Etozolin: Difference between revisions
Content deleted Content added
Od Mishehu (talk | contribs) m stub sorting {{pharmacology-stub}} -> {{antihypertensive-stub}} |
←Created page with '{{Drugbox | IUPAC_name = ethyl (2''Z'')-(3-methyl-4-oxo-5-piperidin-1-yl-1,3-thiazolidin-2-ylidene)ethanoate | image = <!-- missing...' |
||
| Line 1: | Line 1: | ||
{{Drugbox |
{{Drugbox |
||
| IUPAC_name =(2'' |
| IUPAC_name = ethyl (2''Z'')-(3-methyl-4-oxo-5-piperidin-1-yl-1,3-thiazolidin-2-ylidene)ethanoate |
||
| image = |
| image = <!-- missing --> |
||
| CAS_number = 73-09-6 |
| CAS_number = 73-09-6 |
||
| ATC_prefix = C03 |
| ATC_prefix = C03 |
||
| ATC_suffix = CX01 |
| ATC_suffix = CX01 |
||
| PubChem = |
| PubChem = 5743585 |
||
| |
| ChemSpiderID = 4675409 |
||
| C = 13 | H = 20 | N = 20 | O = 3 | S = 1 |
|||
| chemical_formula = |
|||
| |
| molecular_weight = 284.37 g/mol |
||
| smiles = O=C(OCC)\C=C1/SC(C(=O)N1C)N2CCCCC2 |
|||
| molecular_weight = 284.37 g/mol |
|||
| |
| bioavailability = |
||
| |
| metabolism = |
||
| |
| elimination_half-life = |
||
| |
| excretion = |
||
| ⚫ | |||
| elimination_half-life = |
|||
| |
| legal_status = Rx-only |
||
| ⚫ | |||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|||
| pregnancy_US = <!-- A / B / C / D / X --> |
|||
| ⚫ | |||
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|||
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|||
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|||
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|||
| legal_status = |
|||
| ⚫ | |||
}} |
}} |
||
'''Etozoline''' ('''Diulozin''', '''Elkapin''', '''Etopinil''') is a [[loop diuretic]] used in [[Europe]].<ref name="isbn3-88763-075-0">{{cite book | author = Swiss Pharmaceutical Society | title = Index Nominum 2000: International Drug Directory (Book with CD-ROM) | publisher = Medpharm Scientific Publishers | location = Boca Raton | year = 2000 | pages = | isbn = 3-88763-075-0 | oclc = | doi = | accessdate = }}</ref><ref name="pmid3525089">{{cite journal | author = Lant A | title = Diuretic drugs. Progress in clinical pharmacology | journal = Drugs | volume = 31 Suppl 4 | issue = | pages = 40–55 | year = 1986 | pmid = 3525089 | doi = | url = http://content.wkhealth.com/linkback/openurl?issn=0012-6667&volume=31&issue=&spage=40}}</ref> |
|||
'''Etozolin''' is a [[diuretic]]. |
|||
== See also == |
|||
* [[Ozolinone]] |
|||
== References == |
|||
{{Reflist}} |
|||
{{antihypertensive-stub}} |
|||
{{Diuretics}} |
{{Diuretics}} |
||
[[Category:Acetates]] |
|||
[[Category:Diuretics]] |
[[Category:Diuretics]] |
||
[[Category:Piperidines]] |
[[Category:Piperidines]] |
||
[[Category:Thiazolidines]] |
|||
Revision as of 08:10, 12 April 2010
| Clinical data | |
|---|---|
| Routes of administration | ? |
| ATC code | |
| Legal status | |
| Legal status |
|
| Identifiers | |
| |
| CAS Number | |
| PubChem CID | |
| ChemSpider | |
| CompTox Dashboard (EPA) | |
| ECHA InfoCard | 100.000.722 |
| Chemical and physical data | |
| Formula | C13H20N20O3S |
| Molar mass | 284.37 g/mol g·mol−1 |
| 3D model (JSmol) | |
| |
Etozoline (Diulozin, Elkapin, Etopinil) is a loop diuretic used in Europe.[1][2]
See also
References
- ^ Swiss Pharmaceutical Society (2000). Index Nominum 2000: International Drug Directory (Book with CD-ROM). Boca Raton: Medpharm Scientific Publishers. ISBN 3-88763-075-0.
- ^ Lant A (1986). "Diuretic drugs. Progress in clinical pharmacology". Drugs. 31 Suppl 4: 40–55. PMID 3525089.