Jump to content

Ericolol

From Wikipedia, the free encyclopedia

This is an old revision of this page, as edited by Vanished user 0x8cSXE0x6 (talk | contribs) at 06:33, 2 June 2016. The present address (URL) is a permanent link to this revision, which may differ significantly from the current revision.

{{Infobox drug | drug_name = | IUPAC_name = 3-(4-Chloro-2-{2-hydroxy-3-[(2-methyl-2-propanyl)amino]propoxy}phenyl)-2-cyclopenten-1-one | image = Ericolol.svg | alt = | caption = | tradename = | Drugs.com = | MedlinePlus = | pregnancy_AU = | pregnancy_US = | pregnancy_category= | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration = | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | ATCvet = | ATC_prefix = None | ATC_suffix = | CAS_number = 85320-67-8 | PubChem = 208929 | ChEMBL = 1742480 | ChemSpiderID = 181025 | DrugBank = | C=18 | H=24 | Cl=1 | N=1 | O=3 | molecular_weight = 337.84 g/mol | smiles = CC(C)(C)NCC(COC1=C(C=CC(=C1)Cl)C2=CC(=O)CC2)O | StdInChI = 1S/C18H24ClNO3/c1-18(2,3)20-10-15(22)11-23-17-9-13(19)5-7-16(17)12-4-6-14(21)8-12/h5,7-9,15,20,22H,4,6,10-11H2,1-3H3 | StdInChIKey = QACGCDWSRFDWQO-UHFFFAOYSA-N }}

Ericolol is a beta blocker.[1]

References

  1. ^ I.K. Morton, Judith M. Hall (1999). Concise Dictionary of Pharmacological Agents: Properties and Synonyms. Springer. p. 114.