Aceprometazine
{{Drugbox
| verifiedrevid = 477238377
| IUPAC_name = 1-{10-[2-(dimethylamino)propyl]-10H-phenothiazin-2-yl}ethanone
| image = Aceprometazine.svg
| tradename =
| pregnancy_category = Contraindicated
Passes into breast milk
| legal_status = Rx-only
| routes_of_administration = Oral
| bioavailability =
| protein_bound =
| metabolism = Hepatic
| elimination_half-life =
| excretion = Renal and fecal
| CAS_number_Ref =
| CAS_number = 13461-01-3
| ATC_prefix = none
| ATC_suffix =
| PubChem = 26035
| DrugBank_Ref =
| DrugBank = DB01615
| ChemSpiderID_Ref =
| ChemSpiderID = 24249
| ChEMBL = 2104054
| UNII_Ref =
| UNII = 984N9YTM4Y
| ChEBI_Ref =
| ChEBI = 53770
| C=19 | H=22
| N=2 | O=1
| S=1
| molecular_weight = 326.456 g/mol
| smiles = O=C(c2cc1N(c3c(Sc1cc2)cccc3)CC(N(C)C)C)C
| StdInChI_Ref =
| StdInChI = 1S/C19H22N2OS/c1-13(20(3)4)12-21-16-7-5-6-8-18(16)23-19-10-9-15(14(2)22)11-17(19)21/h5-11,13H,12H2,1-4H3
| StdInChIKey_Ref =
| StdInChIKey = XLOQNFNTQIRSOX-UHFFFAOYSA-N
}}
Aceprometazine (INN) is a phenothiazine derivative prescription drug with neuroleptic and anti-histamine properties. It is not widely prescribed. It may be used in combination with meprobamate for the treatment of sleep disorders. This combination is available in France under the trade name Mepronizine.
References