Wikipedia:WikiProject Chemicals/Log/2011-11-19

Standard header for logs from CheMoBot

01:13:53 (2, 4, 5) (EDIT) User:Atropos235 (contribs, talk) edited Gallium_arsenide (diff, hist)
Changed: 'ImageFile1' ('GaAscrystals.JPG' -> 'Gallium arsenide crystal.jpg', SET 'Gallium-arsenide-unit-cell-3D-balls.png')
01:54:52 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Glucosamine (diff, hist)
Changed: 'verifiedrevid' ('399902425' -> '461121559', SET '399902425')
01:54:52 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Glucosamine (diff, hist)
Changed: 'DrugBank_Ref' ('{{drugbankcite|changed|drugbank}}' -> '{{drugbankcite|correct|drugbank}}', SET '{{drugbankcite|changed|drugbank}}')
01:54:53 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Glucosamine (diff, hist)
Deleted: 'Watchedfields' ('changed' -> '', SET 'changed')
03:25:49 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Heptaminol (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite|correct|??}}', SET '')
04:11:58 (2, 4, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'realboxname' ('chembox' -> 'chembox_lucas_sucks_james'_balls.', SET 'chembox')
04:11:59 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'boxname' ('chembox' -> '', SET 'chembox')
04:11:59 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'Section1' ('{{Chembox Identifiers' -> '{{Chembox Identifiers| CASNo = 83-88-5| CASNosRef ={{cascite|correct|CAS}}| CASNosComment = -10-[(2''R'',3''R'',4''S'')-2,3,4-trihydroxypentyl]| CASNo1 = 482-11-1| CASNo1sRef ={{cascite|correct|?
04:11:59 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'Section2' ('{{Chembox Properties' -> '{{Chembox Properties| Formula ={{Chem|C|17|N|4|H|20|O|6}}| MolarMass = 376.3639 g mol-1| ExactMass = 376.138284392 g mol-1| Appearance = Orange crystals| LogP = 0.095| pKa = 9.888| pKb =
04:12:00 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'CASNo_Ref' ('{{cascite|correct|CAS}}' -> '', SET '{{cascite|correct|CAS}}')
04:12:01 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'CASNo_Comment' ('-10-[(2''R'',3''R'',4''S'')-2,3,4-trihydroxypentyl]' -> '', SET '-10-[(2''R'',3''R'',4''S'')-2,3,4-trihydroxypentyl]')
04:12:02 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'CASNo1' ('482-11-1' -> '', SET '482-11-1')
04:12:03 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'CASNo1_Ref' ('{{cascite|correct|??}}' -> '', SET '{{cascite|correct|??}}')
04:12:04 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'CASNo1_Comment' ('-10-[(2''S'',3''R'',4''S'')-2,3,4-trihydroxypentyl]' -> '', SET '-10-[(2''S'',3''R'',4''S'')-2,3,4-trihydroxypentyl]')
04:12:05 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'PubChem_Ref' ('{{Pubchemcite|correct|Pubchem}}' -> '', SET '{{Pubchemcite|correct|Pubchem}}')
04:12:05 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'PubChem1' ('6328150' -> '', SET '6328150')
04:12:06 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'PubChem1_Ref' ('{{Pubchemcite|correct|Pubchem}}' -> '', SET '{{Pubchemcite|correct|Pubchem}}')
04:12:07 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'PubChem1_Comment' ('-10-[(2''R'',3''R'',4''R'')-2,3,4-trihydroxypentyl]' -> '', SET '-10-[(2''R'',3''R'',4''R'')-2,3,4-trihydroxypentyl]')
04:12:07 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'PubChem2' ('6759' -> '', SET '6759')
04:12:08 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'realboxname' ('chembox_lucas_sucks_james'_balls.' -> 'chembox', SET 'chembox')
04:12:08 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'PubChem2_Ref' ('{{Pubchemcite|correct|Pubchem}}' -> '', SET '{{Pubchemcite|correct|Pubchem}}')
04:12:08 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'boxname' ('' -> 'chembox', SET 'chembox')
04:12:09 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'PubChem2_Comment' ('-10-[(2''R'',3''R'',4''S'')-2,3,4-trihydroxypentyl]' -> '', SET '-10-[(2''R'',3''R'',4''S'')-2,3,4-trihydroxypentyl]')
04:12:09 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'Section1' ('{{Chembox Identifiers| CASNo = 83-88-5| CASNosRef ={{cascite|correct|CAS}}| CASNosComment = -10-[(2''R'',3''R'',4''S'')-2,3,4-trihydroxypentyl]| CASNo1 = 482-11-1| CASNo1sRef ={{cascite|correct|??}}| CASNo1sComment = <sma
04:12:09 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'PubChem3' ('7048775' -> '', SET '7048775')
04:12:09 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'CASNo_Ref' ('' -> '{{cascite|correct|CAS}}', SET '{{cascite|correct|CAS}}')
04:12:10 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'PubChem3_Ref' ('{{Pubchemcite|correct|Pubchem}}' -> '', SET '{{Pubchemcite|correct|Pubchem}}')
04:12:10 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'CASNo_Comment' ('' -> '-10-[(2''R'',3''R'',4''S'')-2,3,4-trihydroxypentyl]', SET '-10-[(2''R'',3''R'',4''S'')-2,3,4-trihydroxypentyl]')
04:12:10 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'PubChem3_Comment' ('-10-[(2''R'',3''S'',4''R'')-2,3,4-trihydroxypentyl]' -> '', SET '-10-[(2''R'',3''S'',4''R'')-2,3,4-trihydroxypentyl]')
04:12:10 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'CASNo1' ('' -> '482-11-1', SET '482-11-1')
04:12:11 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'PubChem4' ('12304941' -> '', SET '12304941')
04:12:11 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'CASNo1_Ref' ('' -> '{{cascite|correct|??}}', SET '{{cascite|correct|??}}')
04:12:11 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'PubChem4_Ref' ('{{Pubchemcite|correct|Pubchem}}' -> '', SET '{{Pubchemcite|correct|Pubchem}}')
04:12:12 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'CASNo1_Comment' ('' -> '-10-[(2''S'',3''R'',4''S'')-2,3,4-trihydroxypentyl]', SET '-10-[(2''S'',3''R'',4''S'')-2,3,4-trihydroxypentyl]')
04:12:12 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'PubChem4_Comment' ('-10-[(2''R'',3''S'',4''S'')-2,3,4-trihydroxypentyl]' -> '', SET '-10-[(2''R'',3''S'',4''S'')-2,3,4-trihydroxypentyl]')
04:12:12 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'PubChem_Ref' ('' -> '{{Pubchemcite|correct|Pubchem}}', SET '{{Pubchemcite|correct|Pubchem}}')
04:12:12 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'PubChem5' ('7048776' -> '', SET '7048776')
04:12:13 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'PubChem1' ('' -> '6328150', SET '6328150')
04:12:13 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'PubChem5_Ref' ('{{Pubchemcite|correct|Pubchem}}' -> '', SET '{{Pubchemcite|correct|Pubchem}}')
04:12:13 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'PubChem1_Ref' ('' -> '{{Pubchemcite|correct|Pubchem}}', SET '{{Pubchemcite|correct|Pubchem}}')
04:12:14 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'PubChem5_Comment' ('-10-[(2''S'',3''R'',4''R'')-2,3,4-trihydroxypentyl]' -> '', SET '-10-[(2''S'',3''R'',4''R'')-2,3,4-trihydroxypentyl]')
04:12:14 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'PubChem1_Comment' ('' -> '-10-[(2''R'',3''R'',4''R'')-2,3,4-trihydroxypentyl]', SET '-10-[(2''R'',3''R'',4''R'')-2,3,4-trihydroxypentyl]')
04:12:14 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChemSpiderID_Ref' ('{{chemspidercite|changed|chemspider}}' -> '', SET '{{chemspidercite|changed|chemspider}}')
04:12:14 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'PubChem2' ('' -> '6759', SET '6759')
04:12:15 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChemSpiderID1' ('4886488' -> '', SET '4886488')
04:12:15 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'PubChem2_Ref' ('' -> '{{Pubchemcite|correct|Pubchem}}', SET '{{Pubchemcite|correct|Pubchem}}')
04:12:15 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChemSpiderID1_Ref' ('{{chemspidercite|correct|chemspider}}' -> '', SET '{{chemspidercite|correct|chemspider}}')
04:12:15 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'PubChem2_Comment' ('' -> '-10-[(2''R'',3''R'',4''S'')-2,3,4-trihydroxypentyl]', SET '-10-[(2''R'',3''R'',4''S'')-2,3,4-trihydroxypentyl]')
04:12:16 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChemSpiderID1_Comment' ('-10-[(2''R'',3''R'',4''R'')-2,3,4-trihydroxypentyl]' -> '', SET '-10-[(2''R'',3''R'',4''R'')-2,3,4-trihydroxypentyl]')
04:12:16 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'PubChem3' ('' -> '7048775', SET '7048775')
04:12:16 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChemSpiderID2' ('6501' -> '', SET '6501')
04:12:17 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'PubChem3_Ref' ('' -> '{{Pubchemcite|correct|Pubchem}}', SET '{{Pubchemcite|correct|Pubchem}}')
04:12:17 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChemSpiderID2_Ref' ('{{chemspidercite|correct|chemspider}}' -> '', SET '{{chemspidercite|correct|chemspider}}')
04:12:18 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'PubChem3_Comment' ('' -> '-10-[(2''R'',3''S'',4''R'')-2,3,4-trihydroxypentyl]', SET '-10-[(2''R'',3''S'',4''R'')-2,3,4-trihydroxypentyl]')
04:12:18 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChemSpiderID2_Comment' ('-10-[(2''R'',3''R'',4''S'')-2,3,4-trihydroxypentyl]' -> '', SET '-10-[(2''R'',3''R'',4''S'')-2,3,4-trihydroxypentyl]')
04:12:18 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'PubChem4' ('' -> '12304941', SET '12304941')
04:12:18 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChemSpiderID3' ('5408940' -> '', SET '5408940')
04:12:19 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'PubChem4_Ref' ('' -> '{{Pubchemcite|correct|Pubchem}}', SET '{{Pubchemcite|correct|Pubchem}}')
04:12:19 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChemSpiderID3_Ref' ('{{chemspidercite|correct|chemspider}}' -> '', SET '{{chemspidercite|correct|chemspider}}')
04:12:19 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'PubChem4_Comment' ('' -> '-10-[(2''R'',3''S'',4''S'')-2,3,4-trihydroxypentyl]', SET '-10-[(2''R'',3''S'',4''S'')-2,3,4-trihydroxypentyl]')
04:12:20 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChemSpiderID3_Comment' ('-10-[(2''R'',3''S'',4''R'')-2,3,4-trihydroxypentyl]' -> '', SET '-10-[(2''R'',3''S'',4''R'')-2,3,4-trihydroxypentyl]')
04:12:20 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'PubChem5' ('' -> '7048776', SET '7048776')
04:12:20 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChemSpiderID4' ('5408941' -> '', SET '5408941')
04:12:20 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'PubChem5_Ref' ('' -> '{{Pubchemcite|correct|Pubchem}}', SET '{{Pubchemcite|correct|Pubchem}}')
04:12:20 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChemSpiderID4_Ref' ('{{chemspidercite|correct|chemspider}}' -> '', SET '{{chemspidercite|correct|chemspider}}')
04:12:21 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'PubChem5_Comment' ('' -> '-10-[(2''S'',3''R'',4''R'')-2,3,4-trihydroxypentyl]', SET '-10-[(2''S'',3''R'',4''R'')-2,3,4-trihydroxypentyl]')
04:12:21 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChemSpiderID4_Comment' ('-10-[(2''S'',3''R'',4''R'')-2,3,4-trihydroxypentyl]' -> '', SET '-10-[(2''S'',3''R'',4''R'')-2,3,4-trihydroxypentyl]')
04:12:21 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChemSpiderID_Ref' ('' -> '{{chemspidercite|changed|chemspider}}', SET '{{chemspidercite|changed|chemspider}}')
04:12:22 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChemSpiderID5' ('167741' -> '', SET '167741')
04:12:22 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChemSpiderID1' ('' -> '4886488', SET '4886488')
04:12:22 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChemSpiderID5_Ref' ('{{chemspidercite|correct|chemspider}}' -> '', SET '{{chemspidercite|correct|chemspider}}')
04:12:22 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChemSpiderID1_Ref' ('' -> '{{chemspidercite|correct|chemspider}}', SET '{{chemspidercite|correct|chemspider}}')
04:12:23 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChemSpiderID5_Comment' ('-10-[(2''S'',3''R'',4''S'')-2,3,4-trihydroxypentyl]' -> '', SET '-10-[(2''S'',3''R'',4''S'')-2,3,4-trihydroxypentyl]')
04:12:23 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChemSpiderID1_Comment' ('' -> '-10-[(2''R'',3''R'',4''R'')-2,3,4-trihydroxypentyl]', SET '-10-[(2''R'',3''R'',4''R'')-2,3,4-trihydroxypentyl]')
04:12:23 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'UNII_Ref' ('{{fdacite|correct|FDA}}' -> '', SET '{{fdacite|correct|FDA}}')
04:12:23 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChemSpiderID2' ('' -> '6501', SET '6501')
04:12:23 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'DrugBank_Ref' ('{{drugbankcite|correct|drugbank}}' -> '', SET '{{drugbankcite|changed|drugbank}}')
04:12:24 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChemSpiderID2_Ref' ('' -> '{{chemspidercite|correct|chemspider}}', SET '{{chemspidercite|correct|chemspider}}')
04:12:24 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'KEGG_Ref' ('{{keggcite|changed|kegg}}' -> '', SET '{{keggcite|changed|kegg}}')
04:12:24 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChemSpiderID2_Comment' ('' -> '-10-[(2''R'',3''R'',4''S'')-2,3,4-trihydroxypentyl]', SET '-10-[(2''R'',3''R'',4''S'')-2,3,4-trihydroxypentyl]')
04:12:24 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChEBI_Ref' ('{{ebicite|correct|EBI}}' -> '', SET '{{ebicite|changed|EBI}}')
04:12:24 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChemSpiderID3' ('' -> '5408940', SET '5408940')
04:12:25 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChEMBL_Ref' ('{{ebicite|changed|EBI}}' -> '', SET '{{ebicite|changed|EBI}}')
04:12:25 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChemSpiderID3_Ref' ('' -> '{{chemspidercite|correct|chemspider}}', SET '{{chemspidercite|correct|chemspider}}')
04:12:26 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ATCCode_prefix' ('A11' -> '', SET 'A11')
04:12:26 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChemSpiderID3_Comment' ('' -> '-10-[(2''R'',3''S'',4''R'')-2,3,4-trihydroxypentyl]', SET '-10-[(2''R'',3''S'',4''R'')-2,3,4-trihydroxypentyl]')
04:12:26 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ATCCode_suffix' ('HA04' -> '', SET 'HA04')
04:12:26 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChemSpiderID4' ('' -> '5408941', SET '5408941')
04:12:27 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'Beilstein' ('97831 -10-[(2''R'',3''R'',4''R'')-2,3,4-trihydroxypentyl] 97825 -10-[(2''R'',3''R'',4''S'')-2,3,4-trihydroxypentyl]' -> '', SET '97831 -10-[(2''R'',3''R'',4''R'')-2,3,4-trihydroxypentyl]<br /
04:12:27 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChemSpiderID4_Ref' ('' -> '{{chemspidercite|correct|chemspider}}', SET '{{chemspidercite|correct|chemspider}}')
04:12:27 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: '3DMet' ('B01201' -> '', SET 'B01201')
04:12:27 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChemSpiderID4_Comment' ('' -> '-10-[(2''S'',3''R'',4''R'')-2,3,4-trihydroxypentyl]', SET '-10-[(2''S'',3''R'',4''R'')-2,3,4-trihydroxypentyl]')
04:12:28 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'SMILES1' ('CC1=CC2=C(C=C1C)N(CC(O)C(O)C(O)CO)C1=NC(O)=NC(=O)C1=N2' -> '', SET 'CC1=CC2=C(C=C1C)N(CC(O)C(O)C(O)CO)C1=NC(O)=NC(=O)C1=N2')
04:12:28 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChemSpiderID5' ('' -> '167741', SET '167741')
04:12:28 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'StdInChI_Ref' ('{{stdinchicite|changed|chemspider}}' -> '', SET '{{stdinchicite|changed|chemspider}}')
04:12:28 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChemSpiderID5_Ref' ('' -> '{{chemspidercite|correct|chemspider}}', SET '{{chemspidercite|correct|chemspider}}')
04:12:29 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'StdInChIKey_Ref' ('{{stdinchicite|changed|chemspider}}}' -> '', SET '{{stdinchicite|changed|chemspider}}}')
04:12:29 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChemSpiderID5_Comment' ('' -> '-10-[(2''S'',3''R'',4''S'')-2,3,4-trihydroxypentyl]', SET '-10-[(2''S'',3''R'',4''S'')-2,3,4-trihydroxypentyl]')
04:12:29 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'Appearance' ('Orange crystals' -> '', SET 'Orange crystals')
04:12:29 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'UNII_Ref' ('' -> '{{fdacite|correct|FDA}}', SET '{{fdacite|correct|FDA}}')
04:12:30 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'LogP' ('0.095' -> '', SET '0.095')
04:12:30 (2, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'DrugBank_Ref' ('' -> '{{drugbankcite|correct|drugbank}}', SET '{{drugbankcite|changed|drugbank}}')
04:12:30 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'pKa' ('9.888' -> '', SET '9.888')
04:12:30 (2, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'KEGG_Ref' ('' -> '{{keggcite|changed|kegg}}', SET '{{keggcite|changed|kegg}}')
04:12:30 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'pKb' ('4.109}' -> '', SET '4.109}')
04:12:31 (2, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChEBI_Ref' ('' -> '{{ebicite|correct|EBI}}', SET '{{ebicite|changed|EBI}}')
04:12:31 (4, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'EINECS' ('201-507-1' -> '', SET '201-507-1')
04:12:31 (2, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChEMBL_Ref' ('' -> '{{ebicite|changed|EBI}}', SET '{{ebicite|changed|EBI}}')
04:12:31 (4, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'PubChem' ('1072' -> '', SET '1072')
04:12:32 (2, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ATCCode_prefix' ('' -> 'A11', SET 'A11')
04:12:32 (4, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'SMILES' ('Cc1cc2N=C3C(=O)N=C(O)N=C3N(CC(O)C(O)C(O)CO)c2cc1C' -> '', SET 'Cc1cc2N=C3C(=O)N=C(O)N=C3N(CC(O)C(O)C(O)CO)c2cc1C')
04:12:32 (2, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ATCCode_suffix' ('' -> 'HA04', SET 'HA04')
04:12:32 (4, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'MeSHName' ('Riboflavin' -> '', SET 'Riboflavin')
04:12:32 (2, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'Beilstein' ('' -> '97831 -10-[(2''R'',3''R'',4''R'')-2,3,4-trihydroxypentyl] 97825 -10-[(2''R'',3''R'',4''S'')-2,3,4-trihydroxypentyl]', SET '97831 -10-[(2''R'',3''R'',4''R'')-2,3,4-trihydroxypentyl]<br /
04:12:33 (4, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'Formula' ('{{Chem|C|17|N|4|H|20|O|6}}' -> '', SET '{{Chem|C|17|N|4|H|20|O|6}}')
04:12:33 (2, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: '3DMet' ('' -> 'B01201', SET 'B01201')
04:12:33 (4, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'MolarMass' ('376.3639 g mol-1' -> '', SET '376.3639 g mol-1')
04:12:33 (2, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'SMILES1' ('' -> 'CC1=CC2=C(C=C1C)N(CC(O)C(O)C(O)CO)C1=NC(O)=NC(=O)C1=N2', SET 'CC1=CC2=C(C=C1C)N(CC(O)C(O)C(O)CO)C1=NC(O)=NC(=O)C1=N2')
04:12:33 (4, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ExactMass' ('376.138284392 g mol-1' -> '', SET '376.138284392 g mol-1')
04:12:34 (2, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'StdInChI_Ref' ('' -> '{{stdinchicite|changed|chemspider}}', SET '{{stdinchicite|changed|chemspider}}')
04:12:34 (5, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChemSpiderID' ('1043' -> '', SET '431981')
04:12:34 (2, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'StdInChIKey_Ref' ('' -> '{{stdinchicite|changed|chemspider}}}', SET '{{stdinchicite|changed|chemspider}}}')
04:12:34 (5, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'DrugBank' ('DB00140' -> '', SET 'DB00140')
04:12:34 (2, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'Section2' ('{{Chembox Properties| Formula ={{Chem|C|17|N|4|H|20|O|6}}| MolarMass = 376.3639 g mol-1| ExactMass = 376.138284392 g mol-1| Appearance = Orange crystals| LogP = 0.095| pKa = 9.888| pKb = 4.109}}}' -> '{{Chembox Pr
04:12:35 (5, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'UNII' ('TLM2976OFR' -> '', SET 'TLM2976OFR')
04:12:35 (2, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'Appearance' ('' -> 'Orange crystals', SET 'Orange crystals')
04:12:35 (5, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChEMBL' ('511565' -> '', SET '1534')
04:12:35 (2, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'LogP' ('' -> '0.095', SET '0.095')
04:12:36 (5, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChEBI' ('17015' -> '', SET '17015')
04:12:36 (2, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'pKa' ('' -> '9.888', SET '9.888')
04:12:36 (5, 6, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'KEGG' ('D00050' -> '', SET '')
04:12:36 (2, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'pKb' ('' -> '4.109}', SET '4.109}')
04:12:37 (5, 6, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'StdInChI' ('1S/C17H20N4O6/c1-7-3-9-10(4-8(7)2)21(5-11(23)14(25)12(24)6-22)15-13(18-9)16(26)20-17(27)19-15/h3-4,11-12,14,22-25H,5-6H2,1-2H3,(H,20,26,27)' -> '', SET '1S/C17H20N4O6/c1-7-3-9-10(4-8(7)2)21(5-11(23)14(25)12(24)6-22)15-13(18-9)16(26)20-17(27)1
04:12:37 (4, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'EINECS' ('' -> '201-507-1', SET '201-507-1')
04:12:37 (5, 6, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'StdInChIKey' ('AUNGANRZJHBGPY-UHFFFAOYSA-N' -> '', SET 'AUNGANRZJHBGPY-SCRDCRAPSA-N')
04:12:37 (4, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'PubChem' ('' -> '1072', SET '1072')
04:12:38 (5, 6, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'CASNo' ('83-88-5' -> '', SET '83-88-5')
04:12:38 (4, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'SMILES' ('' -> 'Cc1cc2N=C3C(=O)N=C(O)N=C3N(CC(O)C(O)C(O)CO)c2cc1C', SET 'Cc1cc2N=C3C(=O)N=C(O)N=C3N(CC(O)C(O)C(O)CO)c2cc1C')
04:12:38 (4, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'MeSHName' ('' -> 'Riboflavin', SET 'Riboflavin')
04:12:39 (4, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'Formula' ('' -> '{{Chem|C|17|N|4|H|20|O|6}}', SET '{{Chem|C|17|N|4|H|20|O|6}}')
04:12:40 (4, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'MolarMass' ('' -> '376.3639 g mol-1', SET '376.3639 g mol-1')
04:12:40 (4, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ExactMass' ('' -> '376.138284392 g mol-1', SET '376.138284392 g mol-1')
04:12:41 (5, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChemSpiderID' ('' -> '1043', SET '431981')
04:12:41 (5, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'DrugBank' ('' -> 'DB00140', SET 'DB00140')
04:12:41 (5, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'UNII' ('' -> 'TLM2976OFR', SET 'TLM2976OFR')
04:12:42 (5, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChEMBL' ('' -> '511565', SET '1534')
04:12:42 (5, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChEBI' ('' -> '17015', SET '17015')
04:12:43 (5, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Added: 'KEGG' ('' -> 'D00050', SET '')
04:12:43 (5, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'StdInChI' ('' -> '1S/C17H20N4O6/c1-7-3-9-10(4-8(7)2)21(5-11(23)14(25)12(24)6-22)15-13(18-9)16(26)20-17(27)19-15/h3-4,11-12,14,22-25H,5-6H2,1-2H3,(H,20,26,27)', SET '1S/C17H20N4O6/c1-7-3-9-10(4-8(7)2)21(5-11(23)14(25)12(24)6-22)15-13(18-9)16(26)20-17(27)1
04:12:44 (5, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'StdInChIKey' ('' -> 'AUNGANRZJHBGPY-UHFFFAOYSA-N', SET 'AUNGANRZJHBGPY-SCRDCRAPSA-N')
04:12:45 (5, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'CASNo' ('' -> '83-88-5', SET '83-88-5')
04:14:21 (2, 4, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'realboxname' ('chembox' -> 'chembox_ugh_i_dunno.', SET 'chembox')
04:14:22 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'boxname' ('chembox' -> '', SET 'chembox')
04:14:22 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'Section1' ('{{Chembox Identifiers' -> '{{Chembox Identifiers| CASNo = 83-88-5| CASNosRef ={{cascite|correct|CAS}}| CASNosComment = -10-[(2''R'',3''R'',4''S'')-2,3,4-trihydroxypentyl]| CASNo1 = 482-11-1| CASNo1sRef ={{cascite|correct|?
04:14:23 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'Section2' ('{{Chembox Properties' -> '{{Chembox Properties| Formula ={{Chem|C|17|N|4|H|20|O|6}}| MolarMass = 376.3639 g mol-1| ExactMass = 376.138284392 g mol-1| Appearance = Orange crystals| LogP = 0.095| pKa = 9.888| pKb =
04:14:23 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'CASNo_Ref' ('{{cascite|correct|CAS}}' -> '', SET '{{cascite|correct|CAS}}')
04:14:24 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'CASNo_Comment' ('-10-[(2''R'',3''R'',4''S'')-2,3,4-trihydroxypentyl]' -> '', SET '-10-[(2''R'',3''R'',4''S'')-2,3,4-trihydroxypentyl]')
04:14:24 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'CASNo1' ('482-11-1' -> '', SET '482-11-1')
04:14:24 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'CASNo1_Ref' ('{{cascite|correct|??}}' -> '', SET '{{cascite|correct|??}}')
04:14:25 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'CASNo1_Comment' ('-10-[(2''S'',3''R'',4''S'')-2,3,4-trihydroxypentyl]' -> '', SET '-10-[(2''S'',3''R'',4''S'')-2,3,4-trihydroxypentyl]')
04:14:25 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'PubChem_Ref' ('{{Pubchemcite|correct|Pubchem}}' -> '', SET '{{Pubchemcite|correct|Pubchem}}')
04:14:25 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'PubChem1' ('6328150' -> '', SET '6328150')
04:14:26 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'PubChem1_Ref' ('{{Pubchemcite|correct|Pubchem}}' -> '', SET '{{Pubchemcite|correct|Pubchem}}')
04:14:27 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'PubChem1_Comment' ('-10-[(2''R'',3''R'',4''R'')-2,3,4-trihydroxypentyl]' -> '', SET '-10-[(2''R'',3''R'',4''R'')-2,3,4-trihydroxypentyl]')
04:14:27 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'PubChem2' ('6759' -> '', SET '6759')
04:14:28 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'PubChem2_Ref' ('{{Pubchemcite|correct|Pubchem}}' -> '', SET '{{Pubchemcite|correct|Pubchem}}')
04:14:28 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'PubChem2_Comment' ('-10-[(2''R'',3''R'',4''S'')-2,3,4-trihydroxypentyl]' -> '', SET '-10-[(2''R'',3''R'',4''S'')-2,3,4-trihydroxypentyl]')
04:14:29 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'PubChem3' ('7048775' -> '', SET '7048775')
04:14:29 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'PubChem3_Ref' ('{{Pubchemcite|correct|Pubchem}}' -> '', SET '{{Pubchemcite|correct|Pubchem}}')
04:14:30 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'PubChem3_Comment' ('-10-[(2''R'',3''S'',4''R'')-2,3,4-trihydroxypentyl]' -> '', SET '-10-[(2''R'',3''S'',4''R'')-2,3,4-trihydroxypentyl]')
04:14:30 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'PubChem4' ('12304941' -> '', SET '12304941')
04:14:30 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'PubChem4_Ref' ('{{Pubchemcite|correct|Pubchem}}' -> '', SET '{{Pubchemcite|correct|Pubchem}}')
04:14:31 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'PubChem4_Comment' ('-10-[(2''R'',3''S'',4''S'')-2,3,4-trihydroxypentyl]' -> '', SET '-10-[(2''R'',3''S'',4''S'')-2,3,4-trihydroxypentyl]')
04:14:31 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'realboxname' ('chembox_ugh_i_dunno.' -> 'chembox', SET 'chembox')
04:14:31 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'PubChem5' ('7048776' -> '', SET '7048776')
04:14:31 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'boxname' ('' -> 'chembox', SET 'chembox')
04:14:31 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'PubChem5_Ref' ('{{Pubchemcite|correct|Pubchem}}' -> '', SET '{{Pubchemcite|correct|Pubchem}}')
04:14:31 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'Section1' ('{{Chembox Identifiers| CASNo = 83-88-5| CASNosRef ={{cascite|correct|CAS}}| CASNosComment = -10-[(2''R'',3''R'',4''S'')-2,3,4-trihydroxypentyl]| CASNo1 = 482-11-1| CASNo1sRef ={{cascite|correct|??}}| CASNo1sComment = <sma
04:14:32 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'PubChem5_Comment' ('-10-[(2''S'',3''R'',4''R'')-2,3,4-trihydroxypentyl]' -> '', SET '-10-[(2''S'',3''R'',4''R'')-2,3,4-trihydroxypentyl]')
04:14:32 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'CASNo_Ref' ('' -> '{{cascite|correct|CAS}}', SET '{{cascite|correct|CAS}}')
04:14:32 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChemSpiderID_Ref' ('{{chemspidercite|changed|chemspider}}' -> '', SET '{{chemspidercite|changed|chemspider}}')
04:14:32 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'CASNo_Comment' ('' -> '-10-[(2''R'',3''R'',4''S'')-2,3,4-trihydroxypentyl]', SET '-10-[(2''R'',3''R'',4''S'')-2,3,4-trihydroxypentyl]')
04:14:32 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChemSpiderID1' ('4886488' -> '', SET '4886488')
04:14:32 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'CASNo1' ('' -> '482-11-1', SET '482-11-1')
04:14:32 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChemSpiderID1_Ref' ('{{chemspidercite|correct|chemspider}}' -> '', SET '{{chemspidercite|correct|chemspider}}')
04:14:33 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'CASNo1_Ref' ('' -> '{{cascite|correct|??}}', SET '{{cascite|correct|??}}')
04:14:33 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChemSpiderID1_Comment' ('-10-[(2''R'',3''R'',4''R'')-2,3,4-trihydroxypentyl]' -> '', SET '-10-[(2''R'',3''R'',4''R'')-2,3,4-trihydroxypentyl]')
04:14:33 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'CASNo1_Comment' ('' -> '-10-[(2''S'',3''R'',4''S'')-2,3,4-trihydroxypentyl]', SET '-10-[(2''S'',3''R'',4''S'')-2,3,4-trihydroxypentyl]')
04:14:33 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChemSpiderID2' ('6501' -> '', SET '6501')
04:14:33 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'PubChem_Ref' ('' -> '{{Pubchemcite|correct|Pubchem}}', SET '{{Pubchemcite|correct|Pubchem}}')
04:14:33 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChemSpiderID2_Ref' ('{{chemspidercite|correct|chemspider}}' -> '', SET '{{chemspidercite|correct|chemspider}}')
04:14:34 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'PubChem1' ('' -> '6328150', SET '6328150')
04:14:34 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChemSpiderID2_Comment' ('-10-[(2''R'',3''R'',4''S'')-2,3,4-trihydroxypentyl]' -> '', SET '-10-[(2''R'',3''R'',4''S'')-2,3,4-trihydroxypentyl]')
04:14:34 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'PubChem1_Ref' ('' -> '{{Pubchemcite|correct|Pubchem}}', SET '{{Pubchemcite|correct|Pubchem}}')
04:14:34 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChemSpiderID3' ('5408940' -> '', SET '5408940')
04:14:34 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'PubChem1_Comment' ('' -> '-10-[(2''R'',3''R'',4''R'')-2,3,4-trihydroxypentyl]', SET '-10-[(2''R'',3''R'',4''R'')-2,3,4-trihydroxypentyl]')
04:14:34 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChemSpiderID3_Ref' ('{{chemspidercite|correct|chemspider}}' -> '', SET '{{chemspidercite|correct|chemspider}}')
04:14:35 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'PubChem2' ('' -> '6759', SET '6759')
04:14:35 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChemSpiderID3_Comment' ('-10-[(2''R'',3''S'',4''R'')-2,3,4-trihydroxypentyl]' -> '', SET '-10-[(2''R'',3''S'',4''R'')-2,3,4-trihydroxypentyl]')
04:14:35 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'PubChem2_Ref' ('' -> '{{Pubchemcite|correct|Pubchem}}', SET '{{Pubchemcite|correct|Pubchem}}')
04:14:35 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChemSpiderID4' ('5408941' -> '', SET '5408941')
04:14:35 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'PubChem2_Comment' ('' -> '-10-[(2''R'',3''R'',4''S'')-2,3,4-trihydroxypentyl]', SET '-10-[(2''R'',3''R'',4''S'')-2,3,4-trihydroxypentyl]')
04:14:36 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChemSpiderID4_Ref' ('{{chemspidercite|correct|chemspider}}' -> '', SET '{{chemspidercite|correct|chemspider}}')
04:14:36 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'PubChem3' ('' -> '7048775', SET '7048775')
04:14:36 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChemSpiderID4_Comment' ('-10-[(2''S'',3''R'',4''R'')-2,3,4-trihydroxypentyl]' -> '', SET '-10-[(2''S'',3''R'',4''R'')-2,3,4-trihydroxypentyl]')
04:14:36 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'PubChem3_Ref' ('' -> '{{Pubchemcite|correct|Pubchem}}', SET '{{Pubchemcite|correct|Pubchem}}')
04:14:36 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChemSpiderID5' ('167741' -> '', SET '167741')
04:14:36 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'PubChem3_Comment' ('' -> '-10-[(2''R'',3''S'',4''R'')-2,3,4-trihydroxypentyl]', SET '-10-[(2''R'',3''S'',4''R'')-2,3,4-trihydroxypentyl]')
04:14:37 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChemSpiderID5_Ref' ('{{chemspidercite|correct|chemspider}}' -> '', SET '{{chemspidercite|correct|chemspider}}')
04:14:37 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'PubChem4' ('' -> '12304941', SET '12304941')
04:14:37 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChemSpiderID5_Comment' ('-10-[(2''S'',3''R'',4''S'')-2,3,4-trihydroxypentyl]' -> '', SET '-10-[(2''S'',3''R'',4''S'')-2,3,4-trihydroxypentyl]')
04:14:37 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'PubChem4_Ref' ('' -> '{{Pubchemcite|correct|Pubchem}}', SET '{{Pubchemcite|correct|Pubchem}}')
04:14:37 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'UNII_Ref' ('{{fdacite|correct|FDA}}' -> '', SET '{{fdacite|correct|FDA}}')
04:14:37 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'PubChem4_Comment' ('' -> '-10-[(2''R'',3''S'',4''S'')-2,3,4-trihydroxypentyl]', SET '-10-[(2''R'',3''S'',4''S'')-2,3,4-trihydroxypentyl]')
04:14:38 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'DrugBank_Ref' ('{{drugbankcite|correct|drugbank}}' -> '', SET '{{drugbankcite|changed|drugbank}}')
04:14:38 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'PubChem5' ('' -> '7048776', SET '7048776')
04:14:38 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'KEGG_Ref' ('{{keggcite|changed|kegg}}' -> '', SET '{{keggcite|changed|kegg}}')
04:14:38 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'PubChem5_Ref' ('' -> '{{Pubchemcite|correct|Pubchem}}', SET '{{Pubchemcite|correct|Pubchem}}')
04:14:38 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChEBI_Ref' ('{{ebicite|correct|EBI}}' -> '', SET '{{ebicite|changed|EBI}}')
04:14:39 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'PubChem5_Comment' ('' -> '-10-[(2''S'',3''R'',4''R'')-2,3,4-trihydroxypentyl]', SET '-10-[(2''S'',3''R'',4''R'')-2,3,4-trihydroxypentyl]')
04:14:39 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChEMBL_Ref' ('{{ebicite|changed|EBI}}' -> '', SET '{{ebicite|changed|EBI}}')
04:14:39 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChemSpiderID_Ref' ('' -> '{{chemspidercite|changed|chemspider}}', SET '{{chemspidercite|changed|chemspider}}')
04:14:40 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ATCCode_prefix' ('A11' -> '', SET 'A11')
04:14:40 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChemSpiderID1' ('' -> '4886488', SET '4886488')
04:14:40 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ATCCode_suffix' ('HA04' -> '', SET 'HA04')
04:14:40 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChemSpiderID1_Ref' ('' -> '{{chemspidercite|correct|chemspider}}', SET '{{chemspidercite|correct|chemspider}}')
04:14:40 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'Beilstein' ('97831 -10-[(2''R'',3''R'',4''R'')-2,3,4-trihydroxypentyl] 97825 -10-[(2''R'',3''R'',4''S'')-2,3,4-trihydroxypentyl]' -> '', SET '97831 -10-[(2''R'',3''R'',4''R'')-2,3,4-trihydroxypentyl]<br /
04:14:40 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChemSpiderID1_Comment' ('' -> '-10-[(2''R'',3''R'',4''R'')-2,3,4-trihydroxypentyl]', SET '-10-[(2''R'',3''R'',4''R'')-2,3,4-trihydroxypentyl]')
04:14:41 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: '3DMet' ('B01201' -> '', SET 'B01201')
04:14:41 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChemSpiderID2' ('' -> '6501', SET '6501')
04:14:41 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'SMILES1' ('CC1=CC2=C(C=C1C)N(CC(O)C(O)C(O)CO)C1=NC(O)=NC(=O)C1=N2' -> '', SET 'CC1=CC2=C(C=C1C)N(CC(O)C(O)C(O)CO)C1=NC(O)=NC(=O)C1=N2')
04:14:41 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChemSpiderID2_Ref' ('' -> '{{chemspidercite|correct|chemspider}}', SET '{{chemspidercite|correct|chemspider}}')
04:14:41 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'StdInChI_Ref' ('{{stdinchicite|changed|chemspider}}' -> '', SET '{{stdinchicite|changed|chemspider}}')
04:14:41 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChemSpiderID2_Comment' ('' -> '-10-[(2''R'',3''R'',4''S'')-2,3,4-trihydroxypentyl]', SET '-10-[(2''R'',3''R'',4''S'')-2,3,4-trihydroxypentyl]')
04:14:42 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'StdInChIKey_Ref' ('{{stdinchicite|changed|chemspider}}}' -> '', SET '{{stdinchicite|changed|chemspider}}}')
04:14:42 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChemSpiderID3' ('' -> '5408940', SET '5408940')
04:14:42 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'Appearance' ('Orange crystals' -> '', SET 'Orange crystals')
04:14:42 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChemSpiderID3_Ref' ('' -> '{{chemspidercite|correct|chemspider}}', SET '{{chemspidercite|correct|chemspider}}')
04:14:42 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'LogP' ('0.095' -> '', SET '0.095')
04:14:42 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChemSpiderID3_Comment' ('' -> '-10-[(2''R'',3''S'',4''R'')-2,3,4-trihydroxypentyl]', SET '-10-[(2''R'',3''S'',4''R'')-2,3,4-trihydroxypentyl]')
04:14:43 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'pKa' ('9.888' -> '', SET '9.888')
04:14:43 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChemSpiderID4' ('' -> '5408941', SET '5408941')
04:14:43 (2, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'pKb' ('4.109}' -> '', SET '4.109}')
04:14:43 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChemSpiderID4_Ref' ('' -> '{{chemspidercite|correct|chemspider}}', SET '{{chemspidercite|correct|chemspider}}')
04:14:43 (4, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'EINECS' ('201-507-1' -> '', SET '201-507-1')
04:14:43 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChemSpiderID4_Comment' ('' -> '-10-[(2''S'',3''R'',4''R'')-2,3,4-trihydroxypentyl]', SET '-10-[(2''S'',3''R'',4''R'')-2,3,4-trihydroxypentyl]')
04:14:44 (4, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'PubChem' ('1072' -> '', SET '1072')
04:14:44 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChemSpiderID5' ('' -> '167741', SET '167741')
04:14:44 (4, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'SMILES' ('Cc1cc2N=C3C(=O)N=C(O)N=C3N(CC(O)C(O)C(O)CO)c2cc1C' -> '', SET 'Cc1cc2N=C3C(=O)N=C(O)N=C3N(CC(O)C(O)C(O)CO)c2cc1C')
04:14:44 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChemSpiderID5_Ref' ('' -> '{{chemspidercite|correct|chemspider}}', SET '{{chemspidercite|correct|chemspider}}')
04:14:45 (4, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'MeSHName' ('Riboflavin' -> '', SET 'Riboflavin')
04:14:45 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChemSpiderID5_Comment' ('' -> '-10-[(2''S'',3''R'',4''S'')-2,3,4-trihydroxypentyl]', SET '-10-[(2''S'',3''R'',4''S'')-2,3,4-trihydroxypentyl]')
04:14:45 (4, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'Formula' ('{{Chem|C|17|N|4|H|20|O|6}}' -> '', SET '{{Chem|C|17|N|4|H|20|O|6}}')
04:14:45 (2, 2, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'UNII_Ref' ('' -> '{{fdacite|correct|FDA}}', SET '{{fdacite|correct|FDA}}')
04:14:45 (4, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'MolarMass' ('376.3639 g mol-1' -> '', SET '376.3639 g mol-1')
04:14:45 (2, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'DrugBank_Ref' ('' -> '{{drugbankcite|correct|drugbank}}', SET '{{drugbankcite|changed|drugbank}}')
04:14:46 (2, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'KEGG_Ref' ('' -> '{{keggcite|changed|kegg}}', SET '{{keggcite|changed|kegg}}')
04:14:46 (4, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ExactMass' ('376.138284392 g mol-1' -> '', SET '376.138284392 g mol-1')
04:14:46 (2, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChEBI_Ref' ('' -> '{{ebicite|correct|EBI}}', SET '{{ebicite|changed|EBI}}')
04:14:46 (5, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChemSpiderID' ('1043' -> '', SET '431981')
04:14:46 (2, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChEMBL_Ref' ('' -> '{{ebicite|changed|EBI}}', SET '{{ebicite|changed|EBI}}')
04:14:46 (5, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'DrugBank' ('DB00140' -> '', SET 'DB00140')
04:14:46 (2, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ATCCode_prefix' ('' -> 'A11', SET 'A11')
04:14:46 (5, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'UNII' ('TLM2976OFR' -> '', SET 'TLM2976OFR')
04:14:47 (2, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ATCCode_suffix' ('' -> 'HA04', SET 'HA04')
04:14:47 (5, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChEMBL' ('511565' -> '', SET '1534')
04:14:47 (2, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'Beilstein' ('' -> '97831 -10-[(2''R'',3''R'',4''R'')-2,3,4-trihydroxypentyl] 97825 -10-[(2''R'',3''R'',4''S'')-2,3,4-trihydroxypentyl]', SET '97831 -10-[(2''R'',3''R'',4''R'')-2,3,4-trihydroxypentyl]<br /
04:14:47 (5, 5, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'ChEBI' ('17015' -> '', SET '17015')
04:14:47 (2, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: '3DMet' ('' -> 'B01201', SET 'B01201')
04:14:47 (5, 6, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'KEGG' ('D00050' -> '', SET '')
04:14:47 (2, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'SMILES1' ('' -> 'CC1=CC2=C(C=C1C)N(CC(O)C(O)C(O)CO)C1=NC(O)=NC(=O)C1=N2', SET 'CC1=CC2=C(C=C1C)N(CC(O)C(O)C(O)CO)C1=NC(O)=NC(=O)C1=N2')
04:14:48 (5, 6, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'StdInChI' ('1S/C17H20N4O6/c1-7-3-9-10(4-8(7)2)21(5-11(23)14(25)12(24)6-22)15-13(18-9)16(26)20-17(27)19-15/h3-4,11-12,14,22-25H,5-6H2,1-2H3,(H,20,26,27)' -> '', SET '1S/C17H20N4O6/c1-7-3-9-10(4-8(7)2)21(5-11(23)14(25)12(24)6-22)15-13(18-9)16(26)20-17(27)1
04:14:48 (2, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'StdInChI_Ref' ('' -> '{{stdinchicite|changed|chemspider}}', SET '{{stdinchicite|changed|chemspider}}')
04:14:48 (5, 6, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'StdInChIKey' ('AUNGANRZJHBGPY-UHFFFAOYSA-N' -> '', SET 'AUNGANRZJHBGPY-SCRDCRAPSA-N')
04:14:48 (2, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'StdInChIKey_Ref' ('' -> '{{stdinchicite|changed|chemspider}}}', SET '{{stdinchicite|changed|chemspider}}}')
04:14:48 (5, 6, 5) (EDIT) User:121.220.202.81 (contribs, talk) edited Riboflavin (diff, hist)
Deleted: 'CASNo' ('83-88-5' -> '', SET '83-88-5')
04:14:49 (2, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'Section2' ('{{Chembox Properties| Formula ={{Chem|C|17|N|4|H|20|O|6}}| MolarMass = 376.3639 g mol-1| ExactMass = 376.138284392 g mol-1| Appearance = Orange crystals| LogP = 0.095| pKa = 9.888| pKb = 4.109}}}' -> '{{Chembox Pr
04:14:49 (2, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'Appearance' ('' -> 'Orange crystals', SET 'Orange crystals')
04:14:50 (2, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'LogP' ('' -> '0.095', SET '0.095')
04:14:50 (2, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'pKa' ('' -> '9.888', SET '9.888')
04:14:51 (2, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'pKb' ('' -> '4.109}', SET '4.109}')
04:14:51 (4, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'EINECS' ('' -> '201-507-1', SET '201-507-1')
04:14:51 (4, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'PubChem' ('' -> '1072', SET '1072')
04:14:52 (4, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'SMILES' ('' -> 'Cc1cc2N=C3C(=O)N=C(O)N=C3N(CC(O)C(O)C(O)CO)c2cc1C', SET 'Cc1cc2N=C3C(=O)N=C(O)N=C3N(CC(O)C(O)C(O)CO)c2cc1C')
04:14:52 (4, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'MeSHName' ('' -> 'Riboflavin', SET 'Riboflavin')
04:14:52 (4, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'Formula' ('' -> '{{Chem|C|17|N|4|H|20|O|6}}', SET '{{Chem|C|17|N|4|H|20|O|6}}')
04:14:52 (4, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'MolarMass' ('' -> '376.3639 g mol-1', SET '376.3639 g mol-1')
04:14:53 (4, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ExactMass' ('' -> '376.138284392 g mol-1', SET '376.138284392 g mol-1')
04:14:53 (5, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChemSpiderID' ('' -> '1043', SET '431981')
04:14:53 (5, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'DrugBank' ('' -> 'DB00140', SET 'DB00140')
04:14:54 (5, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'UNII' ('' -> 'TLM2976OFR', SET 'TLM2976OFR')
04:14:54 (5, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChEMBL' ('' -> '511565', SET '1534')
04:14:54 (5, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'ChEBI' ('' -> '17015', SET '17015')
04:14:55 (5, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Added: 'KEGG' ('' -> 'D00050', SET '')
04:14:55 (5, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'StdInChI' ('' -> '1S/C17H20N4O6/c1-7-3-9-10(4-8(7)2)21(5-11(23)14(25)12(24)6-22)15-13(18-9)16(26)20-17(27)19-15/h3-4,11-12,14,22-25H,5-6H2,1-2H3,(H,20,26,27)', SET '1S/C17H20N4O6/c1-7-3-9-10(4-8(7)2)21(5-11(23)14(25)12(24)6-22)15-13(18-9)16(26)20-17(27)1
04:14:55 (5, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'StdInChIKey' ('' -> 'AUNGANRZJHBGPY-UHFFFAOYSA-N', SET 'AUNGANRZJHBGPY-SCRDCRAPSA-N')
04:14:56 (5, 4, 4) (EDIT) User:Tide rolls (contribs, talk) edited Riboflavin (diff, hist)
Changed: 'CASNo' ('' -> '83-88-5', SET '83-88-5')
05:57:28 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Mannoheptulose (diff, hist)
Changed: 'verifiedrevid' ('443933163' -> '443934920', SET '443933163')
05:57:29 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Mannoheptulose (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite|correct|??}}', SET '')
07:18:02 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Farnesol (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')
07:18:03 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Farnesol (diff, hist)
Changed: 'verifiedrevid' ('419646408' -> '461098987', SET '419646408')
07:18:04 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Farnesol (diff, hist)
Changed: 'DrugBank_Ref' ('{{drugbankcite|changed|drugbank}}' -> '{{drugbankcite|correct|drugbank}}', SET '{{drugbankcite|changed|drugbank}}')
07:18:06 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Farnesol (diff, hist)
Changed: 'ChEBI_Ref' ('{{ebicite|changed|EBI}}' -> '{{ebicite|correct|EBI}}', SET '{{ebicite|changed|EBI}}')
08:33:27 (3, 2, 4) (EDIT) User:Dgdeckard (contribs, talk) edited Propane (diff, hist)
Added links: http://hd5propane.com/
10:36:43 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Djenkolic_acid (diff, hist)
Added: 'Verifiedfields' ('' -> 'changed', SET '')
10:36:43 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Djenkolic_acid (diff, hist)
Added: 'verifiedrevid' ('' -> '460959776', SET '')
10:36:44 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Djenkolic_acid (diff, hist)
Added: 'ChemSpiderID_Ref' ('' -> '{{chemspidercite|correct|chemspider}}', SET '')
10:36:44 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Djenkolic_acid (diff, hist)
Added: 'StdInChI_Ref' ('' -> '{{stdinchicite|correct|chemspider}}', SET '')
10:36:44 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Djenkolic_acid (diff, hist)
Added: 'StdInChIKey_Ref' ('' -> '{{stdinchicite|correct|chemspider}}', SET '')
10:36:45 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Djenkolic_acid (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite|changed|??}}', SET '')
10:36:45 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Djenkolic_acid (diff, hist)
Added: 'KEGG_Ref' ('' -> '{{keggcite|changed|kegg}}', SET '')
10:47:38 (3, 3, 5) (EDIT) User:Materialscientist (contribs, talk) edited Gallium_arsenide (diff, hist)
Changed: 'ImageFile1' ('Gallium arsenide crystal.jpg' -> 'Gallium-arsenide-unit-cell-3D-balls.png', SET 'Gallium-arsenide-unit-cell-3D-balls.png')
10:47:38 (3, 4, 5) (EDIT) User:Materialscientist (contribs, talk) edited Gallium_arsenide (diff, hist)
Added: 'ImageFile2' ('' -> 'Gallium arsenide crystal.jpg', SET '')
10:47:39 (3, 4, 5) (EDIT) User:Materialscientist (contribs, talk) edited Gallium_arsenide (diff, hist)
Changed: 'Solubility' ('<1 g dm-1 (at 20 Â°C)' -> 'insoluble', SET '< 0.1 g/100 mL (20 Â°C)')
10:47:39 (3, 4, 5) (EDIT) User:Materialscientist (contribs, talk) edited Gallium_arsenide (diff, hist)
Changed: 'RefractIndex' ('3.0 - 5.0<ref>{{cite journal|url=http://www.worldscibooks.com/etextbook/2046/2046schap1s4.pdf|page=28|title=Handbook on Semiconductor Properties|volume= 2}}</ref>' -> '3.8<ref>[http://www.ioffe.ru/SVA/NSM/nk/A3B5/Gif/gaas.gif Refractive i
10:47:39 (3, 5, 5) (EDIT) User:Materialscientist (contribs, talk) edited Gallium_arsenide (diff, hist)
Deleted: 'ImageFile' ('Gallium-arsenide-unit-cell-3D-balls.png' -> '', SET 'GaAscrystals.JPG')
10:47:39 (3, 5, 5) (EDIT) User:Materialscientist (contribs, talk) edited Gallium_arsenide (diff, hist)
Changed: 'ImageName' ('Ball and stick cell model of gallium arsenide' -> '', SET '')
10:47:40 (4, 5, 5) (EDIT) User:Materialscientist (contribs, talk) edited Gallium_arsenide (diff, hist)
Changed: 'MolarMass' ('144.645 g mol-1' -> '144.645 g molâ1', SET '144.645 g/mol')
10:47:41 (4, 5, 5) (EDIT) User:Materialscientist (contribs, talk) edited Gallium_arsenide (diff, hist)
Changed: 'Density' ('5.316 g cm-3 <ref>{{cite book|url=http://books.google.com/books?id=Xqj-TTzkvTEC&pg=PA310|page=310|author = P. Patnaik| title = Handbook of Inorganic Chemicals| publisher = McGraw-Hill| year = 2003| isbn = 0070494398}}</ref>' -> '5.3
10:47:42 (4, 5, 5) (EDIT) User:Materialscientist (contribs, talk) edited Gallium_arsenide (diff, hist)
Added: 'ExactMass' ('143.847177329 g mol-1' -> '143.847177329 g molâ1', SET '')
10:47:43 (4, 5, 5) (EDIT) User:Materialscientist (contribs, talk) edited Gallium_arsenide (diff, hist)
Added: 'PIN' ('Gallium arsenide{{Citation needed|date = September 2011}}' -> 'Gallium arsenide', SET '')
10:47:44 (3, 2, 4) (EDIT) User:Materialscientist (contribs, talk) edited Gallium_arsenide (diff, hist)
Added links: http://www.ioffe.ru/SVA/NSM/nk/A3B5/Gif/gaas.gif
11:04:18 (2, 4, 4) (EDIT) User:Materialscientist (contribs, talk) edited Cobalt(II)_oxide (diff, hist)
Changed: 'Solubility' ('insoluble in water<ref>http://www.alfa.com/content/msds/german/44354.pdf</ref>' -> 'insoluble in water<ref>[http://www.alfa.com/content/msds/german/44354.pdf Advanced Search â Alfa Aesar â A Johnson Matthey Company]. Alfa.com. Retrieved
11:14:49 (3, 4, 5) (EDIT) User:Materialscientist (contribs, talk) edited Cobalt(II)_hydroxide (diff, hist)
Changed: 'Solubility' ('320 Âµg/100mL' -> '3.20 mg/L', SET '320 Âµg/100mL')
11:14:50 (3, 4, 5) (EDIT) User:Materialscientist (contribs, talk) edited Cobalt(II)_hydroxide (diff, hist)
Changed: 'SolubilityProduct' ('1.0 x 10-15' -> '1.0{{e|-15}}', SET '1.0 x 10-15')
11:14:50 (3, 4, 5) (EDIT) User:Materialscientist (contribs, talk) edited Cobalt(II)_hydroxide (diff, hist)
Changed: 'DeltaHf' ('-539.7 [[Kilojoule per mole|kJâ¢mol-1]]' -> '-539.7 [[Kilojoule per mole|kJÂ·molâ1]]', SET '-539.7 [[Kilojoule per mole|kJâ¢mol-1]]')
11:14:50 (3, 4, 5) (EDIT) User:Materialscientist (contribs, talk) edited Cobalt(II)_hydroxide (diff, hist)
Changed: 'Entropy' ('79.0 Jâ¢mol-1â¢K-1<ref name="hand2">{{Citation | last = Lide | first = David R. | author-link = | last2 = | first2 = | author2-link = | publication-date = | date = | year = 1998 | title = Handbook of Chemistry and Ph
11:14:51 (4, 4, 5) (EDIT) User:Materialscientist (contribs, talk) edited Cobalt(II)_hydroxide (diff, hist)
Changed: 'MeltingPt' ('168 Â°C (decomp)<ref name="icc">{{Citation | last =Patnaik | first =Pradyot | author-link = | last2 = | first2 = | author2-link = | publication-date = | date = | year = 2003 | title =Handbook of Inorganic Chemical Compounds | edition = | vo
11:14:51 (3, 2, 4) (EDIT) User:Materialscientist (contribs, talk) edited Cobalt(II)_hydroxide (diff, hist)
Added links: http://books.google.com/?id=Xqj-TTzkvTEC&pg=PA243, http://books.google.com/?id=LxhQPdMRfVIC&pg=PA1478
11:16:59 (3, 2, 4) (EDIT) User:Granateple (contribs, talk) edited Lupeol (diff, hist)
Added links: http://www.ncbi.nlm.nih.gov/pmc/articles/PMC2764818/pdf/nihms114280.pdf
11:25:32 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Cobalt(II)_hydroxide (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')
11:25:32 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Cobalt(II)_hydroxide (diff, hist)
Changed: 'verifiedrevid' ('401965348' -> '412150315', SET '401965348')
11:54:17 (2, 3, 5) (EDIT) User:Makecat (contribs, talk) edited Rhodium(VI)_fluoride (diff, hist)
Changed: 'ImageFile' ('' -> 'Rhodium(VI)-fluoride.svg')
11:54:17 (2, 3, 5) (EDIT) User:Makecat (contribs, talk) edited Rhodium(VI)_fluoride (diff, hist)
Changed: 'ImageSize' ('' -> '200px')
14:34:44 (2, 4, 5) (EDIT) User:Ephemeronium (contribs, talk) edited Carbonic_acid (diff, hist)
Changed: 'ImageSizeL1' ('100px' -> '115px', SET '100px')
14:34:45 (2, 4, 5) (EDIT) User:Ephemeronium (contribs, talk) edited Carbonic_acid (diff, hist)
Changed: 'ImageSizeR1' ('120px' -> '125px', SET '120px')
14:35:17 (3, 3, 5) (EDIT) User:Anypodetos (contribs, talk) edited Morphine-N-oxide (diff, hist)
Changed: 'PubChem_Ref' ('{{Pubchemcite|correc|Pubchem}}' -> '{{Pubchemcite|correct|Pubchem}}')
14:35:18 (3, 3, 5) (EDIT) User:Anypodetos (contribs, talk) edited Morphine-N-oxide (diff, hist)
Changed: 'CASNo_Comment' ('(1''S'',5''R'',13''R'',14''S'',17''R'')-14-hydroxy,-pentacyclooctadeca' -> '')
14:35:18 (3, 3, 5) (EDIT) User:Anypodetos (contribs, talk) edited Morphine-N-oxide (diff, hist)
Changed: 'PubChem1' ('21128868' -> '')
14:35:18 (3, 3, 5) (EDIT) User:Anypodetos (contribs, talk) edited Morphine-N-oxide (diff, hist)
Changed: 'PubChem1_Ref' ('{{Pubchemcite|correc|Pubchem}}' -> '')
14:35:19 (3, 3, 5) (EDIT) User:Anypodetos (contribs, talk) edited Morphine-N-oxide (diff, hist)
Changed: 'PubChem1_Comment' ('(1''S'',5''R'',17''R'')- pentacyclooctadeca' -> '')
14:35:19 (3, 3, 5) (EDIT) User:Anypodetos (contribs, talk) edited Morphine-N-oxide (diff, hist)
Changed: 'PubChem2' ('5362459' -> '')
14:35:20 (3, 3, 5) (EDIT) User:Anypodetos (contribs, talk) edited Morphine-N-oxide (diff, hist)
Changed: 'PubChem2_Ref' ('{{Pubchemcite|correc|Pubchem}}' -> '')
14:35:20 (3, 3, 5) (EDIT) User:Anypodetos (contribs, talk) edited Morphine-N-oxide (diff, hist)
Changed: 'PubChem2_Comment' ('(1''S'',5''R'',13''R'',14''S'',17''R'')-14-hydroxy,-pentacyclooctadeca' -> '')
14:35:20 (3, 3, 5) (EDIT) User:Anypodetos (contribs, talk) edited Morphine-N-oxide (diff, hist)
Changed: 'ChemSpiderID1' ('4515047' -> '')
14:35:21 (3, 3, 5) (EDIT) User:Anypodetos (contribs, talk) edited Morphine-N-oxide (diff, hist)
Changed: 'ChemSpiderID1_Ref' ('{{chemspidercite|correct|chemspider}}' -> '')
14:35:21 (3, 3, 5) (EDIT) User:Anypodetos (contribs, talk) edited Morphine-N-oxide (diff, hist)
Changed: 'ChemSpiderID1_Comment' ('(1''S'',5''R'',13''R'',14''S'',17''R'')-14-hydroxy,-pentacyclooctadeca' -> '')
14:35:21 (4, 3, 5) (EDIT) User:Anypodetos (contribs, talk) edited Morphine-N-oxide (diff, hist)
Changed: 'C' ('' -> '17')
14:35:22 (4, 3, 5) (EDIT) User:Anypodetos (contribs, talk) edited Morphine-N-oxide (diff, hist)
Changed: 'H' ('' -> '19')
14:35:22 (4, 3, 5) (EDIT) User:Anypodetos (contribs, talk) edited Morphine-N-oxide (diff, hist)
Changed: 'N' ('' -> '1')
14:35:22 (4, 3, 5) (EDIT) User:Anypodetos (contribs, talk) edited Morphine-N-oxide (diff, hist)
Changed: 'O' ('' -> '4')
14:35:23 (4, 3, 5) (EDIT) User:Anypodetos (contribs, talk) edited Morphine-N-oxide (diff, hist)
Changed: 'IUPACName' ('3-Methyl-2,3,4,4a,7,7a-hexahydro-1''H''-4,12-methano[1]benzofuro[3,2-e]isoquinoline-7,9-diol 3-oxide{{Citation needed|date = November 2011}}' -> '(4''R'',4a''R'',7''S'',7a''R'',12b''S'')-3-Methyl-2,3,4,4a,7,7a-hexahydro-1''H''-4,12-methano[1
14:35:23 (4, 3, 5) (EDIT) User:Anypodetos (contribs, talk) edited Morphine-N-oxide (diff, hist)
Changed: 'PubChem' ('4464646' -> '5362459')
14:35:24 (4, 3, 5) (EDIT) User:Anypodetos (contribs, talk) edited Morphine-N-oxide (diff, hist)
Changed: 'MolarMass' ('301.3371 g molâ1' -> '')
14:35:24 (5, 3, 5) (EDIT) User:Anypodetos (contribs, talk) edited Morphine-N-oxide (diff, hist)
Changed: 'ChemSpiderID' ('3663196' -> '4515047')
14:35:24 (3, 2, 4) (EDIT) User:Anypodetos (contribs, talk) edited Morphine-N-oxide (diff, hist)
Added links: http://www.chemspider.com/4515047
14:39:50 (2, 4, 5) (EDIT) User:Ephemeronium (contribs, talk) edited Nitric_acid (diff, hist)
Added: 'ImageFile1' ('' -> 'Nitric-acid-2D-dimensions.png', SET '')
14:39:50 (2, 4, 5) (EDIT) User:Ephemeronium (contribs, talk) edited Nitric_acid (diff, hist)
Added: 'ImageSize1' ('' -> '200', SET '')
14:39:50 (2, 4, 5) (EDIT) User:Ephemeronium (contribs, talk) edited Nitric_acid (diff, hist)
Added: 'ImageName1' ('' -> 'Structural formula of nitric acid with assorted dimensions', SET '')
14:39:51 (2, 4, 5) (EDIT) User:Ephemeronium (contribs, talk) edited Nitric_acid (diff, hist)
Changed: 'ImageSize2' ('220' -> '240', SET '220')
14:39:51 (2, 4, 5) (EDIT) User:Ephemeronium (contribs, talk) edited Nitric_acid (diff, hist)
Added: 'ImageFileL3' ('' -> 'Nitric acid resonance median.png', SET '')
14:39:51 (2, 4, 5) (EDIT) User:Ephemeronium (contribs, talk) edited Nitric_acid (diff, hist)
Added: 'ImageSizeL3' ('' -> '125', SET '')
14:39:51 (2, 4, 5) (EDIT) User:Ephemeronium (contribs, talk) edited Nitric_acid (diff, hist)
Added: 'ImageNameL3' ('' -> 'Resonance structural formula of nitric acid', SET '')
14:39:52 (2, 4, 5) (EDIT) User:Ephemeronium (contribs, talk) edited Nitric_acid (diff, hist)
Added: 'ImageFileR3' ('' -> 'Nitric-acid-3D-balls-B.png', SET '')
14:39:52 (2, 4, 5) (EDIT) User:Ephemeronium (contribs, talk) edited Nitric_acid (diff, hist)
Added: 'ImageSizeR3' ('' -> '115', SET '')
14:39:52 (2, 4, 5) (EDIT) User:Ephemeronium (contribs, talk) edited Nitric_acid (diff, hist)
Added: 'ImageNameR3' ('' -> 'Resonance ball and stick model of nitric acid', SET '')
14:39:53 (2, 5, 5) (EDIT) User:Ephemeronium (contribs, talk) edited Nitric_acid (diff, hist)
Deleted: 'ImageFileL1' ('Nitric acid resonance median.png' -> '', SET 'Nitric acid resonance median.png')
14:39:53 (2, 5, 5) (EDIT) User:Ephemeronium (contribs, talk) edited Nitric_acid (diff, hist)
Deleted: 'ImageSizeL1' ('100' -> '', SET '100')
14:39:53 (2, 5, 5) (EDIT) User:Ephemeronium (contribs, talk) edited Nitric_acid (diff, hist)
Deleted: 'ImageNameL1' ('Resonance structural formula of nitric acid' -> '', SET 'Resonance structural formula of nitric acid')
14:39:54 (2, 5, 5) (EDIT) User:Ephemeronium (contribs, talk) edited Nitric_acid (diff, hist)
Deleted: 'ImageFileR1' ('Nitric-acid-3D-balls-B.png' -> '', SET 'Nitric-acid-3D-balls-B.png')
14:39:54 (2, 5, 5) (EDIT) User:Ephemeronium (contribs, talk) edited Nitric_acid (diff, hist)
Deleted: 'ImageSizeR1' ('100' -> '', SET '100')
14:39:54 (2, 5, 5) (EDIT) User:Ephemeronium (contribs, talk) edited Nitric_acid (diff, hist)
Deleted: 'ImageNameR1' ('Resonance ball and stick model of nitric acid' -> '', SET 'Resonance ball and stick model of nitric acid')
14:39:54 (2, 5, 5) (EDIT) User:Ephemeronium (contribs, talk) edited Nitric_acid (diff, hist)
Deleted: 'ImageFile3' ('Nitric-acid-2D-dimensions.png' -> '', SET 'Nitric-acid-2D-dimensions.png')
14:39:55 (2, 5, 5) (EDIT) User:Ephemeronium (contribs, talk) edited Nitric_acid (diff, hist)
Deleted: 'ImageSize3' ('150' -> '', SET '150')
14:39:55 (2, 5, 5) (EDIT) User:Ephemeronium (contribs, talk) edited Nitric_acid (diff, hist)
Deleted: 'ImageName3' ('Structural formula of nitric acid with assorted dimensions' -> '', SET 'Structural formula of nitric acid with assorted dimensions')
14:40:58 (2, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Morphine-N-oxide (diff, hist)
Changed: 'ImageName' ('Stereo, skeletal formula of morphine-N-oxide ((1S,4S,5R,13R,14S,17R)-14-hydroxy,-4-methyl,-pentacyclooctadeca)' -> 'Skeletal formula of morphine-N-oxide, with stereochemistry')
14:40:58 (4, 3, 4) (EDIT) User:Anypodetos (contribs, talk) edited Morphine-N-oxide (diff, hist)
Changed: 'Formula' ('{{Chem|C|17|NH|19|O|4}}' -> '')
15:30:27 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Galactosamine (diff, hist)
Changed: 'verifiedrevid' ('400097576' -> '461116190', SET '400097576')
15:30:27 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Galactosamine (diff, hist)
Changed: 'CASNo_Ref' ('{{cascite|correct|??}}' -> '{{cascite|changed|??}}', SET '{{cascite|correct|??}}')
15:30:28 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Galactosamine (diff, hist)
Changed: 'ChEBI_Ref' ('{{ebicite|changed|EBI}}' -> '{{ebicite|correct|EBI}}', SET '{{ebicite|changed|EBI}}')
16:56:18 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Domoic_acid (diff, hist)
Added: 'Verifiedfields' ('' -> 'changed', SET '')
16:56:18 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Domoic_acid (diff, hist)
Added: 'verifiedrevid' ('' -> '461091080', SET '')
16:56:19 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Domoic_acid (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite|changed|??}}', SET '')
16:56:19 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Domoic_acid (diff, hist)
Added: 'ChemSpiderID_Ref' ('' -> '{{chemspidercite|correct|chemspider}}', SET '')
16:56:19 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Domoic_acid (diff, hist)
Added: 'ChEMBL_Ref' ('' -> '{{ebicite|changed|EBI}}', SET '')
16:56:20 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Domoic_acid (diff, hist)
Added: 'StdInChI_Ref' ('' -> '{{stdinchicite|correct|chemspider}}', SET '')
16:56:20 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Domoic_acid (diff, hist)
Added: 'StdInChIKey_Ref' ('' -> '{{stdinchicite|correct|chemspider}}', SET '')
17:29:25 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Cerium(III)_chloride (diff, hist)
Changed: 'verifiedrevid' ('443511595' -> '443512770', SET '443511595')
18:05:57 (3, 2, 4) (EDIT) User:Nagelfar (contribs, talk) edited Pseudomorphine (diff, hist)
Added links: http://www.jbc.org/content/71/2/537.full.pdf
21:43:35 (3, 4, 5) (EDIT) User:Multi-colored uppers (contribs, talk) edited Sodium_polyacrylate (diff, hist)
Changed: 'ExternalMSDS' ('[http://www.profbunsen.com.au/downloads/SodPolyAcrylateMSDS.pdf?PHPSESSID=ec1d82101e090202a51c416640c38d6a MSDS]' -> '[http://avogadro.chem.iastate.edu/MSDS/Naspolyacrylate.pdf MSDS]', SET '[http://www.profbunsen.com.au/downloads/SodPolyA
21:43:36 (3, 2, 4) (EDIT) User:Multi-colored uppers (contribs, talk) edited Sodium_polyacrylate (diff, hist)
Added links: http://avogadro.chem.iastate.edu/MSDS/Na_polyacrylate.pdf
21:54:55 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Sodium_polyacrylate (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite|correct|CAS}}', SET '')
21:59:27 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Zinc_fluoride (diff, hist)
Changed: 'verifiedrevid' ('441267223' -> '454732113', SET '441267223')
21:59:29 (4, 4, 4) (EDIT) User:Edgar181 (contribs, talk) edited 1,2-Dimethylhydrazine (diff, hist)
Added: 'Formula' ('{{Chem|C|2|N|2|H|8}}' -> '{{Chem|C|2|H|8|N|2}}', SET '')
22:06:14 (4, 4, 4) (EDIT) User:Edgar181 (contribs, talk) edited Dimethylamine (diff, hist)
Changed: 'Formula' ('{{Chem|C|2|NH|7}}' -> '{{Chem|C|2|H|7|N}}', SET 'C2H7N')
22:06:30 (4, 4, 4) (EDIT) User:Edgar181 (contribs, talk) edited Musk_xylene (diff, hist)
Changed: 'Formula' ('{{Chem|C|12|N|3|H|15|O|6}}' -> '{{Chem|C|12|H|15|N|3|O|6}}', SET 'C12H15N3O6')
22:07:20 (4, 4, 4) (EDIT) User:Edgar181 (contribs, talk) edited Dihydropyridine (diff, hist)
Changed: 'Formula' ('{{Chem|C|5|NH|7}}' -> '{{Chem|C|5|H|7|N}}', SET 'C5H7N')
22:10:08 (4, 4, 4) (EDIT) User:Edgar181 (contribs, talk) edited Uric_acid (diff, hist)
Changed: 'Formula' ('{{Chem|C|5|N|4|H|4|O|3}}' -> '{{Chem|C|5|H|4|N|4|O|3}}', SET 'C5H4N4O3')
22:11:56 (4, 4, 4) (EDIT) User:Edgar181 (contribs, talk) edited Ophthalmic_acid (diff, hist)
Changed: 'Formula' ('{{Chem|C|11|N|3|H|19|O|6}}' -> '{{Chem|C|11|H|19|N|3|O|6}}', SET '{{Chem|C|11|N|3|H|19|O|6}}')
22:22:28 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Ophthalmic_acid (diff, hist)
Changed: 'Watchedfields' ('' -> 'changed', SET 'changed')
23:17:48 (2, 4, 5) (EDIT) User:The chemistds (contribs, talk) edited Setrobuvir (diff, hist)
Added: 'InChIKey' ('' -> 'DEKOYVOWOVJMPM-RLHIPHHXBY', SET '')
23:17:50 (4, 4, 5) (EDIT) User:The chemistds (contribs, talk) edited Setrobuvir (diff, hist)
Added: 'InChI' ('' -> '1/C25H25FN4O6S2/c1-37(33,34)28-17-8-9-18-19(11-17)38(35,36)29-24(27-18)21-23(31)20-14-4-5-15(10-14)22(20)30(25(21)32)12-13-2-6-16(26)7-3-13/h2-3,6-9,11,14-15,20,22,28,31H,4-5,10,12H2,1H3,(H,27,29)/t14-,15+,20+,22-/m0/s1', SET '')
23:17:52 (5, 4, 5) (EDIT) User:The chemistds (contribs, talk) edited Setrobuvir (diff, hist)
Added: 'ChemSpiderID' ('' -> '24680206', SET '')
23:17:53 (5, 4, 5) (EDIT) User:The chemistds (contribs, talk) edited Setrobuvir (diff, hist)
Added: 'StdInChI' ('' -> '1S/C25H25FN4O6S2/c1-37(33,34)28-17-8-9-18-19(11-17)38(35,36)29-24(27-18)21-23(31)20-14-4-5-15(10-14)22(20)30(25(21)32)12-13-2-6-16(26)7-3-13/h2-3,6-9,11,14-15,20,22,28,31H,4-5,10,12H2,1H3,(H,27,29)/t14-,15+,20+,22-/m0/s1', SET '')
23:17:54 (5, 4, 5) (EDIT) User:The chemistds (contribs, talk) edited Setrobuvir (diff, hist)
Added: 'StdInChIKey' ('' -> 'DEKOYVOWOVJMPM-RLHIPHHXSA-N', SET '')
23:27:51 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Perfluorooctanesulfonic_acid (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite|correct|??}}', SET '')
23:30:19 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Setrobuvir (diff, hist)
Changed: 'verifiedrevid' ('457658470' -> '461494827', SET '457658470')
23:30:20 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Setrobuvir (diff, hist)
Changed: 'CASNo_Ref' ('{{cascite|changed|??}}' -> '{{cascite|correct|??}}', SET '{{cascite|changed|??}}')
23:30:21 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Setrobuvir (diff, hist)
Added: 'ChemSpiderID_Ref' ('' -> '{{chemspidercite|correct|chemspider}}', SET '')
23:30:23 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Setrobuvir (diff, hist)
Added: 'StdInChI_Ref' ('' -> '{{stdinchicite|correct|chemspider}}', SET '')
23:30:24 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Setrobuvir (diff, hist)
Added: 'StdInChIKey_Ref' ('' -> '{{stdinchicite|correct|chemspider}}', SET '')
23:30:25 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Setrobuvir (diff, hist)
Deleted: 'Verifiedfields' ('changed' -> '', SET 'changed')
00:02:13 (4, 4, 5) (EDIT) User:Philoleb (contribs, talk) edited Isoamyl_acetate (diff, hist)
Changed: 'IUPACName' ('3-methyl-1-butyl ethanoate' -> '3-methylbut-1-yl ethanoate', SET '3-methyl-1-butyl acetate')