From Wikipedia, the free encyclopedia
Chemical compound
Alfadolone |
|
Other names | 3α,21-dihydroxy-5α-pregnane-11,20-dione |
---|
Routes of administration | Intravenous |
---|
ATC code | |
---|
|
(3R,5S,9S,14S)-3-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-one
|
CAS Number | |
---|
PubChem CID | |
---|
ChemSpider | |
---|
UNII | |
---|
ChEMBL | |
---|
CompTox Dashboard (EPA) | |
---|
ECHA InfoCard | 100.034.496 |
---|
|
Formula | C21H32O4 |
---|
Molar mass | 348.483 g·mol−1 |
---|
3D model (JSmol) | |
---|
O=C2[C@H]3[C@H]([C@@H]1CC[C@H](C(=O)CO)[C@@]1(C)C2)CC[C@H]4C[C@H](O)CC[C@]34C
|
InChI=1S/C21H32O4/c1-20-8-7-13(23)9-12(20)3-4-14-15-5-6-16(18(25)11-22)21(15,2)10-17(24)19(14)20/h12-16,19,22-23H,3-11H2,1-2H3/t12-,13+,14-,15-,16+,19+,20-,21-/m0/s1 YKey:XWYBFXIUISNTQG-VKMGZQQJSA-N Y
|
NY (what is this?) (verify) |
Alfadolone (INN), or alphadolone is a neuroactive steroid and general anesthetic.[1] Along with alfaxolone, as alfadolone acetate, it is one of the components of the anesthetic drug mixture althesin.[1]
|
---|
Alcohols | |
---|
Barbiturates | |
---|
Benzodiazepines | |
---|
Carbamates | |
---|
Flavonoids | |
---|
Imidazoles | |
---|
Kava constituents | |
---|
Monoureides | |
---|
Neuroactive steroids | |
---|
Nonbenzodiazepines | |
---|
Phenols | |
---|
Piperidinediones | |
---|
Pyrazolopyridines | |
---|
Quinazolinones | |
---|
Volatiles/gases | |
---|
Others/unsorted |
- 3-Hydroxybutanal
- α-EMTBL
- AA-29504
- Alogabat
- Avermectins (e.g., ivermectin)
- Bromide compounds (e.g., lithium bromide, potassium bromide, sodium bromide)
- Carbamazepine
- Chloralose
- Chlormezanone
- Clomethiazole
- Darigabat
- DEABL
- Deuterated etifoxine
- Dihydroergolines (e.g., dihydroergocryptine, dihydroergosine, dihydroergotamine, ergoloid (dihydroergotoxine))
- DS2
- Efavirenz
- Etazepine
- Etifoxine
- Fenamates (e.g., flufenamic acid, mefenamic acid, niflumic acid, tolfenamic acid)
- Fluoxetine
- Flupirtine
- Hopantenic acid
- KRM-II-81
- Lanthanum
- Lavender oil
- Lignans (e.g., 4-O-methylhonokiol, honokiol, magnolol, obovatol)
- Loreclezole
- Menthyl isovalerate (validolum)
- Monastrol
- Niacin
- Niacinamide
- Org 25,435
- Phenytoin
- Propanidid
- Retigabine (ezogabine)
- Safranal
- Seproxetine
- Stiripentol
- Sulfonylalkanes (e.g., sulfonmethane (sulfonal), tetronal, trional)
- Terpenoids (e.g., borneol)
- Topiramate
- Valerian constituents (e.g., isovaleric acid, isovaleramide, valerenic acid, valerenol)
|
---|
|