Jump to content

Simfibrate

From Wikipedia, the free encyclopedia

This is an old revision of this page, as edited by Aldis90 (talk | contribs) at 07:42, 17 December 2015. The present address (URL) is a permanent link to this revision, which may differ significantly from the current revision.

{{Drugbox | verifiedrevid = 464391792 | IUPAC_name = propane-1,3-diyl bis[2-(4-chlorophenoxy)-2-methylpropanoate] | image = simfibrate.png

| tradename = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number = | ATC_prefix = C10 | ATC_suffix = AB06 | PubChem = 5217 | DrugBank_Ref =  checkY | DrugBank = | ChemSpiderID_Ref =  checkY | ChemSpiderID = 5028 | UNII_Ref =  checkY | UNII = L2R75RQX26 | KEGG_Ref =  checkY | KEGG = D01212

| C=23 | H=26 | Cl=2 | O=6 | molecular_weight = 469.354 g/mol | smiles = Clc2ccc(OC(C(=O)OCCCOC(=O)C(Oc1ccc(Cl)cc1)(C)C)(C)C)cc2 | InChI = 1/C23H26Cl2O6/c1-22(2,30-18-10-6-16(24)7-11-18)20(26)28-14-5-15-29-21(27)23(3,4)31-19-12-8-17(25)9-13-19/h6-13H,5,14-15H2,1-4H3 | InChIKey = JLRNKCZRCMIVKA-UHFFFAOYAQ | StdInChI_Ref =  checkY | StdInChI = 1S/C23H26Cl2O6/c1-22(2,30-18-10-6-16(24)7-11-18)20(26)28-14-5-15-29-21(27)23(3,4)31-19-12-8-17(25)9-13-19/h6-13H,5,14-15H2,1-4H3 | StdInChIKey_Ref =  checkY | StdInChIKey = JLRNKCZRCMIVKA-UHFFFAOYSA-N | synonyms = 3-{[2-(4-chlorophenoxy)-2-methylpropanoyl]oxy}propyl 2-(4-chlorophenoxy)-2-methylpropanoate }}

Simfibrate is a fibrate.

References