Morniflumate
{{Drugbox | Watchedfields = changed | verifiedrevid = 444424085 | IUPAC_name = 2-morpholin-4-ylethyl 2-{[3-(trifluoromethyl)phenyl]amino}nicotinate | image = morniflumate.png
| tradename = | Drugs.com = International Drug Names | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =
| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
| CAS_number = 65847-85-0
| ATC_prefix = M01
| ATC_suffix = AX22
| PubChem = 72106
| DrugBank_Ref = 
| DrugBank =
| ChemSpiderID_Ref =
| ChemSpiderID = 65089
| UNII_Ref =
| UNII = R133MWH7X1
| KEGG_Ref =
| KEGG = D05078
| C=19 | H=20 | F=3 | N=3 | O=3
| molecular_weight = 395.37561 g/mol
| smiles = FC(F)(F)c1cc(ccc1)Nc2ncccc2C(=O)OCCN3CCOCC3
| InChI = 1/C19H20F3N3O3/c20-19(21,22)14-3-1-4-15(13-14)24-17-16(5-2-6-23-17)18(26)28-12-9-25-7-10-27-11-8-25/h1-6,13H,7-12H2,(H,23,24)
| InChIKey = LDXSPUSKBDTEKA-UHFFFAOYAK
| StdInChI_Ref =
| StdInChI = 1S/C19H20F3N3O3/c20-19(21,22)14-3-1-4-15(13-14)24-17-16(5-2-6-23-17)18(26)28-12-9-25-7-10-27-11-8-25/h1-6,13H,7-12H2,(H,23,24)
| StdInChIKey_Ref =
| StdInChIKey = LDXSPUSKBDTEKA-UHFFFAOYSA-N
}}
Morniflumate is a non-steroidal anti-inflammatory drug.[1][2][3]
References
- ^ PMID 1796197
- ^ PMID 1659152
- ^ Attention: This template ({{cite doi}}) is deprecated. To cite the publication identified by doi:10.1007/BF01966649, please use {{cite journal}} (if it was published in a bona fide academic journal, otherwise {{cite report}} with
|doi=10.1007/BF01966649instead.
| pyrazolones / pyrazolidines | |
|---|---|
| salicylates | |
| acetic acid derivatives and related substances | |
| oxicams | |
| propionic acid derivatives (profens) |
|
| n-arylanthranilic acids (fenamates) | |
| COX-2 inhibitors (coxibs) | |
| other | |
| NSAID combinations | |
Key: underline indicates initially developed first-in-class compound of specific group; #WHO-Essential Medicines; †withdrawn drugs; ‡veterinary use. | |
 | This drug article relating to the musculoskeletal system is a stub. You can help Wikipedia by expanding it. |