<- User:Beetstra/listing5 - User:Beetstra/Validation - User:Beetstra/listing7 ->

Data

1251 to 1300

Aluminium(I)_oxide (1251)
```
Botcommand: addindex 332190931 Aluminium(I)_oxide
```
```
For index : Aluminium(I)_oxide=332190931
```
* 12004-36-3 -> 12004-36-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Aluminium+I+oxide not found on commonchemistry - Aluminium+I+oxide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Aluminium(II)_oxide (1252)
```
Botcommand: addindex 333470541 Aluminium(II)_oxide
```
```
For index : Aluminium(II)_oxide=333470541
```
* 14457-64-8 -> 14457-64-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Aluminium+II+oxide not found on commonchemistry - Aluminium+II+oxide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Aluminon (1253)
```
Botcommand: addindex 357019536 Aluminon
```
```
For index : Aluminon=357019536
```
* 569-58-4 -> 569-58-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Aluminon not found on commonchemistry - Aluminon

* No ChemSpiderID

* PubChem: 68439

* No InChI

* No SMILES
Alvameline (1254)

* No CASNo

* Alvameline not found on commonchemistry - Alvameline

* ChemSpiderID: 154980 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 178030

* No InChI - (ChemSpider: | InChI=InChI=1/C9H15N5/c1-3-14-11-9(10-12-14)8-5-4-6-13(2)7-8/h5H,3-4,6-7H2,1-2H3 )

* No SMILES - (ChemSpider: | smiles=n1nn(nc1\C2=C\CCN(C)C2)CC )
Alverine (1255)
```
Botcommand: addindex 332694839 Alverine
```
```
For index : Alverine=332694839
```
* 150-59-4 -> 150-59-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Alverine not found on commonchemistry - Alverine

* ChemSpiderID: 3550 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 3678

* No InChI - (ChemSpider: | InChI=InChI=1/C20H27N/c1-2-21(17-9-15-19-11-5-3-6-12-19)18-10-16-20-13-7-4-8-14-20/h3-8,11-14H,2,9-10,15-18H2,1H3 )

* No SMILES - (ChemSpider: | smiles=c1ccccc1CCCN(CC)CCCc2ccccc2 )
Alvimopan (1256)
```
Botcommand: addindex 362204963 Alvimopan
```
```
For index : Alvimopan=362204963
```
* 156053-89-3 -> 156053-89-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Alvimopan not found on commonchemistry - Alvimopan

* ChemSpiderID: 4589864 (correct: 4589864) - CORRECT - Retrieved data from ChemSpider

* PubChem: 5488548

* No InChI - (ChemSpider: | InChI=InChI=1/C25H32N2O4/c1-18-16-27(12-11-25(18,2)21-9-6-10-22(28)14-21)17-20(24(31)26-15-23(29)30)13-19-7-4-3-5-8-19/h3-10,14,18,20,28H,11-13,15-17H2,1-2H3,(H,26,31)(H,29,30)/t18-,20-,25+/m0/s1 )

* No SMILES - (ChemSpider: | smiles=O=C(O)CNC(=O)[C@@H](Cc1ccccc1)CN3CC[C@@](c2cccc(O)c2)([C@H](C3)C)C )
Alvocidib (1257)
```
Botcommand: addindex 308940784 Alvocidib
```
```
For index : Alvocidib=308940784
```
* 146426-40-6 -> 146426-40-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Alvocidib not found on commonchemistry - Alvocidib

* No ChemSpiderID

* PubChem: 5287969

* No InChI

* SMILES: CN1CCC(C(C1)O)C2=C(C=C(C3=C2OC(=CC3=O)C4=CC=CC=C4Cl)O)O
Amanin (1258)
```
Botcommand: addindex 335957079 Amanin
```
```
For index : Amanin=335957079
```
* 21150-21-0 -> 21150-21-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Amanin not found on commonchemistry - Amanin

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: O=C(NCC(N[C@@](C(NCC(N[C@@H](C3)C(N[C@@H](CC(O)=O)C(N5[C@H]4C[C@@H](O)C5)=O)=O)=O)=O)([H])[C@@H](C)CC)=O)[C@H](CC1=C(S3=O)NC2=C1C=CC=C2)NC([C@@]([C@@H](C)[C@@H](O)CO)([H])N[C@@]4=O)=O
Amaninamide (1259)
```
Botcommand: addindex 335957115 Amaninamide
```
```
For index : Amaninamide=335957115
```
* 58311-65-2 -> 58311-65-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Amaninamide not found on commonchemistry - Amaninamide

* No ChemSpiderID

* PubChem: 3035225

* No InChI

* SMILES: O=C(NCC(N[C@@](C(NCC(N[C@@H](C3)C(N[C@@H](CC(N)=O)C(N5[C@H]4C[C@@H](O)C5)=O)=O)=O)=O)([H])[C@@H](C)CC)=O)[C@H](CC1=C(S3=O)NC2=C1C=CC=C2)NC([C@@]([C@@H](C)[C@@H](O)CO)([H])N[C@@]4=O)=O
Amanullin (1261)
```
Botcommand: addindex 269759345 Amanullin
```
```
For index : Amanullin=269759345
```
* 21803-57-6 -> 21803-57-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Amanullin not found on commonchemistry - Amanullin

* No ChemSpiderID

* PubChem: 114856

* No InChI

* SMILES: O=C(NCC(N[C@@](C(NCC(N[C@@H](C3)C(N[C@@H](CC(N)=O)C(N5[C@H]4C[C@@H](O)C5)=O)=O)=O)=O)([H])[C@@H](C)CC)=O)[C@H](CC1=C(S3=O)NC2=C1C=CC(O)=C2)NC([C@@]([C@@H](C)CC)([H])N[C@@]4=O)=O
Amanullinic_acid (1262)
```
Botcommand: addindex 269764944 Amanullinic_acid
```
```
For index : Amanullinic_acid=269764944
```
* 54532-45-5 -> 54532-45-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Amanullinic+acid not found on commonchemistry - Amanullinic+acid

* No ChemSpiderID

* PubChem: 171349

* No InChI

* SMILES: O=C(NCC(N[C@@](C(NCC(N[C@@H](C3)C(N[C@@H](CC(O)=O)C(N5[C@H]4C[C@@H](O)C5)=O)=O)=O)=O)([H])[C@@H](C)CC)=O)[C@H](CC1=C(S3=O)NC2=C1C=CC(O)=C2)NC([C@@]([C@@H](C)CC)([H])N[C@@]4=O)=O
Ambazone (1264)
```
Botcommand: addindex 332695572 Ambazone
```
```
For index : Ambazone=332695572
```
* 539-21-9 -> 539-21-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Ambazone not found on commonchemistry - Ambazone

* ChemSpiderID: 12232507 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 1549158

* InChI: 1/C8H11N7S/c9-7(10)14-12-5-1-3-6(4-2-5)13-15-8(11)16/h1-4H,(H4,9,10,14)(H3,11,15,16)/b12-5-,13-6+ - (ChemSpider: | InChI=InChI=1/C8H11N7S/c9-7(10)14-12-5-1-3-6(4-2-5)13-15-8(11)16/h1-4H,(H4,9,10,14)(H3,11,15,16)/b12-5-,13-6+ )

* SMILES: NC(=S)N\N=C1\C=C/C(=N\NC(N)=N)/C=C1 - (ChemSpider: | SMILES=NC(=S)N\N=C1\C=C/C(=N\NC(N)=N)/C=C1 )
Ambrein (1266)
```
Botcommand: addindex 355640317 Ambrein
```
```
For index : Ambrein=355640317
```
* 473-03-0 -> 473-03-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Ambrein not found on commonchemistry - Ambrein

* No ChemSpiderID

* PubChem: 11826112

* No InChI

* SMILES: C/C(=C\CC[C@@H]1[C@]2(CCCC(C2CC[C@@]1(C)O)(C)C)C)/CC[C@@H]3C(=C)CCCC3(C)C
Ambrisentan (1267)
```
Botcommand: addindex 351652130 Ambrisentan
```
```
For index : Ambrisentan=351652130
```
* 177036-94-1 -> 177036-94-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Ambrisentan not found on commonchemistry - Ambrisentan

* ChemSpiderID: 5293690 (correct: 171133) - INCORRECT

* PubChem: 6918493

* No InChI

* No SMILES
Ambroxol (1268)
```
Botcommand: addindex 360245427 Ambroxol
```
```
For index : Ambroxol=360245427
```
* 18683-91-5 -> 18683-91-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Ambroxol not found on commonchemistry - Ambroxol

* ChemSpiderID: 10276826 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 2132

* No InChI - (ChemSpider: | InChI=InChI=1/C13H18Br2N2O/c14-9-5-8(13(16)12(15)6-9)7-17-10-1-3-11(18)4-2-10/h5-6,10-11,17-18H,1-4,7,16H2/t10-,11- )

* No SMILES - (ChemSpider: | smiles=O[C@H]2CC[C@H](NCc1cc(Br)cc(Br)c1N)CC2 )
Ambucetamide (1269)
```
Botcommand: addindex 356335992 Ambucetamide
```
```
For index : Ambucetamide=356335992
```
* 519-88-0 -> 519-88-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Ambucetamide not found on commonchemistry - Ambucetamide

* ChemSpiderID: 10171 (correct: 10171) - CORRECT - Retrieved data from ChemSpider

* PubChem: 10616

* No InChI - (ChemSpider: | InChI=InChI=1/C17H28N2O2/c1-4-6-12-19(13-7-5-2)16(17(18)20)14-8-10-15(21-3)11-9-14/h8-11,16H,4-7,12-13H2,1-3H3,(H2,18,20) )

* No SMILES - (ChemSpider: | smiles=O=C(N)C(c1ccc(OC)cc1)N(CCCC)CCCC )
Ambuphylline (1270)
```
Botcommand: addindex 332822244 Ambuphylline
```
```
For index : Ambuphylline=332822244
```
* 5634-34-4 -> 5634-34-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Ambuphylline not found on commonchemistry - Ambuphylline

* ChemSpiderID: 20536 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 21850

* InChI: 1/C7H8N4O2.C4H11NO/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;1-4(2,5)3-6/h3H,1-2H3,(H,8,9);6H,3,5H2,1-2H3 - (ChemSpider: | InChI=InChI=1/C7H8N4O2.C4H11NO/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;1-4(2,5)3-6/h3H,1-2H3,(H,8,9);6H,3,5H2,1-2H3 )

* SMILES: O=C2N(c1ncnc1C(=O)N2C)C.OCC(N)(C)C - (ChemSpider: | SMILES=O=C2N(c1ncnc1C(=O)N2C)C.OCC(N)(C)C )
Ambutonium_bromide (1271)
```
Botcommand: addindex 297954495 Ambutonium_bromide
```
```
For index : Ambutonium_bromide=297954495
```
* 115-51-5 -> 115-51-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Ambutonium+bromide not found on commonchemistry - Ambutonium+bromide

* No ChemSpiderID

* PubChem: 8276

* No InChI

* SMILES: CC[N+](C)(C)CCC(C1=CC=CC=C1)(C2=CC=CC=C2)C(=O)N.[Br-]
Amdoxovir (1273)

* No CASNo

* Amdoxovir not found on commonchemistry - Amdoxovir

* No ChemSpiderID

* PubChem: 124088

* No InChI

* No SMILES
Amentoflavone (1274)
```
Botcommand: addindex 350495097 Amentoflavone
```
```
For index : Amentoflavone=350495097
```
* 1617-53-4 -> 1617-53-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Amentoflavone not found on commonchemistry - Amentoflavone

* ChemSpiderID: 4444919 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 5281600

* InChI: 1/C30H18O10/c31-15-4-1-13(2-5-15)24-12-23(38)29-21(36)10-20(35)27(30(29)40-24)17-7-14(3-6-18(17)33)25-11-22(37)28-19(34)8-16(32)9-26(28)39-25/h1-12,31-36H - (ChemSpider: | InChI=InChI=1/C30H18O10/c31-15-4-1-13(2-5-15)24-12-23(38)29-21(36)10-20(35)27(30(29)40-24)17-7-14(3-6-18(17)33)25-11-22(37)28-19(34)8-16(32)9-26(28)39-25/h1-12,31-36H )

* SMILES: O=C1\C=C(/Oc2cc(O)cc(O)c12)c6cc(c5c(O)cc(O)c3c5O/C(=C\C3=O)c4ccc(O)cc4)c(O)cc6 - (ChemSpider: | SMILES=O=C1\C=C(/Oc2cc(O)cc(O)c12)c6cc(c5c(O)cc(O)c3c5O/C(=C\C3=O)c4ccc(O)cc4)c(O)cc6 )
Americium_dioxide (1275)
```
Botcommand: addindex 353856585 Americium_dioxide
```
```
For index : Americium_dioxide=353856585
```
* 12005-67-3 -> 12005-67-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Americium+dioxide not found on commonchemistry - Americium+dioxide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Americium(III)_chloride (1276)
```
Botcommand: addindex 363801226 Americium(III)_chloride
```
```
For index : Americium(III)_chloride=363801226
```
* 13464-46-5 -> 13464-46-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Americium+III+chloride not found on commonchemistry - Americium+III+chloride

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Amezinium_metilsulfate (1277)
```
Botcommand: addindex 295151588 Amezinium_metilsulfate
```
```
For index : Amezinium_metilsulfate=295151588
```
* 30578-37-1 -> 30578-37-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Amezinium+metilsulfate not found on commonchemistry - Amezinium+metilsulfate

* No ChemSpiderID

* PubChem: 71926

* No InChI

* No SMILES
Amfecloral (1278)
```
Botcommand: addindex 350632274 Amfecloral
```
```
For index : Amfecloral=350632274
```
* 5581-35-1 -> 5581-35-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Amfecloral not found on commonchemistry - Amfecloral

* ChemSpiderID: 20451 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 21759

* No InChI - (ChemSpider: | InChI=InChI=1/C11H12Cl3N/c1-9(15-8-11(12,13)14)7-10-5-3-2-4-6-10/h2-6,8-9H,7H2,1H3/b15-8+ )

* No SMILES - (ChemSpider: | smiles=ClC(Cl)(Cl)/C=N/C(Cc1ccccc1)C )
Amfenac (1279)
```
Botcommand: addindex 358240056 Amfenac
```
```
For index : Amfenac=358240056
```
* 51579-82-9 -> 51579-82-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Amfenac not found on commonchemistry - Amfenac

* ChemSpiderID: 2051 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 2136

* No InChI - (ChemSpider: | InChI=InChI=1/C15H13NO3/c16-14-11(9-13(17)18)7-4-8-12(14)15(19)10-5-2-1-3-6-10/h1-8H,9,16H2,(H,17,18) )

* No SMILES - (ChemSpider: | smiles=O=C(c1cccc(c1N)CC(=O)O)c2ccccc2 )
Amfepentorex (1280)
File:(Â±)-Amfepentorex Enantiomers Structural Formulae.png
```
Botcommand: addindex 351665140 Amfepentorex
```
```
For index : Amfepentorex=351665140
```
* 15686-27-8 -> 15686-27-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Amfepentorex not found on commonchemistry - Amfepentorex

* ChemSpiderID: 64893 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 71877

* No InChI - (ChemSpider: | InChI=InChI=1/C15H25N/c1-4-5-6-7-14-8-10-15(11-9-14)12-13(2)16-3/h8-11,13,16H,4-7,12H2,1-3H3 )

* No SMILES - (ChemSpider: | smiles=N(C(Cc1ccc(cc1)CCCCC)C)C )
Amfepramone (1281)
```
Botcommand: addindex 362995102 Amfepramone
```
```
For index : Amfepramone=362995102
```
* 134-80-5 -> 134-80-5 - NOT VERIFIED

* CAS found on commonchemistry - 134-80-5 - name in list
All names: 1-Phenyl-2-(diethylamino)propanone-1 hydrochloride, 1-Propanone, 2-(diethylamino)-1-phenyl-, hydrochloride, 1-Propanone, 2-(diethylamino)-1-phenyl-, hydrochloride (1:1), 2-(Diethylamino)propiophenone hydrochloride, Amfepramon hydrochloride, amfepramone hydrochloride, Amfepramone, chlorhydrate, Amfepramonhydrochlorid, Amphepramonum hydrochloride, Anfamon, anfepramona, clorhidrato, Anorex, Danylen, Diethylpropion hydrochloride, Diethylpropione hydrochloride, Dobesin, Fepranon, Frekentine, Keramik, Keramin, Moderatan, Modulor, Parabolin, Phepranon, Prefamone, Propiophenone, 2-(diethylamino)-, hydrochloride, Regenon, Regenon hydrochloride, Tenuate, Tenuate hydrochloride, Tenuate-Dospan, Tepanil, Tylinal, Î±-(Diethylamino)propiophenone hydrochloride, Î±-Benzoyltriethylamine hydrochloride, Î±-Benzoyltriethylammonium chloride

* Amfepramone found on commonchemistry - Amfepramone
* 134-80-5 (exact match) Matches CAS (134-80-5) on page
Name in list

All names: 1-Phenyl-2-(diethylamino)propanone-1 hydrochloride, 1-Propanone, 2-(diethylamino)-1-phenyl-, hydrochloride, 1-Propanone, 2-(diethylamino)-1-phenyl-, hydrochloride (1:1), 2-(Diethylamino)propiophenone hydrochloride, Amfepramon hydrochloride, [[amfepramone hydrochloride]], [[amfepramone, chlorhydrate]], Amfepramonhydrochlorid, Amphepramonum hydrochloride, Anfamon, anfepramona, clorhidrato, Anorex, Danylen, Diethylpropion hydrochloride, Diethylpropione hydrochloride, Dobesin, Fepranon, Frekentine, Keramik, Keramin, Moderatan, Modulor, Parabolin, Phepranon, Prefamone, Propiophenone, 2-(diethylamino)-, hydrochloride, Regenon, Regenon hydrochloride, Tenuate, Tenuate hydrochloride, Tenuate-Dospan, Tepanil, Tylinal, Î±-(Diethylamino)propiophenone hydrochloride, Î±-Benzoyltriethylamine hydrochloride, Î±-Benzoyltriethylammonium chloride

* ChemSpiderID: 6762 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 7029

* No InChI - (ChemSpider: | InChI=InChI=1/C13H19NO/c1-4-14(5-2)11(3)13(15)12-9-7-6-8-10-12/h6-11H,4-5H2,1-3H3 )

* No SMILES - (ChemSpider: | smiles=O=C(c1ccccc1)C(N(CC)CC)C )
Amflutizole (1282)
```
Botcommand: addindex 364974870 Amflutizole
```
```
For index : Amflutizole=364974870
```
* 82114-19-0 -> 82114-19-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Amflutizole not found on commonchemistry - Amflutizole

* No ChemSpiderID

* PubChem: 192344

* No InChI

* No SMILES
Amfonelic_acid (1283)
```
Botcommand: addindex 350204720 Amfonelic_acid
```
```
For index : Amfonelic_acid=350204720
```
* 15180-02-6 -> 15180-02-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Amfonelic+acid not found on commonchemistry - Amfonelic+acid

* No ChemSpiderID

* PubChem: 2137

* No InChI

* No SMILES
Amibegron (1284)
```
Botcommand: addindex 360225147 Amibegron
```
```
For index : Amibegron=360225147
```
* 121524-09-2 -> 121524-09-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Amibegron not found on commonchemistry - Amibegron

* No ChemSpiderID

* PubChem: 3035442

* No InChI

* No SMILES
Amidephrine (1285)
```
Botcommand: addindex 360224519 Amidephrine
```
```
For index : Amidephrine=360224519
```
* 3354-67-4 -> 3354-67-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Amidephrine not found on commonchemistry - Amidephrine

* ChemSpiderID: 14288 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 15010

* No InChI - (ChemSpider: | InChI=InChI=1/C10H16N2O3S/c1-11-7-10(13)8-4-3-5-9(6-8)12-16(2,14)15/h3-6,10-13H,7H2,1-2H3 )

* No SMILES - (ChemSpider: | smiles=O=S(=O)(Nc1cc(ccc1)C(O)CNC)C )
Amido_black_10B (1286)
```
Botcommand: addindex 332697093 Amido_black_10B
```
```
For index : Amido_black_10B=332697093
```
* 1064-48-8 -> 1064-48-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Amido+black+B not found on commonchemistry - Amido+black+B

* ChemSpiderID: 10660833 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 9566044

* InChI: 1/C22H16N6O9S2.2Na/c23-19-18-12(11-17(39(35,36)37)21(22(18)29)27-24-13-4-2-1-3-5-13)10-16(38(32,33)34)20(19)26-25-14-6-8-15(9-7-14)28(30)31;;/h1-11,29H,23H2,(H,32,33,34)(H,35,36,37);;/q;2*+1/p-2/b26-25+,27-24+;; - (ChemSpider: | InChI=InChI=1/C22H16N6O9S2.2Na/c23-19-18-12(11-17(39(35,36)37)21(22(18)29)27-24-13-4-2-1-3-5-13)10-16(38(32,33)34)20(19)26-25-14-6-8-15(9-7-14)28(30)31;;/h1-11,29H,23H2,(H,32,33,34)(H,35,36,37);;/q;2*+1/p-2/b26-25+,27-24+;; )

* SMILES: [Na+].[Na+].O=N(=O)c1ccc(cc1)/N=N/c2c(N)c4c(cc2S([O-])(=O)=O)cc(c(/N=N/c3ccccc3)c4O)S([O-])(=O)=O - (ChemSpider: | SMILES=[Na+].[Na+].O=N(=O)c1ccc(cc1)/N=N/c2c(N)c4c(cc2S([O-])(=O)=O)cc(c(/N=N/c3ccccc3)c4O)S([O-])(=O)=O )
Amidol (1287)
```
Botcommand: addindex 336912011 Amidol
```
```
For index : Amidol=336912011
```
* 95-86-3 -> 95-86-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Amidol found on commonchemistry - Amidol
* 509-74-0 (Formula: C23H31NO2; Name: Benzeneethanol, Î²-[2-(dimethylamino)propyl]-Î±-ethyl-Î²-phenyl-, acetate (ester))

* 4039-32-1 (Formula: C6H19NSi2.Li; Name: Silanamine, 1,1,1-trimethyl-N-(trimethylsilyl)-, lithium salt)

* 73590-58-6 (Formula: C17H19N3O3S; Name: 1H-Benzimidazole, 5-methoxy-2-[[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]sulfinyl]-)

* No ChemSpiderID

* PubChem: 7266

* No InChI

* SMILES: NC1=CC(N)=C(O)C=C1
Amiflamine (1288)
```
Botcommand: addindex 350637009 Amiflamine
```
```
For index : Amiflamine=350637009
```
* 77518-07-1 -> 77518-07-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Amiflamine not found on commonchemistry - Amiflamine

* ChemSpiderID: 64356 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 71221

* No InChI - (ChemSpider: | InChI=InChI=1/C12H20N2/c1-9-7-12(14(3)4)6-5-11(9)8-10(2)13/h5-7,10H,8,13H2,1-4H3/t10-/m0/s1 )

* No SMILES - (ChemSpider: | smiles=N(c1cc(c(cc1)C[C@@H](N)C)C)(C)C )
Amikacin (1290)
```
Botcommand: addindex 333014384 Amikacin
```
```
For index : Amikacin=333014384
```
* 37517-28-5 -> 37517-28-5 - NOT VERIFIED

* CAS found on commonchemistry - 37517-28-5 - name in list
All names: [[1-N-[L-(-)-Î³-Amino-Î±-hydroxybutyryl]kanamycin A]], Amicacin, Amikacillin, amikacin, amikacina, amikacine, Amukin, Antibiotic BB-K 8, BB-K 8, [[D-Streptamine, O-3-amino-3-deoxy-Î±-D-glucopyranosyl-(1â†’6)-O-[6-amino-6-deoxy-Î±-D-glucopyranosyl-(1â†’4)]-N1-(4-amino-2-hydroxy-1-oxobutyl)-2-deoxy-, (S)-]], [[D-Streptamine, O-3-amino-3-deoxy-Î±-D-glucopyranosyl-(1â†’6)-O-[6-amino-6-deoxy-Î±-D-glucopyranosyl-(1â†’4)]-N1-[(2S)-4-amino-2-hydroxy-1-oxobutyl]-2-deoxy-]], [[D-Streptamine,O-3-amino-3-deoxy-Î±-D-glucopyranosyl-(1â†’6)-O-[6-amino-6-deoxy-Î±-D-glucopyranosyl-(1â†’4)]-N1-[(2S)-4-amino-2-hydroxy-1-oxobutyl]-2-deoxy-]], Lukadin

* Amikacin found on commonchemistry - Amikacin
* 37517-28-5 (exact match) Matches CAS (37517-28-5) on page
Name in list

All names: [[1-N-[L-(-)-Î³-Amino-Î±-hydroxybutyryl]kanamycin A]], Amicacin, Amikacillin, [[amikacin]], [[amikacina]], [[amikacine]], Amukin, Antibiotic BB-K 8, BB-K 8, [[D-Streptamine, O-3-amino-3-deoxy-Î±-D-glucopyranosyl-(1â†’6)-O-[6-amino-6-deoxy-Î±-D-glucopyranosyl-(1â†’4)]-N1-(4-amino-2-hydroxy-1-oxobutyl)-2-deoxy-, (S)-]], [[D-Streptamine, O-3-amino-3-deoxy-Î±-D-glucopyranosyl-(1â†’6)-O-[6-amino-6-deoxy-Î±-D-glucopyranosyl-(1â†’4)]-N1-[(2S)-4-amino-2-hydroxy-1-oxobutyl]-2-deoxy-]], [[D-Streptamine,O-3-amino-3-deoxy-Î±-D-glucopyranosyl-(1â†’6)-O-[6-amino-6-deoxy-Î±-D-glucopyranosyl-(1â†’4)]-N1-[(2S)-4-amino-2-hydroxy-1-oxobutyl]-2-deoxy-]], Lukadin

* ChemSpiderID: 34635 (correct: 34635) - CORRECT - Retrieved data from ChemSpider

* PubChem: 37768

* No InChI - (ChemSpider: | InChI=InChI=1/C22H43N5O13/c23-2-1-8(29)20(36)27-7-3-6(25)18(39-22-16(34)15(33)13(31)9(4-24)37-22)17(35)19(7)40-21-14(32)11(26)12(30)10(5-28)38-21/h6-19,21-22,28-35H,1-5,23-26H2,(H,27,36)/t6-,7+,8-,9+,10+,11-,12+,13+,14+,15-,16+,17-,18+,19-,21+,22+/m0/s1 )

* No SMILES - (ChemSpider: | smiles=O=C(N[C@H]3[C@H](O[C@H]1O[C@@H]([C@@H](O)[C@H](N)[C@H]1O)CO)[C@@H](O)[C@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](N)C3)[C@@H](O)CCN )
Amikhelline (1291)
```
Botcommand: addindex 332697360 Amikhelline
```
```
For index : Amikhelline=332697360
```
* 4439-67-2 -> 4439-67-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Amikhelline not found on commonchemistry - Amikhelline

* ChemSpiderID: 64334 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 71198

* No InChI - (ChemSpider: | InChI=InChI=1/C18H21NO5/c1-4-19(5-2)7-9-23-18-16-12(6-8-22-16)15(21)14-13(20)10-11(3)24-17(14)18/h6,8,10,21H,4-5,7,9H2,1-3H3 )

* No SMILES - (ChemSpider: | smiles=O=C/1c3c(O\C(=C\1)C)c(OCCN(CC)CC)c2occc2c3O )
Amineptine (1293)
```
Botcommand: addindex 360064070 Amineptine
```
```
For index : Amineptine=360064070
```
* 57574-09-1 -> 57574-09-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Amineptine not found on commonchemistry - Amineptine

* ChemSpiderID: 32091 (correct: 32091) - CORRECT - Retrieved data from ChemSpider

* PubChem: 34870

* No InChI - (ChemSpider: | InChI=InChI=1/C22H27NO2/c24-21(25)13-3-1-2-8-16-23-22-19-11-6-4-9-17(19)14-15-18-10-5-7-12-20(18)22/h4-7,9-12,22-23H,1-3,8,13-16H2,(H,24,25) )

* No SMILES - (ChemSpider: | smiles=O=C(O)CCCCCCNC3c1ccccc1CCc2c3cccc2 )
Aminocandin (1294)

* No CASNo

* Aminocandin not found on commonchemistry - Aminocandin

* No ChemSpiderID

* PubChem: 16072305

* No InChI

* No SMILES
Aminoglutethimide (1298)
```
Botcommand: addindex 362691191 Aminoglutethimide
```
```
For index : Aminoglutethimide=362691191
```
* 125-84-8 -> 125-84-8 - NOT VERIFIED

* CAS found on commonchemistry - 125-84-8 - name in list
All names: (.+-.)-Aminoglutethimide, (RS)-Aminoglutethimide, 2-(p-Aminophenyl)-2-ethylglutarimide, 2,6-Piperidinedione, 3-(4-aminophenyl)-3-ethyl-, 3-(4-Aminophenyl)-3-ethylpiperidine-2,6-dione, Aminoglutethimid, aminoglutethimide, aminoglutetimida, Ba-16038, Cytadren, dl-Aminoglutethimide, Elipten, Glutarimide, 2-(p-aminophenyl)-2-ethyl-, NSC 330915, Orimeten, p-Aminoglutethimide, Î±-(p-Aminophenyl)-Î±-ethylglutarimide

* Aminoglutethimide found on commonchemistry - Aminoglutethimide
* 125-84-8 (exact match) Matches CAS (125-84-8) on page
Name in list

All names: [[(.+-.)-aminoglutethimide]], [[(RS)-aminoglutethimide]], 2-(p-Aminophenyl)-2-ethylglutarimide, 2,6-Piperidinedione, 3-(4-aminophenyl)-3-ethyl-, 3-(4-Aminophenyl)-3-ethylpiperidine-2,6-dione, Aminoglutethimid, [[aminoglutethimide]], aminoglutetimida, Ba-16038, Cytadren, [[dl-aminoglutethimide]], Elipten, Glutarimide, 2-(p-aminophenyl)-2-ethyl-, NSC 330915, Orimeten, [[p-aminoglutethimide]], Î±-(p-Aminophenyl)-Î±-ethylglutarimide

* ChemSpiderID: 2060 (correct: 2060) - CORRECT - Retrieved data from ChemSpider

* PubChem: 2145

* No InChI - (ChemSpider: | InChI=InChI=1/C13H16N2O2/c1-2-13(8-7-11(16)15-12(13)17)9-3-5-10(14)6-4-9/h3-6H,2,7-8,14H2,1H3,(H,15,16,17) )

* No SMILES - (ChemSpider: | smiles=O=C1NC(=O)CCC1(c2ccc(N)cc2)CC )

1301 to 1350

Aminomethylbenzoic_acid (1301)
```
Botcommand: addindex 281275995 Aminomethylbenzoic_acid
```
```
For index : Aminomethylbenzoic_acid=281275995
```
* 56-91-7 -> 56-91-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Aminomethylbenzoic+acid not found on commonchemistry - Aminomethylbenzoic+acid

* No ChemSpiderID

* PubChem: 65526

* No InChI

* No SMILES
Aminometradine (1302)
```
Botcommand: addindex 351345036 Aminometradine
```
```
For index : Aminometradine=351345036
```
* 642-44-4 -> 642-44-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Aminometradine not found on commonchemistry - Aminometradine

* ChemSpiderID: 12033 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 12551

* No InChI - (ChemSpider: | InChI=InChI=1/C9H13N3O2/c1-3-5-12-7(10)6-8(13)11(4-2)9(12)14/h3,6H,1,4-5,10H2,2H3 )

* No SMILES - (ChemSpider: | smiles=O=C1N(/C(=C\C(=O)N1CC)N)C\C=C )
Aminopyralid (1307)
```
Botcommand: addindex 343025116 Aminopyralid
```
```
For index : Aminopyralid=343025116
```
* 150114-71-9 -> 150114-71-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Aminopyralid not found on commonchemistry - Aminopyralid

* ChemSpiderID: 184712 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 213012

* InChI: 1/C6H4Cl2N2O2/c7-3-1-2(9)4(8)5(10-3)6(11)12/h1H,(H2,9,10)(H,11,12) - (ChemSpider: | InChI=InChI=1/C6H4Cl2N2O2/c7-3-1-2(9)4(8)5(10-3)6(11)12/h1H,(H2,9,10)(H,11,12) )

* SMILES: Clc1c(nc(Cl)cc1N)C(=O)O - (ChemSpider: | SMILES=Clc1c(nc(Cl)cc1N)C(=O)O )
Aminorex (1308)
```
Botcommand: addindex 361568785 Aminorex
```
```
For index : Aminorex=361568785
```
* 2207-50-3 -> 2207-50-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Aminorex not found on commonchemistry - Aminorex

* ChemSpiderID: 15767 (correct: 15767) - CORRECT - Retrieved data from ChemSpider

* PubChem: 16630

* No InChI - (ChemSpider: | InChI=InChI=1/C9H10N2O/c10-9-11-6-8(12-9)7-4-2-1-3-5-7/h1-5,8H,6H2,(H2,10,11) )

* No SMILES - (ChemSpider: | smiles=N\2=C(\OC(c1ccccc1)C/2)N )
Aminoshikimic_acid (1309)
```
Botcommand: addindex 361538345 Aminoshikimic_acid
```
```
For index : Aminoshikimic_acid=361538345
```
* 178948-66-8 -> 178948-66-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Aminoshikimic+acid not found on commonchemistry - Aminoshikimic+acid

* ChemSpiderID: 391778 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 443636

* InChI: 1/C7H11NO4/c8-4-1-3(7(11)12)2-5(9)6(4)10/h2,4-6,9-10H,1,8H2,(H,11,12)/t4-,5-,6+/m1/s1 - (ChemSpider: | InChI=InChI=1/C7H11NO4/c8-4-1-3(7(11)12)2-5(9)6(4)10/h2,4-6,9-10H,1,8H2,(H,11,12)/t4-,5-,6+/m1/s1 )

* SMILES: O=C(O)/C1=C/[C@@H](O)[C@@H](O)[C@H](N)C1 - (ChemSpider: | SMILES=O=C(O)/C1=C/[C@@H](O)[C@@H](O)[C@H](N)C1 )
Amiphenazole (1312)
```
Botcommand: addindex 292701232 Amiphenazole
```
```
For index : Amiphenazole=292701232
```
* 490-55-1 -> 490-55-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Amiphenazole not found on commonchemistry - Amiphenazole

* No ChemSpiderID

* PubChem: 10275

* No InChI

* No SMILES
Amisulpride (1313)
```
Botcommand: addindex 363638422 Amisulpride
```
```
For index : Amisulpride=363638422
```
* 53583-79-2 -> 53583-79-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Amisulpride not found on commonchemistry - Amisulpride

* ChemSpiderID: 2074 (correct: 2074) - CORRECT - Retrieved data from ChemSpider

* PubChem: 2159

* No InChI - (ChemSpider: | InChI=InChI=1/C17H27N3O4S/c1-4-20-8-6-7-12(20)11-19-17(21)13-9-16(25(22,23)5-2)14(18)10-15(13)24-3/h9-10,12H,4-8,11,18H2,1-3H3,(H,19,21) )

* No SMILES - (ChemSpider: | smiles=O=S(=O)(c1cc(c(OC)cc1N)C(=O)NCC2N(CC)CCC2)CC )
Amitraz (1314)
```
Botcommand: addindex 362431313 Amitraz
```
```
For index : Amitraz=362431313
```
* 33089-61-1 -> 33089-61-1 - NOT VERIFIED

* CAS found on commonchemistry - 33089-61-1 - name in list
All names: 1,5-Di(2,4-dimethylphenyl)-3-methyl-1,3,5-triazapenta-1,4-diene, Acarac, Amigard, amitraz, Apivar ND, Azaform, BAAM, BAAM (pesticide), Bovitraz, BTS 27419, Edrizar, Ektodex, ENT 27967, Formamidine, N-methyl-N'-2,4-xylyl-N-(N-2,4-xylylformimidoyl)-, Fumilat A, [[Methanimidamide, N'-(2,4-dimethylphenyl)-N-[[(2,4-dimethylphenyl)imino]methyl]-N-methyl-]], [[Methanimidamide, N'-(2,4-dimethylphenyl)-N-[[(2,4-dimethylphenyl)imino]methyl]-N-methyl-]], [[Methanimidamide, N'-(2,4-dimethylphenyl)-N-[[(2,4-dimethylphenyl)imino]methyl]-N-methyl-]], Mitaban, Mitac, [[N'-(2,4-Dimethylphenyl)-N-[(2,4-dimethylphenyl)imino]methyl-N-methylimidoformamide]], N,N'-(Methyliminodimethylidyne)bis-2,4-xylidine, N,N-Di-(2,4-Xylyliminomethyl)methylamine, N-Methylbis(2,4-xylyliminomethyl)amine, NSC 324552, Ovasyn, Parsec, Taktic, TCL, Triazid, U 36059, Varamit

* Amitraz found on commonchemistry - Amitraz
* 33089-61-1 (exact match) Matches CAS (33089-61-1) on page
Name in list

All names: 1,5-Di(2,4-dimethylphenyl)-3-methyl-1,3,5-triazapenta-1,4-diene, Acarac, Amigard, [[amitraz]], Apivar ND, Azaform, BAAM, BAAM (pesticide), Bovitraz, BTS 27419, Edrizar, Ektodex, ENT 27967, Formamidine, N-methyl-N'-2,4-xylyl-N-(N-2,4-xylylformimidoyl)-, Fumilat A, [[Methanimidamide, N'-(2,4-dimethylphenyl)-N-[[(2,4-dimethylphenyl)imino]methyl]-N-methyl-]], [[Methanimidamide, N'-(2,4-dimethylphenyl)-N-[[(2,4-dimethylphenyl)imino]methyl]-N-methyl-]], [[Methanimidamide, N'-(2,4-dimethylphenyl)-N-[[(2,4-dimethylphenyl)imino]methyl]-N-methyl-]], Mitaban, Mitac, [[N'-(2,4-Dimethylphenyl)-N-[(2,4-dimethylphenyl)imino]methyl-N-methylimidoformamide]], N,N'-(Methyliminodimethylidyne)bis-2,4-xylidine, N,N-Di-(2,4-Xylyliminomethyl)methylamine, N-Methylbis(2,4-xylyliminomethyl)amine, NSC 324552, Ovasyn, Parsec, Taktic, TCL, Triazid, U 36059, Varamit

* ChemSpiderID: 33405 (correct: 33405) - CORRECT - Retrieved data from ChemSpider

* PubChem: 36324

* InChI: 1/C19H23N3/c1-14-6-8-18(16(3)10-14)20-12-22(5)13-21-19-9-7-15(2)11-17(19)4/h6-13H,1-5H3/b20-12+,21-13+ - (ChemSpider: | InChI=InChI=1/C19H23N3/c1-14-6-8-18(16(3)10-14)20-12-22(5)13-21-19-9-7-15(2)11-17(19)4/h6-13H,1-5H3/b20-12+,21-13+ )

* SMILES: N(=C/N(\C=N\c1ccc(cc1C)C)C)\c2ccc(cc2C)C - (ChemSpider: | SMILES=N(=C/N(\C=N\c1ccc(cc1C)C)C)\c2ccc(cc2C)C )
Amitriptylinoxide (1316)
```
Botcommand: addindex 354715100 Amitriptylinoxide
```
```
For index : Amitriptylinoxide=354715100
```
* 4317-14-0 -> 4317-14-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Amitriptylinoxide not found on commonchemistry - Amitriptylinoxide

* ChemSpiderID: 19137 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 20313

* No InChI - (ChemSpider: | InChI=InChI=1/C20H23NO/c1-21(2,22)15-7-12-20-18-10-5-3-8-16(18)13-14-17-9-4-6-11-19(17)20/h3-6,8-12H,7,13-15H2,1-2H3 )

* No SMILES - (ChemSpider: | smiles=[O-][N+](C)(C)CC/C=C2/c1c(cccc1)CCc3c2cccc3 )
Amixetrine (1317)
```
Botcommand: addindex 356384320 Amixetrine
```
```
For index : Amixetrine=356384320
```
* 24622-72-8 -> 24622-72-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Amixetrine not found on commonchemistry - Amixetrine

* ChemSpiderID: 64922 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 71911

* No InChI - (ChemSpider: | InChI=InChI=1/C17H27NO/c1-15(2)10-13-19-17(14-18-11-6-7-12-18)16-8-4-3-5-9-16/h3-5,8-9,15,17H,6-7,10-14H2,1-2H3 )

* No SMILES - (ChemSpider: | smiles=O(CCC(C)C)C(c1ccccc1)CN2CCCC2 )
Amlodipine/benazepril (1320)

* No CASNo

* Amlodipine+benazepril not found on commonchemistry - Amlodipine+benazepril

* ChemSpiderID: 4676979 (correct: 4676979) - CORRECT - Retrieved data from ChemSpider

* PubChem: 5746247

* No InChI - (ChemSpider: | InChI=InChI=1/C24H28N2O5.C20H25ClN2O5/c1-2-31-24(30)20(14-12-17-8-4-3-5-9-17)25-19-15-13-18-10-6-7-11-21(18)26(23(19)29)16-22(27)28;1-4-28-20(25)18-15(11-27-10-9-22)23-12(2)16(19(24)26-3)17(18)13-7-5-6-8-14(13)21/h3-11,19-20,25H,2,12-16H2,1H3,(H,27,28);5-8,17,23H,4,9-11,22H2,1-3H3/t19-,20-;/m0./s1 )

* No SMILES - (ChemSpider: | smiles=Clc1ccccc1C2C(\C(=O)OC)=C(/N\C(=C2\C(=O)OCC)COCCN)C.O=C(OCC)[C@@H](N[C@@H]2C(=O)N(c1ccccc1CC2)CC(=O)O)CCc3ccccc3 )
Ammelide (1321)
```
Botcommand: addindex 363003218 Ammelide
```
```
For index : Ammelide=363003218
```
* 645-93-2 -> 645-93-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Ammelide not found on commonchemistry - Ammelide

* No ChemSpiderID

* PubChem: 10927

* No InChI

* No SMILES
Ammeline (1322)
```
Botcommand: addindex 361072730 Ammeline
```
```
For index : Ammeline=361072730
```
* 645-92-1 -> 645-92-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Ammeline not found on commonchemistry - Ammeline

* No ChemSpiderID

* PubChem: 12583

* No InChI

* No SMILES
Ammonia_borane (1324)
```
Botcommand: addindex 325678081 Ammonia_borane
```
```
For index : Ammonia_borane=325678081
```
* 13774-81-7 -> 13774-81-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Ammonia+borane not found on commonchemistry - Ammonia+borane

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: [NH3+][BH3-]
Ammonium_aluminium_sulfate (1326)
```
Botcommand: addindex 364838052 Ammonium_aluminium_sulfate
```
```
For index : Ammonium_aluminium_sulfate=364838052
```
* 7784-25-0 -> 7784-25-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Ammonium+aluminium+sulfate not found on commonchemistry - Ammonium+aluminium+sulfate

* ChemSpiderID: 2297489 - UNKNOWN

* No PubChem

* InChI: 1/Al.H3N.2H2O4S/c;;2*1-5(2,3)4/h;1H3;2*(H2,1,2,3,4)/q+3;;;/â€‹p-3

* No SMILES
Ammonium_arsenate (1327)
```
Botcommand: addindex 360024204 Ammonium_arsenate
```
```
For index : Ammonium_arsenate=360024204
```
* 7784-44-3 -> 7784-44-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Ammonium+arsenate not found on commonchemistry - Ammonium+arsenate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Ammonium_azide (1328)

* No CASNo

* Ammonium+azide not found on commonchemistry - Ammonium+azide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Ammonium_cerium(IV)_sulfate (1335)
```
Botcommand: addindex 364869011 Ammonium_cerium(IV)_sulfate
```
```
For index : Ammonium_cerium(IV)_sulfate=364869011
```
* 10378-47-9 -> 10378-47-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Ammonium+cerium+IV+sulfate not found on commonchemistry - Ammonium+cerium+IV+sulfate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Ammonium_chlorate (1336)
```
Botcommand: addindex 364865418 Ammonium_chlorate
```
```
For index : Ammonium_chlorate=364865418
```
* 10192-29-7 -> 10192-29-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Ammonium+chlorate not found on commonchemistry - Ammonium+chlorate

* ChemSpiderID: 55411 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 61491

* InChI: 1/ClHO3.H3N/c2-1(3)4;/h(H,2,3,4);1H3 - (ChemSpider: | InChI=InChI=1/ClHO3.H3N/c2-1(3)4;/h(H,2,3,4);1H3 )

* SMILES: O=Cl(=O)O.N - (ChemSpider: | SMILES=O=Cl(=O)O.N )
Ammonium_cyanide (1338)
```
Botcommand: addindex 359540949 Ammonium_cyanide
```
```
For index : Ammonium_cyanide=359540949
```
* 12211-52-8 -> 12211-52-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Ammonium+cyanide not found on commonchemistry - Ammonium+cyanide

* No ChemSpiderID

* PubChem: 159440

* No InChI

* No SMILES
Ammonium_dinitramide (1341)

* No CASNo

* Ammonium+dinitramide not found on commonchemistry - Ammonium+dinitramide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Ammonium_diuranate (1342)
```
Botcommand: addindex 363197094 Ammonium_diuranate
```
```
For index : Ammonium_diuranate=363197094
```
* 7783-22-4 -> 7783-22-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Ammonium+diuranate not found on commonchemistry - Ammonium+diuranate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Ammonium_ferric_citrate (1343)
```
Botcommand: addindex 341588808 Ammonium_ferric_citrate
```
```
For index : Ammonium_ferric_citrate=341588808
```
* 1185-57-5 -> 1185-57-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Ammonium+ferric+citrate not found on commonchemistry - Ammonium+ferric+citrate

* No ChemSpiderID

* PubChem: 3080636

* No InChI

* No SMILES
Ammonium_fluorosilicate (1345)
```
Botcommand: addindex 351102030 Ammonium_fluorosilicate
```
```
For index : Ammonium_fluorosilicate=351102030
```
* 16919-19-0 -> 16919-19-0 - NOT VERIFIED

* CAS found on commonchemistry - 16919-19-0 - name in list
All names: AMMONIUM FLUOROSILICATE, Ammonium fluorosilicate ((NH4)2SiF6), Ammonium fluosilicate, ammonium hexafluorosilicate, Ammonium hexafluorosilicate ((NH4)2SiF6), Ammonium hexafluorosilicate (NH4SiF6), Ammonium silicofluoride, Ammonium silicon fluoride ((NH4)2SiF6), Ammoniumhexafluorosilicat, AMMONIUM-HEXAFLUOROSILICAT, Diammonium fluosilicate ((NH4)2SiF6), Diammonium hexafluorosilicate, Diammonium hexafluorosilicate ((NH4)2SiF6), Diammonium hexafluorosilicate(2-), Diammonium silicon hexafluoride, Hexafluorosilicate d'ammonium, hexafluorosilicato de amonio, LPE 6, NSC 310005, Silicate(2-), hexafluoro-, ammonium (1:2), Silicate(2-), hexafluoro-, diammonium, UN 2854

* Ammonium+fluorosilicate found on commonchemistry - Ammonium+fluorosilicate
* 16919-19-0 (exact match) Matches CAS (16919-19-0) on page
Name in list

All names: [[ammonium fluorosilicate]], [[ammonium fluorosilicate ((NH4)2SiF6)]], Ammonium fluosilicate, ammonium hexafluorosilicate, Ammonium hexafluorosilicate ((NH4)2SiF6), Ammonium hexafluorosilicate (NH4SiF6), Ammonium silicofluoride, Ammonium silicon fluoride ((NH4)2SiF6), Ammoniumhexafluorosilicat, AMMONIUM-HEXAFLUOROSILICAT, Diammonium fluosilicate ((NH4)2SiF6), Diammonium hexafluorosilicate, Diammonium hexafluorosilicate ((NH4)2SiF6), Diammonium hexafluorosilicate(2-), Diammonium silicon hexafluoride, Hexafluorosilicate d'ammonium, hexafluorosilicato de amonio, LPE 6, NSC 310005, Silicate(2-), hexafluoro-, ammonium (1:2), Silicate(2-), hexafluoro-, diammonium, UN 2854

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Ammonium_hexachloroplatinate (1348)
```
Botcommand: addindex 359946404 Ammonium_hexachloroplatinate
```
```
For index : Ammonium_hexachloroplatinate=359946404
```
* 16919-58-7 -> 16919-58-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Ammonium+hexachloroplatinate not found on commonchemistry - Ammonium+hexachloroplatinate

* ChemSpiderID: 10628022 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/6ClH.2H3N.Pt/h6*1H;2*1H3;/q;;;;;;;;+4/p-4/rCl6Pt.2H3N/c1-7(2,3,4,5)6;;/h;2*1H3/q-2;;/p+2 - (ChemSpider: | InChI=InChI=1/6ClH.2H3N.Pt/h6*1H;2*1H3;/q;;;;;;;;+4/p-4/rCl6Pt.2H3N/c1-7(2,3,4,5)6;;/h;2*1H3/q-2;;/p+2 )

* SMILES: [NH4+].[NH4+].Cl[Pt-2](Cl)(Cl)(Cl)(Cl)Cl - (ChemSpider: | SMILES=[NH4+].[NH4+].Cl[Pt-2](Cl)(Cl)(Cl)(Cl)Cl )
Ammonium_hexafluorophosphate (1349)
```
Botcommand: addindex 352540138 Ammonium_hexafluorophosphate
```
```
For index : Ammonium_hexafluorophosphate=352540138
```
* 16941-11-0 -> 16941-11-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Ammonium+hexafluorophosphate found on commonchemistry - Ammonium+hexafluorophosphate
* 3109-63-5 (exact match)
Name in list

All names: 1-Butanaminium, N,N,N-tributyl-, hexafluorophosphate(1-), 1-Butanaminium, N,N,N-tributyl-, hexafluorophosphate(1-) (1:1), Ammonium, tetrabutyl, hexafluorophosphate, Ammonium, tetrabutyl-, hexafluorophosphate(1-), hexafluorofosfato de tetrabutilamonio, hexafluorophosphate de tetrabutylammonium, [[tetrabutylammonium hexafluorophosphate]], [[Tetrabutylammonium hexafluorophosphate(1-)]], Tetrabutylammoniumhexafluorophosphat, [[Tetra-n-butylammonium hexafluorophosphate]]

* No ChemSpiderID

* PubChem: 9793912

* No InChI

* SMILES: [NH4+].F[P-](F)(F)(F)(F)F
Ammonium_hydrosulfide (1350)
```
Botcommand: addindex 360764043 Ammonium_hydrosulfide
```
```
For index : Ammonium_hydrosulfide=360764043
```
* 12124-99-1 -> 12124-99-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Ammonium+hydrosulfide not found on commonchemistry - Ammonium+hydrosulfide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES

1351 to 1400

Ammonium_iron(III)_sulfate (1354)
```
Botcommand: addindex 332699125 Ammonium_iron(III)_sulfate
```
```
For index : Ammonium_iron(III)_sulfate=332699125
```
* 10138-04-2 -> 10138-04-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Ammonium+iron+III+sulfate not found on commonchemistry - Ammonium+iron+III+sulfate

* ChemSpiderID: 55405 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/Fe.H3N.2H2O4S/c;;2*1-5(2,3)4/h;1H3;2*(H2,1,2,3,4)/q+3;;;/p-3 - (ChemSpider: | InChI=InChI=1/Fe.H3N.2H2O4S/c;;2*1-5(2,3)4/h;1H3;2*(H2,1,2,3,4)/q+3;;;/p-3 )

* SMILES: [Fe+3].[O-]S(=O)(=O)[O-].[O-]S([O-])(=O)=O.[NH4+] - (ChemSpider: | SMILES=[Fe+3].[O-]S(=O)(=O)[O-].[O-]S([O-])(=O)=O.[NH4+] )
Ammonium_lactate (1355)

* No CASNo

* Ammonium+lactate found on commonchemistry - Ammonium+lactate
* 20475-12-1 (exact match)
Name in list

All names: [[(.+-.)-2-Hydroxypropanoic acid compd. with 2,2',2-nitrilotris[ethanol] (1:1)]], [[2,2',2-Nitrilotris[ethanol] (.+-.)-2-hydroxypropanoate (salt)]], Lactate de tris(2-hydroxyethyl)ammonium, lactato de tris(2-hidroxietil)amonio, Lactic acid triethanolamine salt, Lactic acid, compd. with 2,2',2''-nitrilotriethanol (1:1), [[Propanoic acid, 2-hydroxy-, compd. with 2,2',2-nitrilotris[ethanol] (1:1)]], [[Propanoic acid, 2-hydroxy-, compd. with 2,2',2-nitrolotris [ethanol] (1:1)]], [[Propanoic acid, 2-hydroxy-, compound with 2,2',2-nitrilotris[ethanol] (1:1)]], Triethanolamine lactate, [[Triethanolammonium lactate]], [[tris(2-hydroxyethyl)ammonium lactate]], Tris(2-hydroxyethyl)ammoniumlactat

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: CC(C(=O)[O-])O.[NH4+]
Ammonium_nitrite (1359)
```
Botcommand: addindex 364795862 Ammonium_nitrite
```
```
For index : Ammonium_nitrite=364795862
```
* 13446-48-5 -> 13446-48-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Ammonium+nitrite not found on commonchemistry - Ammonium+nitrite

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Ammonium_paratungstate (1360)
```
Botcommand: addindex 333107425 Ammonium_paratungstate
```
```
For index : Ammonium_paratungstate=333107425
```
* 11120-25-5 -> 11120-25-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Ammonium+paratungstate not found on commonchemistry - Ammonium+paratungstate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Ammonium_permanganate (1362)
```
Botcommand: addindex 364880835 Ammonium_permanganate
```
```
For index : Ammonium_permanganate=364880835
```
* 13446-10-1 -> 13446-10-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Ammonium+permanganate not found on commonchemistry - Ammonium+permanganate

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: O- [Mn](=O)(=O)=O.N+
Ammonium_perrhenate (1363)
```
Botcommand: addindex 284089101 Ammonium_perrhenate
```
```
For index : Ammonium_perrhenate=284089101
```
* 13598-65-7 -> 13598-65-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Ammonium+perrhenate not found on commonchemistry - Ammonium+perrhenate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Ammonium_tetrathiomolybdate (1369)
```
Botcommand: addindex 355623713 Ammonium_tetrathiomolybdate
```
```
For index : Ammonium_tetrathiomolybdate=355623713
```
* 15060-55-6 -> 15060-55-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Ammonium+tetrathiomolybdate not found on commonchemistry - Ammonium+tetrathiomolybdate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Ammonium_thioglycolate (1371)
```
Botcommand: addindex 281817593 Ammonium_thioglycolate
```
```
For index : Ammonium_thioglycolate=281817593
```
* 5421-46-5 -> 5421-46-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Ammonium+thioglycolate not found on commonchemistry - Ammonium+thioglycolate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Ammonium_triiodide (1372)

* No CASNo

* Ammonium+triiodide not found on commonchemistry - Ammonium+triiodide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Ammonium_uranyl_carbonate (1373)
* No CASNo

* Ammonium+uranyl+carbonate not found on commonchemistry - Ammonium+uranyl+carbonate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Amonafide (1376)
```
Botcommand: addindex 352966099 Amonafide
```
```
For index : Amonafide=352966099
```
* 69408-81-7 -> 69408-81-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Amonafide not found on commonchemistry - Amonafide

* No ChemSpiderID

* PubChem: 50515

* No InChI

* No SMILES
Amorolfine (1377)
```
Botcommand: addindex 364382766 Amorolfine
```
```
For index : Amorolfine=364382766
```
* 78613-35-1 -> 78613-35-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Amorolfine not found on commonchemistry - Amorolfine

* ChemSpiderID: 49010 (correct: 49010) - CORRECT - Retrieved data from ChemSpider

* PubChem: 54260

* No InChI - (ChemSpider: | InChI=InChI=1/C21H35NO/c1-7-21(5,6)20-10-8-19(9-11-20)12-16(2)13-22-14-17(3)23-18(4)15-22/h8-11,16-18H,7,12-15H2,1-6H3/t16?,17-,18+ )

* No SMILES - (ChemSpider: | smiles=O2[C@@H](CN(CC(C)Cc1ccc(cc1)C(C)(C)CC)C[C@@H]2C)C )
Amorpha-4,11-diene (1378)
```
Botcommand: addindex 355636653 Amorpha-4,11-diene
```
```
For index : Amorpha-4,11-diene=355636653
```
* 92692-39-2 -> 92692-39-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Amorpha+diene not found on commonchemistry - Amorpha+diene

* No ChemSpiderID

* PubChem: 11052747

* No InChI

* SMILES: C[C@@H]1CC[C@H]([C@@H]2[C@H]1CCC(=C2)C)C(=C)C
Amoscanate (1379)
```
Botcommand: addindex 290079650 Amoscanate
```
```
For index : Amoscanate=290079650
```
* 26328-53-0 -> 26328-53-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Amoscanate not found on commonchemistry - Amoscanate

* No ChemSpiderID

* PubChem: 33488

* InChI: InChI=1/C13H9N3O2S/c17-16(18)13-7-5-12(6-8-13)15-11-3-1-10(2-4-11)14-9-19/h1-8,15H

* SMILES: O=N(=O)c1ccc(Nc2ccc(cc2)N=C=S)cc1
Amosulalol (1380)
```
Botcommand: addindex 351659060 Amosulalol
```
```
For index : Amosulalol=351659060
```
* 85320-68-9 -> 85320-68-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Amosulalol not found on commonchemistry - Amosulalol

* No ChemSpiderID

* PubChem: 2169

* No InChI

* No SMILES
Ampelopsin (1383)
```
Botcommand: addindex 358164820 Ampelopsin
```
```
For index : Ampelopsin=358164820
```
* 27200-12-0 -> 27200-12-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Ampelopsin not found on commonchemistry - Ampelopsin

* ChemSpiderID: 16735660 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 161557

* InChI: 1/C15H12O8/c16-6-3-7(17)11-10(4-6)23-15(14(22)13(11)21)5-1-8(18)12(20)9(19)2-5/h1-4,14-20,22H/t14-,15+/m1/s1 - (ChemSpider: | InChI=InChI=1/C15H12O8/c16-6-3-7(17)11-10(4-6)23-15(14(22)13(11)21)5-1-8(18)12(20)9(19)2-5/h1-4,14-20,22H/t14-,15+/m1/s1 )

* SMILES: Oc1cc(cc(O)c1O)[C@@H]3Oc2cc(O)cc(O)c2C(=O)[C@H]3O - (ChemSpider: | SMILES=Oc1cc(cc(O)c1O)[C@@H]3Oc2cc(O)cc(O)c2C(=O)[C@H]3O )
Amperozide (1384)
```
Botcommand: addindex 353505566 Amperozide
```
```
For index : Amperozide=353505566
```
* 75558-90-6 -> 75558-90-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Amperozide not found on commonchemistry - Amperozide

* No ChemSpiderID

* PubChem: 73333

* No InChI

* No SMILES
Amphetaminil (1386)
```
Botcommand: addindex 358816502 Amphetaminil
```
```
For index : Amphetaminil=358816502
```
* 17590-01-1 -> 17590-01-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Amphetaminil not found on commonchemistry - Amphetaminil

* ChemSpiderID: 26613 (correct: 26613) - CORRECT - Retrieved data from ChemSpider

* PubChem: 28615

* No InChI - (ChemSpider: | InChI=InChI=1/C17H18N2/c1-14(12-15-8-4-2-5-9-15)19-17(13-18)16-10-6-3-7-11-16/h2-11,14,17,19H,12H2,1H3 )

* No SMILES - (ChemSpider: | smiles=N#CC(NC(C)Cc1ccccc1)c2ccccc2 )
Amphotericin_B (1387)
```
Botcommand: addindex 364700465 Amphotericin_B
```
```
For index : Amphotericin_B=364700465
```
* 1397-89-3 -> 1397-89-3 - NOT VERIFIED

* CAS found on commonchemistry - 1397-89-3 - name in list
All names: [[(1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,19E,21E,23E,25E,27E,29E,31E,33R,35S,36R,37S)-33-[(3-Amino-3,6-dideoxy-Î²-D-mannopyranosyl)oxy]-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylic acid]], [[14,39-Dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylic acid, 33-[(3-amino-3,6-dideoxy-Î²-D-mannopyranosyl)oxy]-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-, (1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,19E,21E,23E,25E,27E,29E,31E,33R,35S,36R,37S)-]], Abelcet, Abelecet, AmBisome, amfotericina B, Amphocin, Ampho-Moronal, amphotericin B, amphotericine B, Amphozone, Apothecon, Fungilin, Fungizona, Fungizone, Halizon, LNS-AmB, NS 718, NSC 527017

* Amphotericin+B found on commonchemistry - Amphotericin+B
* 1397-89-3 (exact match) Matches CAS (1397-89-3) on page
Name in list

All names: [[(1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,19E,21E,23E,25E,27E,29E,31E,33R,35S,36R,37S)-33-[(3-Amino-3,6-dideoxy-Î²-D-mannopyranosyl)oxy]-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylic acid]], [[14,39-Dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylic acid, 33-[(3-amino-3,6-dideoxy-Î²-D-mannopyranosyl)oxy]-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-, (1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,19E,21E,23E,25E,27E,29E,31E,33R,35S,36R,37S)-]], Abelcet, Abelecet, AmBisome, amfotericina B, Amphocin, Ampho-Moronal, [[amphotericin b]], amphotericine B, Amphozone, Apothecon, Fungilin, Fungizona, Fungizone, Halizon, LNS-AmB, NS 718, NSC 527017

* ChemSpiderID: 10237579 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 14956

* No InChI - (ChemSpider: | InChI=InChI=1/C47H73NO17/c1-27-17-15-13-11-9-7-5-6-8-10-12-14-16-18-34(64-46-44(58)41(48)43(57)30(4)63-46)24-38-40(45(59)60)37(54)26-47(61,65-38)25-33(51)22-36(53)35(52)20-19-31(49)21-32(50)23-39(55)62-29(3)28(2)42(27)56/h5-18,27-38,40-44,46,49-54,56-58,61H,19-26,48H2,1-4H3,(H,59,60)/b6-5+,9-7+,10-8+,13-11+,14-12+,17-15+,18-16+/t27-,28-,29-,30+,31+,32+,33-,34-,35+,36+,37-,38-,40+,41-,42+,43+,44-,46-,47+/m0/s1 )

* No SMILES
Ampicillin/sulbactam (1389)
* No CASNo

* Ampicillin+sulbactam not found on commonchemistry - Ampicillin+sulbactam

* No ChemSpiderID (correct: 10482157)

* PubChem: 656676

* No InChI

* No SMILES
Ampiroxicam (1390)
```
Botcommand: addindex 346847753 Ampiroxicam
```
```
For index : Ampiroxicam=346847753
```
* 99464-64-9 -> 99464-64-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Ampiroxicam not found on commonchemistry - Ampiroxicam

* No ChemSpiderID

* PubChem: 2176

* No InChI

* No SMILES
Ampligen (1391)
```
Botcommand: addindex 361019916 Ampligen
```
```
For index : Ampligen=361019916
```
* 38640-92-5 -> 38640-92-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Ampligen not found on commonchemistry - Ampligen

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Amprolium (1393)
```
Botcommand: addindex 361243319 Amprolium
```
```
For index : Amprolium=361243319
```
* 137-88-2 -> 137-88-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Amprolium not found on commonchemistry - Amprolium

* ChemSpiderID: 66070 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 2178

* InChI: 1/C14H19N4.ClH/c1-3-6-13-16-9-12(14(15)17-13)10-18-8-5-4-7-11(18)2;/h4-5,7-9H,3,6,10H2,1-2H3,(H2,15,16,17);1H/q+1;/p-1 - (ChemSpider: | InChI=InChI=1/C14H19N4.ClH/c1-3-6-13-16-9-12(14(15)17-13)10-18-8-5-4-7-11(18)2;/h4-5,7-9H,3,6,10H2,1-2H3,(H2,15,16,17);1H/q+1;/p-1 )

* SMILES: [Cl-].n1c(c(cnc1CCC)C[n+]2ccccc2C)N - (ChemSpider: | SMILES=[Cl-].n1c(c(cnc1CCC)C[n+]2ccccc2C)N )
Ampyzine (1395)
```
Botcommand: addindex 359240765 Ampyzine
```
```
For index : Ampyzine=359240765
```
* 5214-29-9 -> 5214-29-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Ampyzine not found on commonchemistry - Ampyzine

* ChemSpiderID: 21955 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 21275

* No InChI - (ChemSpider: | InChI=InChI=1/C6H9N3/c1-9(2)6-5-7-3-4-8-6/h3-5H,1-2H3 )

* No SMILES - (ChemSpider: | smiles=n1ccnc(N(C)C)c1 )
Amrubicin (1397)
```
Botcommand: addindex 355097501 Amrubicin
```
```
For index : Amrubicin=355097501
```
* 110267-81-7 -> 110267-81-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Amrubicin not found on commonchemistry - Amrubicin

* ChemSpiderID: 2299344 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 178149

* No InChI - (ChemSpider: | InChI=InChI=1/C25H25NO9/c1-10(27)25(26)7-13-18(16(8-25)35-17-6-14(28)15(29)9-34-17)24(33)20-19(23(13)32)21(30)11-4-2-3-5-12(11)22(20)31/h2-5,14-17,28-29,32-33H,6-9,26H2,1H3/t14-,15+,16-,17-,25-/m0/s1 )

* No SMILES - (ChemSpider: | smiles=O=C2c1c(O)c5c(c(O)c1C(=O)c3ccccc23)C[C@](C(=O)C)(N)C[C@@H]5O[C@@H]4OC[C@@H](O)[C@@H](O)C4 )
Amthamine (1399)
```
Botcommand: addindex 327755781 Amthamine
```
```
For index : Amthamine=327755781
```
* 142437-67-0 -> 142437-67-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Amthamine not found on commonchemistry - Amthamine

* No ChemSpiderID

* PubChem: 126688

* No InChI

* SMILES: CC1=C(SC(=N1)N)CCN
Amtolmetin_guacil (1400)
```
Botcommand: addindex 292702530 Amtolmetin_guacil
```
```
For index : Amtolmetin_guacil=292702530
```
* 87344-06-7 -> 87344-06-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Amtolmetin+guacil not found on commonchemistry - Amtolmetin+guacil

* No ChemSpiderID

* PubChem: 65655

* No InChI

* No SMILES

1401 to 1450

Amurensin (1401)
```
Botcommand: addindex 350684665 Amurensin
```
```
For index : Amurensin=350684665
```
* 641-94-1 -> 641-94-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Amurensin not found on commonchemistry - Amurensin

* No ChemSpiderID

* PubChem: 5318156

* No InChI

* SMILES: CC(C)(CCC1=C(C=C(C2=C1OC(=C(C2=O)O)C3=CC=C(C=C3)O)O)OC4C(C(C(C(O4)CO)O)O)O)O<br>CC(C)(CCC1=C(C=C(C2=C1OC(=C(C2=O)O)C3=CC=C(C=C3)O)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O
Amygdalin (1402)
```
Botcommand: addindex 364367372 Amygdalin
```
```
For index : Amygdalin=364367372
```
* 29883-15-6 -> 29883-15-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Amygdalin not found on commonchemistry - Amygdalin

* No ChemSpiderID

* PubChem: 34751

* No InChI

* SMILES: O[C@@H]3[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]3OC[C@H]2O[C@@H](OC(C#N)c1ccccc1)[C@H](O)[C@@H](O)[C@@H]2O
Amyl_nitrate (1404)
```
Botcommand: addindex 360221600 Amyl_nitrate
```
```
For index : Amyl_nitrate=360221600
```
* 1002-16-0 -> 1002-16-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Amyl+nitrate not found on commonchemistry - Amyl+nitrate

* ChemSpiderID: 55191 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/C5H11NO3/c1-2-3-4-5-9-6(7)8/h2-5H2,1H3 - (ChemSpider: | InChI=InChI=1/C5H11NO3/c1-2-3-4-5-9-6(7)8/h2-5H2,1H3 )

* SMILES: [O-][N+](=O)OCCCCC - (ChemSpider: | SMILES=[O-][N+](=O)OCCCCC )
Amylocaine (1406)
```
Botcommand: addindex 355916568 Amylocaine
```
```
For index : Amylocaine=355916568
```
* 644-26-8 -> 644-26-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Amylocaine not found on commonchemistry - Amylocaine

* ChemSpiderID: 10312 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 10767

* InChI: 1/C14H21NO2/c1-5-14(2,11-15(3)4)17-13(16)12-9-7-6-8-10-12/h6-10H,5,11H2,1-4H3 - (ChemSpider: | InChI=InChI=1/C14H21NO2/c1-5-14(2,11-15(3)4)17-13(16)12-9-7-6-8-10-12/h6-10H,5,11H2,1-4H3 )

* SMILES: O=C(OC(C)(CC)CN(C)C)c1ccccc1 - (ChemSpider: | SMILES=O=C(OC(C)(CC)CN(C)C)c1ccccc1 )
Amylopectin (1407)
```
Botcommand: addindex 363059865 Amylopectin
```
```
For index : Amylopectin=363059865
```
* 9037-22-3 -> 9037-22-3 - NOT VERIFIED

* CAS found on commonchemistry - 9037-22-3 - name in list
All names: Amaizo 839, amilopectina, Amioca, Amioca Powder T, Amioca WCS, Amylopectin, Amylopectine, Amylopektin, C*Gel 04201, C*Pharm 12018, Cato 225, Cato 240, Cato 270, Cerestar SF 04201, Farinex WM 55, Farinex WM 85, Honen Alpha Waxy Starch, ICB 3100, Kosol, Matsunorin A, Matsunorin N, Meritena 300, Novation 2600, Pectin, amylo, Pregeflo C 100, Remyflo S 200, Starch, waxy, Ultraamylopectin N, Ultrasperse A, Waxilys, Waxilys 100, Waxilys 200, Waxy 7350, Waxy Alpha Y, Waxy corn starch, Waxy maize starch, Waxy starch, WCS

* Amylopectin found on commonchemistry - Amylopectin
* 9037-22-3 (Formula: Unspecified; Name: Amylopectin) Matches CAS (9037-22-3) on page

* 9005-25-8 (Formula: W99; Name: Starch)

* 9035-74-9 (Formula: Unspecified; Name: Phosphorylase, glycogen)

* 9075-68-7 (Formula: Unspecified; Name: Pullulanase)

* 113894-92-1 (Formula: C3H8O2.xH3O4P.xUnspecified; Name: Amylopectin, phosphate, 2-hydroxypropyl ether)

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Amylose (1408)
```
Botcommand: addindex 364115009 Amylose
```
```
For index : Amylose=364115009
```
* 9005-82-7 -> 9005-82-7 - NOT VERIFIED

* CAS found on commonchemistry - 9005-82-7 - name in list
All names: amilosa, Amylose, Amylose EX 1, AS 10, AS 110, AS 30, AS 30 (carbohydrate), AS 320, AS 5, AS 70, EX-I, Polyamylose, San Super 240L, V Amylose, Î±-Amylose

* Amylose found on commonchemistry - Amylose
* 9005-82-7 (Formula: Unspecified; Name: Amylose) Matches CAS (9005-82-7) on page

* 7585-39-9 (Formula: C42H70O35; Name: Î²-Cyclodextrin)

* 9004-34-6 (Formula: W99; Name: Cellulose)

* 9005-25-8 (Formula: W99; Name: Starch)

* 10016-20-3 (Formula: C36H60O30; Name: Î±-Cyclodextrin)

* 12619-70-4 (Formula: W99; Name: Cyclodextrin)

* 17465-86-0 (Formula: C48H80O40; Name: Î³-Cyclodextrin)

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Anabasine (1409)
```
Botcommand: addindex 345131597 Anabasine
```
```
For index : Anabasine=345131597
```
* 40774-73-0 -> 40774-73-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Anabasine found on commonchemistry - Anabasine
* 494-52-0 (exact match)
Name in list

All names: (-)-2-(3'-Pyridyl)piperidine, [[(-)-anabasine]], (2S)-2-(Pyridin-3-yl)piperidine, [[(S)-(-)-anabasine]], [[(S)-anabasine]], Anabasin, anabasina, [[anabasine]], Neonicotine, Neonikotin, NSC 87504, Pyridine, 3-(2-piperidinyl)-, (S)-, Pyridine, 3-(2S)-2-piperidinyl-, [[Pyridine, 3-[(2S)-2-piperidinyl]-]]

* ChemSpiderID: 21106257 (correct: 21106257) - CORRECT - Retrieved data from ChemSpider

* No PubChem

* No InChI - (ChemSpider: | InChI=InChI=1/C10H14N2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h3-4,6,8,10,12H,1-2,5,7H2 )

* No SMILES - (ChemSpider: | smiles=n1cc(ccc1)C2CCCCN2 )
Anacardic_acid (1410)
```
Botcommand: addindex 362149795 Anacardic_acid
```
```
For index : Anacardic_acid=362149795
```
* 11034-77-8 -> 11034-77-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Anacardic+acid not found on commonchemistry - Anacardic+acid

* No ChemSpiderID

* PubChem: 9875131

* No InChI

* SMILES: C=CCC=CCC=CCCCCCCCC1=C(C(=CC=C1)O)C(=O)O
Anacetrapib (1411)
```
Botcommand: addindex 346750769 Anacetrapib
```
```
For index : Anacetrapib=346750769
```
* 875446-37-0 -> 875446-37-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Anacetrapib not found on commonchemistry - Anacetrapib

* ChemSpiderID: 9731205 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 11556427

* InChI: 1/C30H25F10NO3/c1-14(2)22-11-23(25(43-4)12-24(22)31)21-6-5-18(28(32,33)34)9-17(21)13-41-15(3)26(44-27(41)42)16-7-19(29(35,36)37)10-20(8-16)30(38,39)40/h5-12,14-15,26H,13H2,1-4H3/t15-,26-/m0/s1 - (ChemSpider: | InChI=InChI=1/C30H25F10NO3/c1-14(2)22-11-23(25(43-4)12-24(22)31)21-6-5-18(28(32,33)34)9-17(21)13-41-15(3)26(44-27(41)42)16-7-19(29(35,36)37)10-20(8-16)30(38,39)40/h5-12,14-15,26H,13H2,1-4H3/t15-,26-/m0/s1 )

* SMILES: O=C2O[C@H](c1cc(cc(c1)C(F)(F)F)C(F)(F)F)[C@@H](N2Cc4c(c3cc(c(F)cc3OC)C(C)C)ccc(c4)C(F)(F)F)C - (ChemSpider: | SMILES=O=C2O[C@H](c1cc(cc(c1)C(F)(F)F)C(F)(F)F)[C@@H](N2Cc4c(c3cc(c(F)cc3OC)C(C)C)ccc(c4)C(F)(F)F)C )
Anakinra (1413)
```
Botcommand: addindex 360547431 Anakinra
```
```
For index : Anakinra=360547431
```
* 143090-92-0 -> 143090-92-0 - NOT VERIFIED

* CAS found on commonchemistry - 143090-92-0 - name not in list
All names: Interleukin 1 receptor antagonist, (human isoform x reduced), N2-L-methionyl-

* Anakinra not found on commonchemistry - Anakinra

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Anandamide (1414)
```
Botcommand: addindex 364641681 Anandamide
```
```
For index : Anandamide=364641681
```
* 94421-68-8 -> 94421-68-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Anandamide not found on commonchemistry - Anandamide

* ChemSpiderID: 4445241 (correct: 4445241) - CORRECT - Retrieved data from ChemSpider

* PubChem: 5281969

* InChI: 1/C22H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(25)23-20-21-24/h6-7,9-10,12-13,15-16,24H,2-5,8,11,14,17-21H2,1H3,(H,23,25)/b7-6-,10-9-,13-12-,16-15- - (ChemSpider: | InChI=InChI=1/C22H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(25)23-20-21-24/h6-7,9-10,12-13,15-16,24H,2-5,8,11,14,17-21H2,1H3,(H,23,25)/b7-6-,10-9-,13-12-,16-15- )

* SMILES: O=C(NCCO)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC - (ChemSpider: | SMILES=O=C(NCCO)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC )
Anatoxin-a (1416)
```
Botcommand: addindex 338684146 Anatoxin-a
```
```
For index : Anatoxin-a=338684146
```
* 64285-06-9 -> 64285-06-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Anatoxin+a not found on commonchemistry - Anatoxin+a

* No ChemSpiderID

* PubChem: 3034748

* No InChI

* SMILES: CC(=O)C1=CCCC2CCC1N2
Anatumomab_mafenatox (1417)
* No CASNo

* Anatumomab+mafenatox not found on commonchemistry - Anatumomab+mafenatox

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Ancarolol (1418)
```
Botcommand: addindex 350937086 Ancarolol
```
```
For index : Ancarolol=350937086
```
* 75748-50-4 -> 75748-50-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Ancarolol not found on commonchemistry - Ancarolol

* ChemSpiderID: 148938 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 170339

* No InChI - (ChemSpider: | InChI=InChI=1/C18H24N2O4/c1-18(2,3)19-11-13(21)12-24-15-8-5-4-7-14(15)20-17(22)16-9-6-10-23-16/h4-10,13,19,21H,11-12H2,1-3H3,(H,20,22) )

* No SMILES - (ChemSpider: | smiles=O=C(Nc1ccccc1OCC(O)CNC(C)(C)C)c2occc2 )
Ancestim (1419)
* No CASNo

* Ancestim not found on commonchemistry - Ancestim

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Ancrod (1420)
* No CASNo

* Ancrod not found on commonchemistry - Ancrod

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Andarine (1421)
* No CASNo

* Andarine not found on commonchemistry - Andarine

* No ChemSpiderID

* PubChem: 10201099

* No InChI

* No SMILES
Androisoxazole (1423)
```
Botcommand: addindex 356724632 Androisoxazole
```
```
For index : Androisoxazole=356724632
```
* 360-66-7 -> 360-66-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Androisoxazole not found on commonchemistry - Androisoxazole

* ChemSpiderID: 9295 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 9676

* InChI: 1/C21H31NO2/c1-19-11-13-12-24-22-18(13)10-14(19)4-5-15-16(19)6-8-20(2)17(15)7-9-21(20,3)23/h12,14-17,23H,4-11H2,1-3H3/t14-,15+,16-,17-,19-,20-,21-/m0/s1 - (ChemSpider: | InChI=InChI=1/C21H31NO2/c1-19-11-13-12-24-22-18(13)10-14(19)4-5-15-16(19)6-8-20(2)17(15)7-9-21(20,3)23/h12,14-17,23H,4-11H2,1-3H3/t14-,15+,16-,17-,19-,20-,21-/m0/s1 )

* SMILES: O[C@@]5(C)CC[C@H]4[C@H]3[C@@H]([C@]2(Cc1c(noc1)C[C@@H]2CC3)C)CC[C@@]45C - (ChemSpider: | SMILES=O[C@@]5(C)CC[C@H]4[C@H]3[C@@H]([C@]2(Cc1c(noc1)C[C@@H]2CC3)C)CC[C@@]45C )
Androstadienone (1424)
```
Botcommand: addindex 355652494 Androstadienone
```
```
For index : Androstadienone=355652494
```
* 4075-07-4 -> 4075-07-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Androstadienone not found on commonchemistry - Androstadienone

* No ChemSpiderID

* PubChem: 92979

* No InChI

* No SMILES
Androstane (1425)
```
Botcommand: addindex 360096070 Androstane
```
```
For index : Androstane=360096070
```
* 24887-75-0 -> 24887-75-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Androstane found on commonchemistry - Androstane
* 53-41-8 (Formula: C19H30O2; Name: Androstan-17-one, 3-hydroxy-, (3Î±,5Î±)-)

* 481-29-8 (Formula: C19H30O2; Name: Androstan-17-one, 3-hydroxy-, (3Î²,5Î±)-)

* 521-18-6 (Formula: C19H30O2; Name: Androstan-3-one, 17-hydroxy-, (5Î±,17Î²)-)

* 571-20-0 (Formula: C19H32O2; Name: Androstane-3,17-diol, (3Î²,5Î±,17Î²)-)

* 846-46-8 (Formula: C19H28O2; Name: Androstane-3,17-dione, (5Î±)-)

* 1852-53-5 (Formula: C19H32O2; Name: Androstane-3,17-diol, (3Î±,5Î±,17Î²)-)

* 15500-66-0 (Formula: C35H60N2O4.2Br; Name: Piperidinium, 1,1'-[(2Î²,3Î±,5Î±,16Î²,17Î²)-3,17-bis(acetyloxy)androstane-2,16-diyl]bis[1-methyl-, dibromide)

* 68399-58-6 (Formula: C35H62N4O4; Name: Piperazinium, 4,4'-[(2Î²,3Î±,5Î±,16Î²,17Î²)-3,17-bis(acetyloxy)androstane-2,16-diyl]bis[1,1-dimethyl-)

* No ChemSpiderID

* PubChem: 94144

* No InChI

* SMILES: C[C@@]12[C@](CCC2)([H])[C@]3([H])CCC4([H])CCCC[C@]4(C)[C@@]3([H])CC1
Androstenol (1427)
```
Botcommand: addindex 357499851 Androstenol
```
```
For index : Androstenol=357499851
```
* 1153-51-1 -> 1153-51-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Androstenol found on commonchemistry - Androstenol
* 53-43-0 (Formula: C19H28O2; Name: Androst-5-en-17-one, 3-hydroxy-, (3Î²)-)

* 72-63-9 (Formula: C20H28O2; Name: Androsta-1,4-dien-3-one, 17-hydroxy-17-methyl-, (17Î²)-)

* 434-22-0 (Formula: C18H26O2; Name: Estr-4-en-3-one, 17-hydroxy-, (17Î²)-)

* No ChemSpiderID

* PubChem: 101989

* No InChI

* No SMILES
Androstenone (1428)
```
Botcommand: addindex 353459427 Androstenone
```
```
For index : Androstenone=353459427
```
* 18339-16-7 -> 18339-16-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Androstenone not found on commonchemistry - Androstenone

* ChemSpiderID: 5254715 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 6852393

* InChI: 1/C19H28O/c1-18-9-3-4-16(18)15-6-5-13-12-14(20)7-11-19(13,2)17(15)8-10-18/h3,9,13,15-17H,4-8,10-12H2,1-2H3/t13-,15-,16-,17-,18-,19-/m0/s1 - (ChemSpider: | InChI=InChI=1/C19H28O/c1-18-9-3-4-16(18)15-6-5-13-12-14(20)7-11-19(13,2)17(15)8-10-18/h3,9,13,15-17H,4-8,10-12H2,1-2H3/t13-,15-,16-,17-,18-,19-/m0/s1 )

* SMILES: O=C4C[C@@H]3CC[C@@H]2[C@H](CC[C@@]1(/C=C\C[C@H]12)C)[C@@]3(C)CC4 - (ChemSpider: | SMILES=O=C4C[C@@H]3CC[C@@H]2[C@H](CC[C@@]1(/C=C\C[C@H]12)C)[C@@]3(C)CC4 )
Anecortave (1430)
```
Botcommand: addindex 361230271 Anecortave
```
```
For index : Anecortave=361230271
```
* 7753-60-8 -> 7753-60-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Anecortave not found on commonchemistry - Anecortave

* ChemSpiderID: 99892 (correct: 99892) - CORRECT - Retrieved data from ChemSpider

* PubChem: 111332

* No InChI - (ChemSpider: | InChI=InChI=1/C23H30O5/c1-14(24)28-13-20(26)23(27)11-8-19-17-5-4-15-12-16(25)6-9-21(15,2)18(17)7-10-22(19,23)3/h7,12,17,19,27H,4-6,8-11,13H2,1-3H3/t17-,19+,21+,22+,23+/m1/s1 )

* No SMILES - (ChemSpider: | smiles=O=C(OCC(=O)[C@@]1(O)CC[C@H]2[C@H]4/C(=C\C[C@]12C)[C@@]3(/C(=C\C(=O)CC3)CC4)C)C )
Anethole_trithione (1432)
```
Botcommand: addindex 343003476 Anethole_trithione
```
```
For index : Anethole_trithione=343003476
```
* 532-11-6 -> 532-11-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Anethole+trithione not found on commonchemistry - Anethole+trithione

* No ChemSpiderID

* PubChem: 2194

* No InChI

* No SMILES
Angelic_acid (1433)
```
Botcommand: addindex 360913947 Angelic_acid
```
```
For index : Angelic_acid=360913947
```
* 565-63-9 -> 565-63-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Angelic+acid not found on commonchemistry - Angelic+acid

* No ChemSpiderID

* PubChem: 643915

* No InChI

* SMILES: C/C=C(C)\C(O)=O
Anidulafungin (1435)
```
Botcommand: addindex 344907318 Anidulafungin
```
```
For index : Anidulafungin=344907318
```
* 166663-25-8 -> 166663-25-8 - NOT VERIFIED

* CAS found on commonchemistry - 166663-25-8 - name in list
All names: Anidulafungin, [[Echinocandin B, 1-[(4R,5R)-4,5-dihydroxy-N2-[[4-(pentyloxy)[1,1':4',1-terphenyl]-4-yl]carbonyl]-L-ornithine]-]], Eraxis, LY 303366

* Anidulafungin found on commonchemistry - Anidulafungin
* 166663-25-8 (exact match) Matches CAS (166663-25-8) on page
Name in list

All names: [[anidulafungin]], [[Echinocandin B, 1-[(4R,5R)-4,5-dihydroxy-N2-[[4-(pentyloxy)[1,1':4',1-terphenyl]-4-yl]carbonyl]-L-ornithine]-]], Eraxis, LY 303366

* No ChemSpiderID (correct: 21106258)

* PubChem: 166548

* No InChI

* No SMILES
Anilazine (1436)

* No CASNo

* Anilazine found on commonchemistry - Anilazine
* 101-05-3 (exact match)
Name in list

All names: 1,3,5-Triazin-2-amine, 4,6-dichloro-N-(2-chlorophenyl)-, 2-(2'-Chloroanilino)-4,6-dichloro-s-triazine, 2-(2-Chloroanilino)-4,6-dichloro-s-triazine, 2-(o-Chloroanilino)-4,6-dichloro-1,3,5-triazine, 2,4-Dichloro-6-(2-chloranilino)-s-triazine, 2,4-Dichloro-6-(2-chloroanilino)-1,3,5-triazine, 2,4-Dichloro-6-(o-chloroanilino)-1,3,5-triazine, 2,4-Dichloro-6-(o-chloroanilino)-s-triazine, 2,4-Dichloro-6-(o-chlorophenyl)amino-s-triazine, 2,4-Dichloro-6-o-chloranilino-s-triazine, Anilazin, Anilazin, anilazina, [[anilazine]], Aniyaline, B 622, Bortrysan, Dyrene, Dyrene 50W, Dyrene Flussig, Kemate, NSC 3851, Pesticide, triazine, s-Triazine, 2,4-dichloro-6-(o-chloroanilino)-, Triazin, TRIAZINE, Triazine (pesticide), UN 2763, Zinochlor

* ChemSpiderID: 7260 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/C9H5Cl3N4/c10-5-3-1-2-4-6(5)13-9-15-7(11)14-8(12)16-9/h1-4H,(H,13,14,15,16) - (ChemSpider: | InChI=InChI=1/C9H5Cl3N4/c10-5-3-1-2-4-6(5)13-9-15-7(11)14-8(12)16-9/h1-4H,(H,13,14,15,16) )

* SMILES: Clc1nc(nc(Cl)n1)Nc2ccccc2Cl - (ChemSpider: | SMILES=Clc1nc(nc(Cl)n1)Nc2ccccc2Cl )
Anipamil (1441)
```
Botcommand: addindex 346449025 Anipamil
```
```
For index : Anipamil=346449025
```
* 83200-10-6 -> 83200-10-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Anipamil not found on commonchemistry - Anipamil

* ChemSpiderID: 49636 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 54966

* InChI: 1/C34H52N2O2/c1-5-6-7-8-9-10-11-12-13-14-23-34(29-35,31-19-16-21-33(28-31)38-4)24-17-25-36(2)26-22-30-18-15-20-32(27-30)37-3/h15-16,18-21,27-28H,5-14,17,22-26H2,1-4H3 - (ChemSpider: | InChI=InChI=1/C34H52N2O2/c1-5-6-7-8-9-10-11-12-13-14-23-34(29-35,31-19-16-21-33(28-31)38-4)24-17-25-36(2)26-22-30-18-15-20-32(27-30)37-3/h15-16,18-21,27-28H,5-14,17,22-26H2,1-4H3 )

* SMILES: N#CC(c1cc(OC)ccc1)(CCCCCCCCCCCC)CCCN(CCc2cccc(OC)c2)C - (ChemSpider: | SMILES=N#CC(c1cc(OC)ccc1)(CCCCCCCCCCCC)CCCN(CCc2cccc(OC)c2)C )
Aniracetam (1442)
```
Botcommand: addindex 354779750 Aniracetam
```
```
For index : Aniracetam=354779750
```
* 72432-10-1 -> 72432-10-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Aniracetam not found on commonchemistry - Aniracetam

* ChemSpiderID: 2111 (correct: 2111) - CORRECT - Retrieved data from ChemSpider

* PubChem: 2196

* No InChI - (ChemSpider: | InChI=InChI=1/C12H13NO3/c1-16-10-6-4-9(5-7-10)12(15)13-8-2-3-11(13)14/h4-7H,2-3,8H2,1H3 )

* No SMILES - (ChemSpider: | smiles=O=C2N(C(=O)c1ccc(OC)cc1)CCC2 )
Anisatin (1444)
```
Botcommand: addindex 354913732 Anisatin
```
```
For index : Anisatin=354913732
```
* 5230-87-5 -> 5230-87-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Anisatin not found on commonchemistry - Anisatin

* No ChemSpiderID

* PubChem: 115121

* No InChI

* SMILES: C[C@@H]1C[C@H]([C@]2([C@@]13C[C@H]([C@]([C@@]24COC4=O)(C)O)OC(=O)[C@@H]3O)O)O
Anisodamine (1446)

* No CASNo

* Anisodamine not found on commonchemistry - Anisodamine

* ChemSpiderID: 159209 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 183088

* No InChI - (ChemSpider: | InChI=InChI=1/C17H23NO4/c1-18-12-7-13(9-15(18)16(20)8-12)22-17(21)14(10-19)11-5-3-2-4-6-11/h2-6,12-16,19-20H,7-10H2,1H3/t12-,13+,14-,15+,16+/m1/s1 )

* No SMILES - (ChemSpider: | smiles=O=C(O[C@@H]1C[C@@H]2N(C)[C@H](C1)C[C@@H]2O)[C@@H](c3ccccc3)CO )
Anisodine (1447)
```
Botcommand: addindex 350644212 Anisodine
```
```
For index : Anisodine=350644212
```
* 52646-92-1 -> 52646-92-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Anisodine not found on commonchemistry - Anisodine

* ChemSpiderID: 3319287 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 4105431

* No InChI - (ChemSpider: | InChI=InChI=1/C17H21NO5/c1-18-12-7-11(8-13(18)15-14(12)23-15)22-16(20)17(21,9-19)10-5-3-2-4-6-10/h2-6,11-15,19,21H,7-9H2,1H3 )

* No SMILES - (ChemSpider: | smiles=O=C(OC1CC2N(C(C1)C3OC23)C)C(O)(c4ccccc4)CO )
Anisomycin (1449)
```
Botcommand: addindex 332701839 Anisomycin
```
```
For index : Anisomycin=332701839
```
* 22862-76-6 -> 22862-76-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Anisomycin not found on commonchemistry - Anisomycin

* ChemSpiderID: 29260 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 31549

* InChI: 1/C14H19NO4/c1-9(16)19-14-12(15-8-13(14)17)7-10-3-5-11(18-2)6-4-10/h3-6,12-15,17H,7-8H2,1-2H3/t12-,13+,14+/m0/s1 - (ChemSpider: | InChI=InChI=1/C14H19NO4/c1-9(16)19-14-12(15-8-13(14)17)7-10-3-5-11(18-2)6-4-10/h3-6,12-15,17H,7-8H2,1-2H3/t12-,13+,14+/m0/s1 )

* SMILES: O=C(O[C@@H]1[C@@H](NC[C@H]1O)Cc2ccc(OC)cc2)C - (ChemSpider: | SMILES=O=C(O[C@@H]1[C@@H](NC[C@H]1O)Cc2ccc(OC)cc2)C )
Anisoyl_chloride (1450)
File:Anisoylchloride.png

* No CASNo

* Anisoyl+chloride found on commonchemistry - Anisoyl+chloride
* 100-07-2 (Formula: C8H7ClO2; Name: Benzoyl chloride, 4-methoxy-)

* 21615-34-9 (Formula: C8H7ClO2; Name: Benzoyl chloride, 2-methoxy-)

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES

1451 to 1500

Anistreplase (1451)
```
Botcommand: addindex 351653709 Anistreplase
```
```
For index : Anistreplase=351653709
```
* 81669-57-0 -> 81669-57-0 - NOT VERIFIED

* CAS found on commonchemistry - 81669-57-0 - name in list
All names: Anistreplase

* Anistreplase found on commonchemistry - Anistreplase
* 81669-57-0 (exact match) Matches CAS (81669-57-0) on page
Name in list

All names: Anistreplase

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Anitrazafen (1452)
```
Botcommand: addindex 360870067 Anitrazafen
```
```
For index : Anitrazafen=360870067
```
* 63119-27-7 -> 63119-27-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Anitrazafen not found on commonchemistry - Anitrazafen

* ChemSpiderID: 40409 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 44410

* No InChI - (ChemSpider: | InChI=InChI=1/C18H17N3O2/c1-12-19-17(13-4-8-15(22-2)9-5-13)18(21-20-12)14-6-10-16(23-3)11-7-14/h4-11H,1-3H3 )

* No SMILES - (ChemSpider: | smiles=n2c(nnc(c1ccc(OC)cc1)c2c3ccc(OC)cc3)C )
Annamycin (1453)
```
Botcommand: addindex 292865827 Annamycin
```
```
For index : Annamycin=292865827
```
* 92689-49-1 -> 92689-49-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Annamycin not found on commonchemistry - Annamycin

* No ChemSpiderID

* PubChem: 115212

* No InChI

* No SMILES
Annonacin (1454)
```
Botcommand: addindex 358869180 Annonacin
```
```
For index : Annonacin=358869180
```
* 111035-65-5 -> 111035-65-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Annonacin not found on commonchemistry - Annonacin

* No ChemSpiderID

* PubChem: 354398

* No InChI

* SMILES: CCCCCCCCCCCCC(C1CCC(O1)C(CCCCC(CCCCCC(CC2=CC(OC2=O)C)O)O)O)O
Anoxomer (1455)
```
Botcommand: addindex 331337366 Anoxomer
```
```
For index : Anoxomer=331337366
```
* 60837-57-2 -> 60837-57-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Anoxomer not found on commonchemistry - Anoxomer

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Anserine (1456)
```
Botcommand: addindex 332701986 Anserine
```
```
For index : Anserine=332701986
```
* 584-85-0 -> 584-85-0 - NOT VERIFIED

* CAS found on commonchemistry - 584-85-0 - name in list
All names: Anserine, Histidine, N-Î²-alanyl-3-methyl-, L-, L-Anserine, L-Histidine, N-Î²-alanyl-3-methyl-, L-Histidine, Î²-alanyl-3-methyl-, Marine Active, N-Î²-alanil-3-metil-L-histidina, N-Î²-Alanyl-3-methyl-L-histidin, N-Î²-alanyl-3-methyl-L-histidine

* Anserine found on commonchemistry - Anserine
* 584-85-0 (Formula: C10H16N4O3; Name: L-Histidine, Î²-alanyl-3-methyl-) Matches CAS (584-85-0) on page

* 24219-97-4 (Formula: C18H20N2; Name: Dibenzo[c,f]pyrazino[1,2-a]azepine, 1,2,3,4,10,14b-hexahydro-2-methyl-)

* 74050-98-9 (Formula: C22H22FN3O3; Name: 2,4(1H,3H)-Quinazolinedione, 3-[2-[4-(4-fluorobenzoyl)-1-piperidinyl]ethyl]-)

* ChemSpiderID: 100482 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 112072

* InChI: 1/C10H16N4O3/c1-14-6-12-5-7(14)4-8(10(16)17)13-9(15)2-3-11/h5-6,8H,2-4,11H2,1H3,(H,13,15)(H,16,17)/t8-/m0/s1 - (ChemSpider: | InChI=InChI=1/C10H16N4O3/c1-14-6-12-5-7(14)4-8(10(16)17)13-9(15)2-3-11/h5-6,8H,2-4,11H2,1H3,(H,13,15)(H,16,17)/t8-/m0/s1 )

* SMILES: O=C(O)[C@@H](NC(=O)CCN)Cc1cncn1C - (ChemSpider: | SMILES=O=C(O)[C@@H](NC(=O)CCN)Cc1cncn1C )
Antalarmin (1457)
```
Botcommand: addindex 352452188 Antalarmin
```
```
For index : Antalarmin=352452188
```
* 157284-96-3 -> 157284-96-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Antalarmin not found on commonchemistry - Antalarmin

* No ChemSpiderID

* PubChem: 177990

* No InChI

* No SMILES
Antamanide (1458)
```
Botcommand: addindex 360474562 Antamanide
```
```
For index : Antamanide=360474562
```
* 16898-32-1 -> 16898-32-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Antamanide not found on commonchemistry - Antamanide

* No ChemSpiderID

* PubChem: 9876840

* No InChI

* No SMILES
Antazoline (1459)
```
Botcommand: addindex 364015154 Antazoline
```
```
For index : Antazoline=364015154
```
* 91-75-8 -> 91-75-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Antazoline not found on commonchemistry - Antazoline

* ChemSpiderID: 2115 (correct: 2115) - CORRECT - Retrieved data from ChemSpider

* PubChem: 2200

* No InChI - (ChemSpider: | InChI=InChI=1/C17H19N3/c1-3-7-15(8-4-1)13-20(14-17-18-11-12-19-17)16-9-5-2-6-10-16/h1-10H,11-14H2,(H,18,19) )

* No SMILES - (ChemSpider: | smiles=N\1=C(\NCC/1)CN(c2ccccc2)Cc3ccccc3 )
Anthramine (1462)

* No CASNo

* Anthramine not found on commonchemistry - Anthramine

* ChemSpiderID: 11392 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/C14H11N/c15-14-7-3-6-12-8-10-4-1-2-5-11(10)9-13(12)14/h1-9H,15H2 - (ChemSpider: | InChI=InChI=1/C14H11N/c15-14-7-3-6-12-8-10-4-1-2-5-11(10)9-13(12)14/h1-9H,15H2 )

* SMILES: c3cc2cc1cccc(N)c1cc2cc3 - (ChemSpider: | SMILES=c3cc2cc1cccc(N)c1cc2cc3 )
Anthrapurpurin (1464)
```
Botcommand: addindex 354056915 Anthrapurpurin
```
```
For index : Anthrapurpurin=354056915
```
* 602-65-3 -> 602-65-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Anthrapurpurin not found on commonchemistry - Anthrapurpurin

* ChemSpiderID: 1280 - UNKNOWN

* PubChem: 1320

* No InChI

* SMILES: C1=CC2=C(C=C1O)C(=O)C3=C(C2=O)C=CC(=C3O)O
Anthrax_vaccines (1466)
* No CASNo

* Anthrax+vaccines not found on commonchemistry - Anthrax+vaccines

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Anti-thymocyte_globulin (1468)
* No CASNo

* Anti+thymocyte+globulin not found on commonchemistry - Anti+thymocyte+globulin

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Antiarin (1469)
```
Botcommand: addindex 353056716 Antiarin
```
```
For index : Antiarin=353056716
```
* 23605-05-2 -> 23605-05-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Antiarin not found on commonchemistry - Antiarin

* ChemSpiderID: 390419 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 6325617

* InChI: 1/C29H42O11/c1-14-22(33)23(34)24(35)25(39-14)40-16-3-6-27(13-30)19-10-20(31)26(2)17(15-9-21(32)38-12-15)5-8-29(26,37)18(19)4-7-28(27,36)11-16/h9,13-14,16-20,22-25,31,33-37H,3-8,10-12H2,1-2H3/t14-,16+,17-,18-,19+,20-,22+,23-,24-,25+,26+,27+,28+,29+/m1/s1 - (ChemSpider: | InChI=InChI=1/C29H42O11/c1-14-22(33)23(34)24(35)25(39-14)40-16-3-6-27(13-30)19-10-20(31)26(2)17(15-9-21(32)38-12-15)5-8-29(26,37)18(19)4-7-28(27,36)11-16/h9,13-14,16-20,22-25,31,33-37H,3-8,10-12H2,1-2H3/t14-,16+,17-,18-,19+,20-,22+,23-,24-,25+,26+,27+,28+,29+/m1/s1 )

* SMILES: O=C\1OC/C(=C/1)[C@H]2CC[C@@]6(O)[C@]2(C)[C@H](O)C[C@H]4[C@H]6CC[C@]5(O)C[C@@H](O[C@@H]3O[C@@H]([C@H](O)[C@@H](O)[C@H]3O)C)CC[C@]45C=O - (ChemSpider: | SMILES=O=C\1OC/C(=C/1)[C@H]2CC[C@@]6(O)[C@]2(C)[C@H](O)C[C@H]4[C@H]6CC[C@]5(O)C[C@@H](O[C@@H]3O[C@@H]([C@H](O)[C@@H](O)[C@H]3O)C)CC[C@]45C=O )
Antimony_pentasulfide (1472)
```
Botcommand: addindex 354610956 Antimony_pentasulfide
```
```
For index : Antimony_pentasulfide=354610956
```
* 1315-04-4 -> 1315-04-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Antimony+pentasulfide not found on commonchemistry - Antimony+pentasulfide

* No ChemSpiderID

* PubChem: 11338637

* No InChI

* No SMILES
Antimony_telluride (1474)
```
Botcommand: addindex 359886082 Antimony_telluride
```
```
For index : Antimony_telluride=359886082
```
* 1327-50-0 -> 1327-50-0 - NOT VERIFIED

* CAS found on commonchemistry - 1327-50-0 - name in list
All names: Antimony 95-100, tellurium 0-5 (atomic), Antimony sesquitelluride, Antimony telluride, Antimony telluride (Sb2Te3), Antimony tritelluride, Antimony(3+) telluride, Diantimontritellurid, diantimony tritelluride, tritellurure de diantimoine, tritelururo de diantimonio

* Antimony+telluride found on commonchemistry - Antimony+telluride
* 1327-50-0 (exact match) Matches CAS (1327-50-0) on page
Name in list

All names: Antimony 95-100, tellurium 0-5 (atomic), Antimony sesquitelluride, [[antimony telluride]], [[antimony telluride (Sb2Te3)]], Antimony tritelluride, Antimony(3+) telluride, Diantimontritellurid, diantimony tritelluride, tritellurure de diantimoine, tritelururo de diantimonio

* No ChemSpiderID

* PubChem: 6369653

* InChI: 1S/2Sb.3Te

* No SMILES
Antimony_tetroxide (1475)
File:Stibiconite structure.jpg
```
Botcommand: addindex 345172011 Antimony_tetroxide
```
```
For index : Antimony_tetroxide=345172011
```
* 12786-74-2 -> 12786-74-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Antimony+tetroxide not found on commonchemistry - Antimony+tetroxide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Antimony_tribromide (1476)
```
Botcommand: addindex 364874376 Antimony_tribromide
```
```
For index : Antimony_tribromide=364874376
```
* 7789-61-9 -> 7789-61-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Antimony+tribromide not found on commonchemistry - Antimony+tribromide

* ChemSpiderID: 21172757 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 24615

* InChI: 1/3BrH.Sb.3H/h3*1H;;;;/q;;;+3;;;/p-3/r3BrH.H3Sb/h3*1H;1H3/q;;;+3/p-3 - (ChemSpider: | InChI=InChI=1/3BrH.Sb.3H/h3*1H;;;;/q;;;+3;;;/p-3/r3BrH.H3Sb/h3*1H;1H3/q;;;+3/p-3 )

* SMILES: [Br-].[Br-].[Br-].[SbH3+3] - (ChemSpider: | SMILES=[Br-].[Br-].[Br-].[SbH3+3] )
Antimony_trifluoride (1478)
```
Botcommand: addindex 361848779 Antimony_trifluoride
```
```
For index : Antimony_trifluoride=361848779
```
* 7783-56-4 -> 7783-56-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Antimony+trifluoride not found on commonchemistry - Antimony+trifluoride

* ChemSpiderID: 21172740 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/3FH.Sb.3H/h3*1H;;;;/q;;;+3;;;/p-3/r3FH.H3Sb/h3*1H;1H3/q;;;+3/p-3 - (ChemSpider: | InChI=InChI=1/3FH.Sb.3H/h3*1H;;;;/q;;;+3;;;/p-3/r3FH.H3Sb/h3*1H;1H3/q;;;+3/p-3 )

* SMILES: [F-].[F-].[F-].[SbH3+3] - (ChemSpider: | SMILES=[F-].[F-].[F-].[SbH3+3] )
Antimony_triiodide (1479)
```
Botcommand: addindex 364874736 Antimony_triiodide
```
```
For index : Antimony_triiodide=364874736
```
* 7790-44-5 -> 7790-44-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Antimony+triiodide not found on commonchemistry - Antimony+triiodide

* ChemSpiderID: 21172761 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/3HI.Sb.3H/h3*1H;;;;/q;;;+3;;;/p-3/r3HI.H3Sb/h3*1H;1H3/q;;;+3/p-3 - (ChemSpider: | InChI=InChI=1/3HI.Sb.3H/h3*1H;;;;/q;;;+3;;;/p-3/r3HI.H3Sb/h3*1H;1H3/q;;;+3/p-3 )

* SMILES: [SbH3+3].[I-].[I-].[I-] - (ChemSpider: | SMILES=[SbH3+3].[I-].[I-].[I-] )
Antimony_triselenide (1481)
File:SbSe3structure.jpg
```
Botcommand: addindex 364874936 Antimony_triselenide
```
```
For index : Antimony_triselenide=364874936
```
* 1315-05-5 -> 1315-05-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Antimony+triselenide not found on commonchemistry - Antimony+triselenide

* No ChemSpiderID

* PubChem: 6391662

* No InChI

* No SMILES
Antimony(III)_acetate (1482)
```
Botcommand: addindex 355988095 Antimony(III)_acetate
```
```
For index : Antimony(III)_acetate=355988095
```
* 6923-52-0 -> 6923-52-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Antimony+III+acetate not found on commonchemistry - Antimony+III+acetate

* ChemSpiderID: 21172629 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/3C2H4O2.Sb.3H/c3*1-2(3)4;;;;/h3*1H3,(H,3,4);;;;/q;;;+3;;;/p-3/r3C2H4O2.H3Sb/c3*1-2(3)4;/h3*1H3,(H,3,4);1H3/q;;;+3/p-3 - (ChemSpider: | InChI=InChI=1/3C2H4O2.Sb.3H/c3*1-2(3)4;;;;/h3*1H3,(H,3,4);;;;/q;;;+3;;;/p-3/r3C2H4O2.H3Sb/c3*1-2(3)4;/h3*1H3,(H,3,4);1H3/q;;;+3/p-3 )

* SMILES: CC(=O)[O-].CC(=O)[O-].CC(=O)[O-].[SbH3+3] - (ChemSpider: | SMILES=CC(=O)[O-].CC(=O)[O-].CC(=O)[O-].[SbH3+3] )
Antimycin_A (1483)
```
Botcommand: addindex 345353444 Antimycin_A
```
```
For index : Antimycin_A=345353444
```
* 642-15-9 -> 642-15-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Antimycin+A found on commonchemistry - Antimycin+A
* 1397-94-0 (exact match)
Name in list

All names: [[antimycin a]], Antipiricullin, Fintrol, Virosin

* No ChemSpiderID

* PubChem: 12550

* No InChI

* No SMILES
Antirrhinin (1484)

* No CASNo

* Antirrhinin not found on commonchemistry - Antirrhinin

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Apamin (1486)
```
Botcommand: addindex 341874621 Apamin
```
```
For index : Apamin=341874621
```
* 24345-16-2 -> 24345-16-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Apamin not found on commonchemistry - Apamin

* No ChemSpiderID

* PubChem: 16133797

* No InChI

* No SMILES
Apatinib (1487)
* No CASNo

* Apatinib not found on commonchemistry - Apatinib

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Apaziquone (1488)
```
Botcommand: addindex 346365183 Apaziquone
```
```
For index : Apaziquone=346365183
```
* 114560-48-4 -> 114560-48-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Apaziquone not found on commonchemistry - Apaziquone

* No ChemSpiderID

* PubChem: 5813717

* No InChI

* No SMILES
Aphidicolin (1489)
```
Botcommand: addindex 355634554 Aphidicolin
```
```
For index : Aphidicolin=355634554
```
* 38966-21-1 -> 38966-21-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Aphidicolin not found on commonchemistry - Aphidicolin

* ChemSpiderID: 10280269 (correct: 10280269) - CORRECT - Retrieved data from ChemSpider

* PubChem: 457964

* InChI: 1/C20H34O4/c1-17(11-21)15-4-3-13-9-14-10-19(13,7-8-20(14,24)12-22)18(15,2)6-5-16(17)23/h13-16,21-24H,3-12H2,1-2H3/t13-,14+,15-,16+,17-,18-,19-,20-/m0/s1 - (ChemSpider: | InChI=InChI=1/C20H34O4/c1-17(11-21)15-4-3-13-9-14-10-19(13,7-8-20(14,24)12-22)18(15,2)6-5-16(17)23/h13-16,21-24H,3-12H2,1-2H3/t13-,14+,15-,16+,17-,18-,19-,20-/m0/s1 )

* SMILES: OC[C@@]4(O)CC[C@]31C[C@H]4C[C@@H]3CC[C@H]2[C@](C)(CO)[C@H](O)CC[C@]12C - (ChemSpider: | SMILES=OC[C@@]4(O)CC[C@]31C[C@H]4C[C@@H]3CC[C@H]2[C@](C)(CO)[C@H](O)CC[C@]12C )
Apiforol (1490)
```
Botcommand: addindex 318075956 Apiforol
```
```
For index : Apiforol=318075956
```
* 55167-29-8 -> 55167-29-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Apiforol not found on commonchemistry - Apiforol

* No ChemSpiderID

* PubChem: 443638

* No InChI

* SMILES: C1C(C2=C(C=C(C=C2OC1C3=CC=C(C=C3)O)O)O)O
Apigeninidin (1492)
```
Botcommand: addindex 311439568 Apigeninidin
```
```
For index : Apigeninidin=311439568
```
* 1151-98-0 -> 1151-98-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Apigeninidin not found on commonchemistry - Apigeninidin

* No ChemSpiderID

* PubChem: 441647

* No InChI

* No SMILES
Apiin (1494)
```
Botcommand: addindex 329495520 Apiin
```
```
For index : Apiin=329495520
```
* 26544-34-3 -> 26544-34-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Apiin not found on commonchemistry - Apiin

* No ChemSpiderID

* PubChem: 5280746&loc

* No InChI

* SMILES: C1C(C(C(O1)OC2C(C(C(OC2OC3=CC(=C4C(=C3)OC(=CC4=O)C5=CC=C(C=C5)O)O)CO)O)O)O)(CO)O
Apiol (1495)
```
Botcommand: addindex 354835021 Apiol
```
```
For index : Apiol=354835021
```
* 523-80-8 -> 523-80-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Apiol not found on commonchemistry - Apiol

* ChemSpiderID: 21106259 (correct: 21106259) - CORRECT - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/C12H14O4/c1-4-5-8-6-9(13-2)11-12(10(8)14-3)16-7-15-11/h4,6H,1,5,7H2,2-3H3 - (ChemSpider: | InChI=InChI=1/C12H14O4/c1-4-5-8-6-9(13-2)11-12(10(8)14-3)16-7-15-11/h4,6H,1,5,7H2,2-3H3 )

* SMILES: COc1cc(CC=C)c(OC)c2OCOc12 - (ChemSpider: | SMILES=COc1cc(CC=C)c(OC)c2OCOc12 )
Apiose (1496)
```
Botcommand: addindex 355288965 Apiose
```
```
For index : Apiose=355288965
```
* 639-97-4 -> 639-97-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Apiose not found on commonchemistry - Apiose

* ChemSpiderID: 16735670 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 4658

* InChI: 1/C5H10O5/c6-1-5(9)2-10-4(8)3(5)7/h3-4,6-9H,1-2H2/t3-,4?,5+/m0/s1 - (ChemSpider: | InChI=InChI=1/C5H10O5/c6-1-5(9)2-10-4(8)3(5)7/h3-4,6-9H,1-2H2/t3-,4?,5+/m0/s1 )

* SMILES: O[C@]1(CO)COC(O)[C@@H]1O - (ChemSpider: | SMILES=O[C@]1(CO)COC(O)[C@@H]1O )
Apixaban (1497)
```
Botcommand: addindex 332709447 Apixaban
```
```
For index : Apixaban=332709447
```
* 503612-47-3 -> 503612-47-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Apixaban not found on commonchemistry - Apixaban

* ChemSpiderID: 8358471 (correct: 8358471) - CORRECT - Retrieved data from ChemSpider

* PubChem: 10182969

* No InChI - (ChemSpider: | InChI=InChI=1/C25H25N5O4/c1-34-19-11-9-18(10-12-19)30-23-20(22(27-30)24(26)32)13-15-29(25(23)33)17-7-5-16(6-8-17)28-14-3-2-4-21(28)31/h5-12H,2-4,13-15H2,1H3,(H2,26,32) )

* No SMILES - (ChemSpider: | smiles=O=C5N(c4ccc(N3C(=O)c1c(c(nn1c2ccc(OC)cc2)C(=O)N)CC3)cc4)CCCC5 )
Aplaviroc (1498)
```
Botcommand: addindex 325465053 Aplaviroc
```
```
For index : Aplaviroc=325465053
```
* 461023-63-2 -> 461023-63-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Aplaviroc not found on commonchemistry - Aplaviroc

* No ChemSpiderID

* PubChem: 3001322

* No InChI

* No SMILES
Aplindore (1499)
```
Botcommand: addindex 360764692 Aplindore
```
```
For index : Aplindore=360764692
```
* 189681-71-8 -> 189681-71-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Aplindore not found on commonchemistry - Aplindore

* No ChemSpiderID

* PubChem: 6440763

* No InChI

* No SMILES
Apocarotenal (1500)
```
Botcommand: addindex 357781845 Apocarotenal
```
```
For index : Apocarotenal=357781845
```
* 1107-26-2 -> 1107-26-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Apocarotenal not found on commonchemistry - Apocarotenal

* No ChemSpiderID

* PubChem: 5478003

* No InChI

* SMILES: CC=1CCCC(C)(C)C=1/C=CC(\C)=C\C=C\C(\C)=C\C=C\C=C(/C)\C=C\C=C(/C)C=O