Cyfluthrin: Difference between revisions
Appearance
Content deleted Content added
m robot Adding: ca:Ciflutrina |
Script assisted update of chemical identifiers from ChemSpider for the Chem/Drugbox validation project. |
||
Line 5: | Line 5: | ||
| OtherNames = |
| OtherNames = |
||
| Section1 = {{Chembox Identifiers |
| Section1 = {{Chembox Identifiers |
||
| ChemSpiderID = 45482 |
|||
| InChI = 1/C22H18Cl2FNO3/c1-22(2)15(11-19(23)24)20(22)21(27)29-18(12-26)13-8-9-16(25)17(10-13)28-14-6-4-3-5-7-14/h3-11,15,18,20H,1-2H3/t15-,18-,20-/m0/s1 |
|||
| InChIKey = QQODLKZGRKWIFG-QSFXBCCZBF |
|||
| CASNo = 68359-37-5 |
| CASNo = 68359-37-5 |
||
| PubChem = 50153 |
| PubChem = 50153 |
||
Line 10: | Line 13: | ||
| ATCCode_suffix = BA01 |
| ATCCode_suffix = BA01 |
||
| ATC_Supplemental = {{ATCvet|P53|AC12}} |
| ATC_Supplemental = {{ATCvet|P53|AC12}} |
||
| SMILES = |
| SMILES = Cl/C(Cl)=C/[C@H]3[C@@H](C(=O)O[C@@H](C#N)c2ccc(F)c(Oc1ccccc1)c2)C3(C)C |
||
}} |
}} |
||
| Section2 = {{Chembox Properties |
| Section2 = {{Chembox Properties |
Revision as of 16:01, 27 January 2010
Names | |
---|---|
IUPAC name
[(R)-cyano-[4-fluoro-3-(phenoxy)phenyl]methyl] (1R,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate
| |
Identifiers | |
3D model (JSmol)
|
|
ChemSpider | |
ECHA InfoCard | 100.063.485 |
PubChem CID
|
|
CompTox Dashboard (EPA)
|
|
| |
| |
Properties | |
Molar mass | 434.288 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Cyfluthrin is a pyrethroid derivative which is used as an insecticide.