Ciladopa
{{Drugbox | IUPAC_name = 2-{4-[(2S)-2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]piperazin-1-yl}cyclohepta-2,4,6-trien-1-one | image = Ciladopa.png
| tradename = | pregnancy_category = | legal_status = Uncontrolled | routes_of_administration = Oral
| bioavailability = | metabolism = | elimination_half-life = | excretion =
| CAS_number = 80109-27-9
| ATC_prefix = none
| ATC_suffix =
| PubChem = 133371
| ChEMBL = 2110793
| ChemSpiderID = 117659
| UNII_Ref = 
| UNII = D09L486R3J
| C=21 | H=26 | N=2 | O=4 | molecular_weight = 370.44 g/mol | smiles = O=C3/C=C\C=C/C=C3/N2CCN(C[C@@H](O)c1ccc(OC)c(OC)c1)CC2 }}
Ciladopa (AY-27,110) is a dopamine agonist with a similar chemical structure to dopamine.[1] It was under investigation as an antiparkinsonian agent but was discontinued due to concerns of tumorogenesis in rodents.[2][3][4][5]
References
- ^ Voith K (1985). "The comparative long-term effects of ciladopa (AY-27,110), a chemically novel dopaminergic agonist, in 6-OHDA-lesioned and intact rats". Psychopharmacology. 85 (4): 405–9. doi:10.1007/BF00429654. PMID 3927334.
- ^ Koller WC, Fields JZ, Gordon JH, Perlow MJ (September 1986). "Evaluation of ciladopa hydrochloride as a potential anti-Parkinson drug". Neuropharmacology. 25 (9): 973–9. doi:10.1016/0028-3908(86)90190-5. PMID 3774130.
- ^ Weiner WJ, Factor SA, Sanchez-Ramos J, Berger J (1987). "A double-blind evaluation of ciladopa in Parkinson's disease". Movement Disorders : Official Journal of the Movement Disorder Society. 2 (3): 211–7. doi:10.1002/mds.870020308. PMID 3332914.
- ^ Lieberman A, Gopinathan G, Neophytides A, Pasternack P, Goldstein M (May 1987). "Advanced Parkinson's disease: use of partial dopamine agonist, ciladopa". Neurology. 37 (5): 863–5. doi:10.1212/wnl.37.5.863. PMID 3574692.
- ^ Lang AE (August 1987). "Update on dopamine agonists in Parkinson's disease: "beyond bromocriptine"". The Canadian Journal of Neurological Sciences. Le Journal Canadien Des Sciences Neurologiques. 14 (3 Suppl): 474–82. PMID 3315148.