Guanabenz
{Refimprove|date=September 2014}
{Drugbox
| Watchedfields = changed
| verifiedrevid = 407835535
| IUPAC_name = 2-(2,6-dichlorobenzylidene)hydrazinecarboximidamide
| image = Guanabenz.svg
| image2 = Guanabenz_sf.png
| tradename =
| Drugs.com = Consumer Drug Information
| MedlinePlus = a686003
| pregnancy_AU =
| pregnancy_US = C
| legal_AU =
| legal_UK =
| legal_US =
| protein_bound = 90%
| elimination_half-life = 6 hours
| IUPHAR_ligand = 5443
| CAS_number = 5051-62-7
| ATC_prefix = none
| PubChem = 5702063
| DrugBank_Ref = 
| DrugBank = DB00629
| ChemSpiderID_Ref =
| ChemSpiderID = 4642445
| UNII_Ref =
| UNII = GGD30112WC
| KEGG_Ref =
| KEGG = D04375
| ChEMBL_Ref =
| ChEMBL = 420
| C=8 | H=8 | Cl=2 | N=4
| molecular_weight = 231.081 g/mol
| smiles = Clc1cccc(Cl)c1\C=N\N=C(/N)N
| StdInChI_Ref =
| StdInChI = 1S/C8H8Cl2N4/c9-6-2-1-3-7(10)5(6)4-13-14-8(11)12/h1-4H,(H4,11,12,14)/b13-4+
| StdInChIKey_Ref =
| StdInChIKey = WDZVGELJXXEGPV-YIXHJXPBSA-N
}}
Guanabenz (pronounced GWAHN-a-benz, sold under the trade name Wytensin) is an alpha agonist of the alpha-2 adrenergic receptor that is used as an antihypertensive drug. It is used to treat high blood pressure (hypertension).[1][2]
The most common side effects during guanabenz therapy are dizziness, drowsiness, dry mouth, headache and weakness.
Guanabenz can make one drowsy or less alert, therefore driving or operating dangerous machinery is not recommended.
See also
References
- ^ Walker BR, Hare LE, Deitch MW (1982). "Comparative antihypertensive effects of guanabenz and clonidine". The Journal of International Medical Research. 10: 6–14. PMID 7037502.
- ^ Bonham AC, Trapani AJ, Portis LR, Brody MJ (1984). "Studies on the mechanism of the central antihypertensive effect of guanabenz and clonidine". Journal of Hypertension Supplement. 2: S543-6.
 | This antihypertensive-related article is a stub. You can help Wikipedia by expanding it. |