Jump to content

Amidephrine

From Wikipedia, the free encyclopedia

This is an old revision of this page, as edited by Tom.Reding (talk | contribs) at 23:50, 20 May 2016 (CS1 maintenance: vauthors/veditors or enumerate multiple authors/editors; WP:GenFixes on; using AWB). The present address (URL) is a permanent link to this revision, which may differ significantly from the current revision.

{{Drugbox | Watchedfields = changed | verifiedrevid = 443383199 | IUPAC_name =(RS)-N-{3-[1-hydroxy-2-(methylamino)ethyl]phenyl}methanesulfonamide | image = Amidephrine.svg | width = 222

| tradename = | pregnancy_category = | legal_status = | routes_of_administration =

| bioavailability = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref =  checkY | CAS_number = 3354-67-4 | ATC_prefix = none | ATC_suffix = | PubChem = 15010 | IUPHAR_ligand = 514 | ChemSpiderID_Ref =  checkY | ChemSpiderID = 14288 | UNII_Ref =  checkY | UNII = 7E2P22546V | ChEMBL_Ref =  checkY | ChEMBL = 146408

| C=10 | H=16 | N=2 | O=3 | S=1 | molecular_weight = 244.31 g/mol | smiles = O=S(=O)(Nc1cc(ccc1)C(O)CNC)C | StdInChI_Ref =  checkY | StdInChI = 1S/C10H16N2O3S/c1-11-7-10(13)8-4-3-5-9(6-8)12-16(2,14)15/h3-6,10-13H,7H2,1-2H3 | StdInChIKey_Ref =  checkY | StdInChIKey = ZHOWHMXTJFZXRB-UHFFFAOYSA-N }}

Amidephrine (amidefrine) is an sulfonamide α1 receptor agonist.[1]

References

  1. ^ MacLean MR, Thomson M, Hiley CR (June 1989). "Pressor effects of the alpha 2-adrenoceptor agonist B-HT 933 in anaesthetized and haemorrhagic rats: comparison with the haemodynamic effects of amidephrine". Br. J. Pharmacol. 97 (2): 419–32. doi:10.1111/j.1476-5381.1989.tb11969.x. PMC 1854522. PMID 2569342.