Jump to content

Capsinolol

From Wikipedia, the free encyclopedia

This is an old revision of this page, as edited by DePiep (talk | contribs) at 15:32, 2 April 2016 (Remove redundant parameters InChI, InChIKey (StdInChI, StdInChIKey are used). See Talk (via AWB script)). The present address (URL) is a permanent link to this revision, which may differ significantly from the current revision.

{{Infobox drug | drug_name = | IUPAC_name = N-{4-[2-Hydroxy-3-(isopropylamino)propoxy]-3-methoxybenzyl}nonanamide | image = Capsinolol.svg | alt = | caption =

| tradename = | Drugs.com = | MedlinePlus = | pregnancy_AU = | pregnancy_US = | pregnancy_category= | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number = | ATCvet = | ATC_prefix = none | ATC_suffix = | PubChem = 9887704 | ChemSpiderID = 8063376 | DrugBank =

| C=23 | H=40 | N=2 | O=4 | molecular_weight = 408.58 g/mol | smiles = CCCCCCCCC(=O)NCC1=CC(=C(C=C1)OCC(CNC(C)C)O)OC | StdInChI = 1S/C23H40N2O4/c1-5-6-7-8-9-10-11-23(27)25-15-19-12-13-21(22(14-19)28-4)29-17-20(26)16-24-18(2)3/h12-14,18,20,24,26H,5-11,15-17H2,1-4H3,(H,25,27) | StdInChIKey = REOKPCLNKKXKDT-UHFFFAOYSA-N }}

Capsinolol is a beta blocker derived from nonivamide. It is the first beta blocker with an associated calcitonin gene-related peptide releasing activity in the heart.[1]

References

  1. ^ Chen IJ, Yeh JL, Lo YC, Sheu SH, Lin YT (Sep 1996). "Capsinolol: the first beta-adrenoceptor blocker with an associated calcitonin gene-related peptide releasing activity in the heart". Br J Pharmacol. 119 (1): 7–14. doi:10.1111/j.1476-5381.1996.tb15670.x. PMC 1915742. PMID 8872350.{{cite journal}}: CS1 maint: multiple names: authors list (link)


Stub icon

This drug article relating to the cardiovascular system is a stub. You can help Wikipedia by expanding it.

Retrieved from "https://en.wikipedia.org/w/index.php?title=Capsinolol&oldid=713197286"