Jump to content

Arbutamine

From Wikipedia, the free encyclopedia

This is an old revision of this page, as edited by Tom.Reding (talk | contribs) at 14:44, 9 June 2016 (top: Fix Category:Pages using citations with accessdate and no URL when permanent identifier present using AWB). The present address (URL) is a permanent link to this revision, which may differ significantly from the current revision.

{{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 457138752 | IUPAC_name = 4-[(1R)-1-hydroxy-2-{[4-(4-hydroxyphenyl)butyl]amino}ethyl]benzene-1,2-diol | image = Arbutamine.svg | width = 250

| tradename = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref =  checkY | CAS_number = 128470-16-6 | ATC_prefix = C01 | ATC_suffix = CA22 | PubChem = 60789 | DrugBank_Ref =  checkY | DrugBank = DB01102 | ChemSpiderID_Ref =  checkY | ChemSpiderID = 54785 | UNII_Ref =  checkY | UNII = B07L15YAEV | ChEBI_Ref =  checkY | ChEBI = 50580 | ChEMBL_Ref =  ☒N | ChEMBL = 1201251

| C=18 | H=23 | N=1 | O=4 | molecular_weight = 317.38 g/mol | smiles = Oc1ccc(cc1O)[C@@H](O)CNCCCCc2ccc(O)cc2 | StdInChI_Ref =  checkY | StdInChI = 1S/C18H23NO4/c20-15-7-4-13(5-8-15)3-1-2-10-19-12-18(23)14-6-9-16(21)17(22)11-14/h4-9,11,18-23H,1-3,10,12H2/t18-/m0/s1 | StdInChIKey_Ref =  checkY | StdInChIKey = IIRWWTKISYTTBL-SFHVURJKSA-N }}

Arbutamine is a cardiac stimulant. It stimulates β adrenergic receptors.[1]

References

  1. ^ Abou-Mohamed, Gamal; Nagarajan, Ravi; Ibrahim, Tarek M.; Caldwell, Robert W. (March 1996). "Characterization of the Adrenergic Activity of Arbutamine, a Novel Agent for Pharmacological Stress Testing". Cardiovascular Drugs and Therapy. 10 (1): 39–47. doi:10.1007/BF00051129. PMID 8723169.