Jump to content

Croconazole: Difference between revisions

From Wikipedia, the free encyclopedia
Content deleted Content added
No edit summary
corrected IUPAC name
Line 1: Line 1:
{{Drugbox
{{Drugbox
| IUPAC_name = 1-[1-[2-[(3-chlorophenyl)methoxy]phenyl]ethenyl]imidazole
| IUPAC_name = 1-(1-{2-[(3-chlorophenyl)methoxy]phenyl}ethenyl)-1''H''-imidazole
| image = Croconazole.png
| image = Croconazole.png
| CAS_number = 77175-51-0
| CAS_number = 77175-51-0

Revision as of 10:37, 21 December 2008

{{Drugbox | IUPAC_name = 1-(1-{2-[(3-chlorophenyl)methoxy]phenyl}ethenyl)-1H-imidazole | image = Croconazole.png | CAS_number = 77175-51-0 | CAS_supplemental = | ATC_prefix = | ATC_suffix = | ATC_supplemental = | PubChem = 2880 | DrugBank = | chemical_formula = | C=18 | H=15 | Cl=1 | N=2 | O=1 | molecular_weight = 310.77 g/mol | smiles = C=C(C1=CC=CC=C1OCC2=CC(=CC=C2)Cl)N3C=CN=C3 | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | pregnancy_AU = | pregnancy_US = | pregnancy_category= | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = Rx-only | routes_of_administration = Topical }}

Croconazole (INN) is an imidazole antifungal.