Loxoprofen
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 462094150
| IUPAC_name = (RS)-2-{4-[(2-oxocyclopentyl)methyl]phenyl}propanoic acid
| image = Loxoprofen.svg
| width = 250px
| image2 = Loxoprofen 3D.png
| chirality = Racemic mixture
| tradename =
| Drugs.com = International Drug Names
| pregnancy_category =
| legal_status = Red Stripe (Brazil)
| routes_of_administration = Oral, transdermal
| bioavailability =
| protein_bound = 97%
| metabolism = Hepatic glucuronidation
| elimination_half-life = 75 minutes
| excretion = Renal
| CAS_number_Ref =
| CAS_number = 68767-14-6
| ATC_prefix = M01
| ATC_suffix = AE
| PubChem = 3965
| DrugBank_Ref =
| DrugBank =
| ChemSpiderID_Ref =
| ChemSpiderID = 3828
| UNII_Ref =
| UNII = 3583H0GZAP
| KEGG_Ref =
| KEGG = D08149
| ChEBI_Ref =
| ChEBI = 76172
| ChEMBL_Ref =
| ChEMBL = 19299
| C=15 | H=18 | O=3
| molecular_weight = 246.302 g/mol
304.314 g/mol (sodium salt as the dihydrate)
| SMILES = O=C2C(Cc1ccc(cc1)C(C(=O)O)C)CCC2
| StdInChI_Ref =
| StdInChI = 1S/C15H18O3/c1-10(15(17)18)12-7-5-11(6-8-12)9-13-3-2-4-14(13)16/h5-8,10,13H,2-4,9H2,1H3,(H,17,18)
| StdInChIKey_Ref =
| StdInChIKey = YMBXTVYHTMGZDW-UHFFFAOYSA-N
}}
Loxoprofen (INN) is a non-steroidal anti-inflammatory drug in the propionic acid derivatives group, which also includes ibuprofen and naproxen among others. It is marketed in Brazil, Mexico and Japan by Sankyo as its sodium salt, loxoprofen sodium, under the trade name Loxonin, Argentina as Oxeno and in India as Loxomac. It is available in these countries for oral administration, and a transdermal preparation was approved for sale in Japan on January 2006.[1]
Pharmacokinetics
Loxoprofen is a prodrug. It is quickly converted to its active trans-alcohol metabolite following oral administration, and reaches its peak plasma concentration within 30 to 50 minutes.
Mechanism of action
As most NSAIDs, loxoprofen is a non-selective cyclooxygenase inhibitor, and works by reducing the synthesis of prostaglandins from arachidonic acid.
Interactions
Loxoprofen should not be administered at the same time as second-generation quinolone antibiotics such as ciprofloxacin and norfloxacin, as it increases their inhibition of GABA and this may cause seizures.[2] It may also increase the plasma concentration of warfarin, methotrexate, sulfonylurea derivatives and lithium salts, so care should be taken when loxoprofen is administered to patients taking any of these drugs.[2]
References
- ^ Daiichi Sankyo Co. (January 24, 2006). "Percutaneous Absorption-Type Analgesic and Anti-inflammatory Drug Loxonin Poultice 100mg Receives Approval for Manufacture" (Press release). Doctor's Guide Global Edition. Retrieved 2007-04-19.
- ^ a b "LOXONIN - Bula do Medicamento [Label Information]" (in Portuguese). Centralx. 2007. Retrieved 2007-04-19.