Cinanserin

{{Drugbox | verifiedrevid = 443648118 | IUPAC_name = (2E)-N-(2-{[3-(dimethylamino)propyl]thio}phenyl)-3-phenylacrylamide | image = Cinanserine.svg

| tradename = | pregnancy_category = | legal_status = | routes_of_administration =

| bioavailability = | metabolism = | elimination_half-life = | excretion =

| CAS_number = 1166-34-3 | ATC_prefix = none | ATC_suffix = | ChEMBL = 18786 | PubChem = 5475158 | UNII_Ref =  ^Y | UNII = KI6J9OY7A3 | ChemSpiderID = 4584027 | StdInChI = 1S/C20H24N2OS/c1-22(2)15-8-16-24-19-12-7-6-11-18(19)21-20(23)14-13-17-9-4-3-5-10-17/h3-7,9-14H,8,15-16H2,1-2H3,(H,21,23)/b14-13+ | StdInChIKey = RSUVYMGADVXGOU-BUHFOSPRSA-N

| C=20 | H=24 | N=2 | O=1 | S=1 | molecular_weight = 340.482 g/mol | smiles = CN(C)CCCSC1=CC=CC=C1NC(=O)\C=C\C2=CC=CC=C2 }}

Cinanserin (INN) is a 5-HT_2A and 5-HT_2C receptor antagonist which was discovered in the 1960s.

The preparation is effective against an atypical pneumonia (SARS).

See also

• Ketanserin
• Ritanserin