Antrafenine
{{Drugbox
| Watchedfields = changed
| verifiedrevid = 437136259
| IUPAC_name = 2-{4-[3-(trifluoromethyl)phenyl]piperazin-1-yl}ethyl 2-{[7-(trifluoromethyl)quinolin-4-yl]amino}benzoate
| image = Antrafenine.svg
| tradename =
| pregnancy_category =
| legal_status = Rx-only
| routes_of_administration = Oral
| bioavailability =
| metabolism = Hepatic
| elimination_half-life =
| excretion = Renal
| CAS_number_Ref = 
| CAS_number = 55300-30-6
| ATC_prefix = none
| ATC_suffix =
| PubChem = 68723
| DrugBank_Ref =
| DrugBank = DB01419
| ChemSpiderID_Ref =
| ChemSpiderID = 61973
| UNII_Ref =
| UNII = 21FS93Y6OE
| ChEMBL_Ref =
| ChEMBL = 345524
| C=30 | H=26
| F=6 | N=4
| O=2
| molecular_weight = 588.543 g/mol
| smiles = FC(F)(F)c5ccc1c(nccc1Nc2ccccc2C(=O)OCCN4CCN(c3cc(ccc3)C(F)(F)F)CC4)c5
| StdInChI_Ref =
| StdInChI = 1S/C30H26F6N4O2/c31-29(32,33)20-4-3-5-22(18-20)40-14-12-39(13-15-40)16-17-42-28(41)24-6-1-2-7-25(24)38-26-10-11-37-27-19-21(30(34,35)36)8-9-23(26)27/h1-11,18-19H,12-17H2,(H,37,38)
| StdInChIKey_Ref =
| StdInChIKey = NWGGKKGAFZIVBJ-UHFFFAOYSA-N
}}
Antrafenine (Stakane) is a phenylpiperazine derivative drug invented in 1979.[1] It acts as an analgesic and anti-inflammatory drug with similar efficacy to naproxen,[2] but is not widely used as it has largely been replaced by newer drugs.
See also
References
- ^ Manoury PM, Dumas AP, Najer H, Branceni D, Prouteau M, Lefevre-Borg FM. Synthesis and analgesic activities of some (4-substituted phenyl-1-piperazinyl)alkyl 2-aminobenzoates and 2-aminonicotinates. Journal of Medicinal Chemistry. 1979 May;22(5):554-9.
- ^ Leatham PA, Bird HA, Wright V, Seymour D, Gordon A. A double blind study of antrafenine, naproxen and placebo in osteoarthrosis. European Journal of Rheumatology and Inflammation. 1983;6(2):209-11.
| pyrazolones / pyrazolidines | |
|---|---|
| salicylates | |
| acetic acid derivatives and related substances | |
| oxicams | |
| propionic acid derivatives (profens) |
|
| n-arylanthranilic acids (fenamates) | |
| COX-2 inhibitors (coxibs) | |
| other | |
| NSAID combinations | |
Key: underline indicates initially developed first-in-class compound of specific group; #WHO-Essential Medicines; †withdrawn drugs; ‡veterinary use. | |
 | This pharmacy-related article is a stub. You can help Wikipedia by expanding it. |