C=C1)C(CC(C2=CC=C(C=C2)C3=CC=C(C=C3)Br)O)C4=C(OC5=CC=CC=C5C4=O)O' -> 'Brc1ccc(cc1)c2ccc(cc2)C(O)CC(C\3=C(/O)c4ccccc4OC/3=O)c5ccccc5')12:02:30 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bromadiolone (diff, hist)
Changed: 'InChI' ('' -> '1/C30H23BrO4/c31-23-16-14-20(15-17-23)19-10-12-22(13-11-19)26(32)18-25(21-6-2-1-3-7-21)28-29(33)24-8-4-5-9-27(24)35-30(28)34/h1-17,25-26,32-33H,18H2')12:02:30 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bromadiolone (diff, hist)
Changed: 'ChemSpiderID' ('' -> '10606098')12:04:26 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bromic_acid (diff, hist)
Changed: 'InChIKey' ('' -> 'SXDBWCPKPHAZSM-UHFFFAOYAE')12:04:26 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bromic_acid (diff, hist)
Changed: 'SMILES' ('OBr(=O)=O' -> 'O=Br(=O)O')12:04:26 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bromic_acid (diff, hist)
Changed: 'InChI' ('' -> '1/BrHO3/c2-1(3)4/h(H,2,3,4)')12:04:27 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bromic_acid (diff, hist)
Changed: 'ChemSpiderID' ('' -> '22853')12:05:45 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bromic_acid (diff, hist)
Changed: 'Solubility' ('? g/100 ml (?°C)' -> '')12:05:45 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bromic_acid (diff, hist)
Changed: 'Viscosity' ('? [[Poise|cP]] at ?°C' -> '')12:05:45 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bromic_acid (diff, hist)
Changed: 'FlashPt' ('?°C' -> '')12:05:45 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bromic_acid (diff, hist)
Changed: 'MeltingPt' ('°C (? K)' -> '')12:05:46 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bromic_acid (diff, hist)
Changed: 'BoilingPt' ('(? K)' -> '')12:06:30 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bromine_monochloride (diff, hist)
Changed: 'InChIKey' ('' -> 'CODNYICXDISAEA-UHFFFAOYAZ')12:06:30 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bromine_monochloride (diff, hist)
Changed: 'SMILES' ('' -> 'BrCl')12:06:30 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bromine_monochloride (diff, hist)
Changed: 'InChI' ('' -> '1/BrCl/c1-2')12:06:31 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bromine_monochloride (diff, hist)
Changed: 'ChemSpiderID' ('' -> '55600')12:10:56 (2, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bromobenzyl_cyanide (diff, hist)
Changed: 'InChIKey' ('' -> 'XUHFBOUSHUEAQZ-UHFFFAOYAJ')12:10:56 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bromobenzyl_cyanide (diff, hist)
Changed: 'SMILES' ('' -> 'N#CC(Br)c1ccccc1')12:10:57 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bromobenzyl_cyanide (diff, hist)
Changed: 'InChI' ('' -> '1/C8H6BrN/c9-8(6-10)7-4-2-1-3-5-7/h1-5,8H')12:10:57 (4, 3, 4) (EDIT) User:Beetstra (contribs, talk) edited Bromobenzyl_cyanide (diff, hist)
Changed: 'ChemSpiderID' ('' -> '20715')- 12:49:59 (3, 2, 4) (EDIT) User:124.185.157.246 (contribs, talk) edited Glufosinate (diff, hist)
Added links: http://www.bayercropscience.com.au/resources/products/TechGuide/Basta_tech%20Guide_BHT22410606H&T_2007_auwsc.pdf 13:38:08 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Dirhenium_decacarbonyl (diff, hist)
Added: 'verifiedrevid' ('' -> '290224343', SET '')13:38:08 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Dirhenium_decacarbonyl (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite}}', SET '')13:38:39 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Dimethyl-4-phenylenediamine (diff, hist)
Added: 'verifiedrevid' ('' -> '265874906', SET '')13:38:39 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Dimethyl-4-phenylenediamine (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite}}', SET '')- 14:06:19 (2, 5, 4) (EDIT) User:William Avery (contribs, talk) edited Cellulose (diff, hist)
Changed: 'OtherNames' ('Mikalia dalyctus' -> '', SET '') 15:02:49 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Aluminium_arsenide (diff, hist)
Added: 'verifiedrevid' ('' -> '292308854', SET '')16:27:13 (2, 4, 4) (EDIT) User:Smokefoot (contribs, talk) edited Sucrose (diff, hist)
Changed: 'Solubility' ('200 g/100 ml (25 °C)' -> '200 g/100 mL (25 °C)', SET '200 g/100 ml (25 °C)')18:23:40 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Anthanthrene (diff, hist)
Added: 'verifiedrevid' ('' -> '307416632', SET '')- 19:32:38 (2, 3, 5) (EDIT) User:RjwilmsiBot (contribs, talk) edited Hexafluorophosphoric_acid (diff, hist)
Changed: 'Reference' ('<ref name="hand">{{Citation | last = Lide | first = David R. | author-link = | last2 = | first2 = | author2-link = | publication-date = | date = | year = 1998 | title = Handbook of Chemistry and Physics | edition = 87 | volume = | series = | publication-place = Boca Raton, FL | place = | publisher = CRC Press | id = | isbn = 0849305942 | doi = | oclc = | pages = 4-74 | url = | accessdate =}}</ref>' -> '<ref name="hand">{{Citation | last = Lide | first = David R. | author-link = | last2 = | first2 = | author2-link = | publication-date = | date = | year = 1998 | title = Handbook of Chemistry and Physics | edition = 87 | volume = | series = | publication-place = Boca Raton, FL | place = | publisher = CRC Press | id = | isbn = 0849305942 | doi = | oclc = | pages = 4â74 | url = | accessdate =}}</ref>') 19:50:25 (2, 4, 4) (EDIT) User:Smokefoot (contribs, talk) edited 2-Furanone (diff, hist)
Added: 'OtherNames' ('' -> 'furan-2-one, γ-crotonolactone, β-angelica lactone, butenolide', SET '')21:48:43 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Silver_tetrafluoroborate (diff, hist)
Added: 'verifiedrevid' ('' -> '261521066', SET '')- 00:01:25 (2, 4, 5) (EDIT) User:RjwilmsiBot (contribs, talk) edited Indium_arsenide (diff, hist)
Added: 'Reference' ('<ref name="hand">{{Citation | last = Lide | first = David R. | year = 1998 | title = Handbook of Chemistry and Physics | edition = 87 | publication-place = Boca Raton, FL | publisher = CRC Press | isbn = 0849305942 | pages = 4-61}}</ref>' -> '<ref name="hand">{{Citation | last = Lide | first = David R. | year = 1998 | title = Handbook of Chemistry and Physics | edition = 87 | publication-place = Boca Raton, FL | publisher = CRC Press | isbn = 0849305942 | pages = 4â61}}</ref>', SET '') - 00:01:40 (2, 3, 5) (EDIT) User:RjwilmsiBot (contribs, talk) edited Indium(III)_bromide (diff, hist)
Changed: 'Reference' ('<ref name="hand">{{Citation | last = Lide | first = David R. | year = 1998 | title = Handbook of Chemistry and Physics | edition = 87 | publication-place = Boca Raton, FL | publisher = CRC Press | isbn = 0849305942 | pages = 4-61}}</ref>' -> '<ref name="hand">{{Citation | last = Lide | first = David R. | year = 1998 | title = Handbook of Chemistry and Physics | edition = 87 | publication-place = Boca Raton, FL | publisher = CRC Press | isbn = 0849305942 | pages = 4â61}}</ref>') - 00:02:11 (4, 3, 5) (EDIT) User:RjwilmsiBot (contribs, talk) edited Indium(III)_telluride (diff, hist)
Changed: 'MeltingPt' ('667°C<ref name="hand">{{Citation | last = Lide | first = David R. | author-link = | last2 = | first2 = | author2-link = | publication-date = | date = | year = 1998 | title = Handbook of Chemistry and Physics | edition = 87 | volume = | series = | publication-place = Boca Raton, FL | place = | publisher = CRC Press | id = | isbn = 0849305942 | doi = | oclc = | pages = 4-61 | url = | accessdate =}}</ref>' -> '667°C<ref name="hand">{{Citation | last = Lide | first = David R. | author-link = | last2 = | first2 = | author2-link = | publication-date = | date = | year = 1998 | title = Handbook of Chemistry and Physics | edition = 87 | volume = | series = | publication-place = Boca Raton, FL | place = | publisher = CRC Press | id = | isbn = 0849305942 | doi = | oclc = | pages = 4â61 | url = | accessdate =}}</ref>') - 00:04:32 (2, 4, 5) (EDIT) User:67.247.75.32 (contribs, talk) edited Sodium_sulfate (diff, hist)
Added: 'RefractIndex' ('1.468 (anhydrous) <br> 1.394 (dechydrate)' -> '1.468 (anhydrous) <br> 1.394 (decahydrate)', SET '') 00:11:53 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Indium_arsenide (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')00:11:53 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Indium_arsenide (diff, hist)
Added: 'verifiedrevid' ('' -> '261543903', SET '')- 00:26:04 (4, 4, 5) (EDIT) User:74.214.109.149 (contribs, talk) edited Cyclohexene (diff, hist)
Changed: 'BoilingPt' ('82.98 °C' -> '12.98 °C', SET '82.98 °C') 00:36:29 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Cyclohexene (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')- 00:40:00 (2, 5, 5) (EDIT) User:Tomaxer (contribs, talk) edited Cyclohexene (diff, hist)
Changed: 'Watchedfields' ('changed' -> '', SET '') - 00:40:00 (4, 5, 5) (EDIT) User:Tomaxer (contribs, talk) edited Cyclohexene (diff, hist)
Changed: 'BoilingPt' ('12.98 °C' -> '82.98 °C', SET '82.98 °C')